{#advhr.advhr

']); + t.addShortcut('ctrl+9', '', ['FormatBlock', false, '

']); + + function find(e) { + var v = null; + + if (!e.altKey && !e.ctrlKey && !e.metaKey) + return v; + + each(t.shortcuts, function(o) { + if (tinymce.isMac && o.ctrl != e.metaKey) + return; + else if (!tinymce.isMac && o.ctrl != e.ctrlKey) + return; + + if (o.alt != e.altKey) + return; + + if (o.shift != e.shiftKey) + return; + + if (e.keyCode == o.keyCode || (e.charCode && e.charCode == o.charCode)) { + v = o; + return false; + } + }); + + return v; + }; + + t.onKeyUp.add(function(ed, e) { + var o = find(e); + + if (o) + return Event.cancel(e); + }); + + t.onKeyPress.add(function(ed, e) { + var o = find(e); + + if (o) + return Event.cancel(e); + }); + + t.onKeyDown.add(function(ed, e) { + var o = find(e); + + if (o) { + o.func.call(o.scope); + return Event.cancel(e); + } + }); + } + + if (tinymce.isIE) { + // Fix so resize will only update the width and height attributes not the styles of an image + // It will also block mceItemNoResize items + t.dom.bind(t.getDoc(), 'controlselect', function(e) { + var re = t.resizeInfo, cb; + + e = e.target; + + // Don't do this action for non image elements + if (e.nodeName !== 'IMG') + return; + + if (re) + t.dom.unbind(re.node, re.ev, re.cb); + + if (!t.dom.hasClass(e, 'mceItemNoResize')) { + ev = 'resizeend'; + cb = t.dom.bind(e, ev, function(e) { + var v; + + e = e.target; + + if (v = t.dom.getStyle(e, 'width')) { + t.dom.setAttrib(e, 'width', v.replace(/[^0-9%]+/g, '')); + t.dom.setStyle(e, 'width', ''); + } + + if (v = t.dom.getStyle(e, 'height')) { + t.dom.setAttrib(e, 'height', v.replace(/[^0-9%]+/g, '')); + t.dom.setStyle(e, 'height', ''); + } + }); + } else { + ev = 'resizestart'; + cb = t.dom.bind(e, 'resizestart', Event.cancel, Event); + } + + re = t.resizeInfo = { + node : e, + ev : ev, + cb : cb + }; + }); + + t.onKeyDown.add(function(ed, e) { + switch (e.keyCode) { + case 8: + // Fix IE control + backspace browser bug + if (t.selection.getRng().item) { + ed.dom.remove(t.selection.getRng().item(0)); + return Event.cancel(e); + } + } + }); + + /*if (t.dom.boxModel) { + t.getBody().style.height = '100%'; + + Event.add(t.getWin(), 'resize', function(e) { + var docElm = t.getDoc().documentElement; + + docElm.style.height = (docElm.offsetHeight - 10) + 'px'; + }); + }*/ + } + + if (tinymce.isOpera) { + t.onClick.add(function(ed, e) { + Event.prevent(e); + }); + } + + // Add custom undo/redo handlers + if (s.custom_undo_redo) { + function addUndo() { + t.undoManager.typing = 0; + t.undoManager.add(); + }; + + t.dom.bind(t.getDoc(), 'focusout', function(e) { + if (!t.removed && t.undoManager.typing) + addUndo(); + }); + + t.onKeyUp.add(function(ed, e) { + if ((e.keyCode >= 33 && e.keyCode <= 36) || (e.keyCode >= 37 && e.keyCode <= 40) || e.keyCode == 13 || e.keyCode == 45 || e.ctrlKey) + addUndo(); + }); + + t.onKeyDown.add(function(ed, e) { + var rng, parent, bookmark; + + // IE has a really odd bug where the DOM might include an node that doesn't have + // a proper structure. If you try to access nodeValue it would throw an illegal value exception. + // This seems to only happen when you delete contents and it seems to be avoidable if you refresh the element + // after you delete contents from it. See: #3008923 + if (isIE && e.keyCode == 46) { + rng = t.selection.getRng(); + + if (rng.parentElement) { + parent = rng.parentElement(); + + // Select next word when ctrl key is used in combo with delete + if (e.ctrlKey) { + rng.moveEnd('word', 1); + rng.select(); + } + + // Delete contents + t.selection.getSel().clear(); + + // Check if we are within the same parent + if (rng.parentElement() == parent) { + bookmark = t.selection.getBookmark(); + + try { + // Update the HTML and hopefully it will remove the artifacts + parent.innerHTML = parent.innerHTML; + } catch (ex) { + // And since it's IE it can sometimes produce an unknown runtime error + } + + // Restore the caret position + t.selection.moveToBookmark(bookmark); + } + + // Block the default delete behavior since it might be broken + e.preventDefault(); + return; + } + } + + // Is caracter positon keys + if ((e.keyCode >= 33 && e.keyCode <= 36) || (e.keyCode >= 37 && e.keyCode <= 40) || e.keyCode == 13 || e.keyCode == 45) { + if (t.undoManager.typing) + addUndo(); + + return; + } + + if (!t.undoManager.typing) { + t.undoManager.add(); + t.undoManager.typing = 1; + } + }); + + t.onMouseDown.add(function() { + if (t.undoManager.typing) + addUndo(); + }); + } + }, + + _isHidden : function() { + var s; + + if (!isGecko) + return 0; + + // Weird, wheres that cursor selection? + s = this.selection.getSel(); + return (!s || !s.rangeCount || s.rangeCount == 0); + }, + + // Fix for bug #1867292 + _fixNesting : function(s) { + var d = [], i; + + s = s.replace(/<(\/)?([^\s>]+)[^>]*?>/g, function(a, b, c) { + var e; + + // Handle end element + if (b === '/') { + if (!d.length) + return ''; + + if (c !== d[d.length - 1].tag) { + for (i=d.length - 1; i>=0; i--) { + if (d[i].tag === c) { + d[i].close = 1; + break; + } + } + + return ''; + } else { + d.pop(); + + if (d.length && d[d.length - 1].close) { + a = a + ''; + d.pop(); + } + } + } else { + // Ignore these + if (/^(br|hr|input|meta|img|link|param)$/i.test(c)) + return a; + + // Ignore closed ones + if (/\/>$/.test(a)) + return a; + + d.push({tag : c}); // Push start element + } + + return a; + }); + + // End all open tags + for (i=d.length - 1; i>=0; i--) + s += ''; + + return s; + } + }); +})(tinymce); + +(function(tinymce) { + // Added for compression purposes + var each = tinymce.each, undefined, TRUE = true, FALSE = false; + + tinymce.EditorCommands = function(editor) { + var dom = editor.dom, + selection = editor.selection, + commands = {state: {}, exec : {}, value : {}}, + settings = editor.settings, + bookmark; + + function execCommand(command, ui, value) { + var func; + + command = command.toLowerCase(); + if (func = commands.exec[command]) { + func(command, ui, value); + return TRUE; + } + + return FALSE; + }; + + function queryCommandState(command) { + var func; + + command = command.toLowerCase(); + if (func = commands.state[command]) + return func(command); + + return -1; + }; + + function queryCommandValue(command) { + var func; + + command = command.toLowerCase(); + if (func = commands.value[command]) + return func(command); + + return FALSE; + }; + + function addCommands(command_list, type) { + type = type || 'exec'; + + each(command_list, function(callback, command) { + each(command.toLowerCase().split(','), function(command) { + commands[type][command] = callback; + }); + }); + }; + + // Expose public methods + tinymce.extend(this, { + execCommand : execCommand, + queryCommandState : queryCommandState, + queryCommandValue : queryCommandValue, + addCommands : addCommands + }); + + // Private methods + + function execNativeCommand(command, ui, value) { + if (ui === undefined) + ui = FALSE; + + if (value === undefined) + value = null; + + return editor.getDoc().execCommand(command, ui, value); + }; + + function isFormatMatch(name) { + return editor.formatter.match(name); + }; + + function toggleFormat(name, value) { + editor.formatter.toggle(name, value ? {value : value} : undefined); + }; + + function storeSelection(type) { + bookmark = selection.getBookmark(type); + }; + + function restoreSelection() { + selection.moveToBookmark(bookmark); + }; + + // Add execCommand overrides + addCommands({ + // Ignore these, added for compatibility + 'mceResetDesignMode,mceBeginUndoLevel' : function() {}, + + // Add undo manager logic + 'mceEndUndoLevel,mceAddUndoLevel' : function() { + editor.undoManager.add(); + }, + + 'Cut,Copy,Paste' : function(command) { + var doc = editor.getDoc(), failed; + + // Try executing the native command + try { + execNativeCommand(command); + } catch (ex) { + // Command failed + failed = TRUE; + } + + // Present alert message about clipboard access not being available + if (failed || !doc.queryCommandSupported(command)) { + if (tinymce.isGecko) { + editor.windowManager.confirm(editor.getLang('clipboard_msg'), function(state) { + if (state) + open('http://www.mozilla.org/editor/midasdemo/securityprefs.html', '_blank'); + }); + } else + editor.windowManager.alert(editor.getLang('clipboard_no_support')); + } + }, + + // Override unlink command + unlink : function(command) { + if (selection.isCollapsed()) + selection.select(selection.getNode()); + + execNativeCommand(command); + selection.collapse(FALSE); + }, + + // Override justify commands to use the text formatter engine + 'JustifyLeft,JustifyCenter,JustifyRight,JustifyFull' : function(command) { + var align = command.substring(7); + + // Remove all other alignments first + each('left,center,right,full'.split(','), function(name) { + if (align != name) + editor.formatter.remove('align' + name); + }); + + toggleFormat('align' + align); + }, + + // Override list commands to fix WebKit bug + 'InsertUnorderedList,InsertOrderedList' : function(command) { + var listElm, listParent; + + execNativeCommand(command); + + // WebKit produces lists within block elements so we need to split them + // we will replace the native list creation logic to custom logic later on + // TODO: Remove this when the list creation logic is removed + listElm = dom.getParent(selection.getNode(), 'ol,ul'); + if (listElm) { + listParent = listElm.parentNode; + + // If list is within a text block then split that block + if (/^(H[1-6]|P|ADDRESS|PRE)$/.test(listParent.nodeName)) { + storeSelection(); + dom.split(listParent, listElm); + restoreSelection(); + } + } + }, + + // Override commands to use the text formatter engine + 'Bold,Italic,Underline,Strikethrough' : function(command) { + toggleFormat(command); + }, + + // Override commands to use the text formatter engine + 'ForeColor,HiliteColor,FontName' : function(command, ui, value) { + toggleFormat(command, value); + }, + + FontSize : function(command, ui, value) { + var fontClasses, fontSizes; + + // Convert font size 1-7 to styles + if (value >= 1 && value <= 7) { + fontSizes = tinymce.explode(settings.font_size_style_values); + fontClasses = tinymce.explode(settings.font_size_classes); + + if (fontClasses) + value = fontClasses[value - 1] || value; + else + value = fontSizes[value - 1] || value; + } + + toggleFormat(command, value); + }, + + RemoveFormat : function(command) { + editor.formatter.remove(command); + }, + + mceBlockQuote : function(command) { + toggleFormat('blockquote'); + }, + + FormatBlock : function(command, ui, value) { + return toggleFormat(value || 'p'); + }, + + mceCleanup : function() { + var bookmark = selection.getBookmark(); + + editor.setContent(editor.getContent({cleanup : TRUE}), {cleanup : TRUE}); + + selection.moveToBookmark(bookmark); + }, + + mceRemoveNode : function(command, ui, value) { + var node = value || selection.getNode(); + + // Make sure that the body node isn't removed + if (node != editor.getBody()) { + storeSelection(); + editor.dom.remove(node, TRUE); + restoreSelection(); + } + }, + + mceSelectNodeDepth : function(command, ui, value) { + var counter = 0; + + dom.getParent(selection.getNode(), function(node) { + if (node.nodeType == 1 && counter++ == value) { + selection.select(node); + return FALSE; + } + }, editor.getBody()); + }, + + mceSelectNode : function(command, ui, value) { + selection.select(value); + }, + + mceInsertContent : function(command, ui, value) { + selection.setContent(value); + }, + + mceInsertRawHTML : function(command, ui, value) { + selection.setContent('tiny_mce_marker'); + editor.setContent(editor.getContent().replace(/tiny_mce_marker/g, value)); + }, + + mceSetContent : function(command, ui, value) { + editor.setContent(value); + }, + + 'Indent,Outdent' : function(command) { + var intentValue, indentUnit, value; + + // Setup indent level + intentValue = settings.indentation; + indentUnit = /[a-z%]+$/i.exec(intentValue); + intentValue = parseInt(intentValue); + + if (!queryCommandState('InsertUnorderedList') && !queryCommandState('InsertOrderedList')) { + each(selection.getSelectedBlocks(), function(element) { + if (command == 'outdent') { + value = Math.max(0, parseInt(element.style.paddingLeft || 0) - intentValue); + dom.setStyle(element, 'paddingLeft', value ? value + indentUnit : ''); + } else + dom.setStyle(element, 'paddingLeft', (parseInt(element.style.paddingLeft || 0) + intentValue) + indentUnit); + }); + } else + execNativeCommand(command); + }, + + mceRepaint : function() { + var bookmark; + + if (tinymce.isGecko) { + try { + storeSelection(TRUE); + + if (selection.getSel()) + selection.getSel().selectAllChildren(editor.getBody()); + + selection.collapse(TRUE); + restoreSelection(); + } catch (ex) { + // Ignore + } + } + }, + + mceToggleFormat : function(command, ui, value) { + editor.formatter.toggle(value); + }, + + InsertHorizontalRule : function() { + selection.setContent('

'); + }, + + mceToggleVisualAid : function() { + editor.hasVisual = !editor.hasVisual; + editor.addVisual(); + }, + + mceReplaceContent : function(command, ui, value) { + selection.setContent(value.replace(/\{\$selection\}/g, selection.getContent({format : 'text'}))); + }, + + mceInsertLink : function(command, ui, value) { + var link = dom.getParent(selection.getNode(), 'a'); + + if (tinymce.is(value, 'string')) + value = {href : value}; + + if (!link) { + execNativeCommand('CreateLink', FALSE, 'javascript:mctmp(0);'); + each(dom.select('a[href=javascript:mctmp(0);]'), function(link) { + dom.setAttribs(link, value); + }); + } else { + if (value.href) + dom.setAttribs(link, value); + else + editor.dom.remove(link, TRUE); + } + }, + + selectAll : function() { + var root = dom.getRoot(), rng = dom.createRng(); + + rng.setStart(root, 0); + rng.setEnd(root, root.childNodes.length); + + editor.selection.setRng(rng); + } + }); + + // Add queryCommandState overrides + addCommands({ + // Override justify commands + 'JustifyLeft,JustifyCenter,JustifyRight,JustifyFull' : function(command) { + return isFormatMatch('align' + command.substring(7)); + }, + + 'Bold,Italic,Underline,Strikethrough' : function(command) { + return isFormatMatch(command); + }, + + mceBlockQuote : function() { + return isFormatMatch('blockquote'); + }, + + Outdent : function() { + var node; + + if (settings.inline_styles) { + if ((node = dom.getParent(selection.getStart(), dom.isBlock)) && parseInt(node.style.paddingLeft) > 0) + return TRUE; + + if ((node = dom.getParent(selection.getEnd(), dom.isBlock)) && parseInt(node.style.paddingLeft) > 0) + return TRUE; + } + + return queryCommandState('InsertUnorderedList') || queryCommandState('InsertOrderedList') || (!settings.inline_styles && !!dom.getParent(selection.getNode(), 'BLOCKQUOTE')); + }, + + 'InsertUnorderedList,InsertOrderedList' : function(command) { + return dom.getParent(selection.getNode(), command == 'insertunorderedlist' ? 'UL' : 'OL'); + } + }, 'state'); + + // Add queryCommandValue overrides + addCommands({ + 'FontSize,FontName' : function(command) { + var value = 0, parent; + + if (parent = dom.getParent(selection.getNode(), 'span')) { + if (command == 'fontsize') + value = parent.style.fontSize; + else + value = parent.style.fontFamily.replace(/, /g, ',').replace(/[\'\"]/g, '').toLowerCase(); + } + + return value; + } + }, 'value'); + + // Add undo manager logic + if (settings.custom_undo_redo) { + addCommands({ + Undo : function() { + editor.undoManager.undo(); + }, + + Redo : function() { + editor.undoManager.redo(); + } + }); + } + }; +})(tinymce); +(function(tinymce) { + var Dispatcher = tinymce.util.Dispatcher; + + tinymce.UndoManager = function(editor) { + var self, index = 0, data = []; + + function getContent() { + return tinymce.trim(editor.getContent({format : 'raw', no_events : 1})); + }; + + return self = { + typing : 0, + + onAdd : new Dispatcher(self), + onUndo : new Dispatcher(self), + onRedo : new Dispatcher(self), + + add : function(level) { + var i, settings = editor.settings, lastLevel; + + level = level || {}; + level.content = getContent(); + + // Add undo level if needed + lastLevel = data[index]; + if (lastLevel && lastLevel.content == level.content) { + if (index > 0 || data.length == 1) + return null; + } + + // Time to compress + if (settings.custom_undo_redo_levels) { + if (data.length > settings.custom_undo_redo_levels) { + for (i = 0; i < data.length - 1; i++) + data[i] = data[i + 1]; + + data.length--; + index = data.length; + } + } + + // Get a non intrusive normalized bookmark + level.bookmark = editor.selection.getBookmark(2, true); + + // Crop array if needed + if (index < data.length - 1) { + // Treat first level as initial + if (index == 0) + data = []; + else + data.length = index + 1; + } + + data.push(level); + index = data.length - 1; + + self.onAdd.dispatch(self, level); + editor.isNotDirty = 0; + + return level; + }, + + undo : function() { + var level, i; + + if (self.typing) { + self.add(); + self.typing = 0; + } + + if (index > 0) { + level = data[--index]; + + editor.setContent(level.content, {format : 'raw'}); + editor.selection.moveToBookmark(level.bookmark); + + self.onUndo.dispatch(self, level); + } + + return level; + }, + + redo : function() { + var level; + + if (index < data.length - 1) { + level = data[++index]; + + editor.setContent(level.content, {format : 'raw'}); + editor.selection.moveToBookmark(level.bookmark); + + self.onRedo.dispatch(self, level); + } + + return level; + }, + + clear : function() { + data = []; + index = self.typing = 0; + }, + + hasUndo : function() { + return index > 0 || self.typing; + }, + + hasRedo : function() { + return index < data.length - 1; + } + }; + }; +})(tinymce); + +(function(tinymce) { + // Shorten names + var Event = tinymce.dom.Event, + isIE = tinymce.isIE, + isGecko = tinymce.isGecko, + isOpera = tinymce.isOpera, + each = tinymce.each, + extend = tinymce.extend, + TRUE = true, + FALSE = false; + + function cloneFormats(node) { + var clone, temp, inner; + + do { + if (/^(SPAN|STRONG|B|EM|I|FONT|STRIKE|U)$/.test(node.nodeName)) { + if (clone) { + temp = node.cloneNode(false); + temp.appendChild(clone); + clone = temp; + } else { + clone = inner = node.cloneNode(false); + } + + clone.removeAttribute('id'); + } + } while (node = node.parentNode); + + if (clone) + return {wrapper : clone, inner : inner}; + }; + + // Checks if the selection/caret is at the end of the specified block element + function isAtEnd(rng, par) { + var rng2 = par.ownerDocument.createRange(); + + rng2.setStart(rng.endContainer, rng.endOffset); + rng2.setEndAfter(par); + + // Get number of characters to the right of the cursor if it's zero then we are at the end and need to merge the next block element + return rng2.cloneContents().textContent.length == 0; + }; + + function isEmpty(n) { + n = n.innerHTML; + + n = n.replace(/<(img|hr|table|input|select|textarea)[ \>]/gi, '-'); // Keep these convert them to - chars + n = n.replace(/<[^>]+>/g, ''); // Remove all tags + + return n.replace(/[ \u00a0\t\r\n]+/g, '') == ''; + }; + + function splitList(selection, dom, li) { + var listBlock, block; + + if (isEmpty(li)) { + listBlock = dom.getParent(li, 'ul,ol'); + + if (!dom.getParent(listBlock.parentNode, 'ul,ol')) { + dom.split(listBlock, li); + block = dom.create('p', 0, '
'); + dom.replace(block, li); + selection.select(block, 1); + } + + return FALSE; + } + + return TRUE; + }; + + tinymce.create('tinymce.ForceBlocks', { + ForceBlocks : function(ed) { + var t = this, s = ed.settings, elm; + + t.editor = ed; + t.dom = ed.dom; + elm = (s.forced_root_block || 'p').toLowerCase(); + s.element = elm.toUpperCase(); + + ed.onPreInit.add(t.setup, t); + + t.reOpera = new RegExp('(\\u00a0| | )<\/' + elm + '>', 'gi'); + t.rePadd = new RegExp(']+)><\\\/p>|]+)\\\/>|]+)>\\s+<\\\/p>|

<\\\/p>||

\\s+<\\\/p>'.replace(/p/g, elm), 'gi'); + t.reNbsp2BR1 = new RegExp(']+)>[\\s\\u00a0]+<\\\/p>|

[\\s\\u00a0]+<\\\/p>'.replace(/p/g, elm), 'gi'); + t.reNbsp2BR2 = new RegExp('<%p()([^>]+)>( | )<\\\/%p>|<%p>( | )<\\\/%p>'.replace(/%p/g, elm), 'gi'); + t.reBR2Nbsp = new RegExp(']+)>\\s*
\\s*<\\\/p>|

\\s*
\\s*<\\\/p>'.replace(/p/g, elm), 'gi'); + + function padd(ed, o) { + if (isOpera) + o.content = o.content.replace(t.reOpera, ''); + + o.content = o.content.replace(t.rePadd, '<' + elm + '$1$2$3$4$5$6>\u00a0'); + + if (!isIE && !isOpera && o.set) { + // Use instead of BR in padded paragraphs + o.content = o.content.replace(t.reNbsp2BR1, '<' + elm + '$1$2>
'); + o.content = o.content.replace(t.reNbsp2BR2, '<' + elm + '$1$2>
'); + } else + o.content = o.content.replace(t.reBR2Nbsp, '<' + elm + '$1$2>\u00a0'); + }; + + ed.onBeforeSetContent.add(padd); + ed.onPostProcess.add(padd); + + if (s.forced_root_block) { + ed.onInit.add(t.forceRoots, t); + ed.onSetContent.add(t.forceRoots, t); + ed.onBeforeGetContent.add(t.forceRoots, t); + } + }, + + setup : function() { + var t = this, ed = t.editor, s = ed.settings, dom = ed.dom, selection = ed.selection; + + // Force root blocks when typing and when getting output + if (s.forced_root_block) { + ed.onBeforeExecCommand.add(t.forceRoots, t); + ed.onKeyUp.add(t.forceRoots, t); + ed.onPreProcess.add(t.forceRoots, t); + } + + if (s.force_br_newlines) { + // Force IE to produce BRs on enter + if (isIE) { + ed.onKeyPress.add(function(ed, e) { + var n; + + if (e.keyCode == 13 && selection.getNode().nodeName != 'LI') { + selection.setContent('
', {format : 'raw'}); + n = dom.get('__'); + n.removeAttribute('id'); + selection.select(n); + selection.collapse(); + return Event.cancel(e); + } + }); + } + } + + if (s.force_p_newlines) { + if (!isIE) { + ed.onKeyPress.add(function(ed, e) { + if (e.keyCode == 13 && !e.shiftKey && !t.insertPara(e)) + Event.cancel(e); + }); + } else { + // Ungly hack to for IE to preserve the formatting when you press + // enter at the end of a block element with formatted contents + // This logic overrides the browsers default logic with + // custom logic that enables us to control the output + tinymce.addUnload(function() { + t._previousFormats = 0; // Fix IE leak + }); + + ed.onKeyPress.add(function(ed, e) { + t._previousFormats = 0; + + // Clone the current formats, this will later be applied to the new block contents + if (e.keyCode == 13 && !e.shiftKey && ed.selection.isCollapsed() && s.keep_styles) + t._previousFormats = cloneFormats(ed.selection.getStart()); + }); + + ed.onKeyUp.add(function(ed, e) { + // Let IE break the element and the wrap the new caret location in the previous formats + if (e.keyCode == 13 && !e.shiftKey) { + var parent = ed.selection.getStart(), fmt = t._previousFormats; + + // Parent is an empty block + if (!parent.hasChildNodes()) { + parent = dom.getParent(parent, dom.isBlock); + + if (parent) { + parent.innerHTML = ''; + + if (t._previousFormats) { + parent.appendChild(fmt.wrapper); + fmt.inner.innerHTML = '\uFEFF'; + } else + parent.innerHTML = '\uFEFF'; + + selection.select(parent, 1); + ed.getDoc().execCommand('Delete', false, null); + } + } + } + }); + } + + if (isGecko) { + ed.onKeyDown.add(function(ed, e) { + if ((e.keyCode == 8 || e.keyCode == 46) && !e.shiftKey) + t.backspaceDelete(e, e.keyCode == 8); + }); + } + } + + // Workaround for missing shift+enter support, http://bugs.webkit.org/show_bug.cgi?id=16973 + if (tinymce.isWebKit) { + function insertBr(ed) { + var rng = selection.getRng(), br, div = dom.create('div', null, ' '), divYPos, vpHeight = dom.getViewPort(ed.getWin()).h; + + // Insert BR element + rng.insertNode(br = dom.create('br')); + + // Place caret after BR + rng.setStartAfter(br); + rng.setEndAfter(br); + selection.setRng(rng); + + // Could not place caret after BR then insert an nbsp entity and move the caret + if (selection.getSel().focusNode == br.previousSibling) { + selection.select(dom.insertAfter(dom.doc.createTextNode('\u00a0'), br)); + selection.collapse(TRUE); + } + + // Create a temporary DIV after the BR and get the position as it + // seems like getPos() returns 0 for text nodes and BR elements. + dom.insertAfter(div, br); + divYPos = dom.getPos(div).y; + dom.remove(div); + + // Scroll to new position, scrollIntoView can't be used due to bug: http://bugs.webkit.org/show_bug.cgi?id=16117 + if (divYPos > vpHeight) // It is not necessary to scroll if the DIV is inside the view port. + ed.getWin().scrollTo(0, divYPos); + }; + + ed.onKeyPress.add(function(ed, e) { + if (e.keyCode == 13 && (e.shiftKey || (s.force_br_newlines && !dom.getParent(selection.getNode(), 'h1,h2,h3,h4,h5,h6,ol,ul')))) { + insertBr(ed); + Event.cancel(e); + } + }); + } + + // Padd empty inline elements within block elements + // For example:

becomes

+ ed.onPreProcess.add(function(ed, o) { + each(dom.select('p,h1,h2,h3,h4,h5,h6,div', o.node), function(p) { + if (isEmpty(p)) { + each(dom.select('span,em,strong,b,i', o.node), function(n) { + if (!n.hasChildNodes()) { + n.appendChild(ed.getDoc().createTextNode('\u00a0')); + return FALSE; // Break the loop one padding is enough + } + }); + } + }); + }); + + // IE specific fixes + if (isIE) { + // Replaces IE:s auto generated paragraphs with the specified element name + if (s.element != 'P') { + ed.onKeyPress.add(function(ed, e) { + t.lastElm = selection.getNode().nodeName; + }); + + ed.onKeyUp.add(function(ed, e) { + var bl, n = selection.getNode(), b = ed.getBody(); + + if (b.childNodes.length === 1 && n.nodeName == 'P') { + n = dom.rename(n, s.element); + selection.select(n); + selection.collapse(); + ed.nodeChanged(); + } else if (e.keyCode == 13 && !e.shiftKey && t.lastElm != 'P') { + bl = dom.getParent(n, 'p'); + + if (bl) { + dom.rename(bl, s.element); + ed.nodeChanged(); + } + } + }); + } + } + }, + + find : function(n, t, s) { + var ed = this.editor, w = ed.getDoc().createTreeWalker(n, 4, null, FALSE), c = -1; + + while (n = w.nextNode()) { + c++; + + // Index by node + if (t == 0 && n == s) + return c; + + // Node by index + if (t == 1 && c == s) + return n; + } + + return -1; + }, + + forceRoots : function(ed, e) { + var t = this, ed = t.editor, b = ed.getBody(), d = ed.getDoc(), se = ed.selection, s = se.getSel(), r = se.getRng(), si = -2, ei, so, eo, tr, c = -0xFFFFFF; + var nx, bl, bp, sp, le, nl = b.childNodes, i, n, eid; + + // Fix for bug #1863847 + //if (e && e.keyCode == 13) + // return TRUE; + + // Wrap non blocks into blocks + for (i = nl.length - 1; i >= 0; i--) { + nx = nl[i]; + + // Ignore internal elements + if (nx.nodeType === 1 && nx.getAttribute('_mce_type')) { + bl = null; + continue; + } + + // Is text or non block element + if (nx.nodeType === 3 || (!t.dom.isBlock(nx) && nx.nodeType !== 8 && !/^(script|mce:script|style|mce:style)$/i.test(nx.nodeName))) { + if (!bl) { + // Create new block but ignore whitespace + if (nx.nodeType != 3 || /[^\s]/g.test(nx.nodeValue)) { + // Store selection + if (si == -2 && r) { + if (!isIE) { + // If selection is element then mark it + if (r.startContainer.nodeType == 1 && (n = r.startContainer.childNodes[r.startOffset]) && n.nodeType == 1) { + // Save the id of the selected element + eid = n.getAttribute("id"); + n.setAttribute("id", "__mce"); + } else { + // If element is inside body, might not be the case in contentEdiable mode + if (ed.dom.getParent(r.startContainer, function(e) {return e === b;})) { + so = r.startOffset; + eo = r.endOffset; + si = t.find(b, 0, r.startContainer); + ei = t.find(b, 0, r.endContainer); + } + } + } else { + // Force control range into text range + if (r.item) { + tr = d.body.createTextRange(); + tr.moveToElementText(r.item(0)); + r = tr; + } + + tr = d.body.createTextRange(); + tr.moveToElementText(b); + tr.collapse(1); + bp = tr.move('character', c) * -1; + + tr = r.duplicate(); + tr.collapse(1); + sp = tr.move('character', c) * -1; + + tr = r.duplicate(); + tr.collapse(0); + le = (tr.move('character', c) * -1) - sp; + + si = sp - bp; + ei = le; + } + } + + // Uses replaceChild instead of cloneNode since it removes selected attribute from option elements on IE + // See: http://support.microsoft.com/kb/829907 + bl = ed.dom.create(ed.settings.forced_root_block); + nx.parentNode.replaceChild(bl, nx); + bl.appendChild(nx); + } + } else { + if (bl.hasChildNodes()) + bl.insertBefore(nx, bl.firstChild); + else + bl.appendChild(nx); + } + } else + bl = null; // Time to create new block + } + + // Restore selection + if (si != -2) { + if (!isIE) { + bl = b.getElementsByTagName(ed.settings.element)[0]; + r = d.createRange(); + + // Select last location or generated block + if (si != -1) + r.setStart(t.find(b, 1, si), so); + else + r.setStart(bl, 0); + + // Select last location or generated block + if (ei != -1) + r.setEnd(t.find(b, 1, ei), eo); + else + r.setEnd(bl, 0); + + if (s) { + s.removeAllRanges(); + s.addRange(r); + } + } else { + try { + r = s.createRange(); + r.moveToElementText(b); + r.collapse(1); + r.moveStart('character', si); + r.moveEnd('character', ei); + r.select(); + } catch (ex) { + // Ignore + } + } + } else if (!isIE && (n = ed.dom.get('__mce'))) { + // Restore the id of the selected element + if (eid) + n.setAttribute('id', eid); + else + n.removeAttribute('id'); + + // Move caret before selected element + r = d.createRange(); + r.setStartBefore(n); + r.setEndBefore(n); + se.setRng(r); + } + }, + + getParentBlock : function(n) { + var d = this.dom; + + return d.getParent(n, d.isBlock); + }, + + insertPara : function(e) { + var t = this, ed = t.editor, dom = ed.dom, d = ed.getDoc(), se = ed.settings, s = ed.selection.getSel(), r = s.getRangeAt(0), b = d.body; + var rb, ra, dir, sn, so, en, eo, sb, eb, bn, bef, aft, sc, ec, n, vp = dom.getViewPort(ed.getWin()), y, ch, car; + + // If root blocks are forced then use Operas default behavior since it's really good +// Removed due to bug: #1853816 +// if (se.forced_root_block && isOpera) +// return TRUE; + + // Setup before range + rb = d.createRange(); + + // If is before the first block element and in body, then move it into first block element + rb.setStart(s.anchorNode, s.anchorOffset); + rb.collapse(TRUE); + + // Setup after range + ra = d.createRange(); + + // If is before the first block element and in body, then move it into first block element + ra.setStart(s.focusNode, s.focusOffset); + ra.collapse(TRUE); + + // Setup start/end points + dir = rb.compareBoundaryPoints(rb.START_TO_END, ra) < 0; + sn = dir ? s.anchorNode : s.focusNode; + so = dir ? s.anchorOffset : s.focusOffset; + en = dir ? s.focusNode : s.anchorNode; + eo = dir ? s.focusOffset : s.anchorOffset; + + // If selection is in empty table cell + if (sn === en && /^(TD|TH)$/.test(sn.nodeName)) { + if (sn.firstChild.nodeName == 'BR') + dom.remove(sn.firstChild); // Remove BR + + // Create two new block elements + if (sn.childNodes.length == 0) { + ed.dom.add(sn, se.element, null, '
'); + aft = ed.dom.add(sn, se.element, null, '
'); + } else { + n = sn.innerHTML; + sn.innerHTML = ''; + ed.dom.add(sn, se.element, null, n); + aft = ed.dom.add(sn, se.element, null, '
'); + } + + // Move caret into the last one + r = d.createRange(); + r.selectNodeContents(aft); + r.collapse(1); + ed.selection.setRng(r); + + return FALSE; + } + + // If the caret is in an invalid location in FF we need to move it into the first block + if (sn == b && en == b && b.firstChild && ed.dom.isBlock(b.firstChild)) { + sn = en = sn.firstChild; + so = eo = 0; + rb = d.createRange(); + rb.setStart(sn, 0); + ra = d.createRange(); + ra.setStart(en, 0); + } + + // Never use body as start or end node + sn = sn.nodeName == "HTML" ? d.body : sn; // Fix for Opera bug: https://bugs.opera.com/show_bug.cgi?id=273224&comments=yes + sn = sn.nodeName == "BODY" ? sn.firstChild : sn; + en = en.nodeName == "HTML" ? d.body : en; // Fix for Opera bug: https://bugs.opera.com/show_bug.cgi?id=273224&comments=yes + en = en.nodeName == "BODY" ? en.firstChild : en; + + // Get start and end blocks + sb = t.getParentBlock(sn); + eb = t.getParentBlock(en); + bn = sb ? sb.nodeName : se.element; // Get block name to create + + // Return inside list use default browser behavior + if (n = t.dom.getParent(sb, 'li,pre')) { + if (n.nodeName == 'LI') + return splitList(ed.selection, t.dom, n); + + return TRUE; + } + + // If caption or absolute layers then always generate new blocks within + if (sb && (sb.nodeName == 'CAPTION' || /absolute|relative|fixed/gi.test(dom.getStyle(sb, 'position', 1)))) { + bn = se.element; + sb = null; + } + + // If caption or absolute layers then always generate new blocks within + if (eb && (eb.nodeName == 'CAPTION' || /absolute|relative|fixed/gi.test(dom.getStyle(sb, 'position', 1)))) { + bn = se.element; + eb = null; + } + + // Use P instead + if (/(TD|TABLE|TH|CAPTION)/.test(bn) || (sb && bn == "DIV" && /left|right/gi.test(dom.getStyle(sb, 'float', 1)))) { + bn = se.element; + sb = eb = null; + } + + // Setup new before and after blocks + bef = (sb && sb.nodeName == bn) ? sb.cloneNode(0) : ed.dom.create(bn); + aft = (eb && eb.nodeName == bn) ? eb.cloneNode(0) : ed.dom.create(bn); + + // Remove id from after clone + aft.removeAttribute('id'); + + // Is header and cursor is at the end, then force paragraph under + if (/^(H[1-6])$/.test(bn) && isAtEnd(r, sb)) + aft = ed.dom.create(se.element); + + // Find start chop node + n = sc = sn; + do { + if (n == b || n.nodeType == 9 || t.dom.isBlock(n) || /(TD|TABLE|TH|CAPTION)/.test(n.nodeName)) + break; + + sc = n; + } while ((n = n.previousSibling ? n.previousSibling : n.parentNode)); + + // Find end chop node + n = ec = en; + do { + if (n == b || n.nodeType == 9 || t.dom.isBlock(n) || /(TD|TABLE|TH|CAPTION)/.test(n.nodeName)) + break; + + ec = n; + } while ((n = n.nextSibling ? n.nextSibling : n.parentNode)); + + // Place first chop part into before block element + if (sc.nodeName == bn) + rb.setStart(sc, 0); + else + rb.setStartBefore(sc); + + rb.setEnd(sn, so); + bef.appendChild(rb.cloneContents() || d.createTextNode('')); // Empty text node needed for Safari + + // Place secnd chop part within new block element + try { + ra.setEndAfter(ec); + } catch(ex) { + //console.debug(s.focusNode, s.focusOffset); + } + + ra.setStart(en, eo); + aft.appendChild(ra.cloneContents() || d.createTextNode('')); // Empty text node needed for Safari + + // Create range around everything + r = d.createRange(); + if (!sc.previousSibling && sc.parentNode.nodeName == bn) { + r.setStartBefore(sc.parentNode); + } else { + if (rb.startContainer.nodeName == bn && rb.startOffset == 0) + r.setStartBefore(rb.startContainer); + else + r.setStart(rb.startContainer, rb.startOffset); + } + + if (!ec.nextSibling && ec.parentNode.nodeName == bn) + r.setEndAfter(ec.parentNode); + else + r.setEnd(ra.endContainer, ra.endOffset); + + // Delete and replace it with new block elements + r.deleteContents(); + + if (isOpera) + ed.getWin().scrollTo(0, vp.y); + + // Never wrap blocks in blocks + if (bef.firstChild && bef.firstChild.nodeName == bn) + bef.innerHTML = bef.firstChild.innerHTML; + + if (aft.firstChild && aft.firstChild.nodeName == bn) + aft.innerHTML = aft.firstChild.innerHTML; + + // Padd empty blocks + if (isEmpty(bef)) + bef.innerHTML = '
'; + + function appendStyles(e, en) { + var nl = [], nn, n, i; + + e.innerHTML = ''; + + // Make clones of style elements + if (se.keep_styles) { + n = en; + do { + // We only want style specific elements + if (/^(SPAN|STRONG|B|EM|I|FONT|STRIKE|U)$/.test(n.nodeName)) { + nn = n.cloneNode(FALSE); + dom.setAttrib(nn, 'id', ''); // Remove ID since it needs to be unique + nl.push(nn); + } + } while (n = n.parentNode); + } + + // Append style elements to aft + if (nl.length > 0) { + for (i = nl.length - 1, nn = e; i >= 0; i--) + nn = nn.appendChild(nl[i]); + + // Padd most inner style element + nl[0].innerHTML = isOpera ? ' ' : '
'; // Extra space for Opera so that the caret can move there + return nl[0]; // Move caret to most inner element + } else + e.innerHTML = isOpera ? ' ' : '
'; // Extra space for Opera so that the caret can move there + }; + + // Fill empty afterblook with current style + if (isEmpty(aft)) + car = appendStyles(aft, en); + + // Opera needs this one backwards for older versions + if (isOpera && parseFloat(opera.version()) < 9.5) { + r.insertNode(bef); + r.insertNode(aft); + } else { + r.insertNode(aft); + r.insertNode(bef); + } + + // Normalize + aft.normalize(); + bef.normalize(); + + function first(n) { + return d.createTreeWalker(n, NodeFilter.SHOW_TEXT, null, FALSE).nextNode() || n; + }; + + // Move cursor and scroll into view + r = d.createRange(); + r.selectNodeContents(isGecko ? first(car || aft) : car || aft); + r.collapse(1); + s.removeAllRanges(); + s.addRange(r); + + // scrollIntoView seems to scroll the parent window in most browsers now including FF 3.0b4 so it's time to stop using it and do it our selfs + y = ed.dom.getPos(aft).y; + ch = aft.clientHeight; + + // Is element within viewport + if (y < vp.y || y + ch > vp.y + vp.h) { + ed.getWin().scrollTo(0, y < vp.y ? y : y - vp.h + 25); // Needs to be hardcoded to roughly one line of text if a huge text block is broken into two blocks + //console.debug('SCROLL!', 'vp.y: ' + vp.y, 'y' + y, 'vp.h' + vp.h, 'clientHeight' + aft.clientHeight, 'yyy: ' + (y < vp.y ? y : y - vp.h + aft.clientHeight)); + } + + return FALSE; + }, + + backspaceDelete : function(e, bs) { + var t = this, ed = t.editor, b = ed.getBody(), dom = ed.dom, n, se = ed.selection, r = se.getRng(), sc = r.startContainer, n, w, tn, walker; + + // Delete when caret is behind a element doesn't work correctly on Gecko see #3011651 + if (!bs && r.collapsed && sc.nodeType == 1 && r.startOffset == sc.childNodes.length) { + walker = new tinymce.dom.TreeWalker(sc.lastChild, sc); + + // Walk the dom backwards until we find a text node + for (n = sc.lastChild; n; n = walker.prev()) { + if (n.nodeType == 3) { + r.setStart(n, n.nodeValue.length); + r.collapse(true); + se.setRng(r); + return; + } + } + } + + // The caret sometimes gets stuck in Gecko if you delete empty paragraphs + // This workaround removes the element by hand and moves the caret to the previous element + if (sc && ed.dom.isBlock(sc) && !/^(TD|TH)$/.test(sc.nodeName) && bs) { + if (sc.childNodes.length == 0 || (sc.childNodes.length == 1 && sc.firstChild.nodeName == 'BR')) { + // Find previous block element + n = sc; + while ((n = n.previousSibling) && !ed.dom.isBlock(n)) ; + + if (n) { + if (sc != b.firstChild) { + // Find last text node + w = ed.dom.doc.createTreeWalker(n, NodeFilter.SHOW_TEXT, null, FALSE); + while (tn = w.nextNode()) + n = tn; + + // Place caret at the end of last text node + r = ed.getDoc().createRange(); + r.setStart(n, n.nodeValue ? n.nodeValue.length : 0); + r.setEnd(n, n.nodeValue ? n.nodeValue.length : 0); + se.setRng(r); + + // Remove the target container + ed.dom.remove(sc); + } + + return Event.cancel(e); + } + } + } + } + }); +})(tinymce); + +(function(tinymce) { + // Shorten names + var DOM = tinymce.DOM, Event = tinymce.dom.Event, each = tinymce.each, extend = tinymce.extend; + + tinymce.create('tinymce.ControlManager', { + ControlManager : function(ed, s) { + var t = this, i; + + s = s || {}; + t.editor = ed; + t.controls = {}; + t.onAdd = new tinymce.util.Dispatcher(t); + t.onPostRender = new tinymce.util.Dispatcher(t); + t.prefix = s.prefix || ed.id + '_'; + t._cls = {}; + + t.onPostRender.add(function() { + each(t.controls, function(c) { + c.postRender(); + }); + }); + }, + + get : function(id) { + return this.controls[this.prefix + id] || this.controls[id]; + }, + + setActive : function(id, s) { + var c = null; + + if (c = this.get(id)) + c.setActive(s); + + return c; + }, + + setDisabled : function(id, s) { + var c = null; + + if (c = this.get(id)) + c.setDisabled(s); + + return c; + }, + + add : function(c) { + var t = this; + + if (c) { + t.controls[c.id] = c; + t.onAdd.dispatch(c, t); + } + + return c; + }, + + createControl : function(n) { + var c, t = this, ed = t.editor; + + each(ed.plugins, function(p) { + if (p.createControl) { + c = p.createControl(n, t); + + if (c) + return false; + } + }); + + switch (n) { + case "|": + case "separator": + return t.createSeparator(); + } + + if (!c && ed.buttons && (c = ed.buttons[n])) + return t.createButton(n, c); + + return t.add(c); + }, + + createDropMenu : function(id, s, cc) { + var t = this, ed = t.editor, c, bm, v, cls; + + s = extend({ + 'class' : 'mceDropDown', + constrain : ed.settings.constrain_menus + }, s); + + s['class'] = s['class'] + ' ' + ed.getParam('skin') + 'Skin'; + if (v = ed.getParam('skin_variant')) + s['class'] += ' ' + ed.getParam('skin') + 'Skin' + v.substring(0, 1).toUpperCase() + v.substring(1); + + id = t.prefix + id; + cls = cc || t._cls.dropmenu || tinymce.ui.DropMenu; + c = t.controls[id] = new cls(id, s); + c.onAddItem.add(function(c, o) { + var s = o.settings; + + s.title = ed.getLang(s.title, s.title); + + if (!s.onclick) { + s.onclick = function(v) { + if (s.cmd) + ed.execCommand(s.cmd, s.ui || false, s.value); + }; + } + }); + + ed.onRemove.add(function() { + c.destroy(); + }); + + // Fix for bug #1897785, #1898007 + if (tinymce.isIE) { + c.onShowMenu.add(function() { + // IE 8 needs focus in order to store away a range with the current collapsed caret location + ed.focus(); + + bm = ed.selection.getBookmark(1); + }); + + c.onHideMenu.add(function() { + if (bm) { + ed.selection.moveToBookmark(bm); + bm = 0; + } + }); + } + + return t.add(c); + }, + + createListBox : function(id, s, cc) { + var t = this, ed = t.editor, cmd, c, cls; + + if (t.get(id)) + return null; + + s.title = ed.translate(s.title); + s.scope = s.scope || ed; + + if (!s.onselect) { + s.onselect = function(v) { + ed.execCommand(s.cmd, s.ui || false, v || s.value); + }; + } + + s = extend({ + title : s.title, + 'class' : 'mce_' + id, + scope : s.scope, + control_manager : t + }, s); + + id = t.prefix + id; + + if (ed.settings.use_native_selects) + c = new tinymce.ui.NativeListBox(id, s); + else { + cls = cc || t._cls.listbox || tinymce.ui.ListBox; + c = new cls(id, s); + } + + t.controls[id] = c; + + // Fix focus problem in Safari + if (tinymce.isWebKit) { + c.onPostRender.add(function(c, n) { + // Store bookmark on mousedown + Event.add(n, 'mousedown', function() { + ed.bookmark = ed.selection.getBookmark(1); + }); + + // Restore on focus, since it might be lost + Event.add(n, 'focus', function() { + ed.selection.moveToBookmark(ed.bookmark); + ed.bookmark = null; + }); + }); + } + + if (c.hideMenu) + ed.onMouseDown.add(c.hideMenu, c); + + return t.add(c); + }, + + createButton : function(id, s, cc) { + var t = this, ed = t.editor, o, c, cls; + + if (t.get(id)) + return null; + + s.title = ed.translate(s.title); + s.label = ed.translate(s.label); + s.scope = s.scope || ed; + + if (!s.onclick && !s.menu_button) { + s.onclick = function() { + ed.execCommand(s.cmd, s.ui || false, s.value); + }; + } + + s = extend({ + title : s.title, + 'class' : 'mce_' + id, + unavailable_prefix : ed.getLang('unavailable', ''), + scope : s.scope, + control_manager : t + }, s); + + id = t.prefix + id; + + if (s.menu_button) { + cls = cc || t._cls.menubutton || tinymce.ui.MenuButton; + c = new cls(id, s); + ed.onMouseDown.add(c.hideMenu, c); + } else { + cls = t._cls.button || tinymce.ui.Button; + c = new cls(id, s); + } + + return t.add(c); + }, + + createMenuButton : function(id, s, cc) { + s = s || {}; + s.menu_button = 1; + + return this.createButton(id, s, cc); + }, + + createSplitButton : function(id, s, cc) { + var t = this, ed = t.editor, cmd, c, cls; + + if (t.get(id)) + return null; + + s.title = ed.translate(s.title); + s.scope = s.scope || ed; + + if (!s.onclick) { + s.onclick = function(v) { + ed.execCommand(s.cmd, s.ui || false, v || s.value); + }; + } + + if (!s.onselect) { + s.onselect = function(v) { + ed.execCommand(s.cmd, s.ui || false, v || s.value); + }; + } + + s = extend({ + title : s.title, + 'class' : 'mce_' + id, + scope : s.scope, + control_manager : t + }, s); + + id = t.prefix + id; + cls = cc || t._cls.splitbutton || tinymce.ui.SplitButton; + c = t.add(new cls(id, s)); + ed.onMouseDown.add(c.hideMenu, c); + + return c; + }, + + createColorSplitButton : function(id, s, cc) { + var t = this, ed = t.editor, cmd, c, cls, bm; + + if (t.get(id)) + return null; + + s.title = ed.translate(s.title); + s.scope = s.scope || ed; + + if (!s.onclick) { + s.onclick = function(v) { + if (tinymce.isIE) + bm = ed.selection.getBookmark(1); + + ed.execCommand(s.cmd, s.ui || false, v || s.value); + }; + } + + if (!s.onselect) { + s.onselect = function(v) { + ed.execCommand(s.cmd, s.ui || false, v || s.value); + }; + } + + s = extend({ + title : s.title, + 'class' : 'mce_' + id, + 'menu_class' : ed.getParam('skin') + 'Skin', + scope : s.scope, + more_colors_title : ed.getLang('more_colors') + }, s); + + id = t.prefix + id; + cls = cc || t._cls.colorsplitbutton || tinymce.ui.ColorSplitButton; + c = new cls(id, s); + ed.onMouseDown.add(c.hideMenu, c); + + // Remove the menu element when the editor is removed + ed.onRemove.add(function() { + c.destroy(); + }); + + // Fix for bug #1897785, #1898007 + if (tinymce.isIE) { + c.onShowMenu.add(function() { + // IE 8 needs focus in order to store away a range with the current collapsed caret location + ed.focus(); + bm = ed.selection.getBookmark(1); + }); + + c.onHideMenu.add(function() { + if (bm) { + ed.selection.moveToBookmark(bm); + bm = 0; + } + }); + } + + return t.add(c); + }, + + createToolbar : function(id, s, cc) { + var c, t = this, cls; + + id = t.prefix + id; + cls = cc || t._cls.toolbar || tinymce.ui.Toolbar; + c = new cls(id, s); + + if (t.get(id)) + return null; + + return t.add(c); + }, + + createSeparator : function(cc) { + var cls = cc || this._cls.separator || tinymce.ui.Separator; + + return new cls(); + }, + + setControlType : function(n, c) { + return this._cls[n.toLowerCase()] = c; + }, + + destroy : function() { + each(this.controls, function(c) { + c.destroy(); + }); + + this.controls = null; + } + }); +})(tinymce); + +(function(tinymce) { + var Dispatcher = tinymce.util.Dispatcher, each = tinymce.each, isIE = tinymce.isIE, isOpera = tinymce.isOpera; + + tinymce.create('tinymce.WindowManager', { + WindowManager : function(ed) { + var t = this; + + t.editor = ed; + t.onOpen = new Dispatcher(t); + t.onClose = new Dispatcher(t); + t.params = {}; + t.features = {}; + }, + + open : function(s, p) { + var t = this, f = '', x, y, mo = t.editor.settings.dialog_type == 'modal', w, sw, sh, vp = tinymce.DOM.getViewPort(), u; + + // Default some options + s = s || {}; + p = p || {}; + sw = isOpera ? vp.w : screen.width; // Opera uses windows inside the Opera window + sh = isOpera ? vp.h : screen.height; + s.name = s.name || 'mc_' + new Date().getTime(); + s.width = parseInt(s.width || 320); + s.height = parseInt(s.height || 240); + s.resizable = true; + s.left = s.left || parseInt(sw / 2.0) - (s.width / 2.0); + s.top = s.top || parseInt(sh / 2.0) - (s.height / 2.0); + p.inline = false; + p.mce_width = s.width; + p.mce_height = s.height; + p.mce_auto_focus = s.auto_focus; + + if (mo) { + if (isIE) { + s.center = true; + s.help = false; + s.dialogWidth = s.width + 'px'; + s.dialogHeight = s.height + 'px'; + s.scroll = s.scrollbars || false; + } + } + + // Build features string + each(s, function(v, k) { + if (tinymce.is(v, 'boolean')) + v = v ? 'yes' : 'no'; + + if (!/^(name|url)$/.test(k)) { + if (isIE && mo) + f += (f ? ';' : '') + k + ':' + v; + else + f += (f ? ',' : '') + k + '=' + v; + } + }); + + t.features = s; + t.params = p; + t.onOpen.dispatch(t, s, p); + + u = s.url || s.file; + u = tinymce._addVer(u); + + try { + if (isIE && mo) { + w = 1; + window.showModalDialog(u, window, f); + } else + w = window.open(u, s.name, f); + } catch (ex) { + // Ignore + } + + if (!w) + alert(t.editor.getLang('popup_blocked')); + }, + + close : function(w) { + w.close(); + this.onClose.dispatch(this); + }, + + createInstance : function(cl, a, b, c, d, e) { + var f = tinymce.resolve(cl); + + return new f(a, b, c, d, e); + }, + + confirm : function(t, cb, s, w) { + w = w || window; + + cb.call(s || this, w.confirm(this._decode(this.editor.getLang(t, t)))); + }, + + alert : function(tx, cb, s, w) { + var t = this; + + w = w || window; + w.alert(t._decode(t.editor.getLang(tx, tx))); + + if (cb) + cb.call(s || t); + }, + + resizeBy : function(dw, dh, win) { + win.resizeBy(dw, dh); + }, + + // Internal functions + + _decode : function(s) { + return tinymce.DOM.decode(s).replace(/\\n/g, '\n'); + } + }); +}(tinymce)); +(function(tinymce) { + function CommandManager() { + var execCommands = {}, queryStateCommands = {}, queryValueCommands = {}; + + function add(collection, cmd, func, scope) { + if (typeof(cmd) == 'string') + cmd = [cmd]; + + tinymce.each(cmd, function(cmd) { + collection[cmd.toLowerCase()] = {func : func, scope : scope}; + }); + }; + + tinymce.extend(this, { + add : function(cmd, func, scope) { + add(execCommands, cmd, func, scope); + }, + + addQueryStateHandler : function(cmd, func, scope) { + add(queryStateCommands, cmd, func, scope); + }, + + addQueryValueHandler : function(cmd, func, scope) { + add(queryValueCommands, cmd, func, scope); + }, + + execCommand : function(scope, cmd, ui, value, args) { + if (cmd = execCommands[cmd.toLowerCase()]) { + if (cmd.func.call(scope || cmd.scope, ui, value, args) !== false) + return true; + } + }, + + queryCommandValue : function() { + if (cmd = queryValueCommands[cmd.toLowerCase()]) + return cmd.func.call(scope || cmd.scope, ui, value, args); + }, + + queryCommandState : function() { + if (cmd = queryStateCommands[cmd.toLowerCase()]) + return cmd.func.call(scope || cmd.scope, ui, value, args); + } + }); + }; + + tinymce.GlobalCommands = new CommandManager(); +})(tinymce); +(function(tinymce) { + tinymce.Formatter = function(ed) { + var formats = {}, + each = tinymce.each, + dom = ed.dom, + selection = ed.selection, + TreeWalker = tinymce.dom.TreeWalker, + rangeUtils = new tinymce.dom.RangeUtils(dom), + isValid = ed.schema.isValid, + isBlock = dom.isBlock, + forcedRootBlock = ed.settings.forced_root_block, + nodeIndex = dom.nodeIndex, + INVISIBLE_CHAR = '\uFEFF', + MCE_ATTR_RE = /^(src|href|style)$/, + FALSE = false, + TRUE = true, + undefined, + pendingFormats = {apply : [], remove : []}; + + function isArray(obj) { + return obj instanceof Array; + }; + + function getParents(node, selector) { + return dom.getParents(node, selector, dom.getRoot()); + }; + + function isCaretNode(node) { + return node.nodeType === 1 && (node.face === 'mceinline' || node.style.fontFamily === 'mceinline'); + }; + + // Public functions + + function get(name) { + return name ? formats[name] : formats; + }; + + function register(name, format) { + if (name) { + if (typeof(name) !== 'string') { + each(name, function(format, name) { + register(name, format); + }); + } else { + // Force format into array and add it to internal collection + format = format.length ? format : [format]; + + each(format, function(format) { + // Set deep to false by default on selector formats this to avoid removing + // alignment on images inside paragraphs when alignment is changed on paragraphs + if (format.deep === undefined) + format.deep = !format.selector; + + // Default to true + if (format.split === undefined) + format.split = !format.selector || format.inline; + + // Default to true + if (format.remove === undefined && format.selector && !format.inline) + format.remove = 'none'; + + // Mark format as a mixed format inline + block level + if (format.selector && format.inline) { + format.mixed = true; + format.block_expand = true; + } + + // Split classes if needed + if (typeof(format.classes) === 'string') + format.classes = format.classes.split(/\s+/); + }); + + formats[name] = format; + } + } + }; + + function apply(name, vars, node) { + var formatList = get(name), format = formatList[0], bookmark, rng, i; + + function moveStart(rng) { + var container = rng.startContainer, + offset = rng.startOffset, + walker, node; + + // Move startContainer/startOffset in to a suitable node + if (container.nodeType == 1 || container.nodeValue === "") { + container = container.nodeType == 1 ? container.childNodes[offset] : container; + + // Might fail if the offset is behind the last element in it's container + if (container) { + walker = new TreeWalker(container, container.parentNode); + for (node = walker.current(); node; node = walker.next()) { + if (node.nodeType == 3 && !isWhiteSpaceNode(node)) { + rng.setStart(node, 0); + break; + } + } + } + } + + return rng; + }; + + function setElementFormat(elm, fmt) { + fmt = fmt || format; + + if (elm) { + each(fmt.styles, function(value, name) { + dom.setStyle(elm, name, replaceVars(value, vars)); + }); + + each(fmt.attributes, function(value, name) { + dom.setAttrib(elm, name, replaceVars(value, vars)); + }); + + each(fmt.classes, function(value) { + value = replaceVars(value, vars); + + if (!dom.hasClass(elm, value)) + dom.addClass(elm, value); + }); + } + }; + + function applyRngStyle(rng) { + var newWrappers = [], wrapName, wrapElm; + + // Setup wrapper element + wrapName = format.inline || format.block; + wrapElm = dom.create(wrapName); + setElementFormat(wrapElm); + + rangeUtils.walk(rng, function(nodes) { + var currentWrapElm; + + function process(node) { + var nodeName = node.nodeName.toLowerCase(), parentName = node.parentNode.nodeName.toLowerCase(), found; + + // Stop wrapping on br elements + if (isEq(nodeName, 'br')) { + currentWrapElm = 0; + + // Remove any br elements when we wrap things + if (format.block) + dom.remove(node); + + return; + } + + // If node is wrapper type + if (format.wrapper && matchNode(node, name, vars)) { + currentWrapElm = 0; + return; + } + + // Can we rename the block + if (format.block && !format.wrapper && isTextBlock(nodeName)) { + node = dom.rename(node, wrapName); + setElementFormat(node); + newWrappers.push(node); + currentWrapElm = 0; + return; + } + + // Handle selector patterns + if (format.selector) { + // Look for matching formats + each(formatList, function(format) { + if (dom.is(node, format.selector) && !isCaretNode(node)) { + setElementFormat(node, format); + found = true; + } + }); + + // Continue processing if a selector match wasn't found and a inline element is defined + if (!format.inline || found) { + currentWrapElm = 0; + return; + } + } + + // Is it valid to wrap this item + if (isValid(wrapName, nodeName) && isValid(parentName, wrapName)) { + // Start wrapping + if (!currentWrapElm) { + // Wrap the node + currentWrapElm = wrapElm.cloneNode(FALSE); + node.parentNode.insertBefore(currentWrapElm, node); + newWrappers.push(currentWrapElm); + } + + currentWrapElm.appendChild(node); + } else { + // Start a new wrapper for possible children + currentWrapElm = 0; + + each(tinymce.grep(node.childNodes), process); + + // End the last wrapper + currentWrapElm = 0; + } + }; + + // Process siblings from range + each(nodes, process); + }); + + // Cleanup + each(newWrappers, function(node) { + var childCount; + + function getChildCount(node) { + var count = 0; + + each(node.childNodes, function(node) { + if (!isWhiteSpaceNode(node) && !isBookmarkNode(node)) + count++; + }); + + return count; + }; + + function mergeStyles(node) { + var child, clone; + + each(node.childNodes, function(node) { + if (node.nodeType == 1 && !isBookmarkNode(node) && !isCaretNode(node)) { + child = node; + return FALSE; // break loop + } + }); + + // If child was found and of the same type as the current node + if (child && matchName(child, format)) { + clone = child.cloneNode(FALSE); + setElementFormat(clone); + + dom.replace(clone, node, TRUE); + dom.remove(child, 1); + } + + return clone || node; + }; + + childCount = getChildCount(node); + + // Remove empty nodes + if (childCount === 0) { + dom.remove(node, 1); + return; + } + + if (format.inline || format.wrapper) { + // Merges the current node with it's children of similar type to reduce the number of elements + if (!format.exact && childCount === 1) + node = mergeStyles(node); + + // Remove/merge children + each(formatList, function(format) { + // Merge all children of similar type will move styles from child to parent + // this: text + // will become: text + each(dom.select(format.inline, node), function(child) { + removeFormat(format, vars, child, format.exact ? child : null); + }); + }); + + // Remove child if direct parent is of same type + if (matchNode(node.parentNode, name, vars)) { + dom.remove(node, 1); + node = 0; + return TRUE; + } + + // Look for parent with similar style format + if (format.merge_with_parents) { + dom.getParent(node.parentNode, function(parent) { + if (matchNode(parent, name, vars)) { + dom.remove(node, 1); + node = 0; + return TRUE; + } + }); + } + + // Merge next and previous siblings if they are similar texttext becomes texttext + if (node) { + node = mergeSiblings(getNonWhiteSpaceSibling(node), node); + node = mergeSiblings(node, getNonWhiteSpaceSibling(node, TRUE)); + } + } + }); + }; + + if (format) { + if (node) { + rng = dom.createRng(); + + rng.setStartBefore(node); + rng.setEndAfter(node); + + applyRngStyle(expandRng(rng, formatList)); + } else { + if (!selection.isCollapsed() || !format.inline) { + // Apply formatting to selection + bookmark = selection.getBookmark(); + applyRngStyle(expandRng(selection.getRng(TRUE), formatList)); + + selection.moveToBookmark(bookmark); + selection.setRng(moveStart(selection.getRng(TRUE))); + ed.nodeChanged(); + } else + performCaretAction('apply', name, vars); + } + } + }; + + function remove(name, vars, node) { + var formatList = get(name), format = formatList[0], bookmark, i, rng; + + function moveStart(rng) { + var container = rng.startContainer, + offset = rng.startOffset, + walker, node, nodes, tmpNode; + + // Convert text node into index if possible + if (container.nodeType == 3 && offset >= container.nodeValue.length - 1) { + container = container.parentNode; + offset = nodeIndex(container) + 1; + } + + // Move startContainer/startOffset in to a suitable node + if (container.nodeType == 1) { + nodes = container.childNodes; + container = nodes[Math.min(offset, nodes.length - 1)]; + walker = new TreeWalker(container); + + // If offset is at end of the parent node walk to the next one + if (offset > nodes.length - 1) + walker.next(); + + for (node = walker.current(); node; node = walker.next()) { + if (node.nodeType == 3 && !isWhiteSpaceNode(node)) { + // IE has a "neat" feature where it moves the start node into the closest element + // we can avoid this by inserting an element before it and then remove it after we set the selection + tmpNode = dom.create('a', null, INVISIBLE_CHAR); + node.parentNode.insertBefore(tmpNode, node); + + // Set selection and remove tmpNode + rng.setStart(node, 0); + selection.setRng(rng); + dom.remove(tmpNode); + + return; + } + } + } + }; + + // Merges the styles for each node + function process(node) { + var children, i, l; + + // Grab the children first since the nodelist might be changed + children = tinymce.grep(node.childNodes); + + // Process current node + for (i = 0, l = formatList.length; i < l; i++) { + if (removeFormat(formatList[i], vars, node, node)) + break; + } + + // Process the children + if (format.deep) { + for (i = 0, l = children.length; i < l; i++) + process(children[i]); + } + }; + + function findFormatRoot(container) { + var formatRoot; + + // Find format root + each(getParents(container.parentNode).reverse(), function(parent) { + var format; + + // Find format root element + if (!formatRoot && parent.id != '_start' && parent.id != '_end') { + // Is the node matching the format we are looking for + format = matchNode(parent, name, vars); + if (format && format.split !== false) + formatRoot = parent; + } + }); + + return formatRoot; + }; + + function wrapAndSplit(format_root, container, target, split) { + var parent, clone, lastClone, firstClone, i, formatRootParent; + + // Format root found then clone formats and split it + if (format_root) { + formatRootParent = format_root.parentNode; + + for (parent = container.parentNode; parent && parent != formatRootParent; parent = parent.parentNode) { + clone = parent.cloneNode(FALSE); + + for (i = 0; i < formatList.length; i++) { + if (removeFormat(formatList[i], vars, clone, clone)) { + clone = 0; + break; + } + } + + // Build wrapper node + if (clone) { + if (lastClone) + clone.appendChild(lastClone); + + if (!firstClone) + firstClone = clone; + + lastClone = clone; + } + } + + // Never split block elements if the format is mixed + if (split && (!format.mixed || !isBlock(format_root))) + container = dom.split(format_root, container); + + // Wrap container in cloned formats + if (lastClone) { + target.parentNode.insertBefore(lastClone, target); + firstClone.appendChild(target); + } + } + + return container; + }; + + function splitToFormatRoot(container) { + return wrapAndSplit(findFormatRoot(container), container, container, true); + }; + + function unwrap(start) { + var node = dom.get(start ? '_start' : '_end'), + out = node[start ? 'firstChild' : 'lastChild']; + + // If the end is placed within the start the result will be removed + // So this checks if the out node is a bookmark node if it is it + // checks for another more suitable node + if (isBookmarkNode(out)) + out = out[start ? 'firstChild' : 'lastChild']; + + dom.remove(node, true); + + return out; + }; + + function removeRngStyle(rng) { + var startContainer, endContainer; + + rng = expandRng(rng, formatList, TRUE); + + if (format.split) { + startContainer = getContainer(rng, TRUE); + endContainer = getContainer(rng); + + if (startContainer != endContainer) { + // Wrap start/end nodes in span element since these might be cloned/moved + startContainer = wrap(startContainer, 'span', {id : '_start', _mce_type : 'bookmark'}); + endContainer = wrap(endContainer, 'span', {id : '_end', _mce_type : 'bookmark'}); + + // Split start/end + splitToFormatRoot(startContainer); + splitToFormatRoot(endContainer); + + // Unwrap start/end to get real elements again + startContainer = unwrap(TRUE); + endContainer = unwrap(); + } else + startContainer = endContainer = splitToFormatRoot(startContainer); + + // Update range positions since they might have changed after the split operations + rng.startContainer = startContainer.parentNode; + rng.startOffset = nodeIndex(startContainer); + rng.endContainer = endContainer.parentNode; + rng.endOffset = nodeIndex(endContainer) + 1; + } + + // Remove items between start/end + rangeUtils.walk(rng, function(nodes) { + each(nodes, function(node) { + process(node); + }); + }); + }; + + // Handle node + if (node) { + rng = dom.createRng(); + rng.setStartBefore(node); + rng.setEndAfter(node); + removeRngStyle(rng); + return; + } + + if (!selection.isCollapsed() || !format.inline) { + bookmark = selection.getBookmark(); + removeRngStyle(selection.getRng(TRUE)); + selection.moveToBookmark(bookmark); + + // Check if start element still has formatting then we are at: "text|text" and need to move the start into the next text node + if (match(name, vars, selection.getStart())) { + moveStart(selection.getRng(true)); + } + + ed.nodeChanged(); + } else + performCaretAction('remove', name, vars); + }; + + function toggle(name, vars, node) { + if (match(name, vars, node)) + remove(name, vars, node); + else + apply(name, vars, node); + }; + + function matchNode(node, name, vars, similar) { + var formatList = get(name), format, i, classes; + + function matchItems(node, format, item_name) { + var key, value, items = format[item_name], i; + + // Check all items + if (items) { + // Non indexed object + if (items.length === undefined) { + for (key in items) { + if (items.hasOwnProperty(key)) { + if (item_name === 'attributes') + value = dom.getAttrib(node, key); + else + value = getStyle(node, key); + + if (similar && !value && !format.exact) + return; + + if ((!similar || format.exact) && !isEq(value, replaceVars(items[key], vars))) + return; + } + } + } else { + // Only one match needed for indexed arrays + for (i = 0; i < items.length; i++) { + if (item_name === 'attributes' ? dom.getAttrib(node, items[i]) : getStyle(node, items[i])) + return format; + } + } + } + + return format; + }; + + if (formatList && node) { + // Check each format in list + for (i = 0; i < formatList.length; i++) { + format = formatList[i]; + + // Name name, attributes, styles and classes + if (matchName(node, format) && matchItems(node, format, 'attributes') && matchItems(node, format, 'styles')) { + // Match classes + if (classes = format.classes) { + for (i = 0; i < classes.length; i++) { + if (!dom.hasClass(node, classes[i])) + return; + } + } + + return format; + } + } + } + }; + + function match(name, vars, node) { + var startNode, i; + + function matchParents(node) { + // Find first node with similar format settings + node = dom.getParent(node, function(node) { + return !!matchNode(node, name, vars, true); + }); + + // Do an exact check on the similar format element + return matchNode(node, name, vars); + }; + + // Check specified node + if (node) + return matchParents(node); + + // Check pending formats + if (selection.isCollapsed()) { + for (i = pendingFormats.apply.length - 1; i >= 0; i--) { + if (pendingFormats.apply[i].name == name) + return true; + } + + for (i = pendingFormats.remove.length - 1; i >= 0; i--) { + if (pendingFormats.remove[i].name == name) + return false; + } + + return matchParents(selection.getNode()); + } + + // Check selected node + node = selection.getNode(); + if (matchParents(node)) + return TRUE; + + // Check start node if it's different + startNode = selection.getStart(); + if (startNode != node) { + if (matchParents(startNode)) + return TRUE; + } + + return FALSE; + }; + + function matchAll(names, vars) { + var startElement, matchedFormatNames = [], checkedMap = {}, i, ni, name; + + // If the selection is collapsed then check pending formats + if (selection.isCollapsed()) { + for (ni = 0; ni < names.length; ni++) { + // If the name is to be removed, then stop it from being added + for (i = pendingFormats.remove.length - 1; i >= 0; i--) { + name = names[ni]; + + if (pendingFormats.remove[i].name == name) { + checkedMap[name] = true; + break; + } + } + } + + // If the format is to be applied + for (i = pendingFormats.apply.length - 1; i >= 0; i--) { + for (ni = 0; ni < names.length; ni++) { + name = names[ni]; + + if (!checkedMap[name] && pendingFormats.apply[i].name == name) { + checkedMap[name] = true; + matchedFormatNames.push(name); + } + } + } + } + + // Check start of selection for formats + startElement = selection.getStart(); + dom.getParent(startElement, function(node) { + var i, name; + + for (i = 0; i < names.length; i++) { + name = names[i]; + + if (!checkedMap[name] && matchNode(node, name, vars)) { + checkedMap[name] = true; + matchedFormatNames.push(name); + } + } + }); + + return matchedFormatNames; + }; + + function canApply(name) { + var formatList = get(name), startNode, parents, i, x, selector; + + if (formatList) { + startNode = selection.getStart(); + parents = getParents(startNode); + + for (x = formatList.length - 1; x >= 0; x--) { + selector = formatList[x].selector; + + // Format is not selector based, then always return TRUE + if (!selector) + return TRUE; + + for (i = parents.length - 1; i >= 0; i--) { + if (dom.is(parents[i], selector)) + return TRUE; + } + } + } + + return FALSE; + }; + + // Expose to public + tinymce.extend(this, { + get : get, + register : register, + apply : apply, + remove : remove, + toggle : toggle, + match : match, + matchAll : matchAll, + matchNode : matchNode, + canApply : canApply + }); + + // Private functions + + function matchName(node, format) { + // Check for inline match + if (isEq(node, format.inline)) + return TRUE; + + // Check for block match + if (isEq(node, format.block)) + return TRUE; + + // Check for selector match + if (format.selector) + return dom.is(node, format.selector); + }; + + function isEq(str1, str2) { + str1 = str1 || ''; + str2 = str2 || ''; + + str1 = '' + (str1.nodeName || str1); + str2 = '' + (str2.nodeName || str2); + + return str1.toLowerCase() == str2.toLowerCase(); + }; + + function getStyle(node, name) { + var styleVal = dom.getStyle(node, name); + + // Force the format to hex + if (name == 'color' || name == 'backgroundColor') + styleVal = dom.toHex(styleVal); + + // Opera will return bold as 700 + if (name == 'fontWeight' && styleVal == 700) + styleVal = 'bold'; + + return '' + styleVal; + }; + + function replaceVars(value, vars) { + if (typeof(value) != "string") + value = value(vars); + else if (vars) { + value = value.replace(/%(\w+)/g, function(str, name) { + return vars[name] || str; + }); + } + + return value; + }; + + function isWhiteSpaceNode(node) { + return node && node.nodeType === 3 && /^([\s\r\n]+|)$/.test(node.nodeValue); + }; + + function wrap(node, name, attrs) { + var wrapper = dom.create(name, attrs); + + node.parentNode.insertBefore(wrapper, node); + wrapper.appendChild(node); + + return wrapper; + }; + + function expandRng(rng, format, remove) { + var startContainer = rng.startContainer, + startOffset = rng.startOffset, + endContainer = rng.endContainer, + endOffset = rng.endOffset, sibling, lastIdx; + + // This function walks up the tree if there is no siblings before/after the node + function findParentContainer(container, child_name, sibling_name, root) { + var parent, child; + + root = root || dom.getRoot(); + + for (;;) { + // Check if we can move up are we at root level or body level + parent = container.parentNode; + + // Stop expanding on block elements or root depending on format + if (parent == root || (!format[0].block_expand && isBlock(parent))) + return container; + + for (sibling = parent[child_name]; sibling && sibling != container; sibling = sibling[sibling_name]) { + if (sibling.nodeType == 1 && !isBookmarkNode(sibling)) + return container; + + if (sibling.nodeType == 3 && !isWhiteSpaceNode(sibling)) + return container; + } + + container = container.parentNode; + } + + return container; + }; + + // If index based start position then resolve it + if (startContainer.nodeType == 1 && startContainer.hasChildNodes()) { + lastIdx = startContainer.childNodes.length - 1; + startContainer = startContainer.childNodes[startOffset > lastIdx ? lastIdx : startOffset]; + + if (startContainer.nodeType == 3) + startOffset = 0; + } + + // If index based end position then resolve it + if (endContainer.nodeType == 1 && endContainer.hasChildNodes()) { + lastIdx = endContainer.childNodes.length - 1; + endContainer = endContainer.childNodes[endOffset > lastIdx ? lastIdx : endOffset - 1]; + + if (endContainer.nodeType == 3) + endOffset = endContainer.nodeValue.length; + } + + // Exclude bookmark nodes if possible + if (isBookmarkNode(startContainer.parentNode)) + startContainer = startContainer.parentNode; + + if (isBookmarkNode(startContainer)) + startContainer = startContainer.nextSibling || startContainer; + + if (isBookmarkNode(endContainer.parentNode)) + endContainer = endContainer.parentNode; + + if (isBookmarkNode(endContainer)) + endContainer = endContainer.previousSibling || endContainer; + + // Move start/end point up the tree if the leaves are sharp and if we are in different containers + // Example * becomes !: !

*texttext*

! + // This will reduce the number of wrapper elements that needs to be created + // Move start point up the tree + if (format[0].inline || format[0].block_expand) { + startContainer = findParentContainer(startContainer, 'firstChild', 'nextSibling'); + endContainer = findParentContainer(endContainer, 'lastChild', 'previousSibling'); + } + + // Expand start/end container to matching selector + if (format[0].selector && format[0].expand !== FALSE && !format[0].inline) { + function findSelectorEndPoint(container, sibling_name) { + var parents, i, y; + + if (container.nodeType == 3 && container.nodeValue.length == 0 && container[sibling_name]) + container = container[sibling_name]; + + parents = getParents(container); + for (i = 0; i < parents.length; i++) { + for (y = 0; y < format.length; y++) { + if (dom.is(parents[i], format[y].selector)) + return parents[i]; + } + } + + return container; + }; + + // Find new startContainer/endContainer if there is better one + startContainer = findSelectorEndPoint(startContainer, 'previousSibling'); + endContainer = findSelectorEndPoint(endContainer, 'nextSibling'); + } + + // Expand start/end container to matching block element or text node + if (format[0].block || format[0].selector) { + function findBlockEndPoint(container, sibling_name, sibling_name2) { + var node; + + // Expand to block of similar type + if (!format[0].wrapper) + node = dom.getParent(container, format[0].block); + + // Expand to first wrappable block element or any block element + if (!node) + node = dom.getParent(container.nodeType == 3 ? container.parentNode : container, isBlock); + + // Exclude inner lists from wrapping + if (node && format[0].wrapper) + node = getParents(node, 'ul,ol').reverse()[0] || node; + + // Didn't find a block element look for first/last wrappable element + if (!node) { + node = container; + + while (node[sibling_name] && !isBlock(node[sibling_name])) { + node = node[sibling_name]; + + // Break on BR but include it will be removed later on + // we can't remove it now since we need to check if it can be wrapped + if (isEq(node, 'br')) + break; + } + } + + return node || container; + }; + + // Find new startContainer/endContainer if there is better one + startContainer = findBlockEndPoint(startContainer, 'previousSibling'); + endContainer = findBlockEndPoint(endContainer, 'nextSibling'); + + // Non block element then try to expand up the leaf + if (format[0].block) { + if (!isBlock(startContainer)) + startContainer = findParentContainer(startContainer, 'firstChild', 'nextSibling'); + + if (!isBlock(endContainer)) + endContainer = findParentContainer(endContainer, 'lastChild', 'previousSibling'); + } + } + + // Setup index for startContainer + if (startContainer.nodeType == 1) { + startOffset = nodeIndex(startContainer); + startContainer = startContainer.parentNode; + } + + // Setup index for endContainer + if (endContainer.nodeType == 1) { + endOffset = nodeIndex(endContainer) + 1; + endContainer = endContainer.parentNode; + } + + // Return new range like object + return { + startContainer : startContainer, + startOffset : startOffset, + endContainer : endContainer, + endOffset : endOffset + }; + } + + function removeFormat(format, vars, node, compare_node) { + var i, attrs, stylesModified; + + // Check if node matches format + if (!matchName(node, format)) + return FALSE; + + // Should we compare with format attribs and styles + if (format.remove != 'all') { + // Remove styles + each(format.styles, function(value, name) { + value = replaceVars(value, vars); + + // Indexed array + if (typeof(name) === 'number') { + name = value; + compare_node = 0; + } + + if (!compare_node || isEq(getStyle(compare_node, name), value)) + dom.setStyle(node, name, ''); + + stylesModified = 1; + }); + + // Remove style attribute if it's empty + if (stylesModified && dom.getAttrib(node, 'style') == '') { + node.removeAttribute('style'); + node.removeAttribute('_mce_style'); + } + + // Remove attributes + each(format.attributes, function(value, name) { + var valueOut; + + value = replaceVars(value, vars); + + // Indexed array + if (typeof(name) === 'number') { + name = value; + compare_node = 0; + } + + if (!compare_node || isEq(dom.getAttrib(compare_node, name), value)) { + // Keep internal classes + if (name == 'class') { + value = dom.getAttrib(node, name); + if (value) { + // Build new class value where everything is removed except the internal prefixed classes + valueOut = ''; + each(value.split(/\s+/), function(cls) { + if (/mce\w+/.test(cls)) + valueOut += (valueOut ? ' ' : '') + cls; + }); + + // We got some internal classes left + if (valueOut) { + dom.setAttrib(node, name, valueOut); + return; + } + } + } + + // IE6 has a bug where the attribute doesn't get removed correctly + if (name == "class") + node.removeAttribute('className'); + + // Remove mce prefixed attributes + if (MCE_ATTR_RE.test(name)) + node.removeAttribute('_mce_' + name); + + node.removeAttribute(name); + } + }); + + // Remove classes + each(format.classes, function(value) { + value = replaceVars(value, vars); + + if (!compare_node || dom.hasClass(compare_node, value)) + dom.removeClass(node, value); + }); + + // Check for non internal attributes + attrs = dom.getAttribs(node); + for (i = 0; i < attrs.length; i++) { + if (attrs[i].nodeName.indexOf('_') !== 0) + return FALSE; + } + } + + // Remove the inline child if it's empty for example or + if (format.remove != 'none') { + removeNode(node, format); + return TRUE; + } + }; + + function removeNode(node, format) { + var parentNode = node.parentNode, rootBlockElm; + + if (format.block) { + if (!forcedRootBlock) { + function find(node, next, inc) { + node = getNonWhiteSpaceSibling(node, next, inc); + + return !node || (node.nodeName == 'BR' || isBlock(node)); + }; + + // Append BR elements if needed before we remove the block + if (isBlock(node) && !isBlock(parentNode)) { + if (!find(node, FALSE) && !find(node.firstChild, TRUE, 1)) + node.insertBefore(dom.create('br'), node.firstChild); + + if (!find(node, TRUE) && !find(node.lastChild, FALSE, 1)) + node.appendChild(dom.create('br')); + } + } else { + // Wrap the block in a forcedRootBlock if we are at the root of document + if (parentNode == dom.getRoot()) { + if (!format.list_block || !isEq(node, format.list_block)) { + each(tinymce.grep(node.childNodes), function(node) { + if (isValid(forcedRootBlock, node.nodeName.toLowerCase())) { + if (!rootBlockElm) + rootBlockElm = wrap(node, forcedRootBlock); + else + rootBlockElm.appendChild(node); + } else + rootBlockElm = 0; + }); + } + } + } + } + + // Never remove nodes that isn't the specified inline element if a selector is specified too + if (format.selector && format.inline && !isEq(format.inline, node)) + return; + + dom.remove(node, 1); + }; + + function getNonWhiteSpaceSibling(node, next, inc) { + if (node) { + next = next ? 'nextSibling' : 'previousSibling'; + + for (node = inc ? node : node[next]; node; node = node[next]) { + if (node.nodeType == 1 || !isWhiteSpaceNode(node)) + return node; + } + } + }; + + function isBookmarkNode(node) { + return node && node.nodeType == 1 && node.getAttribute('_mce_type') == 'bookmark'; + }; + + function mergeSiblings(prev, next) { + var marker, sibling, tmpSibling; + + function compareElements(node1, node2) { + // Not the same name + if (node1.nodeName != node2.nodeName) + return FALSE; + + function getAttribs(node) { + var attribs = {}; + + each(dom.getAttribs(node), function(attr) { + var name = attr.nodeName.toLowerCase(); + + // Don't compare internal attributes or style + if (name.indexOf('_') !== 0 && name !== 'style') + attribs[name] = dom.getAttrib(node, name); + }); + + return attribs; + }; + + function compareObjects(obj1, obj2) { + var value, name; + + for (name in obj1) { + // Obj1 has item obj2 doesn't have + if (obj1.hasOwnProperty(name)) { + value = obj2[name]; + + // Obj2 doesn't have obj1 item + if (value === undefined) + return FALSE; + + // Obj2 item has a different value + if (obj1[name] != value) + return FALSE; + + // Delete similar value + delete obj2[name]; + } + } + + // Check if obj 2 has something obj 1 doesn't have + for (name in obj2) { + // Obj2 has item obj1 doesn't have + if (obj2.hasOwnProperty(name)) + return FALSE; + } + + return TRUE; + }; + + // Attribs are not the same + if (!compareObjects(getAttribs(node1), getAttribs(node2))) + return FALSE; + + // Styles are not the same + if (!compareObjects(dom.parseStyle(dom.getAttrib(node1, 'style')), dom.parseStyle(dom.getAttrib(node2, 'style')))) + return FALSE; + + return TRUE; + }; + + // Check if next/prev exists and that they are elements + if (prev && next) { + function findElementSibling(node, sibling_name) { + for (sibling = node; sibling; sibling = sibling[sibling_name]) { + if (sibling.nodeType == 3 && !isWhiteSpaceNode(sibling)) + return node; + + if (sibling.nodeType == 1 && !isBookmarkNode(sibling)) + return sibling; + } + + return node; + }; + + // If previous sibling is empty then jump over it + prev = findElementSibling(prev, 'previousSibling'); + next = findElementSibling(next, 'nextSibling'); + + // Compare next and previous nodes + if (compareElements(prev, next)) { + // Append nodes between + for (sibling = prev.nextSibling; sibling && sibling != next;) { + tmpSibling = sibling; + sibling = sibling.nextSibling; + prev.appendChild(tmpSibling); + } + + // Remove next node + dom.remove(next); + + // Move children into prev node + each(tinymce.grep(next.childNodes), function(node) { + prev.appendChild(node); + }); + + return prev; + } + } + + return next; + }; + + function isTextBlock(name) { + return /^(h[1-6]|p|div|pre|address|dl|dt|dd)$/.test(name); + }; + + function getContainer(rng, start) { + var container, offset, lastIdx; + + container = rng[start ? 'startContainer' : 'endContainer']; + offset = rng[start ? 'startOffset' : 'endOffset']; + + if (container.nodeType == 1) { + lastIdx = container.childNodes.length - 1; + + if (!start && offset) + offset--; + + container = container.childNodes[offset > lastIdx ? lastIdx : offset]; + } + + return container; + }; + + function performCaretAction(type, name, vars) { + var i, currentPendingFormats = pendingFormats[type], + otherPendingFormats = pendingFormats[type == 'apply' ? 'remove' : 'apply']; + + function hasPending() { + return pendingFormats.apply.length || pendingFormats.remove.length; + }; + + function resetPending() { + pendingFormats.apply = []; + pendingFormats.remove = []; + }; + + function perform(caret_node) { + // Apply pending formats + each(pendingFormats.apply.reverse(), function(item) { + apply(item.name, item.vars, caret_node); + }); + + // Remove pending formats + each(pendingFormats.remove.reverse(), function(item) { + remove(item.name, item.vars, caret_node); + }); + + dom.remove(caret_node, 1); + resetPending(); + }; + + // Check if it already exists then ignore it + for (i = currentPendingFormats.length - 1; i >= 0; i--) { + if (currentPendingFormats[i].name == name) + return; + } + + currentPendingFormats.push({name : name, vars : vars}); + + // Check if it's in the other type, then remove it + for (i = otherPendingFormats.length - 1; i >= 0; i--) { + if (otherPendingFormats[i].name == name) + otherPendingFormats.splice(i, 1); + } + + // Pending apply or remove formats + if (hasPending()) { + ed.getDoc().execCommand('FontName', false, 'mceinline'); + pendingFormats.lastRng = selection.getRng(); + + // IE will convert the current word + each(dom.select('font,span'), function(node) { + var bookmark; + + if (isCaretNode(node)) { + bookmark = selection.getBookmark(); + perform(node); + selection.moveToBookmark(bookmark); + ed.nodeChanged(); + } + }); + + // Only register listeners once if we need to + if (!pendingFormats.isListening && hasPending()) { + pendingFormats.isListening = true; + + each('onKeyDown,onKeyUp,onKeyPress,onMouseUp'.split(','), function(event) { + ed[event].addToTop(function(ed, e) { + // Do we have pending formats and is the selection moved has moved + if (hasPending() && !tinymce.dom.RangeUtils.compareRanges(pendingFormats.lastRng, selection.getRng())) { + each(dom.select('font,span'), function(node) { + var textNode, rng; + + // Look for marker + if (isCaretNode(node)) { + textNode = node.firstChild; + + if (textNode) { + perform(node); + + rng = dom.createRng(); + rng.setStart(textNode, textNode.nodeValue.length); + rng.setEnd(textNode, textNode.nodeValue.length); + selection.setRng(rng); + ed.nodeChanged(); + } else + dom.remove(node); + } + }); + + // Always unbind and clear pending styles on keyup + if (e.type == 'keyup' || e.type == 'mouseup') + resetPending(); + } + }); + }); + } + } + }; + }; +})(tinymce); + +tinymce.onAddEditor.add(function(tinymce, ed) { + var filters, fontSizes, dom, settings = ed.settings; + + if (settings.inline_styles) { + fontSizes = tinymce.explode(settings.font_size_style_values); + + function replaceWithSpan(node, styles) { + dom.replace(dom.create('span', { + style : styles + }), node, 1); + }; + + filters = { + font : function(dom, node) { + replaceWithSpan(node, { + backgroundColor : node.style.backgroundColor, + color : node.color, + fontFamily : node.face, + fontSize : fontSizes[parseInt(node.size) - 1] + }); + }, + + u : function(dom, node) { + replaceWithSpan(node, { + textDecoration : 'underline' + }); + }, + + strike : function(dom, node) { + replaceWithSpan(node, { + textDecoration : 'line-through' + }); + } + }; + + function convert(editor, params) { + dom = editor.dom; + + if (settings.convert_fonts_to_spans) { + tinymce.each(dom.select('font,u,strike', params.node), function(node) { + filters[node.nodeName.toLowerCase()](ed.dom, node); + }); + } + }; + + ed.onPreProcess.add(convert); + + ed.onInit.add(function() { + ed.selection.onSetContent.add(convert); + }); + } +}); + diff --git a/web/libs/tiny_mce/utils/editable_selects.js b/web/libs/tiny_mce/utils/editable_selects.js new file mode 100644 index 0000000..fd943c0 --- /dev/null +++ b/web/libs/tiny_mce/utils/editable_selects.js @@ -0,0 +1,70 @@ +/** + * editable_selects.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +var TinyMCE_EditableSelects = { + editSelectElm : null, + + init : function() { + var nl = document.getElementsByTagName("select"), i, d = document, o; + + for (i=0; i'; + h += ' '; + + return h; +} + +function updateColor(img_id, form_element_id) { + document.getElementById(img_id).style.backgroundColor = document.forms[0].elements[form_element_id].value; +} + +function setBrowserDisabled(id, state) { + var img = document.getElementById(id); + var lnk = document.getElementById(id + "_link"); + + if (lnk) { + if (state) { + lnk.setAttribute("realhref", lnk.getAttribute("href")); + lnk.removeAttribute("href"); + tinyMCEPopup.dom.addClass(img, 'disabled'); + } else { + if (lnk.getAttribute("realhref")) + lnk.setAttribute("href", lnk.getAttribute("realhref")); + + tinyMCEPopup.dom.removeClass(img, 'disabled'); + } + } +} + +function getBrowserHTML(id, target_form_element, type, prefix) { + var option = prefix + "_" + type + "_browser_callback", cb, html; + + cb = tinyMCEPopup.getParam(option, tinyMCEPopup.getParam("file_browser_callback")); + + if (!cb) + return ""; + + html = ""; + html += ''; + html += ' '; + + return html; +} + +function openBrowser(img_id, target_form_element, type, option) { + var img = document.getElementById(img_id); + + if (img.className != "mceButtonDisabled") + tinyMCEPopup.openBrowser(target_form_element, type, option); +} + +function selectByValue(form_obj, field_name, value, add_custom, ignore_case) { + if (!form_obj || !form_obj.elements[field_name]) + return; + + var sel = form_obj.elements[field_name]; + + var found = false; + for (var i=0; i parseInt(v)) + st = this.mark(f, n); + } + } + + return st; + }, + + hasClass : function(n, c, d) { + return new RegExp('\\b' + c + (d ? '[0-9]+' : '') + '\\b', 'g').test(n.className); + }, + + getNum : function(n, c) { + c = n.className.match(new RegExp('\\b' + c + '([0-9]+)\\b', 'g'))[0]; + c = c.replace(/[^0-9]/g, ''); + + return c; + }, + + addClass : function(n, c, b) { + var o = this.removeClass(n, c); + n.className = b ? c + (o != '' ? (' ' + o) : '') : (o != '' ? (o + ' ') : '') + c; + }, + + removeClass : function(n, c) { + c = n.className.replace(new RegExp("(^|\\s+)" + c + "(\\s+|$)"), ' '); + return n.className = c != ' ' ? c : ''; + }, + + tags : function(f, s) { + return f.getElementsByTagName(s); + }, + + mark : function(f, n) { + var s = this.settings; + + this.addClass(n, s.invalid_cls); + this.markLabels(f, n, s.invalid_cls); + + return false; + }, + + markLabels : function(f, n, ic) { + var nl, i; + + nl = this.tags(f, "label"); + for (i=0; i + + + out_file("views/head.php"); ?> + + + + + +
+
+out_file("views/header.php"); ?> +
+
+ +
+
+ +
+out_file("views/admin/colonne.php"); ?> +
+ +
+out_file("views/messages.php"); ?> +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> +
+ +
+ +
+
+ +
+
+out_file("views/footer.php"); ?> +
+
+ + + diff --git a/web/out/dist/compte.php b/web/out/dist/compte.php new file mode 100644 index 0000000..604a9ca --- /dev/null +++ b/web/out/dist/compte.php @@ -0,0 +1,44 @@ + + + + out_file("views/head.php"); ?> + + + + + +
+
+out_file("views/header.php"); ?> +
+
+ +
+
+ +
+out_file("views/users/colonne.php"); ?> +
+ +
+out_file("views/messages.php"); ?> +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> +
+ +
+ +
+
+ +
+
+out_file("views/footer.php"); ?> +
+
+ + + diff --git a/web/out/dist/config.xml b/web/out/dist/config.xml new file mode 100644 index 0000000..a50ddb4 --- /dev/null +++ b/web/out/dist/config.xml @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/out/dist/content.php b/web/out/dist/content.php new file mode 100644 index 0000000..99f10d3 --- /dev/null +++ b/web/out/dist/content.php @@ -0,0 +1,5 @@ +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> \ No newline at end of file diff --git a/web/out/dist/css/actions/admin.css b/web/out/dist/css/actions/admin.css new file mode 100644 index 0000000..ea51ffe --- /dev/null +++ b/web/out/dist/css/actions/admin.css @@ -0,0 +1,199 @@ +table.admin +{ width: 100%; +} + +table.admin tr.hl td +{ padding: 3px; +} + +table.admin td.action +{ text-align: center; + width: 50px; +} + +ul.admin +{ list-style-type: none; + margin: 10px 10px 20px 10px; + text-align: right; + padding-bottom: 10px; +} + +ul.admin li +{ display: inline; +} + +ul.admin li a +{ padding: 3px 7px 3px 7px; +} + +ul li a.add +{ padding: 3px 7px 3px 18px; +} + +ul.admin li.admin_form_title +{ display: block; + float: left; + padding: 0px 7px 3px 7px; +} + +ul.form +{ clear: both; + list-style-type: none; +} + +ul.form li +{ clear: both; + padding: 5px; +} + +ul.form li label +{ float: left; + display: block; + width: 100px; + text-align: right; + padding: 0 15px 0 15px; +} + +ul.form li div p +{ float: left; + display: block; + width: 350px; + text-align: left; + padding: 0 0px 15px 0px; +} + +ul.form li p span +{ display: block; + padding: 5px; + font-size: 0.9em; +} + +ul.admin_form_head +{ clear: both; + list-style-type: none; + margin: 10px 0px 0px 0px; +} + +ul.admin_form_head li +{ clear: both; + padding: 5px; + text-align: right; + line-height: 20px; +} + +ul.admin_form_head li input +{ margin: 0px 10px 0px 10px; +} + +ul.admin_form_content +{ list-style-type: none; + margin: 0px 0px 0px 0px; + padding: 10px 0px 10px 0px; +} + +ul.admin_form_content ul.admin +{ list-style-type: none; + margin: 10px 10px 20px 10px; + text-align: right; + padding-bottom: 10px; +} + +ul.admin_form_content ul.admin li +{ display: inline; +} + +ul.admin_form_content ul.admin li a +{ padding: 3px 7px 3px 7px; +} + +ul.admin_form_content ul li a.add +{ padding: 3px 7px 3px 18px; +} + +ul.admin_form_content ul.admin li.admin_form_title +{ display: block; + float: left; + padding: 0px 7px 3px 7px; +} + +.admin_source_infos +{ margin: 0px 10px 10px 20px; +} + +.admin_source_infos ul.admin_source_head +{ list-style-type: none; + margin: 0px 0px 0px 0px; + text-align: right; + padding-bottom: 10px; + padding-top: 5px; +} + +ul.admin_source_head li +{ display: inline; +} + +ul.admin_source_head li a +{ padding: 3px 7px 3px 7px; +} + +ul.admin_source_head li.admin_form_title +{ display: block; + float: left; + padding: 0px 7px 3px 7px; + font-size: 1.2em; +} + +.admin_source_url +{ margin: 10px 0px 0px 20px; +} + +input[type=text], input[type=file], input[type=password], textarea, select +{ padding: 3px; +} + +input[type=submit], a.button +{ padding: 3px 7px 3px 7px; + cursor: pointer; +} + +ul.form li.buttons +{ text-align: center; +} + +.tinymce +{ width: 500px; + height: 400px; +} + +.document +{ margin: 5px; + padding: 5px; +} + +.document .delete +{ float: right; +} + +.document .clear +{ height: 5px; +} + +.xml_edit_content +{ display: block; + margin: 5px 10px 30px 0px; + text-align: right; +} + +.xml_edit_content textarea +{ width: 97%; +} + +ul.xml_infos +{ margin: 10px 10px 0px 20px; +} + +ul.xml_infos li +{ padding: 5px; + margin: 0px 0px 0px 20px; +} + diff --git a/web/out/dist/css/actions/admin_plugins.css b/web/out/dist/css/actions/admin_plugins.css new file mode 100644 index 0000000..e899c45 --- /dev/null +++ b/web/out/dist/css/actions/admin_plugins.css @@ -0,0 +1,32 @@ +ul.plugins +{ list-style-type: none; + margin: 20px 10px; +} + +ul.plugins li +{ padding: 5px 10px; + margin: 10px; +} + +ul.plugins p.folder +{ float: right; + font-size: 0.9em; +} + +ul.plugins li ul.plugin_links +{ text-align: right; +} + +ul.plugins li ul.plugin_links li +{ display: inline; + padding: 1px 7px; + margin: 0; +} + +ul.plugins li ul.plugin_links li input +{ width: 2em; +} + +ul.plugins li.buttons +{ text-align: right; +} \ No newline at end of file diff --git a/web/out/dist/css/actions/forms_contact.css b/web/out/dist/css/actions/forms_contact.css new file mode 100644 index 0000000..b59c801 --- /dev/null +++ b/web/out/dist/css/actions/forms_contact.css @@ -0,0 +1,32 @@ +@import url("admin.css"); + +#contact form +{ margin: 20px 0px 10px 0px; +} + +#contact form .ptitcaptcha img +{ float: left; + margin: 0px 10px 0px 0px; +} + +#contact ul.form li label +{ float: left; + display: block; + width: 50px; + text-align: right; + padding: 0 15px 0 15px; +} + +#contact ul.form li p +{ float: left; + display: block; + width: 380px; + text-align: left; + padding: 0 15px 5px 15px; +} + +#contact ul.form li p span +{ display: block; + padding: 5px; + font-size: 0.9em; +} \ No newline at end of file diff --git a/web/out/dist/css/actions/users.css b/web/out/dist/css/actions/users.css new file mode 100644 index 0000000..c7f8d13 --- /dev/null +++ b/web/out/dist/css/actions/users.css @@ -0,0 +1 @@ +@import url("admin.css"); diff --git a/web/out/dist/css/colorbox.css b/web/out/dist/css/colorbox.css new file mode 100644 index 0000000..c31b237 --- /dev/null +++ b/web/out/dist/css/colorbox.css @@ -0,0 +1,92 @@ +/* + ColorBox Core Style: + The following CSS is consistent between example themes and should not be altered. +*/ +#colorbox, #cboxOverlay, #cboxWrapper{position:absolute; top:0; left:0; z-index:9999; overflow:hidden;} +#cboxOverlay{position:fixed; width:100%; height:100%;} +#cboxMiddleLeft, #cboxBottomLeft{clear:left;} +#cboxContent{position:relative;} +#cboxLoadedContent{overflow:auto;} +#cboxTitle{margin:0;} +#cboxLoadingOverlay, #cboxLoadingGraphic{position:absolute; top:0; left:0; width:100%;} +#cboxPrevious, #cboxNext, #cboxClose, #cboxSlideshow{cursor:pointer;} +.cboxPhoto{float:left; margin:auto; border:0; display:block;} +.cboxIframe{width:100%; height:100%; display:block; border:0;} + +/* + User Style: + Change the following styles to modify the appearance of ColorBox. They are + ordered & tabbed in a way that represents the nesting of the generated HTML. +*/ +#cboxOverlay{background:url(../images/colorbox/overlay.png) repeat 0 0;} +#colorbox{} +/* + #cboxTopLeft{width:21px; height:21px; background:url(../images/colorbox/controls.png) no-repeat -100px 0;} + #cboxTopRight{width:21px; height:21px; background:url(../images/colorbox/controls.png) no-repeat -129px 0;} + #cboxBottomLeft{width:21px; height:21px; background:url(../images/colorbox/controls.png) no-repeat -100px -29px;} + #cboxBottomRight{width:21px; height:21px; background:url(../images/colorbox/controls.png) no-repeat -129px -29px;} + #cboxMiddleLeft{width:21px; background:url(../images/colorbox/controls.png) left top repeat-y;} + #cboxMiddleRight{width:21px; background:url(../images/colorbox/controls.png) right top repeat-y;} + #cboxTopCenter{height:21px; background:url(../images/colorbox/border.png) 0 0 repeat-x;} + #cboxBottomCenter{height:21px; background:url(../images/colorbox/border.png) 0 -29px repeat-x;} +*/ + #cboxTopLeft{width:21px; height:21px;} + #cboxTopRight{width:21px; height:21px;} + #cboxBottomLeft{width:21px; height:21px;} + #cboxBottomRight{width:21px; height:21px;} + #cboxMiddleLeft{width:21px;} + #cboxMiddleRight{width:21px;} + #cboxTopCenter{height:21px;} + #cboxBottomCenter{height:21px;} + #cboxContent{background:#ffffff; overflow:hidden; color: #555555; padding: 10px 10px 0px 10px; border-radius: 3px 3px 3px 3px; -moz-border-radius: 3px 3px 3px 3px;} + #cboxError{padding:50px; border:1px solid #ccc;} + #cboxLoadedContent{margin-bottom:28px;} + #cboxTitle{position:absolute; bottom:4px; left:0; text-align:center; width:100%; color:#949494;} + #cboxCurrent{position:absolute; bottom:4px; left:58px; color:#949494;} + #cboxSlideshow{position:absolute; bottom:4px; right:30px; color:#0092ef;} + #cboxPrevious{position:absolute; bottom:0; left:0; background:url(../images/colorbox/controls.png) no-repeat -75px 0; width:25px; height:25px; text-indent:-9999px;} + #cboxPrevious.hover{background-position:-75px -25px;} + #cboxNext{position:absolute; bottom:0; left:27px; background:url(../images/colorbox/controls.png) no-repeat -50px 0; width:25px; height:25px; text-indent:-9999px;} + #cboxNext.hover{background-position:-50px -25px;} + #cboxLoadingOverlay{} + #cboxLoadingGraphic{background:url(../images/colorbox/loading.gif) no-repeat center center;} + #cboxClose{position:absolute; bottom:0; right:0; background:url(../images/colorbox/controls.png) no-repeat -25px 0; width:25px; height:25px; text-indent:-9999px;} + #cboxClose.hover{background-position:-25px -25px;} + +/* + The following fixes a problem where IE7+ replaces a PNG's alpha transparency with a black fill + when an alpha filter (opacity change) is set on the element or ancestor element. +*/ +.cboxIE #cboxTopLeft, +.cboxIE #cboxTopCenter, +.cboxIE #cboxTopRight, +.cboxIE #cboxBottomLeft, +.cboxIE #cboxBottomCenter, +.cboxIE #cboxBottomRight, +.cboxIE #cboxMiddleLeft, +.cboxIE #cboxMiddleRight { + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr=#00FFFFFF,endColorstr=#00FFFFFF); +} + +/* + The following provides PNG transparency support for IE6 +*/ +.cboxIE6 #cboxTopLeft{background:url(../images/colorbox/ie6/borderTopLeft.png);} +.cboxIE6 #cboxTopCenter{background:url(../images/colorbox/ie6/borderTopCenter.png);} +.cboxIE6 #cboxTopRight{background:url(../images/colorbox/ie6/borderTopRight.png);} +.cboxIE6 #cboxBottomLeft{background:url(../images/colorbox/ie6/borderBottomLeft.png);} +.cboxIE6 #cboxBottomCenter{background:url(../images/colorbox/ie6/borderBottomCenter.png);} +.cboxIE6 #cboxBottomRight{background:url(../images/colorbox/ie6/borderBottomRight.png);} +.cboxIE6 #cboxMiddleLeft{background:url(../images/colorbox/ie6/borderMiddleLeft.png);} +.cboxIE6 #cboxMiddleRight{background:url(../images/colorbox/ie6/borderMiddleRight.png);} + +.cboxIE6 #cboxTopLeft, +.cboxIE6 #cboxTopCenter, +.cboxIE6 #cboxTopRight, +.cboxIE6 #cboxBottomLeft, +.cboxIE6 #cboxBottomCenter, +.cboxIE6 #cboxBottomRight, +.cboxIE6 #cboxMiddleLeft, +.cboxIE6 #cboxMiddleRight { + _behavior: expression(this.src = this.src ? this.src : this.currentStyle.backgroundImage.split('"')[1], this.style.background = "none", this.style.filter = "progid:DXImageTransform.Microsoft.AlphaImageLoader(src=" + this.src + ", sizingMethod='scale')"); +} diff --git a/web/out/dist/css/colors.css b/web/out/dist/css/colors.css new file mode 100644 index 0000000..9b50de8 --- /dev/null +++ b/web/out/dist/css/colors.css @@ -0,0 +1,324 @@ +body +{ background-color: #ffffff; + color: #333333; +} + +a +{ text-decoration: none; + color: #000066; +} + +a img +{ border: none; +} + +a:hover +{ color: #c0c0c0; +} + +.navig +{ color: #333333; + border: solid 1px #c0c0c0; + background-color: #ffffff; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +.loading +{ background-image: url("../icons/ajax-loader.gif"); + background-repeat: no-repeat; + background-position: 5px 5px; +} + +/* ------------------------- messages --------------- */ + +.messages +{ border: solid 1px #c0c0c0; +} + +.erreur +{ border: solid 1px #c0c0c0; +} + +.redirect_message div +{ border: solid 1px #c0c0c0; +} + +/* ------------------------- blocs generaux --------- */ + +#header +{ padding-top: 10px; +} + +#header .content +{ border-bottom: solid 1px #d9d9d9; +} + +#colonne +{ /*border-right: dashed 1px #555555; */ +} + +#footer .content +{ border-top: solid 1px #e9e9e9; +} + +#footer .content p +{ color: #777777; +} + +/* ----------------------------------- menu top ----- */ + +#menu_top ul.menu li a +{ border: solid 1px #e9e9e9; + background-color: #ffffff; +} + +#menu_top ul.menu li ul li a +{ border-top: none; + border-right: solid 1px #333333; + border-bottom: none; + border-left: solid 1px #333333; + background-color: #050505; +} + +#menu_top ul.menu li ul li.last a +{ border-top: none; + border-right: solid 1px #333333; + border-bottom: solid 1px #333333; + border-left: solid 1px #333333; + background-color: #050505; +} + +/* ----------------------------------- admin --------- */ + +table.admin tr.hl td +{ border: solid 1px #d1d1d1; +} + +table.admin tr.hl:hover +{ background-color: #f9f9f9; +} + +input[type=text], input[type=file], input[type=password], textarea, select +{ border: solid 1px #999999; + color: #333333; +} + +input[type=submit], a.button +{ border: solid 1px #d1d1d1; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +input[type=submit]:hover, a.button:hover +{ border: solid 1px #d1d1d1; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +ul.admin +{ border-bottom: dashed 1px #c0c0c0; +} + +ul.admin_form_head +{ border: solid 1px #c0c0c0; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +ul.admin_form_content ul.admin +{ border-bottom: none; +} + +ul.admin li a +{ border: solid 1px #d1d1d1; +} + +.admin_source_infos ul.admin li a +{ border: none; + background-color: #101010; + color: #c0c0c0; +} + +ul.admin li a.add +{ background-image: url("../icons/add.gif"); + background-repeat: no-repeat; + background-position: 3px 6px; + border: solid 1px #d1d1d1; +} + +ul.admin li a:hover +{ +} + +.admin_source_infos +{ border: solid 1px #c0c0c0; +/* background-color: #0a0a0a;*/ + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +.admin_source_infos ul.admin li a:hover +{ border: none; + background-color: #333333; + color: #c0c0c0; +} + +#documents .document +{ border: solid 1px #c0c0c0; +} + +/* ------------------------------- plugins ----------- */ + +ul.plugins li +{ border: solid 1px #c0c0c0; +} + +ul.plugins li.enabled +{ background-color: #ffffff; +} + +ul.plugins li.disabled +{ background-color: #f7f7f7; +} + +ul.plugins li.uninstalled +{ background-color: #e5e5e5; +} + +ul.plugins li ul.plugin_links li +{ border-top: none; + border-right: none; + border-bottom: none; + border-left: solid 1px #c0c0c0; +} + +ul.plugins li ul.plugin_links li input +{ border: solid 1px #c0c0c0; +} + +/* ------------------------------- liste groupes ----------- */ + +ul.groupes li h4 a +{ border: solid 1px #d9d9d9; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +/* ------------------------------- page album ----------- */ + +p#play_all a +{ border: solid 1px #c0c0c0; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; + background-image: url("../icons/ecouter.png"); + background-repeat: no-repeat; + background-position: 6px 6px; + background-color: #ffffff; +} + +/* ----------------------------------- sources --------- */ + +ul.albums li a +{ border: solid 1px #555555; +} + +.logo_groupe +{ /*border: solid 1px #e9e9e9;*/ + background-color: #ffffff; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +ul#lien_contact li a +{ border-bottom: solid 1px #d9d9d9; +} + +#colonne ul#album_links +{ /*border-bottom: solid 1px #333333;*/ +} + +#colonne ul#album_links li +{ +} + +#colonne ul.menu_albums li +{ border: solid 1px #d9d9d9; + background-color: #ffffff; +} + +#center ul.menu_albums li +{ border: solid 1px #d9d9d9; + float: left; +} + +.track +{ border: solid 1px #ffffff; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +.track h5 +{ background-color: #ffffff; + border-radius: 3px 3px 0px 0px; + -moz-border-radius: 3px 3px 0px 0px; +} + +.playing_track +{ border: solid 1px #dedede; + background-color: #ffffff; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +.player_progress +{ background-color: #ececec; +} + +.player_progress .loaded +{ background-color: #dedede; +} + +.player_progress .position +{ background-color: #999999; +} + +.player_controls a img +{ border: none; +} + +.source_arbo ul.menu_source +{ float: right; + margin: 0px 10px 1px 0px; +} + +.source_arbo ul.menu_source li +{ float: right; + padding: 1px; +} + +.source_arbo ul.menu_source li a +{ display: block; + text-align: center; + background-color: #151515; + border-radius: 3px 3px 0px 0px; + -moz-border-radius: 3px 3px 0px 0px; + padding: 2px 5px 2px 5px; +} + +.source_arbo ul.menu_source li a:hover +{ +} + +.source_arbo ul.menu_source li.icon a +{ border: none; + padding: 2px 2px 2px 2px; +} + +.pistes +{ border-left: none; +} + +.derivation +{ border-left: none; +} diff --git a/web/out/dist/css/footer.css b/web/out/dist/css/footer.css new file mode 100644 index 0000000..d9393d4 --- /dev/null +++ b/web/out/dist/css/footer.css @@ -0,0 +1,12 @@ +#footer .content +{ height: 100px; +} + +#footer .content p +{ text-align: right; +} + +#footer .content p#a_propos_links +{ text-align: left; + float: left; +} diff --git a/web/out/dist/css/general.css b/web/out/dist/css/general.css new file mode 100644 index 0000000..dd3602e --- /dev/null +++ b/web/out/dist/css/general.css @@ -0,0 +1,70 @@ +body +{ font: normal 12px Verdana, Helvetica, Arial, sans-serif; +} + +ul +{ margin: 5px 5px 5px 15px; +} + +h1 +{ margin: 5px +} + +h2 +{ margin: 5px +} + +h2 span +{ font-weight: normal; + font-size: 0.8em; +} + +h3 +{ margin: 5px +} + +p +{ margin: 5px + text-align: justify; +} + +.messages +{ margin: 10px; + padding: 10px; +} + +.erreur +{ margin: 50px 100px 50px 100px; + padding: 20px; +} + +.redirect_message div +{ margin: 50px 100px 50px 100px; + padding: 20px; +} + +ul.list +{ margin: 5px 10px 10px 15px; +} + +ul.list li +{ margin: 5px 5px 5px 15px; + padding: 5px; +} + +.navig +{ text-align: right; + padding: 3px; + margin: 10px; +} + +.loading +{ margin: 5px 0px 10px 15px; + padding: 0px; + height: 40px; + width: 40px; +} + +.loading span +{ display: none; +} diff --git a/web/out/dist/css/header.css b/web/out/dist/css/header.css new file mode 100644 index 0000000..04b1324 --- /dev/null +++ b/web/out/dist/css/header.css @@ -0,0 +1,11 @@ +#header h1 +{ padding-top: 5px; + padding: 5px 0px 0px 0px; + margin: 0px; +} + +#header h1 a +{ text-decoration: none; + display: block; + padding: 10px; +} diff --git a/web/out/dist/css/main.css b/web/out/dist/css/main.css new file mode 100644 index 0000000..32abddb --- /dev/null +++ b/web/out/dist/css/main.css @@ -0,0 +1,32 @@ +#main .content +{ padding: 10px 0px 10px 0px; + width: 800px; +} + +#colonne +{ float: left; + width: 240px; + padding: 0px 0px 50px 0px; +} + +#center +{ float: left; + width: 540px; + padding: 10px; +} + +#center.no_colonne +{ width: 800px; +} + +#colonne ul.menu +{ margin-left: 15px; +} + +#colonne ul.menu li +{ margin-left: 15px; +} + +#colonne ul.navig_menu +{ margin-top: 20px; +} diff --git a/web/out/dist/css/menu_top.css b/web/out/dist/css/menu_top.css new file mode 100644 index 0000000..f751fef --- /dev/null +++ b/web/out/dist/css/menu_top.css @@ -0,0 +1,31 @@ +#menu_top ul.menu +{ margin: 5px 0px 0px 0px; + float: right; + position: relative; +} + +#menu_top ul.menu li +{ list-style-type: none; + margin-left: 15px; + float: left; +} + +#menu_top ul.menu li a +{ display: block; + padding: 5px 10px 5px 10px; +} + +#menu_top ul.menu li ul +{ position: absolute; + margin: 0px 0px 0px -15px; + z-index: 1; + display: none; +} + +#menu_top ul.menu li ul li +{ float: none; +} + +#menu_top ul.menu li ul li a +{ padding: 5px 10px 5px 10px; +} diff --git a/web/out/dist/css/style.css b/web/out/dist/css/style.css new file mode 100644 index 0000000..0eed589 --- /dev/null +++ b/web/out/dist/css/style.css @@ -0,0 +1,34 @@ +@import url("general.css"); +@import url("header.css"); +@import url("menu_top.css"); +@import url("main.css"); +@import url("footer.css"); + +* +{ margin: 0; + padding: 0; +} + +html +{ height: 100%; +} + +body +{ text-align: center; + height: 100%; +} + +pre, div { text-align: left; } + +.content +{ margin-left: auto; + margin-right: auto; + width: 800px; +} + +.clear +{ clear: both; + font-size: 0px; + line-height: 0px; + height: 0px; +} diff --git a/web/out/dist/css/tinymce.css b/web/out/dist/css/tinymce.css new file mode 100644 index 0000000..e892ebe --- /dev/null +++ b/web/out/dist/css/tinymce.css @@ -0,0 +1,3 @@ +body, td, pre +{ +} \ No newline at end of file diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png b/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png new file mode 100644 index 0000000..29460f0 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png b/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png new file mode 100644 index 0000000..64ece57 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png b/web/out/dist/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png new file mode 100644 index 0000000..abdc010 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png b/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png new file mode 100644 index 0000000..9b383f4 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png b/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png new file mode 100644 index 0000000..a23baad Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png b/web/out/dist/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png new file mode 100644 index 0000000..42ccba2 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png b/web/out/dist/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png new file mode 100644 index 0000000..39d5824 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png b/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png new file mode 100644 index 0000000..f127367 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png b/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png new file mode 100644 index 0000000..359397a Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-icons_222222_256x240.png b/web/out/dist/css/ui-lightness/images/ui-icons_222222_256x240.png new file mode 100644 index 0000000..b273ff1 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-icons_222222_256x240.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-icons_228ef1_256x240.png b/web/out/dist/css/ui-lightness/images/ui-icons_228ef1_256x240.png new file mode 100644 index 0000000..a641a37 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-icons_228ef1_256x240.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-icons_ef8c08_256x240.png b/web/out/dist/css/ui-lightness/images/ui-icons_ef8c08_256x240.png new file mode 100644 index 0000000..85e63e9 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-icons_ef8c08_256x240.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-icons_ffd27a_256x240.png b/web/out/dist/css/ui-lightness/images/ui-icons_ffd27a_256x240.png new file mode 100644 index 0000000..e117eff Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-icons_ffd27a_256x240.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-icons_ffffff_256x240.png b/web/out/dist/css/ui-lightness/images/ui-icons_ffffff_256x240.png new file mode 100644 index 0000000..42f8f99 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-icons_ffffff_256x240.png differ diff --git a/web/out/dist/css/ui-lightness/jquery-ui-1.8.12.custom.css b/web/out/dist/css/ui-lightness/jquery-ui-1.8.12.custom.css new file mode 100644 index 0000000..3f7bf90 --- /dev/null +++ b/web/out/dist/css/ui-lightness/jquery-ui-1.8.12.custom.css @@ -0,0 +1,578 @@ +/* + * jQuery UI CSS Framework 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; } +.ui-widget-content a { color: #333333; } +.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; } +.ui-widget-header a { color: #ffffff; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; } +.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); } +.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/* + * jQuery UI Resizable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; + /* http://bugs.jqueryui.com/ticket/7233 + - Resizable: resizable handles fail to work in IE if transparent and content overlaps + */ + background-image:url(data:); +} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.12 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Dialog 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Slider 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI Datepicker 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Progressbar 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/web/out/dist/functions.php b/web/out/dist/functions.php new file mode 100644 index 0000000..21ab7e9 --- /dev/null +++ b/web/out/dist/functions.php @@ -0,0 +1,80 @@ + $max) + { if(isset($legende)) + { $navig .= + $legende." ".($current + 1)." à " + .(($current + $max) > $total ? $total : $current + $max) + ." sur ".$total." - aller à la "; + } + $get_params = array(); + if(($q = strpos($base_url, "?")) !== false) + { $v_query = explode("&", substr($base_url, $q + 1)); + $base_url = substr($base_url, 0, $q); + foreach($v_query as $query) + { if($query) + { $v = explode("=", $query); + $get_params[$v[0]] = $v[1]; + } + } + } + if(isset($get_params[$start_param])) unset($get_params[$start_param]); + $base_url .= "?"; + foreach($get_params as $key => $value) $base_url .= $key."=".$value."&"; + $nb_pages = ceil($total / $max); + $navig .= + "page : " + ."\n"; + if($current >= $max) + { $navig .= + "«\n"; + } + if($current < $total - $max) + { $navig .= + "»\n"; + } + } + return $navig; + } + + function aff_date($date) + { if(preg_match("/([0-9]{2,4})-([0-9]{1,2})-([0-9]{1,2})/", $date, $regs)) + { $date = $regs[3]." ".mois($regs[2])." ".$regs[1]; + } + return $date; + } + + function mois($n) + { switch($n) + { case 1: $mois = "jan"; break; + case 2: $mois = "fev"; break; + case 3: $mois = "mars"; break; + case 4: $mois = "avr"; break; + case 5: $mois = "mai"; break; + case 6: $mois = "juin"; break; + case 7: $mois = "juil"; break; + case 8: $mois = "aout"; break; + case 9: $mois = "sept"; break; + case 10: $mois = "oct"; break; + case 11: $mois = "nov"; break; + case 12: $mois = "dec"; break; + default: $mois = $n; + } + return $mois; + } + +?> \ No newline at end of file diff --git a/web/out/dist/html_reponse.php b/web/out/dist/html_reponse.php new file mode 100644 index 0000000..80aa95a --- /dev/null +++ b/web/out/dist/html_reponse.php @@ -0,0 +1,32 @@ + + + + out_file("views/head.php"); ?> + + + +
+
+out_file("views/header.php"); ?> +
+
+ +
+
+out_file("views/messages.php"); ?> +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> +
+
+ +
+
+out_file("views/footer.php"); ?> +
+
+ + + diff --git a/web/out/dist/html_simple_reponse.php b/web/out/dist/html_simple_reponse.php new file mode 100644 index 0000000..4a63648 --- /dev/null +++ b/web/out/dist/html_simple_reponse.php @@ -0,0 +1,13 @@ + + + + + + +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> + + \ No newline at end of file diff --git a/web/out/dist/icons/add.gif b/web/out/dist/icons/add.gif new file mode 100644 index 0000000..a853e08 Binary files /dev/null and b/web/out/dist/icons/add.gif differ diff --git a/web/out/dist/icons/ajax-loader.gif b/web/out/dist/icons/ajax-loader.gif new file mode 100644 index 0000000..09d621e Binary files /dev/null and b/web/out/dist/icons/ajax-loader.gif differ diff --git a/web/out/dist/icons/asc.gif b/web/out/dist/icons/asc.gif new file mode 100644 index 0000000..8ea0713 Binary files /dev/null and b/web/out/dist/icons/asc.gif differ diff --git a/web/out/dist/icons/del.gif b/web/out/dist/icons/del.gif new file mode 100644 index 0000000..6ec6096 Binary files /dev/null and b/web/out/dist/icons/del.gif differ diff --git a/web/out/dist/icons/desc.gif b/web/out/dist/icons/desc.gif new file mode 100644 index 0000000..bf7c2d4 Binary files /dev/null and b/web/out/dist/icons/desc.gif differ diff --git a/web/out/dist/icons/edit.gif b/web/out/dist/icons/edit.gif new file mode 100644 index 0000000..773e8b3 Binary files /dev/null and b/web/out/dist/icons/edit.gif differ diff --git a/web/out/dist/icons/list.gif b/web/out/dist/icons/list.gif new file mode 100644 index 0000000..82375ff Binary files /dev/null and b/web/out/dist/icons/list.gif differ diff --git a/web/out/dist/images/colorbox/border.png b/web/out/dist/images/colorbox/border.png new file mode 100644 index 0000000..f463a10 Binary files /dev/null and b/web/out/dist/images/colorbox/border.png differ diff --git a/web/out/dist/images/colorbox/controls.png b/web/out/dist/images/colorbox/controls.png new file mode 100644 index 0000000..051b4a6 Binary files /dev/null and b/web/out/dist/images/colorbox/controls.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderBottomCenter.png b/web/out/dist/images/colorbox/ie6/borderBottomCenter.png new file mode 100644 index 0000000..0d4475e Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderBottomCenter.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderBottomLeft.png b/web/out/dist/images/colorbox/ie6/borderBottomLeft.png new file mode 100644 index 0000000..2775eba Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderBottomLeft.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderBottomRight.png b/web/out/dist/images/colorbox/ie6/borderBottomRight.png new file mode 100644 index 0000000..f7f5137 Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderBottomRight.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderMiddleLeft.png b/web/out/dist/images/colorbox/ie6/borderMiddleLeft.png new file mode 100644 index 0000000..a2d63d1 Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderMiddleLeft.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderMiddleRight.png b/web/out/dist/images/colorbox/ie6/borderMiddleRight.png new file mode 100644 index 0000000..fd7c3e8 Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderMiddleRight.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderTopCenter.png b/web/out/dist/images/colorbox/ie6/borderTopCenter.png new file mode 100644 index 0000000..2937a9c Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderTopCenter.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderTopLeft.png b/web/out/dist/images/colorbox/ie6/borderTopLeft.png new file mode 100644 index 0000000..f9d458b Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderTopLeft.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderTopRight.png b/web/out/dist/images/colorbox/ie6/borderTopRight.png new file mode 100644 index 0000000..74b8583 Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderTopRight.png differ diff --git a/web/out/dist/images/colorbox/loading.gif b/web/out/dist/images/colorbox/loading.gif new file mode 100644 index 0000000..09d621e Binary files /dev/null and b/web/out/dist/images/colorbox/loading.gif differ diff --git a/web/out/dist/images/colorbox/loading_background.png b/web/out/dist/images/colorbox/loading_background.png new file mode 100644 index 0000000..6ae83e6 Binary files /dev/null and b/web/out/dist/images/colorbox/loading_background.png differ diff --git a/web/out/dist/images/colorbox/overlay.png b/web/out/dist/images/colorbox/overlay.png new file mode 100644 index 0000000..ddf9e09 Binary files /dev/null and b/web/out/dist/images/colorbox/overlay.png differ diff --git a/web/out/dist/index.php b/web/out/dist/index.php new file mode 100644 index 0000000..2ddd92e --- /dev/null +++ b/web/out/dist/index.php @@ -0,0 +1,53 @@ + + + + out_file("views/head.php"); ?> + + + +
+
+out_file("views/header.php"); ?> +
+
+ +
+
+out_config("navig_menu_top")) require $this->out_file("views/top_menu.php"); ?> +
+
+ +
+ +
+
+ +out_config("colonne")) : ?> +
+out_file("views/index/colonne.php"); ?> +
+ + +
out_config("colonne") ? "" : " class=\"no_colonne\"" ?>> +out_file("views/messages.php"); ?> +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> + +
+ +
+ +
+
+ +
+
+out_file("views/footer.php"); ?> +
+
+ + + diff --git a/web/out/dist/js/actions/admin.js b/web/out/dist/js/actions/admin.js new file mode 100644 index 0000000..a0287e1 --- /dev/null +++ b/web/out/dist/js/actions/admin.js @@ -0,0 +1,14 @@ +$(document).ready +( function() + { init_contact_form_ckeckbox(); + } +); + +function init_contact_form_ckeckbox() +{ $("#contact_form").click + ( function() + { if($(this).get(0).checked) $("#email_li").slideDown(200); + else $("#email_li").slideUp(200); + } + ); +} diff --git a/web/out/dist/js/actions/users.js b/web/out/dist/js/actions/users.js new file mode 100644 index 0000000..0039302 --- /dev/null +++ b/web/out/dist/js/actions/users.js @@ -0,0 +1,14 @@ +$(document).ready +( function() + { init_tinymce(); + } +); + +function init_tinymce() +{ $(".tinymce").each + ( function() + { tinyMCE.execCommand("mceAddControl", true, $(this).attr("id")); + } + ); +} + diff --git a/web/out/dist/js/jquery-1.5.2.min.js b/web/out/dist/js/jquery-1.5.2.min.js new file mode 100644 index 0000000..f78f96a --- /dev/null +++ b/web/out/dist/js/jquery-1.5.2.min.js @@ -0,0 +1,16 @@ +/*! + * jQuery JavaScript Library v1.5.2 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Mar 31 15:28:23 2011 -0400 + */ +(function(a,b){function ci(a){return d.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cf(a){if(!b_[a]){var b=d("<"+a+">").appendTo("body"),c=b.css("display");b.remove();if(c==="none"||c==="")c="block";b_[a]=c}return b_[a]}function ce(a,b){var c={};d.each(cd.concat.apply([],cd.slice(0,b)),function(){c[this]=a});return c}function b$(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function bZ(){try{return new a.XMLHttpRequest}catch(b){}}function bY(){d(a).unload(function(){for(var a in bW)bW[a](0,1)})}function bS(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var e=a.dataTypes,f={},g,h,i=e.length,j,k=e[0],l,m,n,o,p;for(g=1;g=0===c})}function P(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function H(a,b){return(a&&a!=="*"?a+".":"")+b.replace(t,"`").replace(u,"&")}function G(a){var b,c,e,f,g,h,i,j,k,l,m,n,o,p=[],q=[],s=d._data(this,"events");if(a.liveFired!==this&&s&&s.live&&!a.target.disabled&&(!a.button||a.type!=="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var t=s.live.slice(0);for(i=0;ic)break;a.currentTarget=f.elem,a.data=f.handleObj.data,a.handleObj=f.handleObj,o=f.handleObj.origHandler.apply(f.elem,arguments);if(o===!1||a.isPropagationStopped()){c=f.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function E(a,c,e){var f=d.extend({},e[0]);f.type=a,f.originalEvent={},f.liveFired=b,d.event.handle.call(c,f),f.isDefaultPrevented()&&e[0].preventDefault()}function y(){return!0}function x(){return!1}function i(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function h(a,c,e){if(e===b&&a.nodeType===1){e=a.getAttribute("data-"+c);if(typeof e==="string"){try{e=e==="true"?!0:e==="false"?!1:e==="null"?null:d.isNaN(e)?g.test(e)?d.parseJSON(e):e:parseFloat(e)}catch(f){}d.data(a,c,e)}else e=b}return e}var c=a.document,d=function(){function G(){if(!d.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(G,1);return}d.ready()}}var d=function(a,b){return new d.fn.init(a,b,g)},e=a.jQuery,f=a.$,g,h=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/,i=/\S/,j=/^\s+/,k=/\s+$/,l=/\d/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=navigator.userAgent,w,x,y,z=Object.prototype.toString,A=Object.prototype.hasOwnProperty,B=Array.prototype.push,C=Array.prototype.slice,D=String.prototype.trim,E=Array.prototype.indexOf,F={};d.fn=d.prototype={constructor:d,init:function(a,e,f){var g,i,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!e&&c.body){this.context=c,this[0]=c.body,this.selector="body",this.length=1;return this}if(typeof a==="string"){g=h.exec(a);if(!g||!g[1]&&e)return!e||e.jquery?(e||f).find(a):this.constructor(e).find(a);if(g[1]){e=e instanceof d?e[0]:e,k=e?e.ownerDocument||e:c,j=m.exec(a),j?d.isPlainObject(e)?(a=[c.createElement(j[1])],d.fn.attr.call(a,e,!0)):a=[k.createElement(j[1])]:(j=d.buildFragment([g[1]],[k]),a=(j.cacheable?d.clone(j.fragment):j.fragment).childNodes);return d.merge(this,a)}i=c.getElementById(g[2]);if(i&&i.parentNode){if(i.id!==g[2])return f.find(a);this.length=1,this[0]=i}this.context=c,this.selector=a;return this}if(d.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return d.makeArray(a,this)},selector:"",jquery:"1.5.2",length:0,size:function(){return this.length},toArray:function(){return C.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var e=this.constructor();d.isArray(a)?B.apply(e,a):d.merge(e,a),e.prevObject=this,e.context=this.context,b==="find"?e.selector=this.selector+(this.selector?" ":"")+c:b&&(e.selector=this.selector+"."+b+"("+c+")");return e},each:function(a,b){return d.each(this,a,b)},ready:function(a){d.bindReady(),x.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(C.apply(this,arguments),"slice",C.call(arguments).join(","))},map:function(a){return this.pushStack(d.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:B,sort:[].sort,splice:[].splice},d.fn.init.prototype=d.fn,d.extend=d.fn.extend=function(){var a,c,e,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i==="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!=="object"&&!d.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j0)return;x.resolveWith(c,[d]),d.fn.trigger&&d(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!x){x=d._Deferred();if(c.readyState==="complete")return setTimeout(d.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",y,!1),a.addEventListener("load",d.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",y),a.attachEvent("onload",d.ready);var b=!1;try{b=a.frameElement==null}catch(e){}c.documentElement.doScroll&&b&&G()}}},isFunction:function(a){return d.type(a)==="function"},isArray:Array.isArray||function(a){return d.type(a)==="array"},isWindow:function(a){return a&&typeof a==="object"&&"setInterval"in a},isNaN:function(a){return a==null||!l.test(a)||isNaN(a)},type:function(a){return a==null?String(a):F[z.call(a)]||"object"},isPlainObject:function(a){if(!a||d.type(a)!=="object"||a.nodeType||d.isWindow(a))return!1;if(a.constructor&&!A.call(a,"constructor")&&!A.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a){}return c===b||A.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!=="string"||!b)return null;b=d.trim(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return a.JSON&&a.JSON.parse?a.JSON.parse(b):(new Function("return "+b))();d.error("Invalid JSON: "+b)},parseXML:function(b,c,e){a.DOMParser?(e=new DOMParser,c=e.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),e=c.documentElement,(!e||!e.nodeName||e.nodeName==="parsererror")&&d.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(a){if(a&&i.test(a)){var b=c.head||c.getElementsByTagName("head")[0]||c.documentElement,e=c.createElement("script");d.support.scriptEval()?e.appendChild(c.createTextNode(a)):e.text=a,b.insertBefore(e,b.firstChild),b.removeChild(e)}},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,e){var f,g=0,h=a.length,i=h===b||d.isFunction(a);if(e){if(i){for(f in a)if(c.apply(a[f],e)===!1)break}else for(;g1?f.call(arguments,0):c,--g||h.resolveWith(h,f.call(b,0))}}var b=arguments,c=0,e=b.length,g=e,h=e<=1&&a&&d.isFunction(a.promise)?a:d.Deferred();if(e>1){for(;c
a";var e=b.getElementsByTagName("*"),f=b.getElementsByTagName("a")[0],g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=b.getElementsByTagName("input")[0];if(e&&e.length&&f){d.support={leadingWhitespace:b.firstChild.nodeType===3,tbody:!b.getElementsByTagName("tbody").length,htmlSerialize:!!b.getElementsByTagName("link").length,style:/red/.test(f.getAttribute("style")),hrefNormalized:f.getAttribute("href")==="/a",opacity:/^0.55$/.test(f.style.opacity),cssFloat:!!f.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,deleteExpando:!0,optDisabled:!1,checkClone:!1,noCloneEvent:!0,noCloneChecked:!0,boxModel:null,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableHiddenOffsets:!0,reliableMarginRight:!0},i.checked=!0,d.support.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,d.support.optDisabled=!h.disabled;var j=null;d.support.scriptEval=function(){if(j===null){var b=c.documentElement,e=c.createElement("script"),f="script"+d.now();try{e.appendChild(c.createTextNode("window."+f+"=1;"))}catch(g){}b.insertBefore(e,b.firstChild),a[f]?(j=!0,delete a[f]):j=!1,b.removeChild(e)}return j};try{delete b.test}catch(k){d.support.deleteExpando=!1}!b.addEventListener&&b.attachEvent&&b.fireEvent&&(b.attachEvent("onclick",function l(){d.support.noCloneEvent=!1,b.detachEvent("onclick",l)}),b.cloneNode(!0).fireEvent("onclick")),b=c.createElement("div"),b.innerHTML="";var m=c.createDocumentFragment();m.appendChild(b.firstChild),d.support.checkClone=m.cloneNode(!0).cloneNode(!0).lastChild.checked,d(function(){var a=c.createElement("div"),b=c.getElementsByTagName("body")[0];if(b){a.style.width=a.style.paddingLeft="1px",b.appendChild(a),d.boxModel=d.support.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,d.support.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="
",d.support.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="
t
";var e=a.getElementsByTagName("td");d.support.reliableHiddenOffsets=e[0].offsetHeight===0,e[0].style.display="",e[1].style.display="none",d.support.reliableHiddenOffsets=d.support.reliableHiddenOffsets&&e[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(a.style.width="1px",a.style.marginRight="0",d.support.reliableMarginRight=(parseInt(c.defaultView.getComputedStyle(a,null).marginRight,10)||0)===0),b.removeChild(a).style.display="none",a=e=null}});var n=function(a){var b=c.createElement("div");a="on"+a;if(!b.attachEvent)return!0;var d=a in b;d||(b.setAttribute(a,"return;"),d=typeof b[a]==="function");return d};d.support.submitBubbles=n("submit"),d.support.changeBubbles=n("change"),b=e=f=null}}();var g=/^(?:\{.*\}|\[.*\])$/;d.extend({cache:{},uuid:0,expando:"jQuery"+(d.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?d.cache[a[d.expando]]:a[d.expando];return!!a&&!i(a)},data:function(a,c,e,f){if(d.acceptData(a)){var g=d.expando,h=typeof c==="string",i,j=a.nodeType,k=j?d.cache:a,l=j?a[d.expando]:a[d.expando]&&d.expando;if((!l||f&&l&&!k[l][g])&&h&&e===b)return;l||(j?a[d.expando]=l=++d.uuid:l=d.expando),k[l]||(k[l]={},j||(k[l].toJSON=d.noop));if(typeof c==="object"||typeof c==="function")f?k[l][g]=d.extend(k[l][g],c):k[l]=d.extend(k[l],c);i=k[l],f&&(i[g]||(i[g]={}),i=i[g]),e!==b&&(i[c]=e);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[c]:i}},removeData:function(b,c,e){if(d.acceptData(b)){var f=d.expando,g=b.nodeType,h=g?d.cache:b,j=g?b[d.expando]:d.expando;if(!h[j])return;if(c){var k=e?h[j][f]:h[j];if(k){delete k[c];if(!i(k))return}}if(e){delete h[j][f];if(!i(h[j]))return}var l=h[j][f];d.support.deleteExpando||h!=a?delete h[j]:h[j]=null,l?(h[j]={},g||(h[j].toJSON=d.noop),h[j][f]=l):g&&(d.support.deleteExpando?delete b[d.expando]:b.removeAttribute?b.removeAttribute(d.expando):b[d.expando]=null)}},_data:function(a,b,c){return d.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=d.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),d.fn.extend({data:function(a,c){var e=null;if(typeof a==="undefined"){if(this.length){e=d.data(this[0]);if(this[0].nodeType===1){var f=this[0].attributes,g;for(var i=0,j=f.length;i-1)return!0;return!1},val:function(a){if(!arguments.length){var c=this[0];if(c){if(d.nodeName(c,"option")){var e=c.attributes.value;return!e||e.specified?c.value:c.text}if(d.nodeName(c,"select")){var f=c.selectedIndex,g=[],h=c.options,i=c.type==="select-one";if(f<0)return null;for(var j=i?f:0,k=i?f+1:h.length;j=0;else if(d.nodeName(this,"select")){var f=d.makeArray(e);d("option",this).each(function(){this.selected=d.inArray(d(this).val(),f)>=0}),f.length||(this.selectedIndex=-1)}else this.value=e}})}}),d.extend({attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,e,f){if(!a||a.nodeType===3||a.nodeType===8||a.nodeType===2)return b;if(f&&c in d.attrFn)return d(a)[c](e);var g=a.nodeType!==1||!d.isXMLDoc(a),h=e!==b;c=g&&d.props[c]||c;if(a.nodeType===1){var i=m.test(c);if(c==="selected"&&!d.support.optSelected){var j=a.parentNode;j&&(j.selectedIndex,j.parentNode&&j.parentNode.selectedIndex)}if((c in a||a[c]!==b)&&g&&!i){h&&(c==="type"&&n.test(a.nodeName)&&a.parentNode&&d.error("type property can't be changed"),e===null?a.nodeType===1&&a.removeAttribute(c):a[c]=e);if(d.nodeName(a,"form")&&a.getAttributeNode(c))return a.getAttributeNode(c).nodeValue;if(c==="tabIndex"){var k=a.getAttributeNode("tabIndex");return k&&k.specified?k.value:o.test(a.nodeName)||p.test(a.nodeName)&&a.href?0:b}return a[c]}if(!d.support.style&&g&&c==="style"){h&&(a.style.cssText=""+e);return a.style.cssText}h&&a.setAttribute(c,""+e);if(!a.attributes[c]&&(a.hasAttribute&&!a.hasAttribute(c)))return b;var l=!d.support.hrefNormalized&&g&&i?a.getAttribute(c,2):a.getAttribute(c);return l===null?b:l}h&&(a[c]=e);return a[c]}});var r=/\.(.*)$/,s=/^(?:textarea|input|select)$/i,t=/\./g,u=/ /g,v=/[^\w\s.|`]/g,w=function(a){return a.replace(v,"\\$&")};d.event={add:function(c,e,f,g){if(c.nodeType!==3&&c.nodeType!==8){try{d.isWindow(c)&&(c!==a&&!c.frameElement)&&(c=a)}catch(h){}if(f===!1)f=x;else if(!f)return;var i,j;f.handler&&(i=f,f=i.handler),f.guid||(f.guid=d.guid++);var k=d._data(c);if(!k)return;var l=k.events,m=k.handle;l||(k.events=l={}),m||(k.handle=m=function(a){return typeof d!=="undefined"&&d.event.triggered!==a.type?d.event.handle.apply(m.elem,arguments):b}),m.elem=c,e=e.split(" ");var n,o=0,p;while(n=e[o++]){j=i?d.extend({},i):{handler:f,data:g},n.indexOf(".")>-1?(p=n.split("."),n=p.shift(),j.namespace=p.slice(0).sort().join(".")):(p=[],j.namespace=""),j.type=n,j.guid||(j.guid=f.guid);var q=l[n],r=d.event.special[n]||{};if(!q){q=l[n]=[];if(!r.setup||r.setup.call(c,g,p,m)===!1)c.addEventListener?c.addEventListener(n,m,!1):c.attachEvent&&c.attachEvent("on"+n,m)}r.add&&(r.add.call(c,j),j.handler.guid||(j.handler.guid=f.guid)),q.push(j),d.event.global[n]=!0}c=null}},global:{},remove:function(a,c,e,f){if(a.nodeType!==3&&a.nodeType!==8){e===!1&&(e=x);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=d.hasData(a)&&d._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(e=c.handler,c=c.type);if(!c||typeof c==="string"&&c.charAt(0)==="."){c=c||"";for(h in t)d.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+d.map(m.slice(0).sort(),w).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!e){for(j=0;j=0&&(a.type=f=f.slice(0,-1),a.exclusive=!0),e||(a.stopPropagation(),d.event.global[f]&&d.each(d.cache,function(){var b=d.expando,e=this[b];e&&e.events&&e.events[f]&&d.event.trigger(a,c,e.handle.elem)}));if(!e||e.nodeType===3||e.nodeType===8)return b;a.result=b,a.target=e,c=d.makeArray(c),c.unshift(a)}a.currentTarget=e;var h=d._data(e,"handle");h&&h.apply(e,c);var i=e.parentNode||e.ownerDocument;try{e&&e.nodeName&&d.noData[e.nodeName.toLowerCase()]||e["on"+f]&&e["on"+f].apply(e,c)===!1&&(a.result=!1,a.preventDefault())}catch(j){}if(!a.isPropagationStopped()&&i)d.event.trigger(a,c,i,!0);else if(!a.isDefaultPrevented()){var k,l=a.target,m=f.replace(r,""),n=d.nodeName(l,"a")&&m==="click",o=d.event.special[m]||{};if((!o._default||o._default.call(e,a)===!1)&&!n&&!(l&&l.nodeName&&d.noData[l.nodeName.toLowerCase()])){try{l[m]&&(k=l["on"+m],k&&(l["on"+m]=null),d.event.triggered=a.type,l[m]())}catch(p){}k&&(l["on"+m]=k),d.event.triggered=b}}},handle:function(c){var e,f,g,h,i,j=[],k=d.makeArray(arguments);c=k[0]=d.event.fix(c||a.event),c.currentTarget=this,e=c.type.indexOf(".")<0&&!c.exclusive,e||(g=c.type.split("."),c.type=g.shift(),j=g.slice(0).sort(),h=new RegExp("(^|\\.)"+j.join("\\.(?:.*\\.)?")+"(\\.|$)")),c.namespace=c.namespace||j.join("."),i=d._data(this,"events"),f=(i||{})[c.type];if(i&&f){f=f.slice(0);for(var l=0,m=f.length;l-1?d.map(a.options,function(a){return a.selected}).join("-"):"":a.nodeName.toLowerCase()==="select"&&(c=a.selectedIndex);return c},D=function D(a){var c=a.target,e,f;if(s.test(c.nodeName)&&!c.readOnly){e=d._data(c,"_change_data"),f=C(c),(a.type!=="focusout"||c.type!=="radio")&&d._data(c,"_change_data",f);if(e===b||f===e)return;if(e!=null||f)a.type="change",a.liveFired=b,d.event.trigger(a,arguments[1],c)}};d.event.special.change={filters:{focusout:D,beforedeactivate:D,click:function(a){var b=a.target,c=b.type;(c==="radio"||c==="checkbox"||b.nodeName.toLowerCase()==="select")&&D.call(this,a)},keydown:function(a){var b=a.target,c=b.type;(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&D.call(this,a)},beforeactivate:function(a){var b=a.target;d._data(b,"_change_data",C(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in B)d.event.add(this,c+".specialChange",B[c]);return s.test(this.nodeName)},teardown:function(a){d.event.remove(this,".specialChange");return s.test(this.nodeName)}},B=d.event.special.change.filters,B.focus=B.beforeactivate}c.addEventListener&&d.each({focus:"focusin",blur:"focusout"},function(a,b){function f(a){var c=d.event.fix(a);c.type=b,c.originalEvent={},d.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var e=0;d.event.special[b]={setup:function(){e++===0&&c.addEventListener(a,f,!0)},teardown:function(){--e===0&&c.removeEventListener(a,f,!0)}}}),d.each(["bind","one"],function(a,c){d.fn[c]=function(a,e,f){if(typeof a==="object"){for(var g in a)this[c](g,e,a[g],f);return this}if(d.isFunction(e)||e===!1)f=e,e=b;var h=c==="one"?d.proxy(f,function(a){d(this).unbind(a,h);return f.apply(this,arguments)}):f;if(a==="unload"&&c!=="one")this.one(a,e,f);else for(var i=0,j=this.length;i0?this.bind(b,a,c):this.trigger(b)},d.attrFn&&(d.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,e=0,f=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,e,g){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!=="string")return e;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(f.call(n)==="[object Array]")if(u)if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&e.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&e.push(j[t]);else e.push.apply(e,n);else p(n,e);o&&(k(o,h,e,g),k.uniqueSort(e));return e};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e":function(a,b){var c,d=typeof b==="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return"text"===c&&(b===c||b===null)},radio:function(a){return"radio"===a.type},checkbox:function(a){return"checkbox"===a.type},file:function(a){return"file"===a.type},password:function(a){return"password"===a.type},submit:function(a){return"submit"===a.type},image:function(a){return"image"===a.type},reset:function(a){return"reset"===a.type},button:function(a){return"button"===a.type||a.nodeName.toLowerCase()==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return bc[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^$]*$)/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(f.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length==="number")for(var e=a.length;c",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!=="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!=="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!=="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!=="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="
";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="
";if(a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!=="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g0)for(var g=c;g0},closest:function(a,b){var c=[],e,f,g=this[0];if(d.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(e=0,f=a.length;e-1:d(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=N.test(a)?d(a,b||this.context):null;for(e=0,f=this.length;e-1:d.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b)break}}c=c.length>1?d.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a==="string")return d.inArray(this[0],a?d(a):this.parent().children());return d.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a==="string"?d(a,b):d.makeArray(a),e=d.merge(this.get(),c);return this.pushStack(P(c[0])||P(e[0])?e:d.unique(e))},andSelf:function(){return this.add(this.prevObject)}}),d.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return d.dir(a,"parentNode")},parentsUntil:function(a,b,c){return d.dir(a,"parentNode",c)},next:function(a){return d.nth(a,2,"nextSibling")},prev:function(a){return d.nth(a,2,"previousSibling")},nextAll:function(a){return d.dir(a,"nextSibling")},prevAll:function(a){return d.dir(a,"previousSibling")},nextUntil:function(a,b,c){return d.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return d.dir(a,"previousSibling",c)},siblings:function(a){return d.sibling(a.parentNode.firstChild,a)},children:function(a){return d.sibling(a.firstChild)},contents:function(a){return d.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:d.makeArray(a.childNodes)}},function(a,b){d.fn[a]=function(c,e){var f=d.map(this,b,c),g=M.call(arguments);I.test(a)||(e=c),e&&typeof e==="string"&&(f=d.filter(e,f)),f=this.length>1&&!O[a]?d.unique(f):f,(this.length>1||K.test(e))&&J.test(a)&&(f=f.reverse());return this.pushStack(f,a,g.join(","))}}),d.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?d.find.matchesSelector(b[0],a)?[b[0]]:[]:d.find.matches(a,b)},dir:function(a,c,e){var f=[],g=a[c];while(g&&g.nodeType!==9&&(e===b||g.nodeType!==1||!d(g).is(e)))g.nodeType===1&&f.push(g),g=g[c];return f},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var R=/ jQuery\d+="(?:\d+|null)"/g,S=/^\s+/,T=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,U=/<([\w:]+)/,V=/",""],legend:[1,"
","
"],thead:[1,"","
"],tr:[2,"","
"],td:[3,"","
"],col:[2,"","
"],area:[1,"",""],_default:[0,"",""]};Z.optgroup=Z.option,Z.tbody=Z.tfoot=Z.colgroup=Z.caption=Z.thead,Z.th=Z.td,d.support.htmlSerialize||(Z._default=[1,"div
","
"]),d.fn.extend({text:function(a){if(d.isFunction(a))return this.each(function(b){var c=d(this);c.text(a.call(this,b,c.text()))});if(typeof a!=="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return d.text(this)},wrapAll:function(a){if(d.isFunction(a))return this.each(function(b){d(this).wrapAll(a.call(this,b))});if(this[0]){var b=d(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(d.isFunction(a))return this.each(function(b){d(this).wrapInner(a.call(this,b))});return this.each(function(){var b=d(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){d(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){d.nodeName(this,"body")||d(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=d(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,d(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,e;(e=this[c])!=null;c++)if(!a||d.filter(a,[e]).length)!b&&e.nodeType===1&&(d.cleanData(e.getElementsByTagName("*")),d.cleanData([e])),e.parentNode&&e.parentNode.removeChild(e);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&d.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return d.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(R,""):null;if(typeof a!=="string"||X.test(a)||!d.support.leadingWhitespace&&S.test(a)||Z[(U.exec(a)||["",""])[1].toLowerCase()])d.isFunction(a)?this.each(function(b){var c=d(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);else{a=a.replace(T,"<$1>");try{for(var c=0,e=this.length;c1&&l0?this.clone(!0):this).get();d(f[h])[b](j),e=e.concat(j)}return this.pushStack(e,a,f.selector)}}),d.extend({clone:function(a,b,c){var e=a.cloneNode(!0),f,g,h;if((!d.support.noCloneEvent||!d.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!d.isXMLDoc(a)){ba(a,e),f=bb(a),g=bb(e);for(h=0;f[h];++h)ba(f[h],g[h])}if(b){_(a,e);if(c){f=bb(a),g=bb(e);for(h=0;f[h];++h)_(f[h],g[h])}}return e},clean:function(a,b,e,f){b=b||c,typeof b.createElement==="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var g=[];for(var h=0,i;(i=a[h])!=null;h++){typeof i==="number"&&(i+="");if(!i)continue;if(typeof i!=="string"||W.test(i)){if(typeof i==="string"){i=i.replace(T,"<$1>");var j=(U.exec(i)||["",""])[1].toLowerCase(),k=Z[j]||Z._default,l=k[0],m=b.createElement("div");m.innerHTML=k[1]+i+k[2];while(l--)m=m.lastChild;if(!d.support.tbody){var n=V.test(i),o=j==="table"&&!n?m.firstChild&&m.firstChild.childNodes:k[1]===""&&!n?m.childNodes:[];for(var p=o.length-1;p>=0;--p)d.nodeName(o[p],"tbody")&&!o[p].childNodes.length&&o[p].parentNode.removeChild(o[p])}!d.support.leadingWhitespace&&S.test(i)&&m.insertBefore(b.createTextNode(S.exec(i)[0]),m.firstChild),i=m.childNodes}}else i=b.createTextNode(i);i.nodeType?g.push(i):g=d.merge(g,i)}if(e)for(h=0;g[h];h++)!f||!d.nodeName(g[h],"script")||g[h].type&&g[h].type.toLowerCase()!=="text/javascript"?(g[h].nodeType===1&&g.splice.apply(g,[h+1,0].concat(d.makeArray(g[h].getElementsByTagName("script")))),e.appendChild(g[h])):f.push(g[h].parentNode?g[h].parentNode.removeChild(g[h]):g[h]);return g},cleanData:function(a){var b,c,e=d.cache,f=d.expando,g=d.event.special,h=d.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&d.noData[j.nodeName.toLowerCase()])continue;c=j[d.expando];if(c){b=e[c]&&e[c][f];if(b&&b.events){for(var k in b.events)g[k]?d.event.remove(j,k):d.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[d.expando]:j.removeAttribute&&j.removeAttribute(d.expando),delete e[c]}}}});var bd=/alpha$[^)]*$/i,be=/opacity=([^)]*)/,bf=/-([a-z])/ig,bg=/([A-Z]|^ms)/g,bh=/^-?\d+(?:px)?$/i,bi=/^-?\d/,bj={position:"absolute",visibility:"hidden",display:"block"},bk=["Left","Right"],bl=["Top","Bottom"],bm,bn,bo,bp=function(a,b){return b.toUpperCase()};d.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return d.access(this,a,c,!0,function(a,c,e){return e!==b?d.style(a,c,e):d.css(a,c)})},d.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bm(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{zIndex:!0,fontWeight:!0,opacity:!0,zoom:!0,lineHeight:!0},cssProps:{"float":d.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,e,f){if(a&&a.nodeType!==3&&a.nodeType!==8&&a.style){var g,h=d.camelCase(c),i=a.style,j=d.cssHooks[h];c=d.cssProps[h]||h;if(e===b){if(j&&"get"in j&&(g=j.get(a,!1,f))!==b)return g;return i[c]}if(typeof e==="number"&&isNaN(e)||e==null)return;typeof e==="number"&&!d.cssNumber[h]&&(e+="px");if(!j||!("set"in j)||(e=j.set(a,e))!==b)try{i[c]=e}catch(k){}}},css:function(a,c,e){var f,g=d.camelCase(c),h=d.cssHooks[g];c=d.cssProps[g]||g;if(h&&"get"in h&&(f=h.get(a,!0,e))!==b)return f;if(bm)return bm(a,c,g)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]},camelCase:function(a){return a.replace(bf,bp)}}),d.curCSS=d.css,d.each(["height","width"],function(a,b){d.cssHooks[b]={get:function(a,c,e){var f;if(c){a.offsetWidth!==0?f=bq(a,b,e):d.swap(a,bj,function(){f=bq(a,b,e)});if(f<=0){f=bm(a,b,b),f==="0px"&&bo&&(f=bo(a,b,b));if(f!=null)return f===""||f==="auto"?"0px":f}if(f<0||f==null){f=a.style[b];return f===""||f==="auto"?"0px":f}return typeof f==="string"?f:f+"px"}},set:function(a,b){if(!bh.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),d.support.opacity||(d.cssHooks.opacity={get:function(a,b){return be.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style;c.zoom=1;var e=d.isNaN(b)?"":"alpha(opacity="+b*100+")",f=c.filter||"";c.filter=bd.test(f)?f.replace(bd,e):c.filter+" "+e}}),d(function(){d.support.reliableMarginRight||(d.cssHooks.marginRight={get:function(a,b){var c;d.swap(a,{display:"inline-block"},function(){b?c=bm(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bn=function(a,c,e){var f,g,h;e=e.replace(bg,"-$1").toLowerCase();if(!(g=a.ownerDocument.defaultView))return b;if(h=g.getComputedStyle(a,null))f=h.getPropertyValue(e),f===""&&!d.contains(a.ownerDocument.documentElement,a)&&(f=d.style(a,e));return f}),c.documentElement.currentStyle&&(bo=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bh.test(d)&&bi.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bm=bn||bo,d.expr&&d.expr.filters&&(d.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!d.support.reliableHiddenOffsets&&(a.style.display||d.css(a,"display"))==="none"},d.expr.filters.visible=function(a){return!d.expr.filters.hidden(a)});var br=/%20/g,bs=/\[\]$/,bt=/\r?\n/g,bu=/#.*$/,bv=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bw=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bx=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,by=/^(?:GET|HEAD)$/,bz=/^\/\//,bA=/\?/,bB=/)<[^<]*)*<\/script>/gi,bC=/^(?:select|textarea)/i,bD=/\s+/,bE=/([?&])_=[^&]*/,bF=/(^|\-)([a-z])/g,bG=function(a,b,c){return b+c.toUpperCase()},bH=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bI=d.fn.load,bJ={},bK={},bL,bM;try{bL=c.location.href}catch(bN){bL=c.createElement("a"),bL.href="",bL=bL.href}bM=bH.exec(bL.toLowerCase())||[],d.fn.extend({load:function(a,c,e){if(typeof a!=="string"&&bI)return bI.apply(this,arguments);if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var g=a.slice(f,a.length);a=a.slice(0,f)}var h="GET";c&&(d.isFunction(c)?(e=c,c=b):typeof c==="object"&&(c=d.param(c,d.ajaxSettings.traditional),h="POST"));var i=this;d.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?d("
").append(c.replace(bB,"")).find(g):c)),e&&i.each(e,[c,b,a])}});return this},serialize:function(){return d.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?d.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bC.test(this.nodeName)||bw.test(this.type))}).map(function(a,b){var c=d(this).val();return c==null?null:d.isArray(c)?d.map(c,function(a,c){return{name:b.name,value:a.replace(bt,"\r\n")}}):{name:b.name,value:c.replace(bt,"\r\n")}}).get()}}),d.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){d.fn[b]=function(a){return this.bind(b,a)}}),d.each(["get","post"],function(a,c){d[c]=function(a,e,f,g){d.isFunction(e)&&(g=g||f,f=e,e=b);return d.ajax({type:c,url:a,data:e,success:f,dataType:g})}}),d.extend({getScript:function(a,c){return d.get(a,b,c,"script")},getJSON:function(a,b,c){return d.get(a,b,c,"json")},ajaxSetup:function(a,b){b?d.extend(!0,a,d.ajaxSettings,b):(b=a,a=d.extend(!0,d.ajaxSettings,b));for(var c in {context:1,url:1})c in b?a[c]=b[c]:c in d.ajaxSettings&&(a[c]=d.ajaxSettings[c]);return a},ajaxSettings:{url:bL,isLocal:bx.test(bM[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":d.parseJSON,"text xml":d.parseXML}},ajaxPrefilter:bO(bJ),ajaxTransport:bO(bK),ajax:function(a,c){function v(a,c,l,n){if(r!==2){r=2,p&&clearTimeout(p),o=b,m=n||"",u.readyState=a?4:0;var q,t,v,w=l?bR(e,u,l):b,x,y;if(a>=200&&a<300||a===304){if(e.ifModified){if(x=u.getResponseHeader("Last-Modified"))d.lastModified[k]=x;if(y=u.getResponseHeader("Etag"))d.etag[k]=y}if(a===304)c="notmodified",q=!0;else try{t=bS(e,w),c="success",q=!0}catch(z){c="parsererror",v=z}}else{v=c;if(!c||a)c="error",a<0&&(a=0)}u.status=a,u.statusText=c,q?h.resolveWith(f,[t,c,u]):h.rejectWith(f,[u,c,v]),u.statusCode(j),j=b,s&&g.trigger("ajax"+(q?"Success":"Error"),[u,e,q?t:v]),i.resolveWith(f,[u,c]),s&&(g.trigger("ajaxComplete",[u,e]),--d.active||d.event.trigger("ajaxStop"))}}typeof a==="object"&&(c=a,a=b),c=c||{};var e=d.ajaxSetup({},c),f=e.context||e,g=f!==e&&(f.nodeType||f instanceof d)?d(f):d.event,h=d.Deferred(),i=d._Deferred(),j=e.statusCode||{},k,l={},m,n,o,p,q,r=0,s,t,u={readyState:0,setRequestHeader:function(a,b){r||(l[a.toLowerCase().replace(bF,bG)]=b);return this},getAllResponseHeaders:function(){return r===2?m:null},getResponseHeader:function(a){var c;if(r===2){if(!n){n={};while(c=bv.exec(m))n[c[1].toLowerCase()]=c[2]}c=n[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){r||(e.mimeType=a);return this},abort:function(a){a=a||"abort",o&&o.abort(a),v(0,a);return this}};h.promise(u),u.success=u.done,u.error=u.fail,u.complete=i.done,u.statusCode=function(a){if(a){var b;if(r<2)for(b in a)j[b]=[j[b],a[b]];else b=a[u.status],u.then(b,b)}return this},e.url=((a||e.url)+"").replace(bu,"").replace(bz,bM[1]+"//"),e.dataTypes=d.trim(e.dataType||"*").toLowerCase().split(bD),e.crossDomain==null&&(q=bH.exec(e.url.toLowerCase()),e.crossDomain=q&&(q[1]!=bM[1]||q[2]!=bM[2]||(q[3]||(q[1]==="http:"?80:443))!=(bM[3]||(bM[1]==="http:"?80:443)))),e.data&&e.processData&&typeof e.data!=="string"&&(e.data=d.param(e.data,e.traditional)),bP(bJ,e,c,u);if(r===2)return!1;s=e.global,e.type=e.type.toUpperCase(),e.hasContent=!by.test(e.type),s&&d.active++===0&&d.event.trigger("ajaxStart");if(!e.hasContent){e.data&&(e.url+=(bA.test(e.url)?"&":"?")+e.data),k=e.url;if(e.cache===!1){var w=d.now(),x=e.url.replace(bE,"$1_="+w);e.url=x+(x===e.url?(bA.test(e.url)?"&":"?")+"_="+w:"")}}if(e.data&&e.hasContent&&e.contentType!==!1||c.contentType)l["Content-Type"]=e.contentType;e.ifModified&&(k=k||e.url,d.lastModified[k]&&(l["If-Modified-Since"]=d.lastModified[k]),d.etag[k]&&(l["If-None-Match"]=d.etag[k])),l.Accept=e.dataTypes[0]&&e.accepts[e.dataTypes[0]]?e.accepts[e.dataTypes[0]]+(e.dataTypes[0]!=="*"?", */*; q=0.01":""):e.accepts["*"];for(t in e.headers)u.setRequestHeader(t,e.headers[t]);if(e.beforeSend&&(e.beforeSend.call(f,u,e)===!1||r===2)){u.abort();return!1}for(t in {success:1,error:1,complete:1})u[t](e[t]);o=bP(bK,e,c,u);if(o){u.readyState=1,s&&g.trigger("ajaxSend",[u,e]),e.async&&e.timeout>0&&(p=setTimeout(function(){u.abort("timeout")},e.timeout));try{r=1,o.send(l,v)}catch(y){status<2?v(-1,y):d.error(y)}}else v(-1,"No Transport");return u},param:function(a,c){var e=[],f=function(a,b){b=d.isFunction(b)?b():b,e[e.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=d.ajaxSettings.traditional);if(d.isArray(a)||a.jquery&&!d.isPlainObject(a))d.each(a,function(){f(this.name,this.value)});else for(var g in a)bQ(g,a[g],c,f);return e.join("&").replace(br,"+")}}),d.extend({active:0,lastModified:{},etag:{}});var bT=d.now(),bU=/(\=)\?(&|$)|\?\?/i;d.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return d.expando+"_"+bT++}}),d.ajaxPrefilter("json jsonp",function(b,c,e){var f=typeof b.data==="string";if(b.dataTypes[0]==="jsonp"||c.jsonpCallback||c.jsonp!=null||b.jsonp!==!1&&(bU.test(b.url)||f&&bU.test(b.data))){var g,h=b.jsonpCallback=d.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2",m=function(){a[h]=i,g&&d.isFunction(i)&&a[h](g[0])};b.jsonp!==!1&&(j=j.replace(bU,l),b.url===j&&(f&&(k=k.replace(bU,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},e.then(m,m),b.converters["script json"]=function(){g||d.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),d.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){d.globalEval(a);return a}}}),d.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),d.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var bV=d.now(),bW,bX;d.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&bZ()||b$()}:bZ,bX=d.ajaxSettings.xhr(),d.support.ajax=!!bX,d.support.cors=bX&&"withCredentials"in bX,bX=b,d.support.ajax&&d.ajaxTransport(function(a){if(!a.crossDomain||d.support.cors){var c;return{send:function(e,f){var g=a.xhr(),h,i;a.username?g.open(a.type,a.url,a.async,a.username,a.password):g.open(a.type,a.url,a.async);if(a.xhrFields)for(i in a.xhrFields)g[i]=a.xhrFields[i];a.mimeType&&g.overrideMimeType&&g.overrideMimeType(a.mimeType),!a.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(i in e)g.setRequestHeader(i,e[i])}catch(j){}g.send(a.hasContent&&a.data||null),c=function(e,i){var j,k,l,m,n;try{if(c&&(i||g.readyState===4)){c=b,h&&(g.onreadystatechange=d.noop,delete bW[h]);if(i)g.readyState!==4&&g.abort();else{j=g.status,l=g.getAllResponseHeaders(),m={},n=g.responseXML,n&&n.documentElement&&(m.xml=n),m.text=g.responseText;try{k=g.statusText}catch(o){k=""}j||!a.isLocal||a.crossDomain?j===1223&&(j=204):j=m.text?200:404}}}catch(p){i||f(-1,p)}m&&f(j,k,m,l)},a.async&&g.readyState!==4?(bW||(bW={},bY()),h=bV++,g.onreadystatechange=bW[h]=c):c()},abort:function(){c&&c(0,1)}}}});var b_={},ca=/^(?:toggle|show|hide)$/,cb=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cc,cd=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];d.fn.extend({show:function(a,b,c){var e,f;if(a||a===0)return this.animate(ce("show",3),a,b,c);for(var g=0,h=this.length;g=0;a--)c[a].elem===this&&(b&&c[a](!0),c.splice(a,1))}),b||this.dequeue();return this}}),d.each({slideDown:ce("show",1),slideUp:ce("hide",1),slideToggle:ce("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){d.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),d.extend({speed:function(a,b,c){var e=a&&typeof a==="object"?d.extend({},a):{complete:c||!c&&b||d.isFunction(a)&&a,duration:a,easing:c&&b||b&&!d.isFunction(b)&&b};e.duration=d.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in d.fx.speeds?d.fx.speeds[e.duration]:d.fx.speeds._default,e.old=e.complete,e.complete=function(){e.queue!==!1&&d(this).dequeue(),d.isFunction(e.old)&&e.old.call(this)};return e},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig||(b.orig={})}}),d.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(d.fx.step[this.prop]||d.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=d.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function g(a){return e.step(a)}var e=this,f=d.fx;this.startTime=d.now(),this.start=a,this.end=b,this.unit=c||this.unit||(d.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,g.elem=this.elem,g()&&d.timers.push(g)&&!cc&&(cc=setInterval(f.tick,f.interval))},show:function(){this.options.orig[this.prop]=d.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),d(this.elem).show()},hide:function(){this.options.orig[this.prop]=d.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=d.now(),c=!0;if(a||b>=this.options.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),this.options.curAnim[this.prop]=!0;for(var e in this.options.curAnim)this.options.curAnim[e]!==!0&&(c=!1);if(c){if(this.options.overflow!=null&&!d.support.shrinkWrapBlocks){var f=this.elem,g=this.options;d.each(["","X","Y"],function(a,b){f.style["overflow"+b]=g.overflow[a]})}this.options.hide&&d(this.elem).hide();if(this.options.hide||this.options.show)for(var h in this.options.curAnim)d.style(this.elem,h,this.options.orig[h]);this.options.complete.call(this.elem)}return!1}var i=b-this.startTime;this.state=i/this.options.duration;var j=this.options.specialEasing&&this.options.specialEasing[this.prop],k=this.options.easing||(d.easing.swing?"swing":"linear");this.pos=d.easing[j||k](this.state,i,0,1,this.options.duration),this.now=this.start+(this.end-this.start)*this.pos,this.update();return!0}},d.extend(d.fx,{tick:function(){var a=d.timers;for(var b=0;b
";d.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),e=b.firstChild,f=e.firstChild,h=e.nextSibling.firstChild.firstChild,this.doesNotAddBorder=f.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,f.style.position="fixed",f.style.top="20px",this.supportsFixedPosition=f.offsetTop===20||f.offsetTop===15,f.style.position=f.style.top="",e.style.overflow="hidden",e.style.position="relative",this.subtractsBorderForOverflowNotVisible=f.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),d.offset.initialize=d.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;d.offset.initialize(),d.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(d.css(a,"marginTop"))||0,c+=parseFloat(d.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var e=d.css(a,"position");e==="static"&&(a.style.position="relative");var f=d(a),g=f.offset(),h=d.css(a,"top"),i=d.css(a,"left"),j=(e==="absolute"||e==="fixed")&&d.inArray("auto",[h,i])>-1,k={},l={},m,n;j&&(l=f.position()),m=j?l.top:parseInt(h,10)||0,n=j?l.left:parseInt(i,10)||0,d.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):f.css(k)}},d.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),e=ch.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(d.css(a,"marginTop"))||0,c.left-=parseFloat(d.css(a,"marginLeft"))||0,e.top+=parseFloat(d.css(b[0],"borderTopWidth"))||0,e.left+=parseFloat(d.css(b[0],"borderLeftWidth"))||0;return{top:c.top-e.top,left:c.left-e.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&(!ch.test(a.nodeName)&&d.css(a,"position")==="static"))a=a.offsetParent;return a})}}),d.each(["Left","Top"],function(a,c){var e="scroll"+c;d.fn[e]=function(c){var f=this[0],g;if(!f)return null;if(c!==b)return this.each(function(){g=ci(this),g?g.scrollTo(a?d(g).scrollLeft():c,a?c:d(g).scrollTop()):this[e]=c});g=ci(f);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:d.support.boxModel&&g.document.documentElement[e]||g.document.body[e]:f[e]}}),d.each(["Height","Width"],function(a,c){var e=c.toLowerCase();d.fn["inner"+c]=function(){return this[0]?parseFloat(d.css(this[0],e,"padding")):null},d.fn["outer"+c]=function(a){return this[0]?parseFloat(d.css(this[0],e,a?"margin":"border")):null},d.fn[e]=function(a){var f=this[0];if(!f)return a==null?null:this;if(d.isFunction(a))return this.each(function(b){var c=d(this);c[e](a.call(this,b,c[e]()))});if(d.isWindow(f)){var g=f.document.documentElement["client"+c];return f.document.compatMode==="CSS1Compat"&&g||f.document.body["client"+c]||g}if(f.nodeType===9)return Math.max(f.documentElement["client"+c],f.body["scroll"+c],f.documentElement["scroll"+c],f.body["offset"+c],f.documentElement["offset"+c]);if(a===b){var h=d.css(f,e),i=parseFloat(h);return d.isNaN(i)?h:i}return this.css(e,typeof a==="string"?a:a+"px")}}),a.jQuery=a.$=d})(window); \ No newline at end of file diff --git a/web/out/dist/js/jquery-ui-1.8.12.custom.min.js b/web/out/dist/js/jquery-ui-1.8.12.custom.min.js new file mode 100644 index 0000000..1b1c88f --- /dev/null +++ b/web/out/dist/js/jquery-ui-1.8.12.custom.min.js @@ -0,0 +1,783 @@ +/*! + * jQuery UI 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.12",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, +NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this, +"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position"); +if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f, +"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h, +d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}}); +c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate); +if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top- +this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions(); +d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis|| +this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&& +this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== +a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]|| +0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], +this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top- +(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(), +height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"? +document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"), +10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"), +10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&& +d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], +this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.leftthis.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g= +this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])? +e:!(e-this.offset.click.left

{#advhr_dlg.width}	+ + +
{#advhr_dlg.size}
{#advhr_dlg.noshade}

	{#advlink_dlg.popup_location}		{#advlink_dlg.popup_scrollbars}
	{#advlink_dlg.popup_menubar}		{#advlink_dlg.popup_resizable}
	{#advlink_dlg.popup_toolbar}		{#advlink_dlg.popup_dependent}
	{#advlink_dlg.popup_statusbar}		{#advlink_dlg.popup_return}

{#advlink_dlg.id}
{#advlink_dlg.style}
{#advlink_dlg.classes}
{#advlink_dlg.target_name}
{#advlink_dlg.langdir}	+ +
{#advlink_dlg.target_langcode}
{#advlink_dlg.langcode}	+ +
{#advlink_dlg.encoding}
{#advlink_dlg.mime}
{#advlink_dlg.rel}	+
{#advlink_dlg.rev}	+
{#advlink_dlg.tabindex}
{#advlink_dlg.accesskey}

onfocus
onblur
onclick
ondblclick
onmousedown
onmouseup
onmouseover
onmousemove
onmouseout
onkeypress
onkeydown
onkeyup

${#emotions_dlg.cool}$	${#emotions_dlg.cry}$	${#emotions_dlg.embarassed}$	${#emotions_dlg.foot_in_mouth}$
${#emotions_dlg.frown}$	${#emotions_dlg.innocent}$	${#emotions_dlg.kiss}$	${#emotions_dlg.laughing}$
${#emotions_dlg.money_mouth}$	${#emotions_dlg.sealed}$	${#emotions_dlg.smile}$	${#emotions_dlg.surprised}$
${#emotions_dlg.tongue-out}$	${#emotions_dlg.undecided}$	${#emotions_dlg.wink}$	${#emotions_dlg.yell}$

{#advanced_dlg.about_title}

{#advanced_dlg.about_loaded}

{#fullpage_dlg.meta_title}
{#fullpage_dlg.meta_keywords}
{#fullpage_dlg.meta_description}
{#fullpage_dlg.author}
{#fullpage_dlg.copyright}
{#fullpage_dlg.meta_robots}	+ +

{#fullpage_dlg.encoding}	+ +
{#fullpage_dlg.doctypes}	+ +
{#fullpage_dlg.langcode}
{#fullpage_dlg.langdir}	+ +
{#fullpage_dlg.xml_pi}

{#fullpage_dlg.left_margin}		{#fullpage_dlg.right_margin}
{#fullpage_dlg.top_margin}		{#fullpage_dlg.bottom_margin}

{#fullpage_dlg.type}
{#fullpage_dlg.name}
{#fullpage_dlg.content}

{#fullpage_dlg.charset}
{#fullpage_dlg.hreflang}
{#fullpage_dlg.target}
{#fullpage_dlg.rev}	+

{#style_dlg.list_type}
{#style_dlg.bullet_image}
{#style_dlg.position}

{#table_dlg.align}	+ +	{#table_dlg.cell_type}	+ +
{#table_dlg.valign}	+ +	{#table_dlg.scope}	+ +
{#table_dlg.width}		{#table_dlg.height}
{#class_name}	+ +

{#table_dlg.rowtype}	+ +
{#table_dlg.align}	+ +
{#table_dlg.valign}	+ +
{#class_name}	+ +
{#table_dlg.height}

{#table_dlg.cols}		{#table_dlg.rows}
{#table_dlg.cellpadding}		{#table_dlg.cellspacing}
{#table_dlg.align}		{#table_dlg.border}
{#table_dlg.width}		{#table_dlg.height}
{#class_name}	+
{#table_dlg.caption}

{#xhtmlxtras_dlg.attribute_label_title}:
{#xhtmlxtras_dlg.attribute_label_id}:
{#xhtmlxtras_dlg.attribute_label_class}:	+ +
{#xhtmlxtras_dlg.attribute_label_style}:
{#xhtmlxtras_dlg.attribute_label_langdir}:	+ +
{#xhtmlxtras_dlg.attribute_label_langcode}:	+ +

{#fullpage_dlg.type}
{#fullpage_dlg.media}

{#fullpage_dlg.href}
{#fullpage_dlg.target}

onfocus:
onblur:
onclick:
ondblclick:
onmousedown:
onmouseup:
onmouseover:
onmousemove:
onmouseout:
onkeypress:
onkeydown:
onkeyup:

' + ed.getLang('advanced_dlg.about_plugin') + '	' + ed.getLang('advanced_dlg.about_author') + '	' + ed.getLang('advanced_dlg.about_version') + '
' + info.longname + '	' + info.longname + '	' + info.author + '	' + info.author + '	' + info.version + '