From: dj3c1t Date: Fri, 30 Nov 2012 22:29:28 +0000 (+0100) Subject: import mtweb.0.4.1 X-Git-Tag: mtweb.0.4.1 X-Git-Url: http://git.dj3c1t.com/index.cgi?p=mtweb;a=commitdiff_plain;h=19b8f3b9263210d9154e7556446e903f84175519 import mtweb.0.4.1 --- 19b8f3b9263210d9154e7556446e903f84175519 diff --git a/readme.txt b/readme.txt new file mode 100644 index 0000000..87d4bf6 --- /dev/null +++ b/readme.txt @@ -0,0 +1,107 @@ + + mtweb 0.4.1 + +copyright dj3c1t 2011 +programme en GNU/GPLv3 + + +mtweb est une base de programmation pour application web. + + +ce programme utilise, dans le dossier libs : + + - TinyMCE + http://tinymce.moxiecode.com/ + + - une classe Php sxml, tres utile, et trouvee ici : + http://www.shop24-7.info/32-0-simplexml-alternative-php4.html + + - Ptitcaptcha, une classe Php pour un captcha (anti-spam) + http://www.jpfox.fr/?post/2007/10/24/190-un-petit-captcha-en-php + + - InputFilter, une class Php pour filtrer les balises et les attributs + HTML dangereux dans les description des sources + http://www.phpclasses.org/inputfilter + +installation : +-------------- + +installation rapide : + + - l'archive mtweb.tar.gz contient un dossier "web" + - uploadez le contenu de ce dossier a la racine de votre site + - assurez-vous que Php a le droit d'ecrire dans le dossier "content" + (et dans ses fichiers et sous-dossiers) + +Par defaut, mtweb stocke ses donnees dans des fichiers XML. + +pour utilisez le stockage des donnees avec MySql : + + - importez les tables fournies dans le fichier "content/data/sql/mysql/mtweb.sql" + - puis dans le fichier "config.php" : + - commentez la partie relative aux donnees XML + - decommentez la partie relative aux donnees MySql + - adaptez les informations pour MySql avec vos parametres de connexion + +pour une premiere utilisation, vous pouvez vous identifier avec : + +login: admin +pass: adminpass + +pensez a changer le mot de passe + + +documentation : +--------------- + +Plus d'infos en ligne : +http://mtweb.dj3c1t.com + + +historique des modifications : +------------------------------ + +0.4.1 : +------- + +3 Janv 2012 + +la version 0.4, qui introduit les plugins, en contient trois +dans son repertoire "plugins". + +dans cette version, seule l'application principale est fournie. + +les plugins restent disponibles, mais via leur propre archive. + + +0.4 : +----- + +30 Dec 2011 + +version extraite de sourceML.0.13 + +ajout d'un systeme de plugins +l'appli gere aussi maintenant une arborescence de liens + +changement de methode pour les surcharges. le dossier "app/local" +disparait et le contenu du dossier "app/core" descent dans "app/" +les surcharges se font maintenant avec les plugins. + + +0.3.2 : +------- + +Utilisation d'un cache en RAM pour les donnees gerees en XML. + +0.3.1 : +------- + +Ajout d'un exemple d'application, pour un agenda en ligne. + +0.3 : +----- + +Cette version a ete extraite de la dernier version de sourceML (sourceML.0.10) + +marche avec Mysql ou XML diff --git a/web/.htaccess b/web/.htaccess new file mode 100644 index 0000000..7efd22b --- /dev/null +++ b/web/.htaccess @@ -0,0 +1,7 @@ +# ------------------------------------------------------------------------------------ +# le template par defaut de mtweb utilise les "short tags" php pour l'affichage, dans +# les fichiers php du dossier "out". Si ces "short tags" ne sont pas disponibles par +# defaut sur votre hebergement, essayez en decommentant la ligne suivante. +# ------------------------------------------------------------------------------------ + +# php_value short_open_tag On diff --git a/web/app/config.xml b/web/app/config.xml new file mode 100644 index 0000000..b862223 --- /dev/null +++ b/web/app/config.xml @@ -0,0 +1,23 @@ + + + + + #-- + + + + 1 + + + + e + id + user + status + from + start + alpha +
form
+
+ +
\ No newline at end of file diff --git a/web/app/data/impl/mw_mysql.php b/web/app/data/impl/mw_mysql.php new file mode 100644 index 0000000..22bd3ce --- /dev/null +++ b/web/app/data/impl/mw_mysql.php @@ -0,0 +1,87 @@ +EXTENTION_OK; } + + function mw_mysql($host, $base, $user, $password) + { $this->host = $host; + $this->base = $base; + $this->user = $user; + $this->password = $password; + $this->EXTENTION_OK = function_exists("mysql_connect"); + } + + function connect($host, $base, $user, $password) + { $this->link = @mysql_connect($host, $user, $password); + if(!$this->link) return null; + @mysql_query("SET NAMES 'utf8'"); + if($base) + { $connected = @mysql_select_db($base, $this->link); + if(!$connected) return null; + } + return true; + } + + function select_db($db_name) + { $this->base = $db_name; + if(!$this->link) + { if(!$this->connect($this->host, $this->base, $this->user, $this->password)) return null; + } + return $this->query("USE ".$db_name); + } + + function table_exists($table_name) + { $sql = "SHOW TABLES LIKE '".$table_name."'"; + $rst = $this->query($sql); + if(isset($rst)) + { $exists = false; + $v_rst = $this->fetch_assoc($rst); + if($v_rst) $exists = true; + $this->free_result($rst); + return $exists; + } + return null; + } + + function query($query_string) + { if(!$this->link) + { if(!$this->connect($this->host, $this->base, $this->user, $this->password)) return null; + } + $result = @mysql_query($query_string, $this->link); + if(!$result) return null; + return $result; + } + + function fetch_assoc($rst) + { if($rst && $this->link) return mysql_fetch_assoc($rst); + return null; + } + + function insert_id() + { if($this->link) return mysql_insert_id($this->link); + return null; + } + + function free_result($rst) + { if($rst && $this->link) return mysql_free_result($rst); + return null; + } + + function close() + { if($this->link) return mysql_close($this->link); + return null; + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/impl/mw_xml.php b/web/app/data/impl/mw_xml.php new file mode 100644 index 0000000..b454cdd --- /dev/null +++ b/web/app/data/impl/mw_xml.php @@ -0,0 +1,180 @@ +init_xml_env($host, $base, $user, $password); + $this->EXTENTION_OK = true; + } + + function extention_ok(&$env) + { if($this->EXTENTION_OK) + { if + ( file_exists($env->app_file("data/impl/xml/mw_xml_data.php")) + && file_exists($env->app_file("data/impl/xml/mw_xml_data_handler.php")) + ) + { require $env->app_file("data/impl/xml/mw_xml_data.php"); + require $env->app_file("data/impl/xml/mw_xml_data_handler.php"); + if + ( class_exists("mw_xml_data") + && class_exists("mw_xml_data_handler") + ) + { $this->xml_data = new mw_xml_data($this->host, $this->base); + } + else $this->EXTENTION_OK = false; + } + else $this->EXTENTION_OK = false; + } + return $this->EXTENTION_OK; + } + + function init_xml_env($host, $base, $user, $password) + { $this->host = $host.($host && substr($host, -1) != "/" ? "/" : ""); + $this->base = $base.($base && substr($base, -1) != "/" ? "/" : ""); + $this->user = $user; + $this->password = $password; + $this->data_handlers = array(); + $this->last_data_handler = 0; + } + + function connect($host, $base, $user, $password) + { if($host.$base && is_dir($host.$base) && is_writable($host.$base)) + { $this->init_xml_env($host, $base, $user, $password); + $this->xml_data = new mw_xml_data($this->host, $this->base); + return true; + } + return null; + } + + function select_db($base) + { $this->base = $base.($base && substr($base, -1) != "/" ? "/" : ""); + return $this->connect($this->host, $this->base, $this->user, $this->password); + } + + function data_exists($data_path) + { return is_dir($this->host.$this->base.$data_path); + } + + function create_data($data_path) + { if(!is_dir($this->host.$this->base.$data_path)) @mkdir($this->host.$this->base.$data_path); + if(is_dir($this->host.$this->base.$data_path)) + { if($dh = $this->open_data($data_path, false)) + { $this->close_data($dh); + return true; + } + } + return null; + } + + function get_data($data_path, $data_id) + { $dh = ++$this->last_data_handler; + $this->data_handlers[$dh] = new mw_xml_data_handler($this->xml_data, $data_path); + if($this->data_handlers[$dh]->open_data(false)) + { $res = $this->data_handlers[$dh]->get_data($data_id); + $this->close_data($dh); + return $res; + } + return null; + } + + function open_data($data_path, $FETCH = true) + { $dh = ++$this->last_data_handler; + $this->data_handlers[$dh] = new mw_xml_data_handler($this->xml_data, $data_path); + if($this->data_handlers[$dh]->open_data($FETCH)) + { return $dh; + } + $this->close_data($dh); + return null; + } + + function fetch_data($dh) + { if(isset($this->data_handlers[$dh])) + { return $this->data_handlers[$dh]->fetch_assoc(); + } + return false; + } + + function add_data($data_path, $data) + { $dh = ++$this->last_data_handler; + $this->data_handlers[$dh] = new mw_xml_data_handler($this->xml_data, $data_path); + if($this->data_handlers[$dh]->open_data(false)) + { $res = $this->data_handlers[$dh]->add_data($data); + if($res) $res = $this->last_index($dh); + $this->close_data($dh); + return $res; + } + return null; + } + + function last_index($dh) + { if(isset($this->data_handlers[$dh])) + { return $this->data_handlers[$dh]->last_index; + } + return null; + } + + function set_data($data_path, $data_id, $data) + { $dh = ++$this->last_data_handler; + $this->data_handlers[$dh] = new mw_xml_data_handler($this->xml_data, $data_path); + if($this->data_handlers[$dh]->open_data(false)) + { $res = $this->data_handlers[$dh]->set_data($data_id.".xml", $data); + $this->close_data($dh); + return $res; + } + return null; + } + + function del_data($data_path, $data_id) + { $dh = ++$this->last_data_handler; + $this->data_handlers[$dh] = new mw_xml_data_handler($this->xml_data, $data_path); + if($this->data_handlers[$dh]->open_data(false)) + { $res = $this->data_handlers[$dh]->del_data($data_id.".xml"); + $this->close_data($dh); + return $res; + } + return null; + } + + function close_data($dh) + { if(isset($this->data_handlers[$dh])) + { $this->data_handlers[$dh]->close_data(); + unset($this->data_handlers[$dh]); + } + } + + function remove_data($data_path) + { $OK = strlen($data_path) > 0; + if($OK && is_dir($this->host.$this->base.$data_path) && is_writable($this->host.$this->base.$data_path)) + { $data_path .= substr($data_path, -1) == "/" ? "" : "/"; + if($dh = opendir($this->host.$this->base.$data_path)) + { while($OK && ($file = readdir($dh)) !== false) + { if(is_dir($this->host.$this->base.$data_path.$file)) + { if($file != "." && $file != "..") $OK = $this->remove_data($data_path.$file); + } + else $OK = @unlink($this->host.$this->base.$data_path.$file); + } + closedir($dh); + } + else $OK = null; + } + else $OK = null; + if($OK) @rmdir($this->host.$this->base.$data_path); + return $OK; + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/impl/xml/mw_xml_data.php b/web/app/data/impl/xml/mw_xml_data.php new file mode 100644 index 0000000..628c0d2 --- /dev/null +++ b/web/app/data/impl/xml/mw_xml_data.php @@ -0,0 +1,105 @@ +host = $host.(substr($host, -1) != "/" ? "/" : ""); + $this->base = $base.(substr($base, -1) != "/" ? "/" : ""); + $this->cache = array(); + } + + function host() { return $this->host; } + function base() { return $this->base; } + + function use_cache() { return true; } + + function set_cache($data_name, $data, $data_id) + { if($this->use_cache()) + { $this->cache[$data_name] = $data; + $this->cache[$data_name]["id"] = $data_id; + } + } + + function get_data($data_path, $data_id) + { $data_name = $this->data_name($data_path, $data_id); + if(isset($this->cache[$data_name])) return $this->cache[$data_name]; + if($this->buffer = @file_get_contents($data_name)) + { if(($data = $this->parse_data()) !== false) + { $this->set_cache($data_name, $data, $data_id); + $data["id"] = $data_id; + return $data; + } + } + return false; + } + + function add_data($data_path, $data_id, $data) + { return $this->_set_data($data_path, $data_id, $data); + } + + function set_data($data_path, $data_id, $data) + { return $this->_set_data($data_path, $data_id, $data); + } + + function _set_data($data_path, $data_id, $data) + { if($fh = @fopen($this->data_name($data_path, $data_id), "w")) + { $this->buffer = $this->serialize_data($data); + if(@fwrite($fh, $this->buffer) !== false) + { @fclose($fh); + $this->buffer = null; + $data_name = $this->data_name($data_path, $data_id); + $this->set_cache($data_name, $data, $data_id); + return $data_id; + } + else + { @fclose($fh); + $this->buffer = null; + } + } + return null; + } + + function del_data($data_path, $data_id) + { $data_name = $this->data_name($data_path, $data_id); + if(isset($this->cache[$data_name])) unset($this->cache[$data_name]); + return @unlink($this->data_name($data_path, $data_id)); + } + + function data_name($data_path, $data_id) + { return $this->host.$this->base.$data_path.$data_id.".xml"; + } + + function parse_data() + { if(!isset($this->sxml)) $this->sxml = new sxml(); + $this->sxml->parse($this->buffer); + if(isset($this->sxml->data["tuple"][0])) + { $this->buffer = $this->sxml->data["tuple"][0]; + $v_rst = array(); + foreach($this->buffer["subs"] as $key => $value) + { $v_rst[$key] = $value[0]["data"]; + } + return $v_rst; + } + return false; + } + + function serialize_data($data) + { $this->buffer = "\n"; + foreach($data as $key => $value) + { if(isset($value)) $this->buffer .= " <".$key.">\n"; + } + $this->buffer .= "\n"; + return $this->buffer; + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/impl/xml/mw_xml_data_handler.php b/web/app/data/impl/xml/mw_xml_data_handler.php new file mode 100644 index 0000000..fb9e267 --- /dev/null +++ b/web/app/data/impl/xml/mw_xml_data_handler.php @@ -0,0 +1,128 @@ +xml_data = $xml_data; + $this->data_path = $data_path.(substr($data_path, -1) != "/" ? "/" : ""); + } + + function get_data($data_id) + { if(file_exists($this->xml_data->host().$this->xml_data->base().$this->data_path.$data_id.".xml")) + { return $this->xml_data->get_data($this->data_path, $data_id); + } + return false; + } + + function open_data($FETCH = true) + { clearstatcache(); + $INDEX_OK = false; + if($this->xml_data->host() && $this->xml_data->base() && $this->data_path) + { if(is_dir($this->xml_data->host().$this->xml_data->base().$this->data_path) && is_writable($this->xml_data->host().$this->xml_data->base().$this->data_path)) + { if(!file_exists($this->xml_data->host().$this->xml_data->base().$this->data_path.".index")) + { if($fh = @fopen($this->xml_data->host().$this->xml_data->base().$this->data_path.".index", "w+")) + { if(@fwrite($fh, "0")) + { $this->last_index = 0; + @fclose($fh); + $INDEX_OK = true; + } + else @fclose($fh); + } + } + else + { if(($this->buffer = @file_get_contents($this->xml_data->host().$this->xml_data->base().$this->data_path.".index")) !== false) + { if(preg_match("/^[0-9]+$/", $this->buffer)) + { $this->last_index = (int)$this->buffer; + $INDEX_OK = true; + } + } + } + } + } + if($INDEX_OK) + { if($FETCH) + { if($this->data_path_handler = @opendir($this->xml_data->host().$this->xml_data->base().$this->data_path)) + { return true; + } + else + { $this->close_data(); + return null; + } + } + else return true; + } + else + { $this->close_data(); + return null; + } + } + + function fetch_assoc() + { if($this->data_path_handler) + { $FORMAT_OK = false; + while(!$FORMAT_OK && ($data_file = @readdir($this->data_path_handler)) !== false) + { if(substr($data_file, 0, 1) != "." && substr($data_file, -4) == ".xml") $FORMAT_OK = true; + } + if($FORMAT_OK) return $this->xml_data->get_data($this->data_path, substr($data_file, 0, -4)); + } + return false; + } + + function add_data($data) + { $index = $this->inc_index(); + if(isset($index)) + { if(is_array($data)) return $this->xml_data->add_data($this->data_path, $index, $data); + } + return null; + } + + function inc_index() + { clearstatcache(); + if(isset($this->last_index)) + { $index = $this->last_index + 1; + if($fh = @fopen($this->xml_data->host().$this->xml_data->base().$this->data_path.".index", "w+")) + { if(@fwrite($fh, (string)$index)) + { $this->last_index = $index; + @fclose($fh); + return $index; + } + else @fclose($fh); + } + } + return null; + } + + function set_data($data_file, $data) + { if(preg_match("/^[0-9]+\.xml$/", $data_file)) + { if(is_writable($this->xml_data->host().$this->xml_data->base().$this->data_path.$data_file)) + { if(is_array($data)) + { return $this->xml_data->set_data($this->data_path, substr($data_file, 0, -4), $data); + } + } + } + return null; + } + + function del_data($data_file) + { if(preg_match("/^[0-9]+\.xml$/", $data_file)) + { if(is_file($this->xml_data->host().$this->xml_data->base().$this->data_path.$data_file)) + { return $this->xml_data->del_data($this->data_path, substr($data_file, 0, -4)); + } + } + return null; + } + + function close_data() + { $this->data_path= null; + if($this->data_path_handler) @closedir($this->data_path_handler); + $this->last_index = null; + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/modules/share/mw_data_check_instance.php b/web/app/data/modules/share/mw_data_check_instance.php new file mode 100644 index 0000000..772a093 --- /dev/null +++ b/web/app/data/modules/share/mw_data_check_instance.php @@ -0,0 +1,12 @@ + \ No newline at end of file diff --git a/web/app/data/modules/share/mw_data_images.php b/web/app/data/modules/share/mw_data_images.php new file mode 100644 index 0000000..01c1d71 --- /dev/null +++ b/web/app/data/modules/share/mw_data_images.php @@ -0,0 +1,28 @@ + $max_width || $img_infos[1] > $max_height) + { $r = $max_width / $img_infos[0]; + if($r * $img_infos[1] > $max_height) $r = $max_height / $img_infos[1]; + return array + ( "width" => floor($r * $img_infos[0]), + "height" => floor($r * $img_infos[1]) + ); + } + return array + ( "width" => $img_infos[0], + "height" => $img_infos[1] + ); + } + return false; + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/modules/share/mw_data_init.php b/web/app/data/modules/share/mw_data_init.php new file mode 100644 index 0000000..ae4df81 --- /dev/null +++ b/web/app/data/modules/share/mw_data_init.php @@ -0,0 +1,18 @@ +env; } + function sgbd() { return $this->sgbd; } + + function set_env(&$env) { $this->env = &$env; } + function set_sgbd(&$sgbd) { $this->sgbd = &$sgbd; } + + function table_prefix() { return false; } + + } + +?> \ No newline at end of file diff --git a/web/app/data/modules/share/mw_data_links.php b/web/app/data/modules/share/mw_data_links.php new file mode 100644 index 0000000..7af65db --- /dev/null +++ b/web/app/data/modules/share/mw_data_links.php @@ -0,0 +1,99 @@ +links = array(); + return true; + } + + function load_link(&$links, $v_path, $url, $intitule = "", $position = 0) + { if($path_item = array_shift($v_path)) + { if(!isset($links[$path_item])) $links[$path_item] = array + ( "nom" => $path_item, + "url" => $v_path ? null : $url, + "intitule" => $v_path ? null : $intitule, + "subs" => array(), + "position" => 0 + ); + if($v_path) $this->load_link($links[$path_item]["subs"], $v_path, $url, $intitule, $position); + else + { $links[$path_item]["nom"] = $path_item; + $links[$path_item]["url"] = $url; + $links[$path_item]["intitule"] = $intitule; + $links[$path_item]["position"] = $position; + } + } + } + + function valid_link_path($path) + { $v_path = explode("/", $path); + $SYNTAX_OK = true; + foreach($v_path as $i => $path_item) + { if($path_item) + { if(!preg_match("/^[a-zA-Z]+[a-zA-Z0-9\-_\.]*$/", $path_item)) + { $SYNTAX_OK = false; + break; + } + } + else unset($v_path[$i]); + } + return $v_path && $SYNTAX_OK ? $v_path : false; + } + + function get_link($path = null) + { if(!isset($this->links)) $this->init_links(); + if($this->links !== false) + { if(!isset($path)) return $this->links; + if($v_path = $this->valid_link_path($path)) + { return $this->_get_link($this->links, $v_path); + } + } + return false; + } + + function _get_link($links, $v_path) + { if($path_item = array_shift($v_path)) + { if(isset($links[$path_item])) + { if($v_path) return $this->_get_link($links[$path_item]["subs"], $v_path); + else return $links[$path_item]; + } + else return false; + } + } + + function set_link($path, $url, $intitule = "", $position = 0) + { if(!isset($this->links)) $this->init_links(); + if($v_path = $this->valid_link_path($path)) + { $this->load_link($this->links, $v_path, $url, $intitule, $position); + $this->links = $this->ordonne_links($this->links); + } + } + + function ordonne_links($links) + { if(!is_array($links)) return false; + $values = array_values($links); + $maximum = count($values); + while($maximum > 0) + { $maximumTemporaire = 0; + for($i = 0; $i < $maximum - 1; $i++) + { if($values[$i]["position"] > $values[$i + 1]["position"]) + { $tmp = $values[$i]; + $values[$i] = $values[$i + 1]; + $values[$i + 1] = $tmp; + $maximumTemporaire = $i + 1; + } + } + $maximum = $maximumTemporaire; + } + $res = array(); + foreach($values as $value) { if($value["nom"]) $res[$value["nom"]] = $value; } + foreach($res as $nom => $sub) { if($sub["subs"]) $res[$nom]["subs"] = $this->ordonne_links($res[$nom]["subs"]); } + return $res; + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/modules/share/mw_data_out_config.php b/web/app/data/modules/share/mw_data_out_config.php new file mode 100644 index 0000000..bdd8ead --- /dev/null +++ b/web/app/data/modules/share/mw_data_out_config.php @@ -0,0 +1,29 @@ +env(); + $config = array(); + if($env->out_file_exists("config.xml")) + { if($this->buffer = file_get_contents($env->out_file("config.xml"))) + { if(!isset($this->sxml)) $this->sxml = new sxml(); + $this->sxml->parse($this->buffer); + $this->buffer = $this->sxml->data["config"][0]; + if($this->buffer["subs"]) foreach($this->buffer["subs"] as $key => $value) + { $config[$key] = array + ( "type" => $value[0]["attrs"]["type"], + "default" => $value[0]["attrs"]["default"], + "text" => $value[0]["data"] + ); + } + } + else $config = false; + } + return $config; + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/modules/share/mw_data_utils.php b/web/app/data/modules/share/mw_data_utils.php new file mode 100644 index 0000000..17ba22b --- /dev/null +++ b/web/app/data/modules/share/mw_data_utils.php @@ -0,0 +1,77 @@ + 0) + { $maximumTemporaire = 0; + for($i = 0; $i < $maximum; $i++) + { if($values[$i][$key] > $values[$i + 1][$key]) + { $tmp = $values[$i]; + $values[$i] = $values[$i + 1]; + $values[$i + 1] = $tmp; + $maximumTemporaire = $i + 1; + } + } + $maximum = $maximumTemporaire; + } + $res = array(); + foreach($values as $value) if($value["id"]) $res[$value["id"]] = $value; + return $res; + } + */ + + function ordonne($list, $key, $order = "ASC") + { $values = array_values($list); + $maximum = count($values); + while($maximum > 0) + { $maximumTemporaire = 0; + for($i = 0; $i < $maximum; $i++) + { if + ( ($order == "ASC" && $values[$i][$key] > $values[$i + 1][$key]) + || ($order == "DESC" && $values[$i][$key] < $values[$i + 1][$key]) + ) + { $tmp = $values[$i]; + $values[$i] = $values[$i + 1]; + $values[$i + 1] = $tmp; + $maximumTemporaire = $i + 1; + } + } + $maximum = $maximumTemporaire; + } + $res = array(); + foreach($values as $value) if($value["id"]) $res[$value["id"]] = $value; + return $res; + } + + function upload($image, $upload_dir) + { $file = ""; + $upload_dir .= $upload_dir && (substr($upload_dir, -1) != "/") ? "/" : ""; + if($_FILES) + { if(isset($_FILES[$image])) + { if($_FILES[$image]["error"] == UPLOAD_ERR_OK) + { if(move_uploaded_file($_FILES[$image]["tmp_name"], $upload_dir.$_FILES[$image]["name"])) + { $file = $_FILES[$image]["name"]; + } + else $file = false; + } + else if($_FILES[$image]["error"] != UPLOAD_ERR_NO_FILE) $file = false; + } + else $file = false; + } + return $file; + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/modules/sql/mw_data_config.php b/web/app/data/modules/sql/mw_data_config.php new file mode 100644 index 0000000..280f5c1 --- /dev/null +++ b/web/app/data/modules/sql/mw_data_config.php @@ -0,0 +1,64 @@ +sgbd(); + $value = false; + if(isset($key)) + { $sql = + "SELECT `value` FROM #--config" + ." WHERE `key`=".$this->eq($key); + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + if($v_rst = $sgbd->fetch_assoc($rst)) $value = $v_rst["value"]; + else $value = ""; + $sgbd->free_result($rst); + } + else + { $value = array(); + $sql = + "SELECT * FROM #--config"; + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + while($v_rst = $sgbd->fetch_assoc($rst)) $value[$v_rst["key"]] = $v_rst["value"]; + $sgbd->free_result($rst); + } + return $value; + } + + function config_exists($key) + { $sgbd = $this->sgbd(); + $exists = false; + $sql = "SELECT count(*) as n FROM #--config" + ." WHERE `key`=".$this->eq($key); + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + if($v_rst = $sgbd->fetch_assoc($rst)) $exists = $v_rst["n"]; + $sgbd->free_result($rst); + return $exists; + } + + function set_config($key, $value) + { $sgbd = $this->sgbd(); + if($this->config_exists($key)) $sql = + "UPDATE #--config" + ." SET `value`=".$this->eq($value) + ." WHERE `key`=".$this->eq($key); + else $sql = + "INSERT INTO #--config" + ." VALUES(NULL, ".$this->eq($key).", ".$this->eq($value).")"; + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + return true; + } + + function del_config($key) + { $sgbd = $this->sgbd(); + return $sgbd->query("DELETE FROM #--config WHERE `key`=".$this->eq($key)) ? true : false; + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/modules/sql/mw_data_users.php b/web/app/data/modules/sql/mw_data_users.php new file mode 100644 index 0000000..b144ad6 --- /dev/null +++ b/web/app/data/modules/sql/mw_data_users.php @@ -0,0 +1,259 @@ +sgbd(); + $env = $this->env(); + $users = array("list" => array(), "total" => 0); + $SELECT = "SELECT *"; + $FROM = " FROM #--users"; + $WHERE = ""; + $WHERE .= (isset($alpha) ? ($WHERE ? " AND" : " WHERE")." LEFT(login, 1)=".$this->eq($alpha) : ""); + $WHERE .= (isset($status) ? ($WHERE ? " AND" : " WHERE")." status=".$this->eq($status) : ""); + $LIMIT = ($env->config("max_list") ? " LIMIT ".$env->config("max_list")." OFFSET ".$start : ""); + $sql = "SELECT count(*) as n FROM(".$SELECT.$FROM.$WHERE.") res"; + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + if($v_rst = $sgbd->fetch_assoc($rst)) $users["total"] = $v_rst["n"]; + $sgbd->free_result($rst); + if($users["total"] > 0) + { $sql = "SELECT * FROM(".$SELECT.$FROM.$WHERE.$LIMIT.") res"; + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + while($v_rst = $sgbd->fetch_assoc($rst)) $users["list"][$v_rst["id"]] = $v_rst; + $sgbd->free_result($rst); + } + return $users; + } + + function user_by_id($id) + { $sgbd = $this->sgbd(); + $user = array(); + $sql = "SELECT * from #--users WHERE id=".$this->eq($id); + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + if($v_rst = $sgbd->fetch_assoc($rst)) $user = $v_rst; + $sgbd->free_result($rst); + return $user; + } + + function user($login) + { $sgbd = $this->sgbd(); + $user = array(); + $sql = "SELECT * from #--users WHERE login=".$this->eq($login); + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + if($v_rst = $sgbd->fetch_assoc($rst)) $user = $v_rst; + $sgbd->free_result($rst); + return $user; + } + + function user_exists($login) + { $sgbd = $this->sgbd(); + $EXISTS = 0; + $sql = "SELECT count(*) as n from #--users WHERE login=".$this->eq($login); + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + if($v_rst = $sgbd->fetch_assoc($rst)) $EXISTS = $v_rst["n"]; + $sgbd->free_result($rst); + return $EXISTS; + } + + function add_user($login, $password, $email, $status) + { $sgbd = $this->sgbd(); + $sql = + "INSERT INTO #--users(login, password, email, status) VALUES" + ."( ".$this->eq($login) + .", ".$this->eq($password) + .", ".$this->eq($email) + .", ".$status + .")"; + return $sgbd->query($sql); + } + + function set_user($id, $login, $password, $email, $status) + { $sgbd = $this->sgbd(); + $sql = + "UPDATE #--users SET" + ." login=".$this->eq($login) + .", password=".$this->eq($password) + .", email=".$this->eq($email) + .", status=".$status + ." WHERE id=".$id; + return $sgbd->query($sql); + } + + function del_user($login) + { $sgbd = $this->sgbd(); + $sql = "DELETE FROM #--users WHERE login=".$this->eq($login); + return $sgbd->query($sql); + } + + # ---------------------------------------------------------------------------------------- + # status + # + + function status() + { if(!isset($this->user_status)) return false; + return $this->user_status; + } + + function init_user_status($status = array()) + { $sgbd = $this->sgbd(); + $this->user_status = array(); + $sql = "SELECT * FROM #--user_status"; + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + while($v_rst = $sgbd->fetch_assoc($rst)) $this->user_status[$v_rst["id"]] = $v_rst; + $sgbd->free_result($rst); + return $this->user_status; + } + + function init_action_status($status = array()) + { if(!isset($this->user_status)) return false; + $sgbd = $this->sgbd(); + $this->action_status = array(); + $sql = "SELECT * FROM #--action_status"; + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + while($v_rst = $sgbd->fetch_assoc($rst)) $this->action_status[$v_rst["id"]] = $v_rst; + $sgbd->free_result($rst); + return $this->action_status; + } + + function get_user_status() + { $user = $this->get_session_user(); + if($user && isset($user["status"])) return $user["status"]; + return 0; + } + + function get_action_status($mod, $controller = "index", $action = "index", $set_status = array()) + { $sgbd = $this->sgbd(); + $status = array(); + $sql = + "SELECT action, id_status" + ." FROM #--action_status" + ." WHERE action=".$this->eq($mod) + ." OR action=".$this->eq($mod."/".$controller) + ." OR action=".$this->eq($mod."/".$controller."/".$action); + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + while($v_rst = $sgbd->fetch_assoc($rst)) + { if(!isset($status[$v_rst["action"]])) $status[$v_rst["action"]] = array(); + $status[$v_rst["action"]][$v_rst["id_status"]] = true; + } + $sgbd->free_result($rst); + return $status; + } + + function creation_default_status() + { $sgbd = $this->sgbd(); + $default_status = 0; + $sql = "SELECT id FROM #--user_status WHERE creation_default=1 LIMIT 0,1"; + $rst = $sgbd->query($sql); + if(!isset($rst)) return false; + if($v_rst = $sgbd->fetch_assoc($rst)) $default_status = $v_rst["id"]; + $sgbd->free_result($rst); + return $default_status; + } + + # ---------------------------------------------------------------------------------------- + # log in / out + # + + function login($login, $password) + { if(($user = $this->user($login)) !== false) + { if($this->password_ok($user, $password)) + { if(!$this->set_session($user)) $user = false; + } + else + { $this->clear_session(); + $user = array(); + } + } + return $user; + } + + function logout() + { return $this->clear_session(); + } + + function user_ok($user) + { return + strcmp(md5($user["password"].$_SESSION["id"]), $_SESSION["pass"]) == 0 + && $_SESSION["ip"] == $_SERVER["REMOTE_ADDR"]; + } + + function password_ok($user, $password) + { return + strcmp(md5($user["password"].$_SESSION["id"]), $password) == 0 + && $_SESSION["ip"] == $_SERVER["REMOTE_ADDR"]; + } + + # ---------------------------------------------------------------------------------------- + # session + # + + function load_session() + { session_start(); + if(!isset($_SESSION["id"])) $this->clear_session(); + if + ( $user = + ( isset($_COOKIE["user"]) || isset($_SESSION["user"]) ? + $this->user(isset($_COOKIE["user"]) ? $_COOKIE["user"] : $_SESSION["user"]) + : array() + ) + ) + { if(isset($_COOKIE["user"])) $this->set_session($user); + if(!$this->user_ok($user)) + { $this->clear_session(); + $user = array(); + } + } + $this->_user = $user; + return $user; + } + + function set_session($user) + { $_SESSION["user"] = $user["login"]; + $_SESSION["pass"] = md5($user["password"].$_SESSION["id"]); + $env = $this->env(); + return setcookie("user", $user["login"], time() + (60 * 60 * 24 * 7), $env->path("web")); + } + + function clear_session() + { unset($_SESSION["user"]); + unset($_SESSION["pass"]); + $_SESSION["ip"] = $_SERVER["REMOTE_ADDR"]; + $_SESSION["id"] = md5(rand()); + $env = $this->env(); + return setcookie("user", "", 0, $env->path("web")); + } + + function get_session_user() { return $this->_user; } + + # ---------------------------------------------------------------------------------------- + # uploads + # + + function check_user_uploads_dir($user = null) + { $env = $this->env(); + $user_dir = $env->path("content")."uploads/".(isset($user) ? $user : $this->_user["id"]); + if(!file_exists($user_dir)) @mkdir($user_dir); + return file_exists($user_dir); + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/modules/xml/mw_data_config.php b/web/app/data/modules/xml/mw_data_config.php new file mode 100644 index 0000000..98d4607 --- /dev/null +++ b/web/app/data/modules/xml/mw_data_config.php @@ -0,0 +1,106 @@ +sgbd(); + $value = false; + if($rst = $sgbd->open_data("config")) + { if(isset($key)) + { while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { if($v_rst["key"] == $key) + { $value = $v_rst["value"]; + } + } + else $value = null; + } + } + else + { $value = array(); + while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { if(is_array($v_rst)) foreach($v_rst as $key => $_value) + { $value[$key] = $_value; + break; + } + } + else $value = null; + } + } + $sgbd->close_data($rst); + } + if(!isset($value)) return false; + return $value; + } + + function config_exists($key) + { $sgbd = $this->sgbd(); + $exists = 0; + if($rst = $sgbd->open_data("config")) + { while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { if(isset($v_rst[$key])) $exists++; + } + else + { $exists = false; + break; + } + } + $sgbd->close_data($rst); + } + else $exists = false; + return $exists; + } + + function set_config($key, $value) + { $sgbd = $this->sgbd(); + $FOUND = false; + if($rst = $sgbd->open_data("config")) + { while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { if(array_key_exists($key, $v_rst)) + { $FOUND = $sgbd->set_data("config", $v_rst["id"], array($key => $value)); + break; + } + } + else + { $FOUND = null; + break; + } + } + $sgbd->close_data($rst); + } + else $FOUND = null; + if(isset($FOUND)) + { if($FOUND) return true; + else + { if($sgbd->add_data("config", array($key => $value))) return true; + } + } + return false; + } + + function del_config($key) + { $ids = array(); + $sgbd = $this->sgbd(); + if($rst = $sgbd->open_data("config")) + { while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { if(isset($v_rst[$key]) && isset($v_rst["id"])) + { $ids[] = $v_rst["id"]; + } + } + else $ids = false; + } + $sgbd->close_data($rst); + } + if($ids === false) return false; + foreach($ids as $id) if(!$sgbd->del_data("config", $id)) return false; + return true; + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/modules/xml/mw_data_users.php b/web/app/data/modules/xml/mw_data_users.php new file mode 100644 index 0000000..cc84872 --- /dev/null +++ b/web/app/data/modules/xml/mw_data_users.php @@ -0,0 +1,427 @@ +sgbd(); + $env = $this->env(); + $users = array("list" => array(), "total" => 0); + $res = array(); + if($rst = $sgbd->open_data("users")) + { while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { if(!isset($alpha) || (isset($v_rst["login"]) && strtolower(substr($v_rst["login"], 0, 1)) == strtolower($alpha))) + { if(!isset($status) || (isset($v_rst["status"]) && $v_rst["status"] == $status)) + { $res[$v_rst["id"]] = $v_rst; + $users["total"]++; + } + } + } + else + { $res = false; + break; + } + } + $sgbd->close_data($rst); + if($res !== false) + { $n = 0; + foreach($res as $id_user => $user) + { $n++; + if(!$env->config("max_list") || ($n > $start && $n <= ($start + $env->config("max_list")))) + { $users["list"][$user["id"]] = $user; + if(!isset($this->users)) $this->users = array(); + $this->users[$user["id"]] = $user; + } + } + } + else $users = false; + } + else $users = false; + return $users; + } + + function user_by_id($id) + { if(!isset($this->users)) $this->users = array(); + if(isset($this->users[$id])) return $this->users[$id]; + $sgbd = $this->sgbd(); + if(($user = $sgbd->get_data("users", $id)) !== false) + { $this->users[$id] = $user; + } + return $user; + } + + function user($login) + { $sgbd = $this->sgbd(); + $user = array(); + if($rst = $sgbd->open_data("users")) + { while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { if(isset($v_rst["login"]) && $v_rst["login"] == $login) + { $user = $v_rst; + break; + } + } + else $user = false; + } + $sgbd->close_data($rst); + } + else $user = false; + if($user !== false) + { if(!isset($this->users)) $this->users = array(); + $this->users[$user["id"]] = $user; + } + return $user; + } + + function user_exists($login) + { $sgbd = $this->sgbd(); + $EXISTS = 0; + if($rst = $sgbd->open_data("users")) + { while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { if(isset($v_rst["login"]) && $v_rst["login"] == $login) + { $EXISTS++; + } + } + else + { $EXISTS = false; + break; + } + } + $sgbd->close_data($rst); + } + else $EXISTS = false; + return $EXISTS; + } + + function add_user($login, $password, $email, $status) + { $sgbd = $this->sgbd(); + return $sgbd->add_data + ( "users", + array + ( "login" => $login, + "password" => $password, + "email" => $email, + "status" => $status + ) + ); + } + + function set_user($id, $login, $password, $email, $status) + { $sgbd = $this->sgbd(); + return $sgbd->set_data + ( "users", + $id, + array + ( "login" => $login, + "password" => $password, + "email" => $email, + "status" => $status + ) + ); + } + + function del_user($login) + { if(($user = $this->user($login)) !== false) + { $sgbd = $this->sgbd(); + return $sgbd->del_data("users", $user["id"]); + } + return false; + } + + # ---------------------------------------------------------------------------------------- + # status + # + + function status() + { if(!isset($this->user_status)) return false; + return $this->user_status; + } + + function init_user_status($status = array()) + { $sgbd = $this->sgbd(); + $this->user_status = array(); + if($rst = $sgbd->open_data("user_status")) + { while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { $this->user_status[$v_rst["id"]] = $v_rst; + } + else + { $this->user_status = false; + break; + } + } + $sgbd->close_data($rst); + } + else $this->user_status = false; + if($status && $this->user_status !== false) + { foreach($status as $new_user_status) + { $id_status = false; + foreach($this->user_status as $user_status) if($new_user_status["nom"] == $user_status["nom"]) + { $id_status = $user_status["id"]; + break; + } + if($id_status) + { $SAME = true; + foreach($new_user_status as $status_key => $status_value) + { if(!isset($this->user_status[$id_status][$status_key]) || $this->user_status[$id_status][$status_key] != $status_value) + { $SAME = false; break; + } + } + if(!$SAME) + { if($sgbd->set_data("user_status", $id_status, $new_user_status)) $this->user_status[$id_status] = $new_user_status; + else { $this->user_status = false; break; } + } + } + else + { if($id_status = $sgbd->add_data("user_status", $new_user_status)) $this->user_status[$id_status] = $new_user_status; + else { $this->user_status = false; break; } + } + } + } + return $this->user_status; + } + + function init_action_status($status = array()) + { if(!isset($this->user_status)) return false; + $sgbd = $this->sgbd(); + $this->action_status = array(); + if($rst = $sgbd->open_data("action_status")) + { while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { $this->action_status[$v_rst["id"]] = $v_rst; + } + else + { $this->action_status = false; + break; + } + } + $sgbd->close_data($rst); + } + else $this->action_status = false; + if($status && $this->action_status !== false) + { $STATUS_OK = true; + foreach($status as $id_new_action_status => $new_action_status) + { $FOUND = $new_action_status["id_status"] == "0"; + if(!$FOUND) foreach($this->user_status as $user_status) + { if($new_action_status["id_status"] == $user_status["nom"]) + { $FOUND = true; + $status[$id_new_action_status]["id_status"] = $user_status["id"]; + } + } + if(!$FOUND) + { $STATUS_OK = false; + break; + } + } + if($STATUS_OK) + { foreach($status as $new_action_status) + { $id_status = false; + foreach($this->action_status as $action_status) + { if + ( $new_action_status["action"] == $action_status["action"] + && $new_action_status["id_status"] == $action_status["id_status"] + ) + { $id_status = $action_status["id"]; + break; + } + } + if($id_status) + { $SAME = true; + foreach($new_action_status as $status_key => $status_value) + { if(!isset($this->action_status[$id_status][$status_key]) || $this->action_status[$id_status][$status_key] != $status_value) + { $SAME = false; break; + } + } + if(!$SAME) + { if($id_status = $sgbd->add_data("action_status", $new_action_status)) $this->action_status[$id_status] = $new_action_status; + else { $this->action_status = false; break; } + } + } + else + { if($id_status = $sgbd->add_data("action_status", $new_action_status)) $this->action_status[$id_status] = $new_action_status; + else { $this->action_status = false; break; } + } + } + } + else $this->action_status = false; + } + return $this->action_status; + } + + function get_user_status() + { $user = $this->get_session_user(); + if($user && isset($user["status"])) return $user["status"]; + return 0; + } + + function get_action_status($mod, $controller = "index", $action = "index", $set_status = array()) + { $sgbd = $this->sgbd(); + if($rst = $sgbd->open_data("action_status")) + { while($status !==false && $v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst) && isset($v_rst["action"]) && isset($v_rst["id_status"])) + { if + ( $v_rst["action"] == $mod + || $v_rst["action"] == $mod."/".$controller + || $v_rst["action"] == $mod."/".$controller."/".$action + ) + { if(!isset($status[$v_rst["action"]])) $status[$v_rst["action"]] = array(); + $status[$v_rst["action"]][$v_rst["id_status"]] = true; + } + } + else $status = false; + } + $sgbd->close_data($rst); + } + else $status = false; + if($status !== false) + { if($set_status) + { foreach($set_status as $new_action_status) + { $id_status = false; + foreach($status as $user_status) if($new_user_status["nom"] == $user_status["nom"]) + { $id_status = $user_status["id"]; + break; + } + if($id_status) + { $SAME = true; + foreach($new_user_status as $status_key => $status_value) + { if(!isset($status[$id_status][$status_key]) || $status[$id_status][$status_key] != $status_value) + { $SAME = false; break; + } + } + if(!$SAME) + { if($sgbd->set_data("user_status", $id_status, $new_user_status)) $status[$id_status] = $new_user_status; + else { $status = false; break; } + } + } + else + { if($id_status = $sgbd->add_data("user_status", $new_user_status)) $status[$id_status] = $new_user_status; + else { $status = false; break; } + } + } + } + } + return $status; + } + + function creation_default_status() + { $sgbd = $this->sgbd(); + $default_status = 0; + if($rst = $sgbd->open_data("user_status")) + { while($v_rst = $sgbd->fetch_data($rst)) + { if(isset($v_rst)) + { if(isset($v_rst["creation_default"]) && $v_rst["creation_default"] == 1) + { $default_status = $v_rst["id"]; + break; + } + } + else + { $default_status = false; + break; + } + } + $sgbd->close_data($rst); + } + else $default_status = false; + return $default_status; + } + + # ---------------------------------------------------------------------------------------- + # log in / out + # + + function login($login, $password) + { if(($user = $this->user($login)) !== false) + { if($this->password_ok($user, $password)) + { if(!$this->set_session($user)) $user = false; + } + else + { $this->clear_session(); + $user = array(); + } + } + return $user; + } + + function logout() + { return $this->clear_session(); + } + + function user_ok($user) + { return + strcmp(md5($user["password"].$_SESSION["id"]), $_SESSION["pass"]) == 0 + && $_SESSION["ip"] == $_SERVER["REMOTE_ADDR"]; + } + + function password_ok($user, $password) + { return + strcmp(md5($user["password"].$_SESSION["id"]), $password) == 0 + && $_SESSION["ip"] == $_SERVER["REMOTE_ADDR"]; + } + + # ---------------------------------------------------------------------------------------- + # session + # + + function load_session() + { session_start(); + if(!isset($_SESSION["id"])) $this->clear_session(); + if + ( $user = + ( isset($_COOKIE["user"]) || isset($_SESSION["user"]) ? + $this->user(isset($_COOKIE["user"]) ? $_COOKIE["user"] : $_SESSION["user"]) + : array() + ) + ) + { if(isset($_COOKIE["user"])) $this->set_session($user); + if(!$this->user_ok($user)) + { $this->clear_session(); + $user = array(); + } + } + $this->_user = $user; + return $user; + } + + function set_session($user) + { $_SESSION["user"] = $user["login"]; + $_SESSION["pass"] = md5($user["password"].$_SESSION["id"]); + $env = $this->env(); + return setcookie("user", $user["login"], time() + (60 * 60 * 24 * 7), $env->path("web")); + } + + function clear_session() + { unset($_SESSION["user"]); + unset($_SESSION["pass"]); + $_SESSION["ip"] = $_SERVER["REMOTE_ADDR"]; + $_SESSION["id"] = md5(rand()); + $env = $this->env(); + return setcookie("user", "", 0, $env->path("web")); + } + + function get_session_user() { return $this->_user; } + + # ---------------------------------------------------------------------------------------- + # uploads + # + + function check_user_uploads_dir($user = null) + { $env = $this->env(); + $user_dir = $env->path("content")."uploads/".(isset($user) ? $user : $this->_user["id"]); + if(!file_exists($user_dir)) @mkdir($user_dir); + return file_exists($user_dir); + } + + } + +?> \ No newline at end of file diff --git a/web/app/data/mw_data.php b/web/app/data/mw_data.php new file mode 100644 index 0000000..c08fbb1 --- /dev/null +++ b/web/app/data/mw_data.php @@ -0,0 +1,8 @@ + \ No newline at end of file diff --git a/web/app/data/mw_sgbd.php b/web/app/data/mw_sgbd.php new file mode 100644 index 0000000..432ff33 --- /dev/null +++ b/web/app/data/mw_sgbd.php @@ -0,0 +1,109 @@ +sgbd_impl = $sgbd_impl; + $this->env = $env; + } + + function extention_ok() { return $this->sgbd_impl->extention_ok($this->env); } + + function connect($host, $base, $user, $password) + { return $this->sgbd_impl->connect($host, $base, $user, $password); + } + + function select_db($db_name) + { return $this->sgbd_impl->select_db($db_name); + } + + # --------------------------------------------------------------------------------- + # SQL + # + + function table_exists($table_name) + { return $this->sgbd_impl->table_exists + ( ($prefix_codes = array_keys($this->env->bdd("table_prefix"))) ? + str_replace($prefix_codes, array_values($this->env->bdd("table_prefix")), $table_name) + : $table_name + ); + } + + function query($sql) + { return $this->sgbd_impl->query + ( ($prefix_codes = array_keys($this->env->bdd("table_prefix"))) ? + str_replace($prefix_codes, array_values($this->env->bdd("table_prefix")), $sql) + : $sql + ); + } + + function insert_id() + { return $this->sgbd_impl->insert_id(); + } + + function fetch_assoc($rst) + { return $this->sgbd_impl->fetch_assoc($rst); + } + + function free_result($rst) + { return $this->sgbd_impl->free_result($rst); + } + + function close() + { return $this->sgbd_impl->close(); + } + + # --------------------------------------------------------------------------------- + # XML + # + + function data_exists($data_path) + { return $this->sgbd_impl->data_exists($data_path); + } + + function create_data($data_path) + { return $this->sgbd_impl->create_data($data_path); + } + + function get_data($data_path, $data_id) + { return $this->sgbd_impl->get_data($data_path, $data_id); + } + + function open_data($data_path, $FETCH = true) + { return $this->sgbd_impl->open_data($data_path, $FETCH); + } + + function fetch_data($dh) + { return $this->sgbd_impl->fetch_data($dh); + } + + function add_data($data_path, $data) + { return $this->sgbd_impl->add_data($data_path, $data); + } + + function last_index($dh) + { return $this->sgbd_impl->last_index($dh); + } + + function set_data($data_path, $data_id, $data) + { return $this->sgbd_impl->set_data($data_path, $data_id, $data); + } + + function del_data($data_path, $data_id) + { return $this->sgbd_impl->del_data($data_path, $data_id); + } + + function close_data($dh) + { return $this->sgbd_impl->close_data($dh); + } + + function remove_data($data_path) + { return $this->sgbd_impl->remove_data($data_path); + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/modules/mw_env_config.php b/web/app/env/modules/mw_env_config.php new file mode 100644 index 0000000..4357b06 --- /dev/null +++ b/web/app/env/modules/mw_env_config.php @@ -0,0 +1,114 @@ +bdd = $bdd; + $this->bdd["table_prefix"] = array(); + $this->CONFIG = isset($CONFIG) ? $CONFIG : array(); + $this->PARAMS = array(); + $xml_parser = new sxml(); + $app_config_file = $this->path("app")."config.xml"; + if(file_exists($app_config_file)) + { $xml_parser->parse(file_get_contents($app_config_file)); + $app_config = $xml_parser->data["config"][0]; + if(isset($app_config["subs"]["params"])) + { foreach($app_config["subs"]["params"][0]["subs"] as $param_key => $param_elt) + { $this->PARAMS[$param_key] = $param_elt[0]["data"]; + } + } + if(isset($app_config["subs"]["config"])) + { foreach($app_config["subs"]["config"][0]["subs"] as $config_key => $config_elt) + { $this->CONFIG[$config_key] = $config_elt[0]["data"]; + } + } + if(isset($app_config["subs"]["bdd"][0]["subs"]["table_prefix_code"])) + { $this->add_table_prefix + ( array + ( $app_config["subs"]["bdd"][0]["subs"]["table_prefix_code"][0]["data"] => $bdd["table_prefix"] + ) + ); + } + } + if(($plugins = $this->plugins("ASC")) !== false) + { foreach($plugins as $plugin_name => $plugin) + { $app_config_file = $this->path("plugins").$plugin_name."/app/config.xml"; + if(file_exists($app_config_file) && $plugin["installed"] && $plugin["enabled"]) + { $xml_parser->parse(file_get_contents($app_config_file)); + $app_config = $xml_parser->data["config"][0]; + if(isset($app_config["subs"]["params"])) + { foreach($app_config["subs"]["params"][0]["subs"] as $param_key => $param_elt) + { $this->PARAMS[$param_key] = $param_elt[0]["data"]; + } + } + if(isset($app_config["subs"]["config"])) + { foreach($app_config["subs"]["config"][0]["subs"] as $config_key => $config_elt) + { $this->CONFIG[$config_key] = $config_elt[0]["data"]; + } + } + if(isset($app_config["subs"]["bdd"][0]["subs"]["table_prefix_code"])) + { $this->add_table_prefix + ( array + ( $app_config["subs"]["bdd"][0]["subs"]["table_prefix_code"][0]["data"] => $bdd["table_prefix"] + ) + ); + } + } + } + $this->init_additional_get_params(); + } + else $this->erreur("impossible de lire les fichiers de configuration pour les plugins", true); + } + else $this->erreur("impossible de trouver le fichier de configuration pour l'installation", true); + } + + function get_config_file() { return $this->config_file; } + function set_config_file($config_file) { $this->config_file = $config_file; } + + function get_PATHES() { return $this->PATHES; } + function path($name) + { if(isset($this->PATHES[$name])) return $this->PATHES[$name]; + return ""; + } + function set_PATHES($PATHES) + { foreach($PATHES as $path_name => $path_value) + { if($path_value && substr($path_value, -1) != "/") $PATHES[$path_name] .= "/"; + } + $this->PATHES = $PATHES; + } + + function get_PARAMS() { return $this->PARAMS; } + function param($name) { return $this->PARAMS[$name]; } + + function get_CONFIG() { return $this->CONFIG; } + function config($name) { return $this->CONFIG[$name]; } + function set_config($config) + { if(is_array($config)) + { foreach($config as $key => $value) $this->CONFIG[$key] = $value; + return true; + } + return false; + } + + function get_bdd() { return $this->bdd; } + function bdd($name) { return $this->bdd[$name]; } + function set_bdd($key, $value) { $this->bdd[$key] = $value; } + function add_table_prefix($table_prefix) + { if(is_array($table_prefix)) + { foreach($table_prefix as $prefix_code => $prefix) $this->bdd["table_prefix"][$prefix_code] = $prefix; + return true; + } + return false; + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/modules/mw_env_data.php b/web/app/env/modules/mw_env_data.php new file mode 100644 index 0000000..cc0e711 --- /dev/null +++ b/web/app/env/modules/mw_env_data.php @@ -0,0 +1,15 @@ +data = &$data; } + + function data() + { return $this->data; + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/modules/mw_env_init.php b/web/app/env/modules/mw_env_init.php new file mode 100644 index 0000000..8987f71 --- /dev/null +++ b/web/app/env/modules/mw_env_init.php @@ -0,0 +1,65 @@ +plugins()) !== false) + { foreach($plugins as $plugin_name => $plugin) + { $init_path = $this->path("plugins").$plugin_name."/app/init/"; + if + ( $plugin["installed"] + && $plugin["enabled"] + && file_exists($init_path) + && is_dir($init_path) + ) + { if($dh = opendir($init_path)) + { $files = array(); + while(($file = readdir($dh)) !== false) + { if + ( substr($file, 0, 1) != "." + && !is_dir($init_path.$file) + && strcmp(substr($file, -4), ".php") == 0 + && !isset($init_files[$file]) + ) $init_files[$file] = $init_path; + } + closedir($dh); + + } + else $this->erreur("impossible d'ouvrir le dossier init du plugin ".$plugin_name, true); + } + if($this->check_stop()) return; + } + $init_path = $this->path("app")."init/"; + if + ( file_exists($init_path) + && is_dir($init_path) + ) + { if($dh = opendir($init_path)) + { $files = array(); + while(($file = readdir($dh)) !== false) + { if + ( substr($file, 0, 1) != "." + && !is_dir($init_path.$file) + && strcmp(substr($file, -4), ".php") == 0 + ) $init_files[$file] = $init_path; + } + closedir($dh); + } + else $this->erreur("impossible d'ouvrir le dossier init du plugin ".$plugin_name, true); + } + } + if($this->check_stop()) return; + if($init_files) + { ksort($init_files); + foreach($init_files as $file => $init_path) + { require $init_path.$file; + if($this->check_stop()) return; + } + } + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/modules/mw_env_inputs.php b/web/app/env/modules/mw_env_inputs.php new file mode 100644 index 0000000..526285a --- /dev/null +++ b/web/app/env/modules/mw_env_inputs.php @@ -0,0 +1,42 @@ +path("libs")."inputfilter.php"; + $allowed_tags = array + ( "p", "span", "pre", "blockquote", "address", "hr", "br", + "img", + "strong", "em", "u", "i", "b", "s", + "a", + "ul", "ol", "li", + "h1", "h2", "h3", "h4", "h5", "h6" + ); + $allowed_attrs = array + ( "style", + "src", "alt", "width", "height", + "href", "title" + ); + $input_filter = new InputFilter($allowed_tags, $allowed_attrs); + $_POST = $input_filter->process($_POST); + } + if($_FILES) + { foreach($_FILES as $file_key => $file_infos) + { $v_name = explode(".", $file_infos["name"]); + $ext = strtolower($v_name[count($v_name) - 1]); + if + ( $ext != "png" + && $ext != "jpg" + && $ext != "jpeg" + && $ext != "gif" + ) unset($_FILES[$file_key]); + } + } + return true; + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/modules/mw_env_links.php b/web/app/env/modules/mw_env_links.php new file mode 100644 index 0000000..818ce44 --- /dev/null +++ b/web/app/env/modules/mw_env_links.php @@ -0,0 +1,23 @@ +data(); + return $data->init_links(); + } + + function get_link($path = null) + { $data = $this->data(); + return $data->get_link($path); + } + + function set_link($path, $url, $intitule = "", $position = 0) + { $data = $this->data(); + return $data->set_link($path, $url, $intitule, $position); + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/modules/mw_env_messages.php b/web/app/env/modules/mw_env_messages.php new file mode 100644 index 0000000..824b82f --- /dev/null +++ b/web/app/env/modules/mw_env_messages.php @@ -0,0 +1,35 @@ +set_etat("reponses/html/erreur", false); + $erreur = $this->out("erreur"); + if(!isset($erreur)) $erreur = array("messages" => array()); + $erreur["messages"][] = $message; + $this->set_out("erreur", $erreur); + } + } + + function message($message) + { $messages = $this->out("messages"); + if(!isset($messages)) $messages = array(); + $messages[] = $message; + $this->set_out("messages", $messages); + } + + function messages() + { $messages = $this->out("messages"); + if(isset($messages)) return $messages; + return array(); + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/modules/mw_env_out.php b/web/app/env/modules/mw_env_out.php new file mode 100644 index 0000000..17f1096 --- /dev/null +++ b/web/app/env/modules/mw_env_out.php @@ -0,0 +1,275 @@ +out[$key] = $value; return $value; } + function get_out() { return $this->out; } + function out($key) { return $this->out[$key]; } + + function out_pathes() + { $pathes = array(); + if($dh = opendir($this->path("out"))) + { while(($file = readdir($dh)) !== false) + { if(is_dir($this->path("out").$file) && substr($file, 0 ,1) != ".") $pathes[] = $file; + } + closedir($dh); + } + else $pathes = false; + return $pathes; + } + + function out_file_exists($file, $PRIORITE = "DESC") + { $out_file = $this->_out_file($file, $PRIORITE); + return $out_file ? true : false; + } + + function out_file($file, $PRIORITE = "DESC") + { $out_file = $this->_out_file($file, $PRIORITE); + return $out_file ? $out_file : $file; + } + + function _out_file($file, $PRIORITE = "DESC") + { $out_file = false; + if($PRIORITE == "ASC") + { $tmp_out_file = $this->path("out").$this->config("out").$file; + if($file && file_exists($tmp_out_file)) + { $out_file = $tmp_out_file; + } + if(!$out_file) + { $tmp_out_file = $this->path("out").$this->path("dist_out").$file; + if($file && file_exists($tmp_out_file)) + { $out_file = $tmp_out_file; + } + } + } + if($out_file) return $out_file; + if(($plugins = $this->plugins($PRIORITE)) !== false) + { foreach($plugins as $plugin_name => $plugin) + { $tmp_out_file = $this->path("plugins").$plugin_name."/out/".$this->config("out").$file; + if($file && $plugin["installed"] && $plugin["enabled"] && file_exists($tmp_out_file)) + { $out_file = $tmp_out_file; + break; + } + if(!$out_file) + { $tmp_out_file = $this->path("plugins").$plugin_name."/out/".$this->path("dist_out").$file; + if($file && $plugin["installed"] && $plugin["enabled"] && file_exists($tmp_out_file)) + { $out_file = $tmp_out_file; + break; + } + } + } + if($PRIORITE == "DESC" && !$out_file) + { $tmp_out_file = $this->path("out").$this->config("out").$file; + if($file && file_exists($tmp_out_file)) + { $out_file = $tmp_out_file; + } + if(!$out_file) + { $tmp_out_file = $this->path("out").$this->path("dist_out").$file; + if($file && file_exists($tmp_out_file)) + { $out_file = $tmp_out_file; + } + } + } + } + return $out_file; + } + + # --------------------------------------------------------------------------------- + # out config + # + + function set_out_config($out_config) + { $this->out_config = $out_config; + return $this->out_config; + } + + function get_out_config() { return isset($this->out_config) ? $this->out_config : array(); } + + function out_config($name) + { if(isset($this->out_config)) + { $CONFIG = $this->get_CONFIG(); + return isset($CONFIG["out_".$name]) ? $CONFIG["out_".$name] : $this->out_config[$name]["default"]; + } + return null; + } + + # --------------------------------------------------------------------------------- + # layouts + # + + function layout() { return $this->layout; } + + function render_layout($layout = null) + { if(!isset($layout)) $layout = $this->init_layout(); + if(($plugins = $this->plugins("ASC")) !== false) + { foreach($plugins as $plugin_name => $plugin) + { if($plugin["installed"] && $plugin["enabled"]) + { $FOUND = false; + $functions_file = $this->path("plugins").$plugin_name."/out/".$this->config("out")."functions.php"; + if(file_exists($functions_file)) + { $FOUND = true; + require $functions_file; + } + if(!$FOUND) + { $functions_file = $this->path("plugins").$plugin_name."/out/".$this->path("dist_out")."functions.php"; + if($plugin["installed"] && $plugin["enabled"] && file_exists($functions_file)) + { require $functions_file; + } + } + } + } + $FOUND = false; + $functions_file = $this->path("out").$this->config("out")."functions.php"; + if(file_exists($functions_file)) + { $FOUND = true; + require $functions_file; + } + if(!$FOUND) + { $functions_file = $this->path("out").$this->path("dist_out")."functions.php"; + if(file_exists($functions_file)) + { require $functions_file; + } + } + if($layout["page"]) + { if($this->out_file_exists($layout["page"])) require $this->out_file($layout["page"]); + } + elseif($layout["content"]) + { if($this->out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + } + } + } + + function init_layout() + { $this->layout = array(); + $this->_init_layout("index"); + if(($mod = $this->etat("mod")) != "index") $this->_init_layout($mod); + return $this->get_layout(); + } + + function _init_layout($mod) + { if(($plugins = $this->plugins("ASC")) !== false) + { $layout_file = false; + $tmp_layout_file = $this->path("out").$this->config("out")."layouts/".$mod.".xml"; + if(file_exists($tmp_layout_file)) $layout_file = $tmp_layout_file; + if(!$layout_file) + { $tmp_layout_file = $this->path("out").$this->path("dist_out")."layouts/".$mod.".xml"; + if(file_exists($tmp_layout_file)) $layout_file = $tmp_layout_file; + } + if($layout_file) $this->load_layout($layout_file); + foreach($plugins as $plugin_name => $plugin) + { if($plugin["installed"] && $plugin["enabled"]) + { $layout_file = false; + $tmp_layout_file = $this->path("plugins").$plugin_name."/out/".$this->config("out")."layouts/".$mod.".xml"; + if(file_exists($tmp_layout_file)) $layout_file = $tmp_layout_file; + if(!$layout_file) + { $tmp_layout_file = $this->path("plugins").$plugin_name."/out/".$this->path("dist_out")."layouts/".$mod.".xml"; + if(file_exists($tmp_layout_file)) $layout_file = $tmp_layout_file; + } + if($layout_file) $this->load_layout($layout_file); + } + } + } + } + + function load_layout($layout_file) + { if(file_exists($layout_file)) + { $xml_parser = new sxml(); + $xml_parser->parse(file_get_contents($layout_file)); + $layout = $xml_parser->data; + if(isset($layout["layout"][0]["subs"])) + { foreach($layout["layout"][0]["subs"] as $mod => $mod_node) + { if(!isset($this->layout[$mod])) + { $this->layout[$mod] = array + ( "page" => null, + "content" => null, + "controllers" => array() + ); + } + if(isset($mod_node[0]["attrs"]["page"])) $this->layout[$mod]["page"] = $mod_node[0]["attrs"]["page"]; + if(isset($mod_node[0]["attrs"]["content"])) $this->layout[$mod]["content"] = $mod_node[0]["attrs"]["content"]; + if(isset($mod_node[0]["subs"])) + { foreach($mod_node[0]["subs"] as $controller => $controller_node) + { if(!isset($this->layout[$mod]["controllers"][$controller])) + { $this->layout[$mod]["controllers"][$controller] = array + ( "page" => null, + "content" => null, + "actions" => array() + ); + } + if(isset($controller_node[0]["attrs"]["page"])) $this->layout[$mod]["controllers"][$controller]["page"] = $controller_node[0]["attrs"]["page"]; + if(isset($controller_node[0]["attrs"]["content"])) $this->layout[$mod]["controllers"][$controller]["content"] = $controller_node[0]["attrs"]["content"]; + if(isset($controller_node[0]["subs"])) + { foreach($controller_node[0]["subs"] as $action => $action_node) + { if(!isset($this->layout[$mod]["controllers"][$controller]["actions"][$action])) + { $this->layout[$mod]["controllers"][$controller]["actions"][$action] = array + ( "page" => null, + "content" => null + ); + } + if(isset($action_node[0]["attrs"]["page"])) $this->layout[$mod]["controllers"][$controller]["actions"][$action]["page"] = $action_node[0]["attrs"]["page"]; + if(isset($action_node[0]["attrs"]["content"])) $this->layout[$mod]["controllers"][$controller]["actions"][$action]["content"] = $action_node[0]["attrs"]["content"]; + } + } + } + } + } + } + } + return false; + } + + function get_layout() + { $mod = $this->etat("mod"); + $controller = $this->etat("controller"); + $action = $this->etat("action"); + $content = ""; + if(isset($this->layout[$mod]["controllers"][$controller]["actions"][$action]["content"])) + { $content = $this->layout[$mod]["controllers"][$controller]["actions"][$action]["content"]; + } + else + { if(isset($this->layout[$mod]["controllers"][$controller]["content"])) + { $content = $this->layout[$mod]["controllers"][$controller]["content"]; + } + else + { if(isset($this->layout[$mod]["content"])) + { $content = $this->layout[$mod]["content"]; + } + else + { if(isset($this->layout["index"]["content"])) + { $content = $this->layout["index"]["content"]; + } + } + } + } + $page = ""; + if(isset($this->layout[$mod]["controllers"][$controller]["actions"][$action]["page"])) + { $page = $this->layout[$mod]["controllers"][$controller]["actions"][$action]["page"]; + } + else + { if(isset($this->layout[$mod]["controllers"][$controller]["page"])) + { $page = $this->layout[$mod]["controllers"][$controller]["page"]; + } + else + { if(isset($this->layout[$mod]["page"])) + { $page = $this->layout[$mod]["page"]; + } + else + { if(isset($this->layout["index"]["page"])) + { $content = $this->layout["index"]["page"]; + } + } + } + } + return array + ( "page" => $page, + "content" => $content + ); + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/modules/mw_env_plugins.php b/web/app/env/modules/mw_env_plugins.php new file mode 100644 index 0000000..fc4925b --- /dev/null +++ b/web/app/env/modules/mw_env_plugins.php @@ -0,0 +1,185 @@ +init_plugins($PRIORITE); + if($PRIORITE == "ASC") return $this->plugins_asc; + if($PRIORITE == "DESC") return $this->plugins_desc; + return false; + } + + # --------------------------------------------------------------------------------- + # init + # + + function init_plugins($PRIORITE = "ASC") + { if(isset($this->plugins_asc) || isset($this->plugins_desc)) + { if($PRIORITE == "ASC") + { if(!isset($this->plugins_asc)) $this->plugins_asc = $this->ordonne_plugins($this->plugins_desc, $PRIORITE); + } + elseif($PRIORITE == "DESC") + { if(!isset($this->plugins_desc)) $this->plugins_desc = $this->ordonne_plugins($this->plugins_asc, $PRIORITE); + } + return; + } + $plugins = array(); + if(!class_exists("mw_plugin")) + { require $this->path("app")."mw_plugin.php"; + if(!class_exists("mw_plugin")) + { $plugins = false; + return; + } + } + if(file_exists($this->path("plugins"))) + { if($dh = opendir($this->path("plugins"))) + { $OK = true; + while($OK && ($plugin_name = readdir($dh)) !== false) + { if(substr($plugin_name, 0 ,1) !== "." && is_dir($this->path("plugins").$plugin_name)) + { if(!isset($plugins[$plugin_name])) + { if(($plugin = $this->plugin_data($plugin_name)) !== false) + { $MAJ = false; + if(!isset($plugin["installed"]) || !isset($plugin["enabled"])) + { $plugin["installed"] = false; + $plugin["enabled"] = false; + $plugin["priorite"] = 0; + $MAJ = true; + } + if(!$plugin["installed"] && $plugin["enabled"]) { $plugin["enabled"] = false; $MAJ = true; } + if($MAJ) $OK = $this->set_plugin_data($plugin_name, $plugin); + if($OK) + { if(($plugin["impl"] = $this->plugin_impl($plugin_name)) !== false) + { $plugin["title"] = ($plugin_title = $this->plugin_call($plugin["impl"], "title")) ? $plugin_title : ""; + $plugin["description"] = ($plugin_description = $this->plugin_call($plugin["impl"], "description")) ? $plugin_description : ""; + $plugin["name"] = $plugin_name; + $plugins[$plugin_name] = $plugin; + } + } + } + else $OK = false; + } + } + if(!$OK) $plugins = false; + } + closedir($dh); + if($plugins !== false) + { if(file_exists($this->plugins_data_dir()) && is_dir($this->plugins_data_dir())) + { if($dh = opendir($this->plugins_data_dir())) + { $plugins_data_files = array(); + $OK = true; + while($OK && ($plugin_name = readdir($dh)) !== false) + { if(substr($plugin_name, 0 ,1) != "." && !is_dir($this->plugin_data_file($plugin_name))) + { if(!$plugins[$plugin_name]) $this->del_plugin_data($plugin_name); + } + if(!$OK) $plugins = false; + } + closedir($dh); + } + } + } + } + else $plugins = false; + } + if($plugins !== false) + { if($PRIORITE == "ASC") $this->plugins_asc = $this->ordonne_plugins($plugins, $PRIORITE); + elseif($PRIORITE == "DESC") $this->plugins_desc = $this->ordonne_plugins($plugins, $PRIORITE); + } + else + { $this->plugins_asc = false; + $this->plugins_desc = false; + } + } + + function ordonne_plugins($plugins, $PRIORITE = "ASC") + { $values = array_values($plugins); + $maximum = count($values); + while($maximum > 0) + { $maximumTemporaire = 0; + for($i = 0; $i < $maximum - 1; $i++) + { if + ( ($PRIORITE == "ASC" && $values[$i]["priorite"] > $values[$i + 1]["priorite"]) + || ($PRIORITE == "DESC" && $values[$i]["priorite"] < $values[$i + 1]["priorite"]) + ) + { $tmp = $values[$i]; + $values[$i] = $values[$i + 1]; + $values[$i + 1] = $tmp; + $maximumTemporaire = $i + 1; + } + } + $maximum = $maximumTemporaire; + } + $res = array(); + foreach($values as $value) if($value["name"]) $res[$value["name"]] = $value; + return $res; + } + + function plugin_call($impl, $method) { if(method_exists($impl, $method)) return $impl->$method($this); } + + # --------------------------------------------------------------------------------- + # impl + # + + function plugin_impl($plugin_name) + { $plugin = false; + if(file_exists($this->path("plugins"))) + { if(substr($plugin_name, 0 ,1) !== "." && is_dir($this->path("plugins").$plugin_name)) + { if(file_exists($this->path("plugins").$plugin_name."/".$plugin_name.".php")) + { require $this->path("plugins").$plugin_name."/".$plugin_name.".php"; + if(class_exists($plugin_name)) + { $plugin = new $plugin_name(); + } + } + } + } + return $plugin; + } + + # --------------------------------------------------------------------------------- + # data + # + + function plugins_data_dir() + { return $this->path("content")."data/plugins/"; + } + + function plugin_data_file($plugin_name) + { return $this->plugins_data_dir().$plugin_name; + } + + function plugin_data($plugin_name) + { $data_file = $this->plugin_data_file($plugin_name); + $data = array(); + if(file_exists($data_file)) + { if($content = file_get_contents($data_file)) + { $data = unserialize($content); + } + } + return $data; + } + + function set_plugin_data($plugin_name, $data) + { $data_file = $this->plugin_data_file($plugin_name); + $content = serialize($data); + $OK = false; + if($fh = fopen($data_file, "w")) + { if(fwrite($fh, $content) !== false) + { $OK = true; + } + fclose($fh); + } + return $OK; + } + + function del_plugin_data($plugin_name) + { $data_file = $this->plugin_data_file($plugin_name); + if(file_exists($data_file)) return @unlink($data_file); + return true; + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/modules/mw_env_run.php b/web/app/env/modules/mw_env_run.php new file mode 100644 index 0000000..ba47626 --- /dev/null +++ b/web/app/env/modules/mw_env_run.php @@ -0,0 +1,174 @@ +data(); + return $data->get_session_user(); + } + + function set_etat($etat, $valid_status = true) + { if(($this->etat = $this->valid_etat($etat)) !== false) + { if(!$valid_status || $this->status_ok($this->etat, false)) + { return $this->etat; + } + else $this->erreur("Vous n'avez pas le statut requis pour effectuer cette action"); + } + else $this->erreur("etat invalide"); + return false; + } + + function valid_etat($etat) + { $_etat = array(); + $_etat["mod"] = ""; + $_etat["controller"] = ""; + $_etat["action"] = ""; + if(is_array($etat)) + { $_etat["mod"] = isset($etat["mod"]) ? $etat["mod"] : ""; + $_etat["controller"] = isset($etat["controller"]) ? $etat["controller"] : ""; + $_etat["action"] = isset($etat["action"]) ? $etat["action"] : ""; + } + else + { $etat = explode("/", $etat); + foreach($etat as $etat_item) + { if($etat_item) + { if(!$_etat["mod"]) $_etat["mod"] = $etat_item; + else + { if(!$_etat["controller"]) $_etat["controller"] = $etat_item; + else + { if(!$_etat["action"]) $_etat["action"] = $etat_item; + break; + } + } + } + } + } + if(!$_etat["mod"]) + { $_etat["mod"] = "index"; + $_etat["controller"] = "index"; + $_etat["action"] = "index"; + } + else + { if(!$_etat["controller"]) + { $_etat["controller"] = "index"; + $_etat["action"] = "index"; + } + else + { if(!$_etat["action"]) $_etat["action"] = "index"; + } + } + if + ( is_array($_etat) + && count($_etat) == 3 + && isset($_etat["mod"]) && preg_match("/^[a-zA-Z0-9_]+$/", $_etat["mod"]) + && isset($_etat["controller"]) && preg_match("/^[a-zA-Z0-9_]+$/", $_etat["controller"]) + && isset($_etat["action"]) && preg_match("/^[a-zA-Z0-9_]+$/", $_etat["action"]) + ) return $_etat; + return false; + } + + function etat_is_valid() + { return $this->valid_etat($this->etat); + } + + function status_ok($etat, $CHECK_FORMAT = true) + { $OK = $this->config("default_allow"); + $data = $this->data(); + if($CHECK_FORMAT) $etat = $this->valid_etat($etat); + if($etat !== false) + { if(($user_status = $data->get_user_status()) !== false) + { if + ( ( $action_status = $data->get_action_status + ( $etat["mod"], + $etat["controller"], + $etat["action"] + ) + ) !== false + ) + { $action = $etat["mod"]."/".$etat["controller"]."/".$etat["action"]; + if(isset($action_status[$action])) + { $OK = $action_status[$action][0] || (isset($action_status[$action][$user_status]) && $action_status[$action][$user_status]); + } + else + { $action = $etat["mod"]."/".$etat["controller"]; + if(isset($action_status[$action])) + { $OK = $action_status[$action][0] || (isset($action_status[$action][$user_status]) && $action_status[$action][$user_status]); + } + else + { $action = $etat["mod"]; + if(isset($action_status[$action])) + { $OK = $action_status[$action][0] || (isset($action_status[$action][$user_status]) && $action_status[$action][$user_status]); + } + } + } + } + else $this->erreur("Impossible de lire les status des actions en base"); + } + else $this->erreur("Impossible de lire le statut de l'utilisateur courant"); + } + else $this->erreur("etat invalide"); + return $OK; + } + + function run($etat, $valid_status = true, $params = array(), $method = "GET") + { if($this->set_etat($etat, $valid_status)) + { $controller_file = "mods/".$this->etat("mod")."/".$this->etat("controller").".php"; + if($this->app_file_exists($controller_file = "mods/".$this->etat("mod")."/".$this->etat("controller").".php", "DESC")) + { if(!class_exists("mw_mod")) require $this->app_file("mods/mw_mod.php"); + if(!class_exists($controller_class = "mw_".$this->etat("mod")."_".$this->etat("controller"))) + { require $this->app_file($controller_file, "DESC"); + } + if(class_exists($controller_class)) + { $controller = new $controller_class(); + $action_method = $this->etat("action"); + if(method_exists($controller, $action_method)) + { foreach($params as $key => $value) + { switch(strtolower($method)) + { case "get": $_GET[$this->param($key)] = $value; break; + case "post": $_POST[$key] = $value; break; + default: break; + } + } + if(($controller_validate = $controller->validate($this)) === true) + { if(($controller_prepare_inputs = $controller->prepare_inputs($this)) === true) + { $controller->$action_method($this); + } + else $this->erreur($controller_prepare_inputs); + } + else $this->erreur($controller_validate); + } + else $this->erreur("Impossible de trouver l'action ".$this->etat("action")); + } + else $this->erreur("Impossible d'instancier le controleur ".$this->etat("controller")); + } + else $this->erreur("Impossible de trouver le controleur ".$this->etat("controller")." pour le module ".$this->etat("mod")); + } + else $this->erreur("Impossible d'effectuer cette action"); + } + + function etat($name) { return $this->etat[$name]; } + + function check_stop() + { return $this->etat("mod") == "reponses"; + } + + function get_mod($mod_name) + { if($etat = $this->valid_etat($mod_name)) + { if($this->app_file_exists($controller_file = "mods/".$etat["mod"]."/".$etat["controller"].".php")) + { if(!class_exists("mw_mod")) require $this->app_file("mods/mw_mod.php"); + if(!class_exists($controller_class = "mw_".$etat["mod"]."_".$etat["controller"])) + { require $this->app_file($controller_file); + } + if(class_exists($controller_class)) + { return new $controller_class(); + } + } + } + return false; + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/modules/mw_env_urls.php b/web/app/env/modules/mw_env_urls.php new file mode 100644 index 0000000..4a8c08a --- /dev/null +++ b/web/app/env/modules/mw_env_urls.php @@ -0,0 +1,47 @@ +additional_get_params = array(); + $_params = $_SERVER["QUERY_STRING"]; + $v_params = explode("&", $_params); + foreach($v_params as $param) + { if($param) + { $key = strpos($param, "=") === false ? $param : substr($param, 0, strpos($param, "=")); + $value = strpos($param, "=") === false ? "" : substr($param, strpos($param, "=") + 1); + if(!$this->is_a_param($key)) $this->additional_get_params[$key] = $value; + } + } + } + + function is_a_param($key) + { foreach($this->get_PARAMS() as $_key => $_value) if(strcmp($key, $_value) == 0) return true; + return false; + } + + function url($action = "", $_params = array(), $script_name = "index.php") + { if($action) $_params["e"] = $action; + $get_params = ""; + if(isset($this->additional_get_params)) foreach($this->additional_get_params as $key => $value) $get_params .= ($get_params ? "&" : "?").$key."=".$value; + foreach($_params as $key => $value) $get_params .= ($get_params ? "&" : "?").$this->param($key)."=".$value; + return $this->path("web").$script_name.$get_params; + } + + function redirect($url, $message, $wait = 1) + { $this->set_etat("reponses/html/redirect_javascript", false); + $this->set_out + ( "redirect", + array + ( "url" => str_replace("&", "&", $url), + "message" => $message, + "wait" => $wait + ) + ); + } + + } + +?> \ No newline at end of file diff --git a/web/app/env/mw_env.php b/web/app/env/mw_env.php new file mode 100644 index 0000000..8350609 --- /dev/null +++ b/web/app/env/mw_env.php @@ -0,0 +1,35 @@ +_app_file($file, $PRIORITE); + return $app_file ? true : false; + } + + function app_file($file, $PRIORITE = "ASC") + { $app_file = $this->_app_file($file, $PRIORITE); + return $app_file ? $app_file : $file; + } + + function _app_file($file, $PRIORITE = "ASC") + { $app_file = false; + if($PRIORITE == "ASC" && file_exists($this->path("app").$file)) return $this->path("app").$file; + if(($plugins = $this->plugins($PRIORITE)) !== false) + { foreach($plugins as $plugin_name => $plugin) + { if($file && $plugin["installed"] && $plugin["enabled"] && file_exists($this->path("plugins").$plugin_name."/app/".$file)) + { $app_file = $this->path("plugins").$plugin_name."/app/".$file; + break; + } + } + if($PRIORITE == "DESC" && !$app_file) + { if(file_exists($this->path("app").$file)) $app_file = $this->path("app").$file; + } + } + return $app_file; + } + + } + +?> \ No newline at end of file diff --git a/web/app/init/0100_functions.php b/web/app/init/0100_functions.php new file mode 100644 index 0000000..06f135d --- /dev/null +++ b/web/app/init/0100_functions.php @@ -0,0 +1,7 @@ +\n".htmlentities(print_r($content, true))."\n\n"; + } + +?> \ No newline at end of file diff --git a/web/app/init/0200_inputs.php b/web/app/init/0200_inputs.php new file mode 100644 index 0000000..e8759d0 --- /dev/null +++ b/web/app/init/0200_inputs.php @@ -0,0 +1,60 @@ + $v) + { unset($process[$key][$k]); + if(is_array($v)) + { $process[$key][stripslashes($k)] = $v; + $process[] = &$process[$key][stripslashes($k)]; + } + else $process[$key][stripslashes($k)] = stripslashes($v); + } + } + unset($process); + } + + + + /* + * + * decommentez la fin du fichier pour activer le filtrage + * des inputs (ici POST et FILES) + * + + if($_POST) + { require $this->path("libs")."inputfilter.php"; + $allowed_tags = array + ( "p", "span", "pre", "blockquote", "address", "hr", "br", + "img", + "strong", "em", "u", "i", "b", "s", + "a", + "ul", "ol", "li", + "h1", "h2", "h3", "h4", "h5", "h6" + ); + $allowed_attrs = array + ( "style", + "src", "alt", "width", "height", + "href", "title" + ); + $input_filter = new InputFilter($allowed_tags, $allowed_attrs); + $_POST = $input_filter->process($_POST); + } + + if($_FILES) + { foreach($_FILES as $file_key => $file_infos) + { $v_name = explode(".", $file_infos["name"]); + $ext = strtolower($v_name[count($v_name) - 1]); + if + ( $ext != "png" + && $ext != "jpg" + && $ext != "jpeg" + && $ext != "gif" + ) unset($_FILES[$file_key]); + } + } + + */ + +?> \ No newline at end of file diff --git a/web/app/init/0300_data.php b/web/app/init/0300_data.php new file mode 100644 index 0000000..b4dc586 --- /dev/null +++ b/web/app/init/0300_data.php @@ -0,0 +1,40 @@ +app_file("data/mw_sgbd.php"); + require $this->app_file("data/mw_data.php"); + if($this->app_file_exists("data/impl/mw_".$this->bdd("sgbd").".php")) + { require $this->app_file("data/impl/mw_".$this->bdd("sgbd").".php"); + if(class_exists($sgbd_impl = "mw_".$this->bdd("sgbd"))) + { if(($plugins = $this->plugins("DESC")) !== false) + { $data = new mw_data(true); + foreach($plugins as $plugin_name => $plugin) + { if($plugin["installed"] && $plugin["enabled"]) + { $data->load_modules($this->path("plugins").$plugin_name."/app/", "data/modules/share/"); + $data->load_modules($this->path("plugins").$plugin_name."/app/", "data/modules/".($this->bdd("sgbd") == "xml" ? "xml" : "sql")."/"); + } + } + $data->load_modules($this->path("app"), "data/modules/share/"); + $data->load_modules($this->path("app"), "data/modules/".($this->bdd("sgbd") == "xml" ? "xml" : "sql")."/"); + $sgbd = new mw_sgbd + ( new $sgbd_impl + ( $this->bdd("host"), + $this->bdd("base"), + $this->bdd("user"), + $this->bdd("password") + ), + $this + ); + if($sgbd->extention_ok()) + { $data->set_sgbd($sgbd); + $data->set_env($this); + $this->set_data($data); + } + else $this->erreur("L'extention php ".$this->bdd("sgbd")." n'est pas installée", true); + } + else $this->erreur("Impossible de lire les plugins pour charger les modules de donnees"); + } + else $this->erreur("Impossible de trouver la classe d'implementation du sgbd ".$this->bdd("sgbd"), true); + } + else $this->erreur("Impossible de trouver le fichier d'implementation du sgbd ".$this->bdd("sgbd"), true); + +?> \ No newline at end of file diff --git a/web/app/init/0400_config.php b/web/app/init/0400_config.php new file mode 100644 index 0000000..7affb17 --- /dev/null +++ b/web/app/init/0400_config.php @@ -0,0 +1,18 @@ +config()) !== false) + { $this->set_config($config); + $start_action_params_config = $this->config("start_action_params") ? @unserialize($this->config("start_action_params")) : array(); + $out_config = $this->config("out"); + $out_config .= $out_config && substr($out_config, -1) != "/" ? "/" : ""; + $this->set_config + ( array + ( "out" => $out_config, + "start_action_params" => $start_action_params_config + ) + ); + if($this->set_out_config($data->out_config()) === false) $this->erreur("Impossible de lire la configuration du template"); + } + else $this->erreur("Impossible de lire la configuration", true); + +?> \ No newline at end of file diff --git a/web/app/init/0500_users.php b/web/app/init/0500_users.php new file mode 100644 index 0000000..409a7fb --- /dev/null +++ b/web/app/init/0500_users.php @@ -0,0 +1,14 @@ +load_session() !== false) + { if($data->init_user_status($this->config("user_status")) !== false) + { if($data->init_action_status($this->config("action_status")) !== false) + { + } + else $this->erreur("Impossible de charger les statuts des actions", true); + } + else $this->erreur("Impossible de charger les statuts des utilisateurs", true); + } + else $this->erreur("Impossible de charger la session", true); + +?> \ No newline at end of file diff --git a/web/app/init/0600_check_instance.php b/web/app/init/0600_check_instance.php new file mode 100644 index 0000000..82f60fa --- /dev/null +++ b/web/app/init/0600_check_instance.php @@ -0,0 +1,11 @@ +check_instance()) !== false) + { if($check_instance_return === true) + { + } + else $this->erreur($check_instance_return, true); + } + else $this->erreur("Impossible de verifier l'integrité de la base de donné", true); + +?> \ No newline at end of file diff --git a/web/app/init/0700_links.php b/web/app/init/0700_links.php new file mode 100644 index 0000000..36d5537 --- /dev/null +++ b/web/app/init/0700_links.php @@ -0,0 +1,10 @@ +init_links()) + { $this->set_link("admin/config", $this->url("admin/config"), "Configuration", 10); + $this->set_link("admin/users", $this->url("admin/users"), "Utilisateurs", 20); + $this->set_link("admin/plugins", $this->url("admin/plugins"), "Plugins", 30); + } + else $this->erreur("impossible de charger les liens", true); + +?> \ No newline at end of file diff --git a/web/app/init/0800_init_plugins.php b/web/app/init/0800_init_plugins.php new file mode 100644 index 0000000..afd3247 --- /dev/null +++ b/web/app/init/0800_init_plugins.php @@ -0,0 +1,12 @@ +plugins("DESC")) !== false) + { foreach($plugins as $plugin_name => $plugin) + { if($plugin["installed"] && $plugin["enabled"]) + { if(!$plugin["impl"]->init($this)) $this->erreur("erreur lors de l'initialisation du plugin ".$plugin_name, true); + } + } + } + else $this->erreur("erreur lors de l'initialisation des plugins", true); + +?> \ No newline at end of file diff --git a/web/app/init/0900_pre_run.php b/web/app/init/0900_pre_run.php new file mode 100644 index 0000000..dbcbaeb --- /dev/null +++ b/web/app/init/0900_pre_run.php @@ -0,0 +1,5 @@ + \ No newline at end of file diff --git a/web/app/main.php b/web/app/main.php new file mode 100644 index 0000000..e6bfabe --- /dev/null +++ b/web/app/main.php @@ -0,0 +1,36 @@ +load_modules($PATHES["app"], "env/modules/"); + $env->set_config_file($config_file); + $env->set_PATHES($PATHES); + $env->init_plugins(); + $env->load_config($bdd, $CONFIG); + $env->init(); + $etat = ($etat === false ? false : ($etat ? $etat : (isset($_GET[$env->param("e")]) ? $_GET[$env->param("e")] : ""))); + if($etat !== false) $env->run($etat); + return $env; + } + else echo "
impossible de trouver le fichier env/mw_env.php
"; + } + else echo "
impossible de trouver le fichier ".$libs_path."empty_class.php
"; + } + else echo "
impossible de trouver le fichier ".$libs_path."sxml.php
"; + return false; + } + + function __mw_display($env) + { if($env->etat_is_valid()) $env->render_layout($env->init_layout()); + } + +?> \ No newline at end of file diff --git a/web/app/mods/admin/config.php b/web/app/mods/admin/config.php new file mode 100644 index 0000000..953f982 --- /dev/null +++ b/web/app/mods/admin/config.php @@ -0,0 +1,66 @@ +data(); + if(($CONFIG = $env->get_CONFIG()) !== false) + { if(!$CONFIG["out"]) $CONFIG["out"] = "dist"; + $env->set_out("config", $CONFIG); + if(($out_config = $env->get_out_config()) !== false) + { $env->set_out("out_config", $out_config); + if($env->set_out("out_pathes", $env->out_pathes()) !== false) + { if($_POST) + { $env->set_out("config", $_POST); + if(preg_match("/^[0-9]+$/", $_POST["max_list"])) + { if(!$_POST["contact_form"] || trim($_POST["email"])) + { $CONTINUE = true; + if($CONTINUE && $data->set_config("site_name", $_POST["site_name"])); + else $CONTINUE = false; + if($CONTINUE && $data->set_config("description", $_POST["description"])); + else $CONTINUE = false; + if($CONTINUE && $data->set_config("max_list", $_POST["max_list"])); + else $CONTINUE = false; + if($CONTINUE && $data->set_config("contact_form", $_POST["contact_form"] ? "1" : "0")); + else $CONTINUE = false; + if($CONTINUE && $data->set_config("email", $_POST["email"])); + else $CONTINUE = false; + if($CONTINUE && $data->set_config("captcha", $_POST["captcha"] ? "1" : "0")); + else $CONTINUE = false; + if($CONTINUE && $data->set_config("out", $_POST["out"])); + else $CONTINUE = false; + if($CONTINUE) + { foreach($out_config as $key => $values) + { if($data->set_config("out_".$key, isset($_POST["out_".$key]) ? $_POST["out_".$key] : "") === false) + { $CONTINUE = false; + break; + } + } + } + if($CONTINUE) $env->redirect + ( $env->url("admin/config"), + "la configuration a été enregistrée" + ); + else $env->erreur("Impossible d'enregistrer la configuration"); + } + else $env->message("merci de préciser un email pour le formulaire de contact"); + } + else $env->message("la taille maximum des listes doit être un nombre"); + } + } + else $env->erreur("Impossible de lire la liste des templates"); + } + else $env->erreur("Impossible de lire l configuration du templates"); + } + else $env->erreur("Impossible de lire la configuration"); + } + + } + +?> \ No newline at end of file diff --git a/web/app/mods/admin/index.php b/web/app/mods/admin/index.php new file mode 100644 index 0000000..5ef3ed7 --- /dev/null +++ b/web/app/mods/admin/index.php @@ -0,0 +1,11 @@ +run("admin/config"); + } + + } + +?> \ No newline at end of file diff --git a/web/app/mods/admin/plugins.php b/web/app/mods/admin/plugins.php new file mode 100644 index 0000000..fe804da --- /dev/null +++ b/web/app/mods/admin/plugins.php @@ -0,0 +1,163 @@ +plugins = $env->plugins("DESC")) === false) return "impossible de lire la liste des plugins"; + return true; + } + + function index(&$env) + { if($this->plugins !== false) + { if($_POST) + { $OK = true; + foreach($this->plugins as $plugin_name => $plugin) + { if(isset($_POST["priorite_".$plugin_name])) + { $this->plugins[$plugin_name]["priorite"] = $_POST["priorite_".$plugin_name]; + if(!preg_match("/^[0-9]+(\.[0-9]+)?$/", $_POST["priorite_".$plugin_name])) + { $env->message("les priorités des plugins doivent être des nombres"); + $OK = false; + break; + } + } + else $this->plugins[$plugin_name]["priorite"] = 0; + } + if($OK) + { foreach($this->plugins as $plugin_name => $plugin) + { $plugin_data = array + ( "installed" => $this->plugins[$plugin_name]["installed"], + "enabled" => $this->plugins[$plugin_name]["enabled"], + "priorite" => $this->plugins[$plugin_name]["priorite"] + ); + if(!$env->set_plugin_data($plugin_name, $plugin_data)) + { $env->erreur("impossible de mettre à jour la priorité du plugin ".$plugin_name); + $OK = false; + break; + } + } + if($OK) + { $env->redirect + ( $env->url("admin/plugins/index"), + "les priorités des plugins ont été enregistrées" + ); + } + } + } + $env->set_out("plugins", $this->plugins); + } + else $env->erreur("impossible de lire la liste des plugins"); + } + + function install(&$env) + { $plugin_name = $_GET[$env->param("id")]; + if(isset($this->plugins[$plugin_name])) + { $impl = $this->plugins[$plugin_name]["impl"]; + $res = $impl->install($env); + if($res === true) + { $plugin_data = array + ( "installed" => true, + "enabled" => false, + "priorite" => isset($this->plugins[$plugin_name]["priorite"]) ? $this->plugins[$plugin_name]["priorite"] : 0 + ); + if($env->set_plugin_data($plugin_name, $plugin_data)) + { $env->redirect + ( $env->url("admin/plugins/index"), + "le plugin a été installé" + ); + } + else $env->erreur("impossible de mettre à jour le statut du plugin ".$plugin_name); + } + else $env->erreur("erreur lors de l'installation du plugin ".$plugin_name."
".$res); + } + else $env->erreur("impossible de trouver le plugin ".$plugin_name); + } + + function uninstall(&$env) + { $plugin_name = $_GET[$env->param("id")]; + if(isset($this->plugins[$plugin_name])) + { $impl = $this->plugins[$plugin_name]["impl"]; + $res= $impl->uninstall($env); + if($res === true) + { $plugin_data = array + ( "installed" => false, + "enabled" => false, + "priorite" => isset($this->plugins[$plugin_name]["priorite"]) ? $this->plugins[$plugin_name]["priorite"] : 0 + ); + if($env->set_plugin_data($plugin_name, $plugin_data)) + { $env->redirect + ( $env->url("admin/plugins/index"), + "le plugin a été désinstallé" + ); + } + else $env->erreur("impossible de mettre à jour le statut du plugin ".$plugin_name); + } + else $env->erreur("erreur lors de la désinstallation du plugin ".$plugin_name."
".$res); + } + else $env->erreur("impossible de trouver le plugin ".$plugin_name); + } + + function enable(&$env) + { $plugin_name = $_GET[$env->param("id")]; + if(isset($this->plugins[$plugin_name])) + { if($this->plugins[$plugin_name]["installed"]) + { if(!$this->plugins[$plugin_name]["enabled"]) + { $impl = $this->plugins[$plugin_name]["impl"]; + $res = $impl->enable($env); + if($res === true) + { $plugin_data = array + ( "installed" => true, + "enabled" => true, + "priorite" => isset($this->plugins[$plugin_name]["priorite"]) ? $this->plugins[$plugin_name]["priorite"] : 0 + ); + if($env->set_plugin_data($plugin_name, $plugin_data)) + { $env->redirect + ( $env->url("admin/plugins/index"), + "le plugin a été activé" + ); + } + else $env->erreur("impossible de mettre à jour le statut du plugin ".$plugin_name); + } + else $env->erreur("erreur lors de l'activation du plugin ".$plugin_name."
".$res); + } + else $env->erreur("le plugin ".$plugin_name." est déjà actif"); + } + else $env->erreur("le plugin ".$plugin_name." n'est pas installé"); + } + else $env->erreur("impossible de trouver le plugin ".$plugin_name); + } + + function disable(&$env) + { $plugin_name = $_GET[$env->param("id")]; + if(isset($this->plugins[$plugin_name])) + { if($this->plugins[$plugin_name]["installed"]) + { if($this->plugins[$plugin_name]["enabled"]) + { $impl = $this->plugins[$plugin_name]["impl"]; + $res = $impl->disable($env); + if($res === true) + { $plugin_data = array + ( "installed" => true, + "enabled" => false, + "priorite" => isset($this->plugins[$plugin_name]["priorite"]) ? $this->plugins[$plugin_name]["priorite"] : 0 + ); + if($env->set_plugin_data($plugin_name, $plugin_data)) + { $env->redirect + ( $env->url("admin/plugins/index"), + "le plugin a été désactivé" + ); + } + else $env->erreur("impossible de mettre à jour le statut du plugin ".$plugin_name); + } + else $env->erreur("erreur lors de la désactivation du plugin ".$plugin_name."
".$res); + } + else $env->erreur("le plugin ".$plugin_name." est déjà inactif"); + } + else $env->erreur("le plugin ".$plugin_name." n'est pas installé"); + } + else $env->erreur("impossible de trouver le plugin ".$plugin_name); + } + + } + +?> \ No newline at end of file diff --git a/web/app/mods/admin/users.php b/web/app/mods/admin/users.php new file mode 100644 index 0000000..f175fdc --- /dev/null +++ b/web/app/mods/admin/users.php @@ -0,0 +1,147 @@ +data(); + if(($this->status = $data->status()) === false) return "impossible de lire la liste des statuts"; + return true; + } + + function index(&$env) + { $data = $env->data(); + if + ( $env->set_out + ( "users", + $data->users + ( $_GET[$env->param("start")] ? $_GET[$env->param("start")] : 0, + $_GET[$env->param("alpha")], + $_GET[$env->param("status")] + ) + ) !== false + ) + { if($this->status) + { $env->set_out("status", $this->status); + } + else $env->erreur("impossible de lire la liste des status"); + } + else $env->erreur("impossible de lire la liste des utilisateurs"); + } + + function add(&$env) + { $data = $env->data(); + if($this->status) + { $env->set_out("status", $this->status); + $env->set_out("user", array("status" => $data->creation_default_status())); + if($_POST) + { $env->set_out("user", $_POST); + if($_POST["login"]) + { if(($exists = $data->user($_POST["login"])) !== false) + { if(!$exists) + { $VALID = true; + if(!$_POST["email"]) + { $env->message("merci de preciser un email"); + $VALID = false; + } + if(!$_POST["password"]) + { $env->message("merci de preciser un mot de passe"); + $VALID = false; + } + if($_POST["password"] != $_POST["password_confirm"]) + { $env->message("la confirmation du mot de passe est incorrecte"); + $VALID = false; + } + if($VALID) + { if + ( $data->add_user + ( $_POST["login"], + md5($_POST["password"]), + $_POST["email"], + $_POST["status"] + ) + ) + $env->redirect + ( $env->url("admin/users"), + "l'utilisateur ".$_POST["login"]." a été ajouté" + ); + else $env->erreur("Impossible d'ajouter l'utilisateur"); + } + } + else $env->message("ce login existe déjà"); + } + else $env->erreur("impossible de savoir si cet login existe déjà"); + } + else $env->message("merci de préciser un login"); + } + } + else $env->erreur("impossible de lire la liste des status"); + } + + function edit(&$env) + { $data = $env->data(); + if($this->status) + { $env->set_out("status", $this->status); + if($env->set_out("user", $data->user($_GET[$env->param("id")]))) + { if($_POST) + { $user = $env->out("user"); + $id = $user["id"]; + $login = $user["login"]; + $password = $user["password"]; + $_POST["login"] = $login; + $env->set_out("user", $_POST); + $VALID = true; + if(!$_POST["email"]) + { $env->message("merci de preciser un email"); + $VALID = false; + } + if(isset($_POST["change_password"]) && $_POST["change_password"]) + { if(!$_POST["password"]) + { $env->message("merci de preciser un mot de passe"); + $VALID = false; + } + if($_POST["password"] != $_POST["password_confirm"]) + { $env->message("la confirmation du mot de passe est incorrecte"); + $VALID = false; + } + } + if($VALID) + { if + ( $data->set_user + ( $id, + $login, + isset($_POST["change_password"]) && $_POST["change_password"] ? md5($_POST["password"]) : $password, + $_POST["email"], + $_POST["status"] + ) + ) + $env->redirect + ( $env->url("admin/users"), + "l'utilisateur ".$login." a été modifié" + ); + else $env->erreur("Impossible de mettre à jour l'utilisateur"); + } + } + } + else $env->erreur("Impossible de lire les informations de cet utilisateur"); + } + else $env->erreur("impossible de lire la liste des status"); + } + + function del(&$env) + { $data = $env->data(); + if($env->set_out("user", $data->user($_GET[$env->param("id")]))) + { $user = $env->out("user"); + if($data->del_user($_GET[$env->param("id")])) $env->redirect + ( $env->url("admin/users"), + "l'utilisateur ".$user["login"]." a été supprimé" + ); + else $env->erreur("Impossible de supprimer l'utilisateur"); + } + else $env->erreur("Impossible de lire les informations de cet utilisateur"); + } + + } + +?> \ No newline at end of file diff --git a/web/app/mods/forms/contact.php b/web/app/mods/forms/contact.php new file mode 100644 index 0000000..d0fcc50 --- /dev/null +++ b/web/app/mods/forms/contact.php @@ -0,0 +1,72 @@ +path("libs")."ptitcaptcha.php")) require $this->path("libs")."ptitcaptcha.php"; + + class mw_forms_contact extends mw_mod + { + + function validate(&$env) + { if($pages_view_mod = $env->get_mod("pages/view")) + { return $pages_view_mod->validate(&$env); + } + return true; + } + + function index(&$env) + { if($env->config("contact_form") && $env->config("email")) + { if($_POST) + { if + ( $this->send + ( $env, + $_POST["email"], + "[".$env->config("site_name")."] nouveau message", + $_POST["message"], + $env->config("email"), + $env->config("captcha") + ) + ) + { $env->redirect + ( $env->url("index"), + "Le message a été envoyé", + 2 + ); + } + } + } + else $env->run("index"); + } + + function send(&$env, $from, $titre, $message, $dest, $captcha) + { $env->set_out("ENVOYE", false); + if($captcha && !file_exists($env->path("libs")."ptitcaptcha.php")) + { $env->erreur("fichier du captcha introuvable"); + return false; + } + if(!$captcha || PtitCaptchaHelper::checkCaptcha()) + { if($from) + { if($dest) + { if + ( mail + ( $dest, + $titre, + $message, + "From: ".$from."\r\n" + ."Reply-To: ".$from."\r\n" + ) + ) + { $env->set_out("ENVOYE", true); + return true; + } + else $env->erreur("Erreur à l'envoi du mail"); + } + else $env->erreur("Impossible de trouver l'email du destinataire"); + } + else $env->message("merci de préciser un email"); + } + else $env->message("anti-spam incorrect"); + return false; + } + + } + +?> \ No newline at end of file diff --git a/web/app/mods/index/index.php b/web/app/mods/index/index.php new file mode 100644 index 0000000..9894853 --- /dev/null +++ b/web/app/mods/index/index.php @@ -0,0 +1,19 @@ +config("start_action"); + if($start_action) + { $start_action_params = $env->config("start_action_params"); + if($start_action_params && is_array($start_action_params)) + { foreach($start_action_params as $key => $value) $_GET[$key] = $value; + } + $env->run($start_action); + } + } + + } + +?> \ No newline at end of file diff --git a/web/app/mods/mw_mod.php b/web/app/mods/mw_mod.php new file mode 100644 index 0000000..cfba689 --- /dev/null +++ b/web/app/mods/mw_mod.php @@ -0,0 +1,12 @@ +prepare_inputs(); } + + } + +?> \ No newline at end of file diff --git a/web/app/mods/reponses/html.php b/web/app/mods/reponses/html.php new file mode 100644 index 0000000..db13052 --- /dev/null +++ b/web/app/mods/reponses/html.php @@ -0,0 +1,19 @@ + \ No newline at end of file diff --git a/web/app/mods/users/compte.php b/web/app/mods/users/compte.php new file mode 100644 index 0000000..7a6c022 --- /dev/null +++ b/web/app/mods/users/compte.php @@ -0,0 +1,37 @@ +validation_result = true; + $this->validate_status($env); + $this->validate_user($env); + return true; + } + + function validate_status(&$env) + { $data = $env->data(); + if(($this->status = $data->status()) !== false) $this->validation_result = true; + else $this->validation_result = "impossible de lire la liste des statuts"; + } + + function validate_user(&$env) + { if($this->user = $env->user()) $this->validation_result = true; + else $this->validation_result = "Vous devez être identifier pour accéder à cette page"; + } + + function index(&$env) + { if($this->validation_result === true) + { $env->run("users/infos"); + } + } + + } + +?> \ No newline at end of file diff --git a/web/app/mods/users/identification.php b/web/app/mods/users/identification.php new file mode 100644 index 0000000..36b6d2b --- /dev/null +++ b/web/app/mods/users/identification.php @@ -0,0 +1,36 @@ +user()) + { $data = $env->data(); + if($data->login(trim($_POST['login']), trim($_POST['pass']))) + { $env->redirect + ( isset($_POST["from"]) ? urldecode($_POST["from"]) : $this->env->url(), + "Vous êtes maintenant identifié en tant que ".$_POST['login'] + ); + } + else $env->message("Idantifiants incorrects"); + } + else $env->message("Vous êtes déjà identifié"); + } + + function logout(&$env) + { $data = $env->data(); + if($data->logout()) + { $env->redirect + ( $env->url(), + "Vous n'êtes plus identifié sur le site" + ); + } + else $env->message("Erreur lors de la deconnection. il se peut que vous soyez encore identifié"); + } + + } + +?> \ No newline at end of file diff --git a/web/app/mods/users/index.php b/web/app/mods/users/index.php new file mode 100644 index 0000000..3cd2462 --- /dev/null +++ b/web/app/mods/users/index.php @@ -0,0 +1,11 @@ +run("users/infos"); + } + + } + +?> \ No newline at end of file diff --git a/web/app/mods/users/infos.php b/web/app/mods/users/infos.php new file mode 100644 index 0000000..0b0e427 --- /dev/null +++ b/web/app/mods/users/infos.php @@ -0,0 +1,73 @@ +users_compte_mod = $env->get_mod("users/compte")) + { $this->users_compte_mod->validation_result = true; + $this->users_compte_mod->validate_status($env); + $this->users_compte_mod->validate_user($env); + return $this->users_compte_mod->validation_result; + } + return "impossible de trouver le module users/compte"; + } + + function index(&$env) + { $env->run("users/infos/edit"); + } + + function edit(&$env) + { if(isset($this->users_compte_mod->user) && $this->users_compte_mod->user !== false) + { $user = $this->users_compte_mod->user; + if($_POST) + { $data = $env->data(); + $VALID = true; + if($_POST["email"]) $user["email"] = $_POST["email"]; + else + { $env->message("merci de preciser un email"); + $VALID = false; + } + if($VALID && isset($_POST["change_password"]) && $_POST["change_password"]) + { if($_POST["password"]) + { if($_POST["password"] == $_POST["password_confirm"]) + { $user["password"] = md5($_POST["password"]); + } + else + { $env->message("la confirmation du mot de passe est incorrecte"); + $VALID = false; + } + } + else + { $env->message("merci de preciser un mot de passe"); + $VALID = false; + } + } + if($VALID) + { if + ( $data->set_user + ( $user["id"], + $user["login"], + $user["password"], + $user["email"], + $user["status"] + ) + ) + $env->redirect + ( $env->url("users/infos"), + "vos informations ont été modifiées" + ); + else $env->erreur("Impossible de mettre à jour l'utilisateur"); + } + } + $env->set_out("user", $user); + $env->set_out("status", $this->users_compte_mod->status); + } + else $env->erreur("Impossible de lire les informations de l'utilisateur"); + } + + } + +?> \ No newline at end of file diff --git a/web/app/mw_plugin.php b/web/app/mw_plugin.php new file mode 100644 index 0000000..eb91f9d --- /dev/null +++ b/web/app/mw_plugin.php @@ -0,0 +1,38 @@ + \ No newline at end of file diff --git a/web/config.php b/web/config.php new file mode 100644 index 0000000..4ac10a1 --- /dev/null +++ b/web/config.php @@ -0,0 +1,65 @@ +mtweb"; + +?> \ No newline at end of file diff --git a/web/content/data/.htaccess b/web/content/data/.htaccess new file mode 100644 index 0000000..3a42882 --- /dev/null +++ b/web/content/data/.htaccess @@ -0,0 +1 @@ +Deny from all diff --git a/web/content/data/mysql/mtweb.sql b/web/content/data/mysql/mtweb.sql new file mode 100644 index 0000000..79d3c80 --- /dev/null +++ b/web/content/data/mysql/mtweb.sql @@ -0,0 +1,108 @@ +-- phpMyAdmin SQL Dump +-- version 3.3.2deb1 +-- http://www.phpmyadmin.net +-- +-- Serveur: localhost +-- Généré le : Dim 25 Décembre 2011 à 15:01 +-- Version du serveur: 5.1.41 +-- Version de PHP: 5.3.2-1ubuntu4.11 + +SET SQL_MODE="NO_AUTO_VALUE_ON_ZERO"; + +-- +-- Base de données: `mtweb` +-- + +-- -------------------------------------------------------- + +-- +-- Structure de la table `mw_action_status` +-- + +CREATE TABLE IF NOT EXISTS `mw_action_status` ( + `id` int(11) NOT NULL AUTO_INCREMENT, + `action` varchar(255) NOT NULL, + `id_status` int(11) NOT NULL, + PRIMARY KEY (`id`) +) ENGINE=MyISAM DEFAULT CHARSET=utf8 AUTO_INCREMENT=5 ; + +-- +-- Contenu de la table `mw_action_status` +-- + +INSERT INTO `mw_action_status` (`id`, `action`, `id_status`) VALUES +(1, 'admin', 1), +(2, 'users', 1), +(3, 'users', 2), +(4, 'users/identification', 0); + +-- -------------------------------------------------------- + +-- +-- Structure de la table `mw_config` +-- + +CREATE TABLE IF NOT EXISTS `mw_config` ( + `id` int(11) NOT NULL AUTO_INCREMENT, + `key` varchar(255) NOT NULL, + `value` text NOT NULL, + PRIMARY KEY (`id`) +) ENGINE=MyISAM DEFAULT CHARSET=utf8 AUTO_INCREMENT=20 ; + +-- +-- Contenu de la table `mw_config` +-- + +INSERT INTO `mw_config` (`id`, `key`, `value`) VALUES +(1, 'site_name', 'mtweb'), +(2, 'max_list', '10'), +(3, 'description', ''), +(4, 'out', 'dist'), +(5, 'start_action', ''), +(6, 'contact_form', '0'), +(8, 'email', ''), +(9, 'captcha', '0'), +(16, 'start_action_params', ''); + +-- -------------------------------------------------------- + +-- +-- Structure de la table `mw_users` +-- + +CREATE TABLE IF NOT EXISTS `mw_users` ( + `id` int(11) NOT NULL AUTO_INCREMENT, + `login` varchar(255) NOT NULL, + `password` varchar(255) NOT NULL, + `email` varchar(255) NOT NULL, + `status` int(11) NOT NULL, + PRIMARY KEY (`id`) +) ENGINE=MyISAM DEFAULT CHARSET=utf8 AUTO_INCREMENT=8 ; + +-- +-- Contenu de la table `mw_users` +-- + +INSERT INTO `mw_users` (`id`, `login`, `password`, `email`, `status`) VALUES +(1, 'admin', '25e4ee4e9229397b6b17776bfceaf8e7', 'admin@domain.tld', 1); + +-- -------------------------------------------------------- + +-- +-- Structure de la table `mw_user_status` +-- + +CREATE TABLE IF NOT EXISTS `mw_user_status` ( + `id` int(11) NOT NULL AUTO_INCREMENT, + `nom` varchar(255) NOT NULL, + `creation_default` tinyint(4) NOT NULL, + PRIMARY KEY (`id`) +) ENGINE=MyISAM DEFAULT CHARSET=utf8 AUTO_INCREMENT=3 ; + +-- +-- Contenu de la table `mw_user_status` +-- + +INSERT INTO `mw_user_status` (`id`, `nom`, `creation_default`) VALUES +(1, 'admin', 0), +(2, 'membre', 1); diff --git a/web/content/data/xml/mw/action_status/.index b/web/content/data/xml/mw/action_status/.index new file mode 100644 index 0000000..a6b4ce8 --- /dev/null +++ b/web/content/data/xml/mw/action_status/.index @@ -0,0 +1 @@ +176 \ No newline at end of file diff --git a/web/content/data/xml/mw/action_status/170.xml b/web/content/data/xml/mw/action_status/170.xml new file mode 100644 index 0000000..8e3fd22 --- /dev/null +++ b/web/content/data/xml/mw/action_status/170.xml @@ -0,0 +1,4 @@ + + + + diff --git a/web/content/data/xml/mw/action_status/171.xml b/web/content/data/xml/mw/action_status/171.xml new file mode 100644 index 0000000..c662bfd --- /dev/null +++ b/web/content/data/xml/mw/action_status/171.xml @@ -0,0 +1,4 @@ + + + + diff --git a/web/content/data/xml/mw/action_status/172.xml b/web/content/data/xml/mw/action_status/172.xml new file mode 100644 index 0000000..c8de13d --- /dev/null +++ b/web/content/data/xml/mw/action_status/172.xml @@ -0,0 +1,5 @@ + + + + + diff --git a/web/content/data/xml/mw/action_status/173.xml b/web/content/data/xml/mw/action_status/173.xml new file mode 100644 index 0000000..d037f86 --- /dev/null +++ b/web/content/data/xml/mw/action_status/173.xml @@ -0,0 +1,4 @@ + + + + diff --git a/web/content/data/xml/mw/config/.index b/web/content/data/xml/mw/config/.index new file mode 100644 index 0000000..4800c7d --- /dev/null +++ b/web/content/data/xml/mw/config/.index @@ -0,0 +1 @@ +58 \ No newline at end of file diff --git a/web/content/data/xml/mw/config/1.xml b/web/content/data/xml/mw/config/1.xml new file mode 100644 index 0000000..9a787f9 --- /dev/null +++ b/web/content/data/xml/mw/config/1.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/config/2.xml b/web/content/data/xml/mw/config/2.xml new file mode 100644 index 0000000..a9b669e --- /dev/null +++ b/web/content/data/xml/mw/config/2.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/config/21.xml b/web/content/data/xml/mw/config/21.xml new file mode 100644 index 0000000..e12352f --- /dev/null +++ b/web/content/data/xml/mw/config/21.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/config/22.xml b/web/content/data/xml/mw/config/22.xml new file mode 100644 index 0000000..60f4932 --- /dev/null +++ b/web/content/data/xml/mw/config/22.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/config/34.xml b/web/content/data/xml/mw/config/34.xml new file mode 100644 index 0000000..7b34699 --- /dev/null +++ b/web/content/data/xml/mw/config/34.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/config/39.xml b/web/content/data/xml/mw/config/39.xml new file mode 100644 index 0000000..09ef208 --- /dev/null +++ b/web/content/data/xml/mw/config/39.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/config/40.xml b/web/content/data/xml/mw/config/40.xml new file mode 100644 index 0000000..449c69f --- /dev/null +++ b/web/content/data/xml/mw/config/40.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/config/41.xml b/web/content/data/xml/mw/config/41.xml new file mode 100644 index 0000000..7ffdb60 --- /dev/null +++ b/web/content/data/xml/mw/config/41.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/config/55.xml b/web/content/data/xml/mw/config/55.xml new file mode 100644 index 0000000..590e811 --- /dev/null +++ b/web/content/data/xml/mw/config/55.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/config/56.xml b/web/content/data/xml/mw/config/56.xml new file mode 100644 index 0000000..4120eef --- /dev/null +++ b/web/content/data/xml/mw/config/56.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/config/57.xml b/web/content/data/xml/mw/config/57.xml new file mode 100644 index 0000000..15e20ee --- /dev/null +++ b/web/content/data/xml/mw/config/57.xml @@ -0,0 +1,3 @@ + + + diff --git a/web/content/data/xml/mw/user_status/.index b/web/content/data/xml/mw/user_status/.index new file mode 100644 index 0000000..bf0d87a --- /dev/null +++ b/web/content/data/xml/mw/user_status/.index @@ -0,0 +1 @@ +4 \ No newline at end of file diff --git a/web/content/data/xml/mw/user_status/1.xml b/web/content/data/xml/mw/user_status/1.xml new file mode 100644 index 0000000..fa722e0 --- /dev/null +++ b/web/content/data/xml/mw/user_status/1.xml @@ -0,0 +1,4 @@ + + admin + 0 + \ No newline at end of file diff --git a/web/content/data/xml/mw/user_status/2.xml b/web/content/data/xml/mw/user_status/2.xml new file mode 100644 index 0000000..93bb41f --- /dev/null +++ b/web/content/data/xml/mw/user_status/2.xml @@ -0,0 +1,4 @@ + + + + diff --git a/web/content/data/xml/mw/users/.index b/web/content/data/xml/mw/users/.index new file mode 100644 index 0000000..da2d398 --- /dev/null +++ b/web/content/data/xml/mw/users/.index @@ -0,0 +1 @@ +14 \ No newline at end of file diff --git a/web/content/data/xml/mw/users/14.xml b/web/content/data/xml/mw/users/14.xml new file mode 100644 index 0000000..c69b833 --- /dev/null +++ b/web/content/data/xml/mw/users/14.xml @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/index.php b/web/index.php new file mode 100644 index 0000000..1320ff3 --- /dev/null +++ b/web/index.php @@ -0,0 +1,8 @@ + \ No newline at end of file diff --git a/web/libs/empty_class.php b/web/libs/empty_class.php new file mode 100644 index 0000000..72c5cd9 --- /dev/null +++ b/web/libs/empty_class.php @@ -0,0 +1,114 @@ +root_inst = $this; + else $this->root_inst = $root_inst; + } + + function load_modules($modules_path, $current_modules, $core_modules = null) + { $this->_load_modules($modules_path, $current_modules, $this->root_inst, true); + if(isset($core_modules) && $current_modules != $core_modules) + { $this->_load_modules($modules_path, $core_modules, $this->root_inst, true); + } + } + + function _load_modules($modules_path, $modules_path_suffixe, $root_inst, $recursif = false) + { if(file_exists($modules_path.$modules_path_suffixe) && $dh = opendir($modules_path.$modules_path_suffixe)) + { while(($file = readdir($dh)) !== false) + { if(is_dir($modules_path.$modules_path_suffixe.$file)) + { if($recursif && substr($file, 0, 1) != ".") + { $this->_load_modules($modules_path, $modules_path_suffixe.$file."/", $root_inst, $recursif); + } + } + elseif(strcasecmp(substr($file, -4), ".php") == 0) + { $this->load($modules_path.$modules_path_suffixe.$file, $root_inst); + } + } + closedir($dh); + } + } + + function load($module_file, $root_inst) + { if($module_file && file_exists($module_file)) + { $v_path = explode("/", $module_file); + $file = $v_path[count($v_path) - 1]; + if(strcasecmp(substr($file, -4), ".php") == 0) + { $class_name = substr($file, 0, -4); + if(!class_exists($class_name)) + { require_once $module_file; + if(version_compare(PHP_VERSION, '5.0.0', '>=')) + { if(class_exists($class_name) && !isset($this->modules[$class_name])) + { $this->modules[$class_name] = new $class_name($root_inst); + } + } + else + { if(class_exists($class_name)) + { aggregate($this, $class_name); + } + } + } + } + } + } + + function __call($method_name, $arguments) + { return $this->empty_class_call($this->root_inst, $method_name, $arguments); + } + + function empty_class_call($inst, $method_name, $arguments) + { $r = false; + $args = ""; + foreach($arguments as $i => $arg) $args .= ($args ? ", " : "")."\$arguments[".$i."]"; + if(isset($inst->modules)) foreach($inst->modules as $module_name => $module) + { if(method_exists($module, $method_name)) + { eval("\$r = \$module->".$method_name."(".$args.");"); + break; + } + else + { $r = $this->empty_class_call($module, $method_name, $arguments); + if($r !== false) break; + } + } + return $r; + } + + } + +?> \ No newline at end of file diff --git a/web/libs/inputfilter.php b/web/libs/inputfilter.php new file mode 100644 index 0000000..b023bc0 --- /dev/null +++ b/web/libs/inputfilter.php @@ -0,0 +1,315 @@ +tagsArray = (array) $tagsArray; + $this->attrArray = (array) $attrArray; + $this->tagsMethod = $tagsMethod; + $this->attrMethod = $attrMethod; + $this->xssAuto = $xssAuto; + } + + /** + * Method to be called by another php script. Processes for XSS and specified bad code. + * @access public + * @param Mixed $source - input string/array-of-string to be 'cleaned' + * @return String $source - 'cleaned' version of input parameter + */ + function process($source) { + // clean all elements in this array + if (is_array($source)) { + foreach($source as $key => $value) + // filter element for XSS and other 'bad' code etc. + if (is_string($value)) $source[$key] = $this->remove($this->decode($value)); + return $source; + // clean this string + } else if (is_string($source)) { + // filter source for XSS and other 'bad' code etc. + return $this->remove($this->decode($source)); + // return parameter as given + } else return $source; + } + + /** + * Internal method to iteratively remove all unwanted tags and attributes + * @access protected + * @param String $source - input string to be 'cleaned' + * @return String $source - 'cleaned' version of input parameter + */ + function remove($source) { + $loopCounter=0; + // provides nested-tag protection + while($source != $this->filterTags($source)) { + $source = $this->filterTags($source); + $loopCounter++; + } + return $source; + } + + /** + * Internal method to strip a string of certain tags + * @access protected + * @param String $source - input string to be 'cleaned' + * @return String $source - 'cleaned' version of input parameter + */ + function filterTags($source) { + // filter pass setup + $preTag = NULL; + $postTag = $source; + // find initial tag's position + $tagOpen_start = strpos($source, '<'); + // interate through string until no tags left + while($tagOpen_start !== FALSE) { + // process tag interatively + $preTag .= substr($postTag, 0, $tagOpen_start); + $postTag = substr($postTag, $tagOpen_start); + $fromTagOpen = substr($postTag, 1); + // end of tag + $tagOpen_end = strpos($fromTagOpen, '>'); + if ($tagOpen_end === false) break; + // next start of tag (for nested tag assessment) + $tagOpen_nested = strpos($fromTagOpen, '<'); + if (($tagOpen_nested !== false) && ($tagOpen_nested < $tagOpen_end)) { + $preTag .= substr($postTag, 0, ($tagOpen_nested+1)); + $postTag = substr($postTag, ($tagOpen_nested+1)); + $tagOpen_start = strpos($postTag, '<'); + continue; + } + $tagOpen_nested = (strpos($fromTagOpen, '<') + $tagOpen_start + 1); + $currentTag = substr($fromTagOpen, 0, $tagOpen_end); + $tagLength = strlen($currentTag); + if (!$tagOpen_end) { + $preTag .= $postTag; + $tagOpen_start = strpos($postTag, '<'); + } + // iterate through tag finding attribute pairs - setup + $tagLeft = $currentTag; + $attrSet = array(); + $currentSpace = strpos($tagLeft, ' '); + // is end tag + if (substr($currentTag, 0, 1) == "/") { + $isCloseTag = TRUE; + list($tagName) = explode(' ', $currentTag); + $tagName = substr($tagName, 1); + // is start tag + } else { + $isCloseTag = FALSE; + list($tagName) = explode(' ', $currentTag); + } + // excludes all "non-regular" tagnames OR no tagname OR remove if xssauto is on and tag is blacklisted + if ((!preg_match("/^[a-z][a-z0-9]*$/i",$tagName)) || (!$tagName) || ((in_array(strtolower($tagName), $this->tagBlacklist)) && ($this->xssAuto))) { + $postTag = substr($postTag, ($tagLength + 2)); + $tagOpen_start = strpos($postTag, '<'); + // don't append this tag + continue; + } + // this while is needed to support attribute values with spaces in! + while ($currentSpace !== FALSE) { + $fromSpace = substr($tagLeft, ($currentSpace+1)); + $nextSpace = strpos($fromSpace, ' '); + $openQuotes = strpos($fromSpace, '"'); + $closeQuotes = strpos(substr($fromSpace, ($openQuotes+1)), '"') + $openQuotes + 1; + // another equals exists + if (strpos($fromSpace, '=') !== FALSE) { + // opening and closing quotes exists + if (($openQuotes !== FALSE) && (strpos(substr($fromSpace, ($openQuotes+1)), '"') !== FALSE)) + $attr = substr($fromSpace, 0, ($closeQuotes+1)); + // one or neither exist + else $attr = substr($fromSpace, 0, $nextSpace); + // no more equals exist + } else $attr = substr($fromSpace, 0, $nextSpace); + // last attr pair + if (!$attr) $attr = $fromSpace; + // add to attribute pairs array + $attrSet[] = $attr; + // next inc + $tagLeft = substr($fromSpace, strlen($attr)); + $currentSpace = strpos($tagLeft, ' '); + } + // appears in array specified by user + $tagFound = in_array(strtolower($tagName), $this->tagsArray); + // remove this tag on condition + if ((!$tagFound && $this->tagsMethod) || ($tagFound && !$this->tagsMethod)) { + // reconstruct tag with allowed attributes + if (!$isCloseTag) { + $attrSet = $this->filterAttr($attrSet); + $preTag .= '<' . $tagName; + for ($i = 0; $i < count($attrSet); $i++) + $preTag .= ' ' . $attrSet[$i]; + // reformat single tags to XHTML + if (strpos($fromTagOpen, "'; + else $preTag .= ' />'; + // just the tagname + } else $preTag .= ''; + } + // find next tag's start + $postTag = substr($postTag, ($tagLength + 2)); + $tagOpen_start = strpos($postTag, '<'); + } + // append any code after end of tags + $preTag .= $postTag; + return $preTag; + } + + /** + * Internal method to strip a tag of certain attributes + * @access protected + * @param Array $attrSet + * @return Array $newSet + */ + function filterAttr($attrSet) { + $newSet = array(); + // process attributes + for ($i = 0; $i xssAuto) && ((in_array(strtolower($attrSubSet[0]), $this->attrBlacklist)) || (substr($attrSubSet[0], 0, 2) == 'on')))) + continue; + // xss attr value filtering + if ($attrSubSet[1]) { + // strips unicode, hex, etc + $attrSubSet[1] = str_replace('&#', '', $attrSubSet[1]); + // strip normal newline within attr value + $attrSubSet[1] = preg_replace('/\s+/', '', $attrSubSet[1]); + // strip double quotes + $attrSubSet[1] = str_replace('"', '', $attrSubSet[1]); + // [requested feature] convert single quotes from either side to doubles (Single quotes shouldn't be used to pad attr value) + if ((substr($attrSubSet[1], 0, 1) == "'") && (substr($attrSubSet[1], (strlen($attrSubSet[1]) - 1), 1) == "'")) + $attrSubSet[1] = substr($attrSubSet[1], 1, (strlen($attrSubSet[1]) - 2)); + // strip slashes + $attrSubSet[1] = stripslashes($attrSubSet[1]); + } + // auto strip attr's with "javascript: + if ( ((strpos(strtolower($attrSubSet[1]), 'expression') !== false) && (strtolower($attrSubSet[0]) == 'style')) || + (strpos(strtolower($attrSubSet[1]), 'javascript:') !== false) || + (strpos(strtolower($attrSubSet[1]), 'behaviour:') !== false) || + (strpos(strtolower($attrSubSet[1]), 'vbscript:') !== false) || + (strpos(strtolower($attrSubSet[1]), 'mocha:') !== false) || + (strpos(strtolower($attrSubSet[1]), 'livescript:') !== false) + ) continue; + + // if matches user defined array + $attrFound = in_array(strtolower($attrSubSet[0]), $this->attrArray); + // keep this attr on condition + if ((!$attrFound && $this->attrMethod) || ($attrFound && !$this->attrMethod)) { + // attr has value + if ($attrSubSet[1]) $newSet[] = $attrSubSet[0] . '="' . $attrSubSet[1] . '"'; + // attr has decimal zero as value + else if ($attrSubSet[1] == "0") $newSet[] = $attrSubSet[0] . '="0"'; + // reformat single attributes to XHTML + else $newSet[] = $attrSubSet[0] . '="' . $attrSubSet[0] . '"'; + } + } + return $newSet; + } + + /** + * Try to convert to plaintext + * @access protected + * @param String $source + * @return String $source + */ + function decode($source) { + // url decode +// $source = html_entity_decode($source, ENT_QUOTES, "ISO-8859-1"); + $source = html_entity_decode($source, ENT_QUOTES, "UTF-8"); + // convert decimal + $source = preg_replace('/&#(\d+);/me',"chr(\\1)", $source); // decimal notation + // convert hex + $source = preg_replace('/&#x([a-f0-9]+);/mei',"chr(0x\\1)", $source); // hex notation + return $source; + } + + /** + * Method to be called by another php script. Processes for SQL injection + * @access public + * @param Mixed $source - input string/array-of-string to be 'cleaned' + * @param Buffer $connection - An open MySQL connection + * @return String $source - 'cleaned' version of input parameter + */ + function safeSQL($source, &$connection) { + // clean all elements in this array + if (is_array($source)) { + foreach($source as $key => $value) + // filter element for SQL injection + if (is_string($value)) $source[$key] = $this->quoteSmart($this->decode($value), $connection); + return $source; + // clean this string + } else if (is_string($source)) { + // filter source for SQL injection + if (is_string($source)) return $this->quoteSmart($this->decode($source), $connection); + // return parameter as given + } else return $source; + } + + /** + * @author Chris Tobin + * @author Daniel Morris + * @access protected + * @param String $source + * @param Resource $connection - An open MySQL connection + * @return String $source + */ + function quoteSmart($source, &$connection) { + // strip slashes + if (get_magic_quotes_gpc()) $source = stripslashes($source); + // quote both numeric and text + $source = $this->escapeString($source, $connection); + return $source; + } + + /** + * @author Chris Tobin + * @author Daniel Morris + * @access protected + * @param String $source + * @param Resource $connection - An open MySQL connection + * @return String $source + */ + function escapeString($string, &$connection) { + // depreciated function + if (version_compare(phpversion(),"4.3.0", "<")) mysql_escape_string($string); + // current function + else mysql_real_escape_string($string); + return $string; + } +} + +?> \ No newline at end of file diff --git a/web/libs/ptitcaptcha.php b/web/libs/ptitcaptcha.php new file mode 100644 index 0000000..6e24126 --- /dev/null +++ b/web/libs/ptitcaptcha.php @@ -0,0 +1,127 @@ +\"???\""; + } + + /** + * Generate input tag (must be in a form) + * + * @return input tag + */ + function generateInputTags() + { + return ""; + } + + /** + * Check if user input is correct + * + * @return boolean (true=correct, false=incorrect) + */ + function checkCaptcha() + { + if( isset($_POST['ptitcaptcha_entry']) && + $_POST['ptitcaptcha_entry'] == PtitCaptchaHelper::_getDisplayText($_POST['ptitcaptcha_key'])) + { + return true; + } + return false; + } + + /** + * Internal function + * + * @param string $pck + * @return string + */ + function _getDisplayText($pck) // internal function + { + $src=md5(PTITCAPTCHA_ENTROPY.$pck); + $txt=""; + for($i=0;$i \ No newline at end of file diff --git a/web/libs/sxml.php b/web/libs/sxml.php new file mode 100644 index 0000000..78533f3 --- /dev/null +++ b/web/libs/sxml.php @@ -0,0 +1,74 @@ +parser, XML_OPTION_CASE_FOLDING, 0); + dans la fonction parse($data) pour la prise en compte de la casse + +- if($attribs) $this->data['attrs'] = $attribs; + dans la fonction tag_open pour la prise en compte des attributs + +*/ + +class sxml +{ + var $parser; + var $error_code; + var $error_string; + var $current_line; + var $current_column; + var $data; + var $datas; + function parse($data) + { +// $this->parser = xml_parser_create('UTF-8'); + $this->data = array(); + $this->datas = array(); + $this->parser = xml_parser_create(); + xml_set_object($this->parser, $this); + xml_parser_set_option($this->parser, XML_OPTION_SKIP_WHITE, 1); + xml_parser_set_option($this->parser, XML_OPTION_CASE_FOLDING, 0); + xml_set_element_handler($this->parser, 'tag_open', 'tag_close'); + xml_set_character_data_handler($this->parser, 'cdata'); + if (!xml_parse($this->parser, $data)) + { + $this->data = array(); + $this->error_code = xml_get_error_code($this->parser); + $this->error_string = xml_error_string($this->error_code); + $this->current_line = xml_get_current_line_number($this->parser); + $this->current_column = xml_get_current_column_number($this->parser); + } + else + { + $this->data = $this->data['subs']; + } + xml_parser_free($this->parser); + } + + function tag_open($parser, $tag, $attribs) + { + $this->datas[] = &$this->data; + $this->data = &$this->data['subs'][$tag][]; + if($attribs) $this->data['attrs'] = $attribs; + + } + + function cdata($parser, $cdata) + { + @$this->data['data'] .= $cdata; + } + + function tag_close($parser, $tag) + { + $this->data =& $this->datas[count($this->datas)-1]; + array_pop($this->datas); + } +} + +?> \ No newline at end of file diff --git a/web/libs/tiny_mce/langs/en.js b/web/libs/tiny_mce/langs/en.js new file mode 100644 index 0000000..ea4a1b0 --- /dev/null +++ b/web/libs/tiny_mce/langs/en.js @@ -0,0 +1,170 @@ +tinyMCE.addI18n({en:{ +common:{ +edit_confirm:"Do you want to use the WYSIWYG mode for this textarea?", +apply:"Apply", +insert:"Insert", +update:"Update", +cancel:"Cancel", +close:"Close", +browse:"Browse", +class_name:"Class", +not_set:"-- Not set --", +clipboard_msg:"Copy/Cut/Paste is not available in Mozilla and Firefox.\nDo you want more information about this issue?", +clipboard_no_support:"Currently not supported by your browser, use keyboard shortcuts instead.", +popup_blocked:"Sorry, but we have noticed that your popup-blocker has disabled a window that provides application functionality. You will need to disable popup blocking on this site in order to fully utilize this tool.", +invalid_data:"Error: Invalid values entered, these are marked in red.", +more_colors:"More colors" +}, +contextmenu:{ +align:"Alignment", +left:"Left", +center:"Center", +right:"Right", +full:"Full" +}, +insertdatetime:{ +date_fmt:"%Y-%m-%d", +time_fmt:"%H:%M:%S", +insertdate_desc:"Insert date", +inserttime_desc:"Insert time", +months_long:"January,February,March,April,May,June,July,August,September,October,November,December", +months_short:"Jan,Feb,Mar,Apr,May,Jun,Jul,Aug,Sep,Oct,Nov,Dec", +day_long:"Sunday,Monday,Tuesday,Wednesday,Thursday,Friday,Saturday,Sunday", +day_short:"Sun,Mon,Tue,Wed,Thu,Fri,Sat,Sun" +}, +print:{ +print_desc:"Print" +}, +preview:{ +preview_desc:"Preview" +}, +directionality:{ +ltr_desc:"Direction left to right", +rtl_desc:"Direction right to left" +}, +layer:{ +insertlayer_desc:"Insert new layer", +forward_desc:"Move forward", +backward_desc:"Move backward", +absolute_desc:"Toggle absolute positioning", +content:"New layer..." +}, +save:{ +save_desc:"Save", +cancel_desc:"Cancel all changes" +}, +nonbreaking:{ +nonbreaking_desc:"Insert non-breaking space character" +}, +iespell:{ +iespell_desc:"Run spell checking", +download:"ieSpell not detected. Do you want to install it now?" +}, +advhr:{ +advhr_desc:"Horizontal rule" +}, +emotions:{ +emotions_desc:"Emotions" +}, +searchreplace:{ +search_desc:"Find", +replace_desc:"Find/Replace" +}, +advimage:{ +image_desc:"Insert/edit image" +}, +advlink:{ +link_desc:"Insert/edit link" +}, +xhtmlxtras:{ +cite_desc:"Citation", +abbr_desc:"Abbreviation", +acronym_desc:"Acronym", +del_desc:"Deletion", +ins_desc:"Insertion", +attribs_desc:"Insert/Edit Attributes" +}, +style:{ +desc:"Edit CSS Style" +}, +paste:{ +paste_text_desc:"Paste as Plain Text", +paste_word_desc:"Paste from Word", +selectall_desc:"Select All", +plaintext_mode_sticky:"Paste is now in plain text mode. Click again to toggle back to regular paste mode. After you paste something you will be returned to regular paste mode.", +plaintext_mode:"Paste is now in plain text mode. Click again to toggle back to regular paste mode." +}, +paste_dlg:{ +text_title:"Use CTRL+V on your keyboard to paste the text into the window.", +text_linebreaks:"Keep linebreaks", +word_title:"Use CTRL+V on your keyboard to paste the text into the window." +}, +table:{ +desc:"Inserts a new table", +row_before_desc:"Insert row before", +row_after_desc:"Insert row after", +delete_row_desc:"Delete row", +col_before_desc:"Insert column before", +col_after_desc:"Insert column after", +delete_col_desc:"Remove column", +split_cells_desc:"Split merged table cells", +merge_cells_desc:"Merge table cells", +row_desc:"Table row properties", +cell_desc:"Table cell properties", +props_desc:"Table properties", +paste_row_before_desc:"Paste table row before", +paste_row_after_desc:"Paste table row after", +cut_row_desc:"Cut table row", +copy_row_desc:"Copy table row", +del:"Delete table", +row:"Row", +col:"Column", +cell:"Cell" +}, +autosave:{ +unload_msg:"The changes you made will be lost if you navigate away from this page.", +restore_content:"Restore auto-saved content.", +warning_message:"If you restore the saved content, you will lose all the content that is currently in the editor.\n\nAre you sure you want to restore the saved content?." +}, +fullscreen:{ +desc:"Toggle fullscreen mode" +}, +media:{ +desc:"Insert / edit embedded media", +edit:"Edit embedded media" +}, +fullpage:{ +desc:"Document properties" +}, +template:{ +desc:"Insert predefined template content" +}, +visualchars:{ +desc:"Visual control characters on/off." +}, +spellchecker:{ +desc:"Toggle spellchecker", +menu:"Spellchecker settings", +ignore_word:"Ignore word", +ignore_words:"Ignore all", +langs:"Languages", +wait:"Please wait...", +sug:"Suggestions", +no_sug:"No suggestions", +no_mpell:"No misspellings found." +}, +pagebreak:{ +desc:"Insert page break." +}, +advlist:{ +types:"Types", +def:"Default", +lower_alpha:"Lower alpha", +lower_greek:"Lower greek", +lower_roman:"Lower roman", +upper_alpha:"Upper alpha", +upper_roman:"Upper roman", +circle:"Circle", +disc:"Disc", +square:"Square" +}}}); \ No newline at end of file diff --git a/web/libs/tiny_mce/license.txt b/web/libs/tiny_mce/license.txt new file mode 100644 index 0000000..60d6d4c --- /dev/null +++ b/web/libs/tiny_mce/license.txt @@ -0,0 +1,504 @@ + GNU LESSER GENERAL PUBLIC LICENSE + Version 2.1, February 1999 + + Copyright (C) 1991, 1999 Free Software Foundation, Inc. + 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + +[This is the first released version of the Lesser GPL. It also counts + as the successor of the GNU Library Public License, version 2, hence + the version number 2.1.] + + Preamble + + The licenses for most software are designed to take away your +freedom to share and change it. By contrast, the GNU General Public +Licenses are intended to guarantee your freedom to share and change +free software--to make sure the software is free for all its users. + + This license, the Lesser General Public License, applies to some +specially designated software packages--typically libraries--of the +Free Software Foundation and other authors who decide to use it. You +can use it too, but we suggest you first think carefully about whether +this license or the ordinary General Public License is the better +strategy to use in any particular case, based on the explanations below. + + When we speak of free software, we are referring to freedom of use, +not price. Our General Public Licenses are designed to make sure that +you have the freedom to distribute copies of free software (and charge +for this service if you wish); that you receive source code or can get +it if you want it; that you can change the software and use pieces of +it in new free programs; and that you are informed that you can do +these things. + + To protect your rights, we need to make restrictions that forbid +distributors to deny you these rights or to ask you to surrender these +rights. These restrictions translate to certain responsibilities for +you if you distribute copies of the library or if you modify it. + + For example, if you distribute copies of the library, whether gratis +or for a fee, you must give the recipients all the rights that we gave +you. You must make sure that they, too, receive or can get the source +code. If you link other code with the library, you must provide +complete object files to the recipients, so that they can relink them +with the library after making changes to the library and recompiling +it. And you must show them these terms so they know their rights. + + We protect your rights with a two-step method: (1) we copyright the +library, and (2) we offer you this license, which gives you legal +permission to copy, distribute and/or modify the library. + + To protect each distributor, we want to make it very clear that +there is no warranty for the free library. Also, if the library is +modified by someone else and passed on, the recipients should know +that what they have is not the original version, so that the original +author's reputation will not be affected by problems that might be +introduced by others. + + Finally, software patents pose a constant threat to the existence of +any free program. We wish to make sure that a company cannot +effectively restrict the users of a free program by obtaining a +restrictive license from a patent holder. Therefore, we insist that +any patent license obtained for a version of the library must be +consistent with the full freedom of use specified in this license. + + Most GNU software, including some libraries, is covered by the +ordinary GNU General Public License. This license, the GNU Lesser +General Public License, applies to certain designated libraries, and +is quite different from the ordinary General Public License. We use +this license for certain libraries in order to permit linking those +libraries into non-free programs. + + When a program is linked with a library, whether statically or using +a shared library, the combination of the two is legally speaking a +combined work, a derivative of the original library. The ordinary +General Public License therefore permits such linking only if the +entire combination fits its criteria of freedom. The Lesser General +Public License permits more lax criteria for linking other code with +the library. + + We call this license the "Lesser" General Public License because it +does Less to protect the user's freedom than the ordinary General +Public License. It also provides other free software developers Less +of an advantage over competing non-free programs. These disadvantages +are the reason we use the ordinary General Public License for many +libraries. However, the Lesser license provides advantages in certain +special circumstances. + + For example, on rare occasions, there may be a special need to +encourage the widest possible use of a certain library, so that it becomes +a de-facto standard. To achieve this, non-free programs must be +allowed to use the library. A more frequent case is that a free +library does the same job as widely used non-free libraries. In this +case, there is little to gain by limiting the free library to free +software only, so we use the Lesser General Public License. + + In other cases, permission to use a particular library in non-free +programs enables a greater number of people to use a large body of +free software. For example, permission to use the GNU C Library in +non-free programs enables many more people to use the whole GNU +operating system, as well as its variant, the GNU/Linux operating +system. + + Although the Lesser General Public License is Less protective of the +users' freedom, it does ensure that the user of a program that is +linked with the Library has the freedom and the wherewithal to run +that program using a modified version of the Library. + + The precise terms and conditions for copying, distribution and +modification follow. Pay close attention to the difference between a +"work based on the library" and a "work that uses the library". The +former contains code derived from the library, whereas the latter must +be combined with the library in order to run. + + GNU LESSER GENERAL PUBLIC LICENSE + TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION + + 0. This License Agreement applies to any software library or other +program which contains a notice placed by the copyright holder or +other authorized party saying it may be distributed under the terms of +this Lesser General Public License (also called "this License"). +Each licensee is addressed as "you". + + A "library" means a collection of software functions and/or data +prepared so as to be conveniently linked with application programs +(which use some of those functions and data) to form executables. + + The "Library", below, refers to any such software library or work +which has been distributed under these terms. A "work based on the +Library" means either the Library or any derivative work under +copyright law: that is to say, a work containing the Library or a +portion of it, either verbatim or with modifications and/or translated +straightforwardly into another language. (Hereinafter, translation is +included without limitation in the term "modification".) + + "Source code" for a work means the preferred form of the work for +making modifications to it. For a library, complete source code means +all the source code for all modules it contains, plus any associated +interface definition files, plus the scripts used to control compilation +and installation of the library. + + Activities other than copying, distribution and modification are not +covered by this License; they are outside its scope. The act of +running a program using the Library is not restricted, and output from +such a program is covered only if its contents constitute a work based +on the Library (independent of the use of the Library in a tool for +writing it). Whether that is true depends on what the Library does +and what the program that uses the Library does. + + 1. You may copy and distribute verbatim copies of the Library's +complete source code as you receive it, in any medium, provided that +you conspicuously and appropriately publish on each copy an +appropriate copyright notice and disclaimer of warranty; keep intact +all the notices that refer to this License and to the absence of any +warranty; and distribute a copy of this License along with the +Library. + + You may charge a fee for the physical act of transferring a copy, +and you may at your option offer warranty protection in exchange for a +fee. + + 2. You may modify your copy or copies of the Library or any portion +of it, thus forming a work based on the Library, and copy and +distribute such modifications or work under the terms of Section 1 +above, provided that you also meet all of these conditions: + + a) The modified work must itself be a software library. + + b) You must cause the files modified to carry prominent notices + stating that you changed the files and the date of any change. + + c) You must cause the whole of the work to be licensed at no + charge to all third parties under the terms of this License. + + d) If a facility in the modified Library refers to a function or a + table of data to be supplied by an application program that uses + the facility, other than as an argument passed when the facility + is invoked, then you must make a good faith effort to ensure that, + in the event an application does not supply such function or + table, the facility still operates, and performs whatever part of + its purpose remains meaningful. + + (For example, a function in a library to compute square roots has + a purpose that is entirely well-defined independent of the + application. Therefore, Subsection 2d requires that any + application-supplied function or table used by this function must + be optional: if the application does not supply it, the square + root function must still compute square roots.) + +These requirements apply to the modified work as a whole. If +identifiable sections of that work are not derived from the Library, +and can be reasonably considered independent and separate works in +themselves, then this License, and its terms, do not apply to those +sections when you distribute them as separate works. But when you +distribute the same sections as part of a whole which is a work based +on the Library, the distribution of the whole must be on the terms of +this License, whose permissions for other licensees extend to the +entire whole, and thus to each and every part regardless of who wrote +it. + +Thus, it is not the intent of this section to claim rights or contest +your rights to work written entirely by you; rather, the intent is to +exercise the right to control the distribution of derivative or +collective works based on the Library. + +In addition, mere aggregation of another work not based on the Library +with the Library (or with a work based on the Library) on a volume of +a storage or distribution medium does not bring the other work under +the scope of this License. + + 3. You may opt to apply the terms of the ordinary GNU General Public +License instead of this License to a given copy of the Library. To do +this, you must alter all the notices that refer to this License, so +that they refer to the ordinary GNU General Public License, version 2, +instead of to this License. (If a newer version than version 2 of the +ordinary GNU General Public License has appeared, then you can specify +that version instead if you wish.) Do not make any other change in +these notices. + + Once this change is made in a given copy, it is irreversible for +that copy, so the ordinary GNU General Public License applies to all +subsequent copies and derivative works made from that copy. + + This option is useful when you wish to copy part of the code of +the Library into a program that is not a library. + + 4. You may copy and distribute the Library (or a portion or +derivative of it, under Section 2) in object code or executable form +under the terms of Sections 1 and 2 above provided that you accompany +it with the complete corresponding machine-readable source code, which +must be distributed under the terms of Sections 1 and 2 above on a +medium customarily used for software interchange. + + If distribution of object code is made by offering access to copy +from a designated place, then offering equivalent access to copy the +source code from the same place satisfies the requirement to +distribute the source code, even though third parties are not +compelled to copy the source along with the object code. + + 5. A program that contains no derivative of any portion of the +Library, but is designed to work with the Library by being compiled or +linked with it, is called a "work that uses the Library". Such a +work, in isolation, is not a derivative work of the Library, and +therefore falls outside the scope of this License. + + However, linking a "work that uses the Library" with the Library +creates an executable that is a derivative of the Library (because it +contains portions of the Library), rather than a "work that uses the +library". The executable is therefore covered by this License. +Section 6 states terms for distribution of such executables. + + When a "work that uses the Library" uses material from a header file +that is part of the Library, the object code for the work may be a +derivative work of the Library even though the source code is not. +Whether this is true is especially significant if the work can be +linked without the Library, or if the work is itself a library. The +threshold for this to be true is not precisely defined by law. + + If such an object file uses only numerical parameters, data +structure layouts and accessors, and small macros and small inline +functions (ten lines or less in length), then the use of the object +file is unrestricted, regardless of whether it is legally a derivative +work. (Executables containing this object code plus portions of the +Library will still fall under Section 6.) + + Otherwise, if the work is a derivative of the Library, you may +distribute the object code for the work under the terms of Section 6. +Any executables containing that work also fall under Section 6, +whether or not they are linked directly with the Library itself. + + 6. As an exception to the Sections above, you may also combine or +link a "work that uses the Library" with the Library to produce a +work containing portions of the Library, and distribute that work +under terms of your choice, provided that the terms permit +modification of the work for the customer's own use and reverse +engineering for debugging such modifications. + + You must give prominent notice with each copy of the work that the +Library is used in it and that the Library and its use are covered by +this License. You must supply a copy of this License. If the work +during execution displays copyright notices, you must include the +copyright notice for the Library among them, as well as a reference +directing the user to the copy of this License. Also, you must do one +of these things: + + a) Accompany the work with the complete corresponding + machine-readable source code for the Library including whatever + changes were used in the work (which must be distributed under + Sections 1 and 2 above); and, if the work is an executable linked + with the Library, with the complete machine-readable "work that + uses the Library", as object code and/or source code, so that the + user can modify the Library and then relink to produce a modified + executable containing the modified Library. (It is understood + that the user who changes the contents of definitions files in the + Library will not necessarily be able to recompile the application + to use the modified definitions.) + + b) Use a suitable shared library mechanism for linking with the + Library. A suitable mechanism is one that (1) uses at run time a + copy of the library already present on the user's computer system, + rather than copying library functions into the executable, and (2) + will operate properly with a modified version of the library, if + the user installs one, as long as the modified version is + interface-compatible with the version that the work was made with. + + c) Accompany the work with a written offer, valid for at + least three years, to give the same user the materials + specified in Subsection 6a, above, for a charge no more + than the cost of performing this distribution. + + d) If distribution of the work is made by offering access to copy + from a designated place, offer equivalent access to copy the above + specified materials from the same place. + + e) Verify that the user has already received a copy of these + materials or that you have already sent this user a copy. + + For an executable, the required form of the "work that uses the +Library" must include any data and utility programs needed for +reproducing the executable from it. However, as a special exception, +the materials to be distributed need not include anything that is +normally distributed (in either source or binary form) with the major +components (compiler, kernel, and so on) of the operating system on +which the executable runs, unless that component itself accompanies +the executable. + + It may happen that this requirement contradicts the license +restrictions of other proprietary libraries that do not normally +accompany the operating system. Such a contradiction means you cannot +use both them and the Library together in an executable that you +distribute. + + 7. You may place library facilities that are a work based on the +Library side-by-side in a single library together with other library +facilities not covered by this License, and distribute such a combined +library, provided that the separate distribution of the work based on +the Library and of the other library facilities is otherwise +permitted, and provided that you do these two things: + + a) Accompany the combined library with a copy of the same work + based on the Library, uncombined with any other library + facilities. This must be distributed under the terms of the + Sections above. + + b) Give prominent notice with the combined library of the fact + that part of it is a work based on the Library, and explaining + where to find the accompanying uncombined form of the same work. + + 8. You may not copy, modify, sublicense, link with, or distribute +the Library except as expressly provided under this License. Any +attempt otherwise to copy, modify, sublicense, link with, or +distribute the Library is void, and will automatically terminate your +rights under this License. However, parties who have received copies, +or rights, from you under this License will not have their licenses +terminated so long as such parties remain in full compliance. + + 9. You are not required to accept this License, since you have not +signed it. However, nothing else grants you permission to modify or +distribute the Library or its derivative works. These actions are +prohibited by law if you do not accept this License. Therefore, by +modifying or distributing the Library (or any work based on the +Library), you indicate your acceptance of this License to do so, and +all its terms and conditions for copying, distributing or modifying +the Library or works based on it. + + 10. Each time you redistribute the Library (or any work based on the +Library), the recipient automatically receives a license from the +original licensor to copy, distribute, link with or modify the Library +subject to these terms and conditions. You may not impose any further +restrictions on the recipients' exercise of the rights granted herein. +You are not responsible for enforcing compliance by third parties with +this License. + + 11. If, as a consequence of a court judgment or allegation of patent +infringement or for any other reason (not limited to patent issues), +conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot +distribute so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you +may not distribute the Library at all. For example, if a patent +license would not permit royalty-free redistribution of the Library by +all those who receive copies directly or indirectly through you, then +the only way you could satisfy both it and this License would be to +refrain entirely from distribution of the Library. + +If any portion of this section is held invalid or unenforceable under any +particular circumstance, the balance of the section is intended to apply, +and the section as a whole is intended to apply in other circumstances. + +It is not the purpose of this section to induce you to infringe any +patents or other property right claims or to contest validity of any +such claims; this section has the sole purpose of protecting the +integrity of the free software distribution system which is +implemented by public license practices. Many people have made +generous contributions to the wide range of software distributed +through that system in reliance on consistent application of that +system; it is up to the author/donor to decide if he or she is willing +to distribute software through any other system and a licensee cannot +impose that choice. + +This section is intended to make thoroughly clear what is believed to +be a consequence of the rest of this License. + + 12. If the distribution and/or use of the Library is restricted in +certain countries either by patents or by copyrighted interfaces, the +original copyright holder who places the Library under this License may add +an explicit geographical distribution limitation excluding those countries, +so that distribution is permitted only in or among countries not thus +excluded. In such case, this License incorporates the limitation as if +written in the body of this License. + + 13. The Free Software Foundation may publish revised and/or new +versions of the Lesser General Public License from time to time. +Such new versions will be similar in spirit to the present version, +but may differ in detail to address new problems or concerns. + +Each version is given a distinguishing version number. If the Library +specifies a version number of this License which applies to it and +"any later version", you have the option of following the terms and +conditions either of that version or of any later version published by +the Free Software Foundation. If the Library does not specify a +license version number, you may choose any version ever published by +the Free Software Foundation. + + 14. If you wish to incorporate parts of the Library into other free +programs whose distribution conditions are incompatible with these, +write to the author to ask for permission. For software which is +copyrighted by the Free Software Foundation, write to the Free +Software Foundation; we sometimes make exceptions for this. Our +decision will be guided by the two goals of preserving the free status +of all derivatives of our free software and of promoting the sharing +and reuse of software generally. + + NO WARRANTY + + 15. BECAUSE THE LIBRARY IS LICENSED FREE OF CHARGE, THERE IS NO +WARRANTY FOR THE LIBRARY, TO THE EXTENT PERMITTED BY APPLICABLE LAW. +EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR +OTHER PARTIES PROVIDE THE LIBRARY "AS IS" WITHOUT WARRANTY OF ANY +KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE +LIBRARY IS WITH YOU. SHOULD THE LIBRARY PROVE DEFECTIVE, YOU ASSUME +THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + + 16. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN +WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY +AND/OR REDISTRIBUTE THE LIBRARY AS PERMITTED ABOVE, BE LIABLE TO YOU +FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR +CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE +LIBRARY (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING +RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A +FAILURE OF THE LIBRARY TO OPERATE WITH ANY OTHER SOFTWARE), EVEN IF +SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH +DAMAGES. + + END OF TERMS AND CONDITIONS + + How to Apply These Terms to Your New Libraries + + If you develop a new library, and you want it to be of the greatest +possible use to the public, we recommend making it free software that +everyone can redistribute and change. You can do so by permitting +redistribution under these terms (or, alternatively, under the terms of the +ordinary General Public License). + + To apply these terms, attach the following notices to the library. It is +safest to attach them to the start of each source file to most effectively +convey the exclusion of warranty; and each file should have at least the +"copyright" line and a pointer to where the full notice is found. + + + Copyright (C) + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation; either + version 2.1 of the License, or (at your option) any later version. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + +Also add information on how to contact you by electronic and paper mail. + +You should also get your employer (if you work as a programmer) or your +school, if any, to sign a "copyright disclaimer" for the library, if +necessary. Here is a sample; alter the names: + + Yoyodyne, Inc., hereby disclaims all copyright interest in the + library `Frob' (a library for tweaking knobs) written by James Random Hacker. + + , 1 April 1990 + Ty Coon, President of Vice + +That's all there is to it! + + diff --git a/web/libs/tiny_mce/plugins/advhr/css/advhr.css b/web/libs/tiny_mce/plugins/advhr/css/advhr.css new file mode 100644 index 0000000..0e22834 --- /dev/null +++ b/web/libs/tiny_mce/plugins/advhr/css/advhr.css @@ -0,0 +1,5 @@ +input.radio {border:1px none #000; background:transparent; vertical-align:middle;} +.panel_wrapper div.current {height:80px;} +#width {width:50px; vertical-align:middle;} +#width2 {width:50px; vertical-align:middle;} +#size {width:100px;} diff --git a/web/libs/tiny_mce/plugins/advhr/editor_plugin.js b/web/libs/tiny_mce/plugins/advhr/editor_plugin.js new file mode 100644 index 0000000..4d3b062 --- /dev/null +++ b/web/libs/tiny_mce/plugins/advhr/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.AdvancedHRPlugin",{init:function(a,b){a.addCommand("mceAdvancedHr",function(){a.windowManager.open({file:b+"/rule.htm",width:250+parseInt(a.getLang("advhr.delta_width",0)),height:160+parseInt(a.getLang("advhr.delta_height",0)),inline:1},{plugin_url:b})});a.addButton("advhr",{title:"advhr.advhr_desc",cmd:"mceAdvancedHr"});a.onNodeChange.add(function(d,c,e){c.setActive("advhr",e.nodeName=="HR")});a.onClick.add(function(c,d){d=d.target;if(d.nodeName==="HR"){c.selection.select(d)}})},getInfo:function(){return{longname:"Advanced HR",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advhr",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("advhr",tinymce.plugins.AdvancedHRPlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/advhr/editor_plugin_src.js b/web/libs/tiny_mce/plugins/advhr/editor_plugin_src.js new file mode 100644 index 0000000..0c652d3 --- /dev/null +++ b/web/libs/tiny_mce/plugins/advhr/editor_plugin_src.js @@ -0,0 +1,57 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.AdvancedHRPlugin', { + init : function(ed, url) { + // Register commands + ed.addCommand('mceAdvancedHr', function() { + ed.windowManager.open({ + file : url + '/rule.htm', + width : 250 + parseInt(ed.getLang('advhr.delta_width', 0)), + height : 160 + parseInt(ed.getLang('advhr.delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + // Register buttons + ed.addButton('advhr', { + title : 'advhr.advhr_desc', + cmd : 'mceAdvancedHr' + }); + + ed.onNodeChange.add(function(ed, cm, n) { + cm.setActive('advhr', n.nodeName == 'HR'); + }); + + ed.onClick.add(function(ed, e) { + e = e.target; + + if (e.nodeName === 'HR') + ed.selection.select(e); + }); + }, + + getInfo : function() { + return { + longname : 'Advanced HR', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advhr', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('advhr', tinymce.plugins.AdvancedHRPlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/advhr/js/rule.js b/web/libs/tiny_mce/plugins/advhr/js/rule.js new file mode 100644 index 0000000..b6cbd66 --- /dev/null +++ b/web/libs/tiny_mce/plugins/advhr/js/rule.js @@ -0,0 +1,43 @@ +var AdvHRDialog = { + init : function(ed) { + var dom = ed.dom, f = document.forms[0], n = ed.selection.getNode(), w; + + w = dom.getAttrib(n, 'width'); + f.width.value = w ? parseInt(w) : (dom.getStyle('width') || ''); + f.size.value = dom.getAttrib(n, 'size') || parseInt(dom.getStyle('height')) || ''; + f.noshade.checked = !!dom.getAttrib(n, 'noshade') || !!dom.getStyle('border-width'); + selectByValue(f, 'width2', w.indexOf('%') != -1 ? '%' : 'px'); + }, + + update : function() { + var ed = tinyMCEPopup.editor, h, f = document.forms[0], st = ''; + + h = ' + + + {#advhr.advhr_desc} + + + + + + + +
+ + +
+
+ + + + + + + + + + + + + +
+ + +
+
+
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/advimage/css/advimage.css b/web/libs/tiny_mce/plugins/advimage/css/advimage.css new file mode 100644 index 0000000..0a6251a --- /dev/null +++ b/web/libs/tiny_mce/plugins/advimage/css/advimage.css @@ -0,0 +1,13 @@ +#src_list, #over_list, #out_list {width:280px;} +.mceActionPanel {margin-top:7px;} +.alignPreview {border:1px solid #000; width:140px; height:140px; overflow:hidden; padding:5px;} +.checkbox {border:0;} +.panel_wrapper div.current {height:305px;} +#prev {margin:0; border:1px solid #000; width:428px; height:150px; overflow:auto;} +#align, #classlist {width:150px;} +#width, #height {vertical-align:middle; width:50px; text-align:center;} +#vspace, #hspace, #border {vertical-align:middle; width:30px; text-align:center;} +#class_list {width:180px;} +input {width: 280px;} +#constrain, #onmousemovecheck {width:auto;} +#id, #dir, #lang, #usemap, #longdesc {width:200px;} diff --git a/web/libs/tiny_mce/plugins/advimage/editor_plugin.js b/web/libs/tiny_mce/plugins/advimage/editor_plugin.js new file mode 100644 index 0000000..4c7a9c3 --- /dev/null +++ b/web/libs/tiny_mce/plugins/advimage/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.AdvancedImagePlugin",{init:function(a,b){a.addCommand("mceAdvImage",function(){if(a.dom.getAttrib(a.selection.getNode(),"class").indexOf("mceItem")!=-1){return}a.windowManager.open({file:b+"/image.htm",width:480+parseInt(a.getLang("advimage.delta_width",0)),height:385+parseInt(a.getLang("advimage.delta_height",0)),inline:1},{plugin_url:b})});a.addButton("image",{title:"advimage.image_desc",cmd:"mceAdvImage"})},getInfo:function(){return{longname:"Advanced image",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advimage",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("advimage",tinymce.plugins.AdvancedImagePlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/advimage/editor_plugin_src.js b/web/libs/tiny_mce/plugins/advimage/editor_plugin_src.js new file mode 100644 index 0000000..2625dd2 --- /dev/null +++ b/web/libs/tiny_mce/plugins/advimage/editor_plugin_src.js @@ -0,0 +1,50 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.AdvancedImagePlugin', { + init : function(ed, url) { + // Register commands + ed.addCommand('mceAdvImage', function() { + // Internal image object like a flash placeholder + if (ed.dom.getAttrib(ed.selection.getNode(), 'class').indexOf('mceItem') != -1) + return; + + ed.windowManager.open({ + file : url + '/image.htm', + width : 480 + parseInt(ed.getLang('advimage.delta_width', 0)), + height : 385 + parseInt(ed.getLang('advimage.delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + // Register buttons + ed.addButton('image', { + title : 'advimage.image_desc', + cmd : 'mceAdvImage' + }); + }, + + getInfo : function() { + return { + longname : 'Advanced image', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advimage', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('advimage', tinymce.plugins.AdvancedImagePlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/advimage/image.htm b/web/libs/tiny_mce/plugins/advimage/image.htm new file mode 100644 index 0000000..79cff3f --- /dev/null +++ b/web/libs/tiny_mce/plugins/advimage/image.htm @@ -0,0 +1,232 @@ + + + + {#advimage_dlg.dialog_title} + + + + + + + + + +
+ + +
+
+
+ {#advimage_dlg.general} + + + + + + + + + + + + + + + + + + +
+ + + + +
 
+
+ +
+ {#advimage_dlg.preview} + +
+
+ +
+
+ {#advimage_dlg.tab_appearance} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ {#advimage_dlg.example_img} + Lorem ipsum, Dolor sit amet, consectetuer adipiscing loreum ipsum edipiscing elit, sed diam + nonummy nibh euismod tincidunt ut laoreet dolore magna aliquam erat volutpat.Loreum ipsum + edipiscing elit, sed diam nonummy nibh euismod tincidunt ut laoreet dolore magna aliquam + erat volutpat. +
+
+ x + px +
  + + + + +
+
+
+
+ +
+
+ {#advimage_dlg.swap_image} + + + + + + + + + + + + + + + + + + + + + +
+ + + + +
 
+ + + + +
 
+
+ +
+ {#advimage_dlg.misc} + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ +
+ + + + +
 
+
+
+
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/advimage/img/sample.gif b/web/libs/tiny_mce/plugins/advimage/img/sample.gif new file mode 100644 index 0000000..53bf689 Binary files /dev/null and b/web/libs/tiny_mce/plugins/advimage/img/sample.gif differ diff --git a/web/libs/tiny_mce/plugins/advimage/js/image.js b/web/libs/tiny_mce/plugins/advimage/js/image.js new file mode 100644 index 0000000..3bda86a --- /dev/null +++ b/web/libs/tiny_mce/plugins/advimage/js/image.js @@ -0,0 +1,443 @@ +var ImageDialog = { + preInit : function() { + var url; + + tinyMCEPopup.requireLangPack(); + + if (url = tinyMCEPopup.getParam("external_image_list_url")) + document.write(''); + }, + + init : function(ed) { + var f = document.forms[0], nl = f.elements, ed = tinyMCEPopup.editor, dom = ed.dom, n = ed.selection.getNode(); + + tinyMCEPopup.resizeToInnerSize(); + this.fillClassList('class_list'); + this.fillFileList('src_list', 'tinyMCEImageList'); + this.fillFileList('over_list', 'tinyMCEImageList'); + this.fillFileList('out_list', 'tinyMCEImageList'); + TinyMCE_EditableSelects.init(); + + if (n.nodeName == 'IMG') { + nl.src.value = dom.getAttrib(n, 'src'); + nl.width.value = dom.getAttrib(n, 'width'); + nl.height.value = dom.getAttrib(n, 'height'); + nl.alt.value = dom.getAttrib(n, 'alt'); + nl.title.value = dom.getAttrib(n, 'title'); + nl.vspace.value = this.getAttrib(n, 'vspace'); + nl.hspace.value = this.getAttrib(n, 'hspace'); + nl.border.value = this.getAttrib(n, 'border'); + selectByValue(f, 'align', this.getAttrib(n, 'align')); + selectByValue(f, 'class_list', dom.getAttrib(n, 'class'), true, true); + nl.style.value = dom.getAttrib(n, 'style'); + nl.id.value = dom.getAttrib(n, 'id'); + nl.dir.value = dom.getAttrib(n, 'dir'); + nl.lang.value = dom.getAttrib(n, 'lang'); + nl.usemap.value = dom.getAttrib(n, 'usemap'); + nl.longdesc.value = dom.getAttrib(n, 'longdesc'); + nl.insert.value = ed.getLang('update'); + + if (/^\s*this.src\s*=\s*\'([^\']+)\';?\s*$/.test(dom.getAttrib(n, 'onmouseover'))) + nl.onmouseoversrc.value = dom.getAttrib(n, 'onmouseover').replace(/^\s*this.src\s*=\s*\'([^\']+)\';?\s*$/, '$1'); + + if (/^\s*this.src\s*=\s*\'([^\']+)\';?\s*$/.test(dom.getAttrib(n, 'onmouseout'))) + nl.onmouseoutsrc.value = dom.getAttrib(n, 'onmouseout').replace(/^\s*this.src\s*=\s*\'([^\']+)\';?\s*$/, '$1'); + + if (ed.settings.inline_styles) { + // Move attribs to styles + if (dom.getAttrib(n, 'align')) + this.updateStyle('align'); + + if (dom.getAttrib(n, 'hspace')) + this.updateStyle('hspace'); + + if (dom.getAttrib(n, 'border')) + this.updateStyle('border'); + + if (dom.getAttrib(n, 'vspace')) + this.updateStyle('vspace'); + } + } + + // Setup browse button + document.getElementById('srcbrowsercontainer').innerHTML = getBrowserHTML('srcbrowser','src','image','theme_advanced_image'); + if (isVisible('srcbrowser')) + document.getElementById('src').style.width = '260px'; + + // Setup browse button + document.getElementById('onmouseoversrccontainer').innerHTML = getBrowserHTML('overbrowser','onmouseoversrc','image','theme_advanced_image'); + if (isVisible('overbrowser')) + document.getElementById('onmouseoversrc').style.width = '260px'; + + // Setup browse button + document.getElementById('onmouseoutsrccontainer').innerHTML = getBrowserHTML('outbrowser','onmouseoutsrc','image','theme_advanced_image'); + if (isVisible('outbrowser')) + document.getElementById('onmouseoutsrc').style.width = '260px'; + + // If option enabled default contrain proportions to checked + if (ed.getParam("advimage_constrain_proportions", true)) + f.constrain.checked = true; + + // Check swap image if valid data + if (nl.onmouseoversrc.value || nl.onmouseoutsrc.value) + this.setSwapImage(true); + else + this.setSwapImage(false); + + this.changeAppearance(); + this.showPreviewImage(nl.src.value, 1); + }, + + insert : function(file, title) { + var ed = tinyMCEPopup.editor, t = this, f = document.forms[0]; + + if (f.src.value === '') { + if (ed.selection.getNode().nodeName == 'IMG') { + ed.dom.remove(ed.selection.getNode()); + ed.execCommand('mceRepaint'); + } + + tinyMCEPopup.close(); + return; + } + + if (tinyMCEPopup.getParam("accessibility_warnings", 1)) { + if (!f.alt.value) { + tinyMCEPopup.confirm(tinyMCEPopup.getLang('advimage_dlg.missing_alt'), function(s) { + if (s) + t.insertAndClose(); + }); + + return; + } + } + + t.insertAndClose(); + }, + + insertAndClose : function() { + var ed = tinyMCEPopup.editor, f = document.forms[0], nl = f.elements, v, args = {}, el; + + tinyMCEPopup.restoreSelection(); + + // Fixes crash in Safari + if (tinymce.isWebKit) + ed.getWin().focus(); + + if (!ed.settings.inline_styles) { + args = { + vspace : nl.vspace.value, + hspace : nl.hspace.value, + border : nl.border.value, + align : getSelectValue(f, 'align') + }; + } else { + // Remove deprecated values + args = { + vspace : '', + hspace : '', + border : '', + align : '' + }; + } + + tinymce.extend(args, { + src : nl.src.value, + width : nl.width.value, + height : nl.height.value, + alt : nl.alt.value, + title : nl.title.value, + 'class' : getSelectValue(f, 'class_list'), + style : nl.style.value, + id : nl.id.value, + dir : nl.dir.value, + lang : nl.lang.value, + usemap : nl.usemap.value, + longdesc : nl.longdesc.value + }); + + args.onmouseover = args.onmouseout = ''; + + if (f.onmousemovecheck.checked) { + if (nl.onmouseoversrc.value) + args.onmouseover = "this.src='" + nl.onmouseoversrc.value + "';"; + + if (nl.onmouseoutsrc.value) + args.onmouseout = "this.src='" + nl.onmouseoutsrc.value + "';"; + } + + el = ed.selection.getNode(); + + if (el && el.nodeName == 'IMG') { + ed.dom.setAttribs(el, args); + } else { + ed.execCommand('mceInsertContent', false, '', {skip_undo : 1}); + ed.dom.setAttribs('__mce_tmp', args); + ed.dom.setAttrib('__mce_tmp', 'id', ''); + ed.undoManager.add(); + } + + tinyMCEPopup.close(); + }, + + getAttrib : function(e, at) { + var ed = tinyMCEPopup.editor, dom = ed.dom, v, v2; + + if (ed.settings.inline_styles) { + switch (at) { + case 'align': + if (v = dom.getStyle(e, 'float')) + return v; + + if (v = dom.getStyle(e, 'vertical-align')) + return v; + + break; + + case 'hspace': + v = dom.getStyle(e, 'margin-left') + v2 = dom.getStyle(e, 'margin-right'); + + if (v && v == v2) + return parseInt(v.replace(/[^0-9]/g, '')); + + break; + + case 'vspace': + v = dom.getStyle(e, 'margin-top') + v2 = dom.getStyle(e, 'margin-bottom'); + if (v && v == v2) + return parseInt(v.replace(/[^0-9]/g, '')); + + break; + + case 'border': + v = 0; + + tinymce.each(['top', 'right', 'bottom', 'left'], function(sv) { + sv = dom.getStyle(e, 'border-' + sv + '-width'); + + // False or not the same as prev + if (!sv || (sv != v && v !== 0)) { + v = 0; + return false; + } + + if (sv) + v = sv; + }); + + if (v) + return parseInt(v.replace(/[^0-9]/g, '')); + + break; + } + } + + if (v = dom.getAttrib(e, at)) + return v; + + return ''; + }, + + setSwapImage : function(st) { + var f = document.forms[0]; + + f.onmousemovecheck.checked = st; + setBrowserDisabled('overbrowser', !st); + setBrowserDisabled('outbrowser', !st); + + if (f.over_list) + f.over_list.disabled = !st; + + if (f.out_list) + f.out_list.disabled = !st; + + f.onmouseoversrc.disabled = !st; + f.onmouseoutsrc.disabled = !st; + }, + + fillClassList : function(id) { + var dom = tinyMCEPopup.dom, lst = dom.get(id), v, cl; + + if (v = tinyMCEPopup.getParam('theme_advanced_styles')) { + cl = []; + + tinymce.each(v.split(';'), function(v) { + var p = v.split('='); + + cl.push({'title' : p[0], 'class' : p[1]}); + }); + } else + cl = tinyMCEPopup.editor.dom.getClasses(); + + if (cl.length > 0) { + lst.options.length = 0; + lst.options[lst.options.length] = new Option(tinyMCEPopup.getLang('not_set'), ''); + + tinymce.each(cl, function(o) { + lst.options[lst.options.length] = new Option(o.title || o['class'], o['class']); + }); + } else + dom.remove(dom.getParent(id, 'tr')); + }, + + fillFileList : function(id, l) { + var dom = tinyMCEPopup.dom, lst = dom.get(id), v, cl; + + l = window[l]; + lst.options.length = 0; + + if (l && l.length > 0) { + lst.options[lst.options.length] = new Option('', ''); + + tinymce.each(l, function(o) { + lst.options[lst.options.length] = new Option(o[0], o[1]); + }); + } else + dom.remove(dom.getParent(id, 'tr')); + }, + + resetImageData : function() { + var f = document.forms[0]; + + f.elements.width.value = f.elements.height.value = ''; + }, + + updateImageData : function(img, st) { + var f = document.forms[0]; + + if (!st) { + f.elements.width.value = img.width; + f.elements.height.value = img.height; + } + + this.preloadImg = img; + }, + + changeAppearance : function() { + var ed = tinyMCEPopup.editor, f = document.forms[0], img = document.getElementById('alignSampleImg'); + + if (img) { + if (ed.getParam('inline_styles')) { + ed.dom.setAttrib(img, 'style', f.style.value); + } else { + img.align = f.align.value; + img.border = f.border.value; + img.hspace = f.hspace.value; + img.vspace = f.vspace.value; + } + } + }, + + changeHeight : function() { + var f = document.forms[0], tp, t = this; + + if (!f.constrain.checked || !t.preloadImg) { + return; + } + + if (f.width.value == "" || f.height.value == "") + return; + + tp = (parseInt(f.width.value) / parseInt(t.preloadImg.width)) * t.preloadImg.height; + f.height.value = tp.toFixed(0); + }, + + changeWidth : function() { + var f = document.forms[0], tp, t = this; + + if (!f.constrain.checked || !t.preloadImg) { + return; + } + + if (f.width.value == "" || f.height.value == "") + return; + + tp = (parseInt(f.height.value) / parseInt(t.preloadImg.height)) * t.preloadImg.width; + f.width.value = tp.toFixed(0); + }, + + updateStyle : function(ty) { + var dom = tinyMCEPopup.dom, st, v, f = document.forms[0], img = dom.create('img', {style : dom.get('style').value}); + + if (tinyMCEPopup.editor.settings.inline_styles) { + // Handle align + if (ty == 'align') { + dom.setStyle(img, 'float', ''); + dom.setStyle(img, 'vertical-align', ''); + + v = getSelectValue(f, 'align'); + if (v) { + if (v == 'left' || v == 'right') + dom.setStyle(img, 'float', v); + else + img.style.verticalAlign = v; + } + } + + // Handle border + if (ty == 'border') { + dom.setStyle(img, 'border', ''); + + v = f.border.value; + if (v || v == '0') { + if (v == '0') + img.style.border = '0'; + else + img.style.border = v + 'px solid black'; + } + } + + // Handle hspace + if (ty == 'hspace') { + dom.setStyle(img, 'marginLeft', ''); + dom.setStyle(img, 'marginRight', ''); + + v = f.hspace.value; + if (v) { + img.style.marginLeft = v + 'px'; + img.style.marginRight = v + 'px'; + } + } + + // Handle vspace + if (ty == 'vspace') { + dom.setStyle(img, 'marginTop', ''); + dom.setStyle(img, 'marginBottom', ''); + + v = f.vspace.value; + if (v) { + img.style.marginTop = v + 'px'; + img.style.marginBottom = v + 'px'; + } + } + + // Merge + dom.get('style').value = dom.serializeStyle(dom.parseStyle(img.style.cssText), 'img'); + } + }, + + changeMouseMove : function() { + }, + + showPreviewImage : function(u, st) { + if (!u) { + tinyMCEPopup.dom.setHTML('prev', ''); + return; + } + + if (!st && tinyMCEPopup.getParam("advimage_update_dimensions_onchange", true)) + this.resetImageData(); + + u = tinyMCEPopup.editor.documentBaseURI.toAbsolute(u); + + if (!st) + tinyMCEPopup.dom.setHTML('prev', ''); + else + tinyMCEPopup.dom.setHTML('prev', ''); + } +}; + +ImageDialog.preInit(); +tinyMCEPopup.onInit.add(ImageDialog.init, ImageDialog); diff --git a/web/libs/tiny_mce/plugins/advimage/langs/en_dlg.js b/web/libs/tiny_mce/plugins/advimage/langs/en_dlg.js new file mode 100644 index 0000000..f493d19 --- /dev/null +++ b/web/libs/tiny_mce/plugins/advimage/langs/en_dlg.js @@ -0,0 +1,43 @@ +tinyMCE.addI18n('en.advimage_dlg',{ +tab_general:"General", +tab_appearance:"Appearance", +tab_advanced:"Advanced", +general:"General", +title:"Title", +preview:"Preview", +constrain_proportions:"Constrain proportions", +langdir:"Language direction", +langcode:"Language code", +long_desc:"Long description link", +style:"Style", +classes:"Classes", +ltr:"Left to right", +rtl:"Right to left", +id:"Id", +map:"Image map", +swap_image:"Swap image", +alt_image:"Alternative image", +mouseover:"for mouse over", +mouseout:"for mouse out", +misc:"Miscellaneous", +example_img:"Appearance preview image", +missing_alt:"Are you sure you want to continue without including an Image Description? Without it the image may not be accessible to some users with disabilities, or to those using a text browser, or browsing the Web with images turned off.", +dialog_title:"Insert/edit image", +src:"Image URL", +alt:"Image description", +list:"Image list", +border:"Border", +dimensions:"Dimensions", +vspace:"Vertical space", +hspace:"Horizontal space", +align:"Alignment", +align_baseline:"Baseline", +align_top:"Top", +align_middle:"Middle", +align_bottom:"Bottom", +align_texttop:"Text top", +align_textbottom:"Text bottom", +align_left:"Left", +align_right:"Right", +image_list:"Image list" +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/advlink/css/advlink.css b/web/libs/tiny_mce/plugins/advlink/css/advlink.css new file mode 100644 index 0000000..1436431 --- /dev/null +++ b/web/libs/tiny_mce/plugins/advlink/css/advlink.css @@ -0,0 +1,8 @@ +.mceLinkList, .mceAnchorList, #targetlist {width:280px;} +.mceActionPanel {margin-top:7px;} +.panel_wrapper div.current {height:320px;} +#classlist, #title, #href {width:280px;} +#popupurl, #popupname {width:200px;} +#popupwidth, #popupheight, #popupleft, #popuptop {width:30px;vertical-align:middle;text-align:center;} +#id, #style, #classes, #target, #dir, #hreflang, #lang, #charset, #type, #rel, #rev, #tabindex, #accesskey {width:200px;} +#events_panel input {width:200px;} diff --git a/web/libs/tiny_mce/plugins/advlink/editor_plugin.js b/web/libs/tiny_mce/plugins/advlink/editor_plugin.js new file mode 100644 index 0000000..983fe5a --- /dev/null +++ b/web/libs/tiny_mce/plugins/advlink/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.AdvancedLinkPlugin",{init:function(a,b){this.editor=a;a.addCommand("mceAdvLink",function(){var c=a.selection;if(c.isCollapsed()&&!a.dom.getParent(c.getNode(),"A")){return}a.windowManager.open({file:b+"/link.htm",width:480+parseInt(a.getLang("advlink.delta_width",0)),height:400+parseInt(a.getLang("advlink.delta_height",0)),inline:1},{plugin_url:b})});a.addButton("link",{title:"advlink.link_desc",cmd:"mceAdvLink"});a.addShortcut("ctrl+k","advlink.advlink_desc","mceAdvLink");a.onNodeChange.add(function(d,c,f,e){c.setDisabled("link",e&&f.nodeName!="A");c.setActive("link",f.nodeName=="A"&&!f.name)})},getInfo:function(){return{longname:"Advanced link",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advlink",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("advlink",tinymce.plugins.AdvancedLinkPlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/advlink/editor_plugin_src.js b/web/libs/tiny_mce/plugins/advlink/editor_plugin_src.js new file mode 100644 index 0000000..14e46a7 --- /dev/null +++ b/web/libs/tiny_mce/plugins/advlink/editor_plugin_src.js @@ -0,0 +1,61 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.AdvancedLinkPlugin', { + init : function(ed, url) { + this.editor = ed; + + // Register commands + ed.addCommand('mceAdvLink', function() { + var se = ed.selection; + + // No selection and not in link + if (se.isCollapsed() && !ed.dom.getParent(se.getNode(), 'A')) + return; + + ed.windowManager.open({ + file : url + '/link.htm', + width : 480 + parseInt(ed.getLang('advlink.delta_width', 0)), + height : 400 + parseInt(ed.getLang('advlink.delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + // Register buttons + ed.addButton('link', { + title : 'advlink.link_desc', + cmd : 'mceAdvLink' + }); + + ed.addShortcut('ctrl+k', 'advlink.advlink_desc', 'mceAdvLink'); + + ed.onNodeChange.add(function(ed, cm, n, co) { + cm.setDisabled('link', co && n.nodeName != 'A'); + cm.setActive('link', n.nodeName == 'A' && !n.name); + }); + }, + + getInfo : function() { + return { + longname : 'Advanced link', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advlink', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('advlink', tinymce.plugins.AdvancedLinkPlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/advlink/js/advlink.js b/web/libs/tiny_mce/plugins/advlink/js/advlink.js new file mode 100644 index 0000000..b78e82f --- /dev/null +++ b/web/libs/tiny_mce/plugins/advlink/js/advlink.js @@ -0,0 +1,528 @@ +/* Functions for the advlink plugin popup */ + +tinyMCEPopup.requireLangPack(); + +var templates = { + "window.open" : "window.open('${url}','${target}','${options}')" +}; + +function preinit() { + var url; + + if (url = tinyMCEPopup.getParam("external_link_list_url")) + document.write(''); +} + +function changeClass() { + var f = document.forms[0]; + + f.classes.value = getSelectValue(f, 'classlist'); +} + +function init() { + tinyMCEPopup.resizeToInnerSize(); + + var formObj = document.forms[0]; + var inst = tinyMCEPopup.editor; + var elm = inst.selection.getNode(); + var action = "insert"; + var html; + + document.getElementById('hrefbrowsercontainer').innerHTML = getBrowserHTML('hrefbrowser','href','file','advlink'); + document.getElementById('popupurlbrowsercontainer').innerHTML = getBrowserHTML('popupurlbrowser','popupurl','file','advlink'); + document.getElementById('linklisthrefcontainer').innerHTML = getLinkListHTML('linklisthref','href'); + document.getElementById('anchorlistcontainer').innerHTML = getAnchorListHTML('anchorlist','href'); + document.getElementById('targetlistcontainer').innerHTML = getTargetListHTML('targetlist','target'); + + // Link list + html = getLinkListHTML('linklisthref','href'); + if (html == "") + document.getElementById("linklisthrefrow").style.display = 'none'; + else + document.getElementById("linklisthrefcontainer").innerHTML = html; + + // Resize some elements + if (isVisible('hrefbrowser')) + document.getElementById('href').style.width = '260px'; + + if (isVisible('popupurlbrowser')) + document.getElementById('popupurl').style.width = '180px'; + + elm = inst.dom.getParent(elm, "A"); + if (elm != null && elm.nodeName == "A") + action = "update"; + + formObj.insert.value = tinyMCEPopup.getLang(action, 'Insert', true); + + setPopupControlsDisabled(true); + + if (action == "update") { + var href = inst.dom.getAttrib(elm, 'href'); + var onclick = inst.dom.getAttrib(elm, 'onclick'); + + // Setup form data + setFormValue('href', href); + setFormValue('title', inst.dom.getAttrib(elm, 'title')); + setFormValue('id', inst.dom.getAttrib(elm, 'id')); + setFormValue('style', inst.dom.getAttrib(elm, "style")); + setFormValue('rel', inst.dom.getAttrib(elm, 'rel')); + setFormValue('rev', inst.dom.getAttrib(elm, 'rev')); + setFormValue('charset', inst.dom.getAttrib(elm, 'charset')); + setFormValue('hreflang', inst.dom.getAttrib(elm, 'hreflang')); + setFormValue('dir', inst.dom.getAttrib(elm, 'dir')); + setFormValue('lang', inst.dom.getAttrib(elm, 'lang')); + setFormValue('tabindex', inst.dom.getAttrib(elm, 'tabindex', typeof(elm.tabindex) != "undefined" ? elm.tabindex : "")); + setFormValue('accesskey', inst.dom.getAttrib(elm, 'accesskey', typeof(elm.accesskey) != "undefined" ? elm.accesskey : "")); + setFormValue('type', inst.dom.getAttrib(elm, 'type')); + setFormValue('onfocus', inst.dom.getAttrib(elm, 'onfocus')); + setFormValue('onblur', inst.dom.getAttrib(elm, 'onblur')); + setFormValue('onclick', onclick); + setFormValue('ondblclick', inst.dom.getAttrib(elm, 'ondblclick')); + setFormValue('onmousedown', inst.dom.getAttrib(elm, 'onmousedown')); + setFormValue('onmouseup', inst.dom.getAttrib(elm, 'onmouseup')); + setFormValue('onmouseover', inst.dom.getAttrib(elm, 'onmouseover')); + setFormValue('onmousemove', inst.dom.getAttrib(elm, 'onmousemove')); + setFormValue('onmouseout', inst.dom.getAttrib(elm, 'onmouseout')); + setFormValue('onkeypress', inst.dom.getAttrib(elm, 'onkeypress')); + setFormValue('onkeydown', inst.dom.getAttrib(elm, 'onkeydown')); + setFormValue('onkeyup', inst.dom.getAttrib(elm, 'onkeyup')); + setFormValue('target', inst.dom.getAttrib(elm, 'target')); + setFormValue('classes', inst.dom.getAttrib(elm, 'class')); + + // Parse onclick data + if (onclick != null && onclick.indexOf('window.open') != -1) + parseWindowOpen(onclick); + else + parseFunction(onclick); + + // Select by the values + selectByValue(formObj, 'dir', inst.dom.getAttrib(elm, 'dir')); + selectByValue(formObj, 'rel', inst.dom.getAttrib(elm, 'rel')); + selectByValue(formObj, 'rev', inst.dom.getAttrib(elm, 'rev')); + selectByValue(formObj, 'linklisthref', href); + + if (href.charAt(0) == '#') + selectByValue(formObj, 'anchorlist', href); + + addClassesToList('classlist', 'advlink_styles'); + + selectByValue(formObj, 'classlist', inst.dom.getAttrib(elm, 'class'), true); + selectByValue(formObj, 'targetlist', inst.dom.getAttrib(elm, 'target'), true); + } else + addClassesToList('classlist', 'advlink_styles'); +} + +function checkPrefix(n) { + if (n.value && Validator.isEmail(n) && !/^\s*mailto:/i.test(n.value) && confirm(tinyMCEPopup.getLang('advlink_dlg.is_email'))) + n.value = 'mailto:' + n.value; + + if (/^\s*www\./i.test(n.value) && confirm(tinyMCEPopup.getLang('advlink_dlg.is_external'))) + n.value = 'http://' + n.value; +} + +function setFormValue(name, value) { + document.forms[0].elements[name].value = value; +} + +function parseWindowOpen(onclick) { + var formObj = document.forms[0]; + + // Preprocess center code + if (onclick.indexOf('return false;') != -1) { + formObj.popupreturn.checked = true; + onclick = onclick.replace('return false;', ''); + } else + formObj.popupreturn.checked = false; + + var onClickData = parseLink(onclick); + + if (onClickData != null) { + formObj.ispopup.checked = true; + setPopupControlsDisabled(false); + + var onClickWindowOptions = parseOptions(onClickData['options']); + var url = onClickData['url']; + + formObj.popupname.value = onClickData['target']; + formObj.popupurl.value = url; + formObj.popupwidth.value = getOption(onClickWindowOptions, 'width'); + formObj.popupheight.value = getOption(onClickWindowOptions, 'height'); + + formObj.popupleft.value = getOption(onClickWindowOptions, 'left'); + formObj.popuptop.value = getOption(onClickWindowOptions, 'top'); + + if (formObj.popupleft.value.indexOf('screen') != -1) + formObj.popupleft.value = "c"; + + if (formObj.popuptop.value.indexOf('screen') != -1) + formObj.popuptop.value = "c"; + + formObj.popuplocation.checked = getOption(onClickWindowOptions, 'location') == "yes"; + formObj.popupscrollbars.checked = getOption(onClickWindowOptions, 'scrollbars') == "yes"; + formObj.popupmenubar.checked = getOption(onClickWindowOptions, 'menubar') == "yes"; + formObj.popupresizable.checked = getOption(onClickWindowOptions, 'resizable') == "yes"; + formObj.popuptoolbar.checked = getOption(onClickWindowOptions, 'toolbar') == "yes"; + formObj.popupstatus.checked = getOption(onClickWindowOptions, 'status') == "yes"; + formObj.popupdependent.checked = getOption(onClickWindowOptions, 'dependent') == "yes"; + + buildOnClick(); + } +} + +function parseFunction(onclick) { + var formObj = document.forms[0]; + var onClickData = parseLink(onclick); + + // TODO: Add stuff here +} + +function getOption(opts, name) { + return typeof(opts[name]) == "undefined" ? "" : opts[name]; +} + +function setPopupControlsDisabled(state) { + var formObj = document.forms[0]; + + formObj.popupname.disabled = state; + formObj.popupurl.disabled = state; + formObj.popupwidth.disabled = state; + formObj.popupheight.disabled = state; + formObj.popupleft.disabled = state; + formObj.popuptop.disabled = state; + formObj.popuplocation.disabled = state; + formObj.popupscrollbars.disabled = state; + formObj.popupmenubar.disabled = state; + formObj.popupresizable.disabled = state; + formObj.popuptoolbar.disabled = state; + formObj.popupstatus.disabled = state; + formObj.popupreturn.disabled = state; + formObj.popupdependent.disabled = state; + + setBrowserDisabled('popupurlbrowser', state); +} + +function parseLink(link) { + link = link.replace(new RegExp(''', 'g'), "'"); + + var fnName = link.replace(new RegExp("\\s*([A-Za-z0-9\.]*)\\s*\\(.*", "gi"), "$1"); + + // Is function name a template function + var template = templates[fnName]; + if (template) { + // Build regexp + var variableNames = template.match(new RegExp("'?\\$\\{[A-Za-z0-9\.]*\\}'?", "gi")); + var regExp = "\\s*[A-Za-z0-9\.]*\\s*\\("; + var replaceStr = ""; + for (var i=0; i'); + for (var i=0; i'; + html += ''; + + for (i=0; i' + name + ''; + } + + html += ''; + + return html; +} + +function insertAction() { + var inst = tinyMCEPopup.editor; + var elm, elementArray, i; + + elm = inst.selection.getNode(); + checkPrefix(document.forms[0].href); + + elm = inst.dom.getParent(elm, "A"); + + // Remove element if there is no href + if (!document.forms[0].href.value) { + tinyMCEPopup.execCommand("mceBeginUndoLevel"); + i = inst.selection.getBookmark(); + inst.dom.remove(elm, 1); + inst.selection.moveToBookmark(i); + tinyMCEPopup.execCommand("mceEndUndoLevel"); + tinyMCEPopup.close(); + return; + } + + tinyMCEPopup.execCommand("mceBeginUndoLevel"); + + // Create new anchor elements + if (elm == null) { + inst.getDoc().execCommand("unlink", false, null); + tinyMCEPopup.execCommand("CreateLink", false, "#mce_temp_url#", {skip_undo : 1}); + + elementArray = tinymce.grep(inst.dom.select("a"), function(n) {return inst.dom.getAttrib(n, 'href') == '#mce_temp_url#';}); + for (i=0; i' + tinyMCELinkList[i][0] + ''; + + html += ''; + + return html; + + // tinyMCE.debug('-- image list start --', html, '-- image list end --'); +} + +function getTargetListHTML(elm_id, target_form_element) { + var targets = tinyMCEPopup.getParam('theme_advanced_link_targets', '').split(';'); + var html = ''; + + html += ''; + + return html; +} + +// While loading +preinit(); +tinyMCEPopup.onInit.add(init); diff --git a/web/libs/tiny_mce/plugins/advlink/langs/en_dlg.js b/web/libs/tiny_mce/plugins/advlink/langs/en_dlg.js new file mode 100644 index 0000000..c71ffbd --- /dev/null +++ b/web/libs/tiny_mce/plugins/advlink/langs/en_dlg.js @@ -0,0 +1,52 @@ +tinyMCE.addI18n('en.advlink_dlg',{ +title:"Insert/edit link", +url:"Link URL", +target:"Target", +titlefield:"Title", +is_email:"The URL you entered seems to be an email address, do you want to add the required mailto: prefix?", +is_external:"The URL you entered seems to external link, do you want to add the required http:// prefix?", +list:"Link list", +general_tab:"General", +popup_tab:"Popup", +events_tab:"Events", +advanced_tab:"Advanced", +general_props:"General properties", +popup_props:"Popup properties", +event_props:"Events", +advanced_props:"Advanced properties", +popup_opts:"Options", +anchor_names:"Anchors", +target_same:"Open in this window / frame", +target_parent:"Open in parent window / frame", +target_top:"Open in top frame (replaces all frames)", +target_blank:"Open in new window", +popup:"Javascript popup", +popup_url:"Popup URL", +popup_name:"Window name", +popup_return:"Insert 'return false'", +popup_scrollbars:"Show scrollbars", +popup_statusbar:"Show status bar", +popup_toolbar:"Show toolbars", +popup_menubar:"Show menu bar", +popup_location:"Show location bar", +popup_resizable:"Make window resizable", +popup_dependent:"Dependent (Mozilla/Firefox only)", +popup_size:"Size", +popup_position:"Position (X/Y)", +id:"Id", +style:"Style", +classes:"Classes", +target_name:"Target name", +langdir:"Language direction", +target_langcode:"Target language", +langcode:"Language code", +encoding:"Target character encoding", +mime:"Target MIME type", +rel:"Relationship page to target", +rev:"Relationship target to page", +tabindex:"Tabindex", +accesskey:"Accesskey", +ltr:"Left to right", +rtl:"Right to left", +link_list:"Link list" +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/advlink/link.htm b/web/libs/tiny_mce/plugins/advlink/link.htm new file mode 100644 index 0000000..876669c --- /dev/null +++ b/web/libs/tiny_mce/plugins/advlink/link.htm @@ -0,0 +1,333 @@ + + + + {#advlink_dlg.title} + + + + + + + + +
+ + +
+
+
+ {#advlink_dlg.general_props} + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + +
 
+ +
+
+
+ + + +
+
+ {#advlink_dlg.advanced_props} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+
+
+
+ +
+
+ {#advlink_dlg.event_props} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/advlist/editor_plugin.js b/web/libs/tiny_mce/plugins/advlist/editor_plugin.js new file mode 100644 index 0000000..02d1697 --- /dev/null +++ b/web/libs/tiny_mce/plugins/advlist/editor_plugin.js @@ -0,0 +1 @@ +(function(){var a=tinymce.each;tinymce.create("tinymce.plugins.AdvListPlugin",{init:function(b,c){var d=this;d.editor=b;function e(g){var f=[];a(g.split(/,/),function(h){f.push({title:"advlist."+(h=="default"?"def":h.replace(/-/g,"_")),styles:{listStyleType:h=="default"?"":h}})});return f}d.numlist=b.getParam("advlist_number_styles")||e("default,lower-alpha,lower-greek,lower-roman,upper-alpha,upper-roman");d.bullist=b.getParam("advlist_bullet_styles")||e("default,circle,disc,square")},createControl:function(d,b){var f=this,e,h;if(d=="numlist"||d=="bullist"){if(f[d][0].title=="advlist.def"){h=f[d][0]}function c(i,k){var j=true;a(k.styles,function(m,l){if(f.editor.dom.getStyle(i,l)!=m){j=false;return false}});return j}function g(){var k,i=f.editor,l=i.dom,j=i.selection;k=l.getParent(j.getNode(),"ol,ul");if(!k||k.nodeName==(d=="bullist"?"OL":"UL")||c(k,h)){i.execCommand(d=="bullist"?"InsertUnorderedList":"InsertOrderedList")}if(h){k=l.getParent(j.getNode(),"ol,ul");if(k){l.setStyles(k,h.styles);k.removeAttribute("_mce_style")}}}e=b.createSplitButton(d,{title:"advanced."+d+"_desc","class":"mce_"+d,onclick:function(){g()}});e.onRenderMenu.add(function(i,j){j.onShowMenu.add(function(){var m=f.editor.dom,l=m.getParent(f.editor.selection.getNode(),"ol,ul"),k;if(l||h){k=f[d];a(j.items,function(n){var o=true;n.setSelected(0);if(l&&!n.isDisabled()){a(k,function(p){if(p.id==n.id){if(!c(l,p)){o=false;return false}}});if(o){n.setSelected(1)}}});if(!l){j.items[h.id].setSelected(1)}}});j.add({id:f.editor.dom.uniqueId(),title:"advlist.types","class":"mceMenuItemTitle"}).setDisabled(1);a(f[d],function(k){k.id=f.editor.dom.uniqueId();j.add({id:k.id,title:k.title,onclick:function(){h=k;g()}})})});return e}},getInfo:function(){return{longname:"Advanced lists",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advlist",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("advlist",tinymce.plugins.AdvListPlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/advlist/editor_plugin_src.js b/web/libs/tiny_mce/plugins/advlist/editor_plugin_src.js new file mode 100644 index 0000000..a61887a --- /dev/null +++ b/web/libs/tiny_mce/plugins/advlist/editor_plugin_src.js @@ -0,0 +1,154 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + var each = tinymce.each; + + tinymce.create('tinymce.plugins.AdvListPlugin', { + init : function(ed, url) { + var t = this; + + t.editor = ed; + + function buildFormats(str) { + var formats = []; + + each(str.split(/,/), function(type) { + formats.push({ + title : 'advlist.' + (type == 'default' ? 'def' : type.replace(/-/g, '_')), + styles : { + listStyleType : type == 'default' ? '' : type + } + }); + }); + + return formats; + }; + + // Setup number formats from config or default + t.numlist = ed.getParam("advlist_number_styles") || buildFormats("default,lower-alpha,lower-greek,lower-roman,upper-alpha,upper-roman"); + t.bullist = ed.getParam("advlist_bullet_styles") || buildFormats("default,circle,disc,square"); + }, + + createControl: function(name, cm) { + var t = this, btn, format; + + if (name == 'numlist' || name == 'bullist') { + // Default to first item if it's a default item + if (t[name][0].title == 'advlist.def') + format = t[name][0]; + + function hasFormat(node, format) { + var state = true; + + each(format.styles, function(value, name) { + // Format doesn't match + if (t.editor.dom.getStyle(node, name) != value) { + state = false; + return false; + } + }); + + return state; + }; + + function applyListFormat() { + var list, ed = t.editor, dom = ed.dom, sel = ed.selection; + + // Check for existing list element + list = dom.getParent(sel.getNode(), 'ol,ul'); + + // Switch/add list type if needed + if (!list || list.nodeName == (name == 'bullist' ? 'OL' : 'UL') || hasFormat(list, format)) + ed.execCommand(name == 'bullist' ? 'InsertUnorderedList' : 'InsertOrderedList'); + + // Append styles to new list element + if (format) { + list = dom.getParent(sel.getNode(), 'ol,ul'); + + if (list) { + dom.setStyles(list, format.styles); + list.removeAttribute('_mce_style'); + } + } + }; + + btn = cm.createSplitButton(name, { + title : 'advanced.' + name + '_desc', + 'class' : 'mce_' + name, + onclick : function() { + applyListFormat(); + } + }); + + btn.onRenderMenu.add(function(btn, menu) { + menu.onShowMenu.add(function() { + var dom = t.editor.dom, list = dom.getParent(t.editor.selection.getNode(), 'ol,ul'), fmtList; + + if (list || format) { + fmtList = t[name]; + + // Unselect existing items + each(menu.items, function(item) { + var state = true; + + item.setSelected(0); + + if (list && !item.isDisabled()) { + each(fmtList, function(fmt) { + if (fmt.id == item.id) { + if (!hasFormat(list, fmt)) { + state = false; + return false; + } + } + }); + + if (state) + item.setSelected(1); + } + }); + + // Select the current format + if (!list) + menu.items[format.id].setSelected(1); + } + }); + + menu.add({id : t.editor.dom.uniqueId(), title : 'advlist.types', 'class' : 'mceMenuItemTitle'}).setDisabled(1); + + each(t[name], function(item) { + item.id = t.editor.dom.uniqueId(); + + menu.add({id : item.id, title : item.title, onclick : function() { + format = item; + applyListFormat(); + }}); + }); + }); + + return btn; + } + }, + + getInfo : function() { + return { + longname : 'Advanced lists', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/advlist', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('advlist', tinymce.plugins.AdvListPlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/autoresize/editor_plugin.js b/web/libs/tiny_mce/plugins/autoresize/editor_plugin.js new file mode 100644 index 0000000..1676b15 --- /dev/null +++ b/web/libs/tiny_mce/plugins/autoresize/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.AutoResizePlugin",{init:function(a,c){var d=this;if(a.getParam("fullscreen_is_enabled")){return}function b(){var h=a.getDoc(),e=h.body,j=h.documentElement,g=tinymce.DOM,i=d.autoresize_min_height,f;f=tinymce.isIE?e.scrollHeight:j.offsetHeight;if(f>d.autoresize_min_height){i=f}g.setStyle(g.get(a.id+"_ifr"),"height",i+"px");if(d.throbbing){a.setProgressState(false);a.setProgressState(true)}}d.editor=a;d.autoresize_min_height=a.getElement().offsetHeight;a.onChange.add(b);a.onSetContent.add(b);a.onPaste.add(b);a.onKeyUp.add(b);a.onPostRender.add(b);if(a.getParam("autoresize_on_init",true)){a.onInit.add(function(f,e){f.setProgressState(true);d.throbbing=true;f.getBody().style.overflowY="hidden"});a.onLoadContent.add(function(f,e){b();setTimeout(function(){b();f.setProgressState(false);d.throbbing=false},1250)})}a.addCommand("mceAutoResize",b)},getInfo:function(){return{longname:"Auto Resize",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/autoresize",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("autoresize",tinymce.plugins.AutoResizePlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/autoresize/editor_plugin_src.js b/web/libs/tiny_mce/plugins/autoresize/editor_plugin_src.js new file mode 100644 index 0000000..c260b7a --- /dev/null +++ b/web/libs/tiny_mce/plugins/autoresize/editor_plugin_src.js @@ -0,0 +1,119 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + /** + * Auto Resize + * + * This plugin automatically resizes the content area to fit its content height. + * It will retain a minimum height, which is the height of the content area when + * it's initialized. + */ + tinymce.create('tinymce.plugins.AutoResizePlugin', { + /** + * Initializes the plugin, this will be executed after the plugin has been created. + * This call is done before the editor instance has finished it's initialization so use the onInit event + * of the editor instance to intercept that event. + * + * @param {tinymce.Editor} ed Editor instance that the plugin is initialized in. + * @param {string} url Absolute URL to where the plugin is located. + */ + init : function(ed, url) { + var t = this; + + if (ed.getParam('fullscreen_is_enabled')) + return; + + /** + * This method gets executed each time the editor needs to resize. + */ + function resize() { + var d = ed.getDoc(), b = d.body, de = d.documentElement, DOM = tinymce.DOM, resizeHeight = t.autoresize_min_height, myHeight; + + // Get height differently depending on the browser used + myHeight = tinymce.isIE ? b.scrollHeight : de.offsetHeight; + + // Don't make it smaller than the minimum height + if (myHeight > t.autoresize_min_height) + resizeHeight = myHeight; + + // Resize content element + DOM.setStyle(DOM.get(ed.id + '_ifr'), 'height', resizeHeight + 'px'); + + // if we're throbbing, we'll re-throb to match the new size + if (t.throbbing) { + ed.setProgressState(false); + ed.setProgressState(true); + } + }; + + t.editor = ed; + + // Define minimum height + t.autoresize_min_height = ed.getElement().offsetHeight; + + // Add appropriate listeners for resizing content area + ed.onChange.add(resize); + ed.onSetContent.add(resize); + ed.onPaste.add(resize); + ed.onKeyUp.add(resize); + ed.onPostRender.add(resize); + + if (ed.getParam('autoresize_on_init', true)) { + // Things to do when the editor is ready + ed.onInit.add(function(ed, l) { + // Show throbber until content area is resized properly + ed.setProgressState(true); + t.throbbing = true; + + // Hide scrollbars + ed.getBody().style.overflowY = "hidden"; + }); + + ed.onLoadContent.add(function(ed, l) { + resize(); + + // Because the content area resizes when its content CSS loads, + // and we can't easily add a listener to its onload event, + // we'll just trigger a resize after a short loading period + setTimeout(function() { + resize(); + + // Disable throbber + ed.setProgressState(false); + t.throbbing = false; + }, 1250); + }); + } + + // Register the command so that it can be invoked by using tinyMCE.activeEditor.execCommand('mceExample'); + ed.addCommand('mceAutoResize', resize); + }, + + /** + * Returns information about the plugin as a name/value array. + * The current keys are longname, author, authorurl, infourl and version. + * + * @return {Object} Name/value array containing information about the plugin. + */ + getInfo : function() { + return { + longname : 'Auto Resize', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/autoresize', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('autoresize', tinymce.plugins.AutoResizePlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/autosave/editor_plugin.js b/web/libs/tiny_mce/plugins/autosave/editor_plugin.js new file mode 100644 index 0000000..6e48540 --- /dev/null +++ b/web/libs/tiny_mce/plugins/autosave/editor_plugin.js @@ -0,0 +1 @@ +(function(e){var c="autosave",g="restoredraft",b=true,f,d,a=e.util.Dispatcher;e.create("tinymce.plugins.AutoSave",{init:function(i,j){var h=this,l=i.settings;h.editor=i;function k(n){var m={s:1000,m:60000};n=/^(\d+)([ms]?)$/.exec(""+n);return(n[2]?m[n[2]]:1)*parseInt(n)}e.each({ask_before_unload:b,interval:"30s",retention:"20m",minlength:50},function(n,m){m=c+"_"+m;if(l[m]===f){l[m]=n}});l.autosave_interval=k(l.autosave_interval);l.autosave_retention=k(l.autosave_retention);i.addButton(g,{title:c+".restore_content",onclick:function(){if(i.getContent({draft:true}).replace(/\s| |<\/?p[^>]*>|]*>/gi,"").length>0){i.windowManager.confirm(c+".warning_message",function(m){if(m){h.restoreDraft()}})}else{h.restoreDraft()}}});i.onNodeChange.add(function(){var m=i.controlManager;if(m.get(g)){m.setDisabled(g,!h.hasDraft())}});i.onInit.add(function(){if(i.controlManager.get(g)){h.setupStorage(i);setInterval(function(){h.storeDraft();i.nodeChanged()},l.autosave_interval)}});h.onStoreDraft=new a(h);h.onRestoreDraft=new a(h);h.onRemoveDraft=new a(h);if(!d){window.onbeforeunload=e.plugins.AutoSave._beforeUnloadHandler;d=b}},getInfo:function(){return{longname:"Auto save",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/autosave",version:e.majorVersion+"."+e.minorVersion}},getExpDate:function(){return new Date(new Date().getTime()+this.editor.settings.autosave_retention).toUTCString()},setupStorage:function(i){var h=this,k=c+"_test",j="OK";h.key=c+i.id;e.each([function(){if(localStorage){localStorage.setItem(k,j);if(localStorage.getItem(k)===j){localStorage.removeItem(k);return localStorage}}},function(){if(sessionStorage){sessionStorage.setItem(k,j);if(sessionStorage.getItem(k)===j){sessionStorage.removeItem(k);return sessionStorage}}},function(){if(e.isIE){i.getElement().style.behavior="url('#default#userData')";return{autoExpires:b,setItem:function(l,n){var m=i.getElement();m.setAttribute(l,n);m.expires=h.getExpDate();m.save("TinyMCE")},getItem:function(l){var m=i.getElement();m.load("TinyMCE");return m.getAttribute(l)},removeItem:function(l){i.getElement().removeAttribute(l)}}}},],function(l){try{h.storage=l();if(h.storage){return false}}catch(m){}})},storeDraft:function(){var i=this,l=i.storage,j=i.editor,h,k;if(l){if(!l.getItem(i.key)&&!j.isDirty()){return}k=j.getContent({draft:true});if(k.length>j.settings.autosave_minlength){h=i.getExpDate();if(!i.storage.autoExpires){i.storage.setItem(i.key+"_expires",h)}i.storage.setItem(i.key,k);i.onStoreDraft.dispatch(i,{expires:h,content:k})}}},restoreDraft:function(){var h=this,i=h.storage;if(i){content=i.getItem(h.key);if(content){h.editor.setContent(content);h.onRestoreDraft.dispatch(h,{content:content})}}},hasDraft:function(){var h=this,k=h.storage,i,j;if(k){j=!!k.getItem(h.key);if(j){if(!h.storage.autoExpires){i=new Date(k.getItem(h.key+"_expires"));if(new Date().getTime()]*>|]*>/gi, "").length > 0) { + // Show confirm dialog if the editor isn't empty + ed.windowManager.confirm( + PLUGIN_NAME + ".warning_message", + function(ok) { + if (ok) + self.restoreDraft(); + } + ); + } else + self.restoreDraft(); + } + }); + + // Enable/disable restoredraft button depending on if there is a draft stored or not + ed.onNodeChange.add(function() { + var controlManager = ed.controlManager; + + if (controlManager.get(RESTORE_DRAFT)) + controlManager.setDisabled(RESTORE_DRAFT, !self.hasDraft()); + }); + + ed.onInit.add(function() { + // Check if the user added the restore button, then setup auto storage logic + if (ed.controlManager.get(RESTORE_DRAFT)) { + // Setup storage engine + self.setupStorage(ed); + + // Auto save contents each interval time + setInterval(function() { + self.storeDraft(); + ed.nodeChanged(); + }, settings.autosave_interval); + } + }); + + /** + * This event gets fired when a draft is stored to local storage. + * + * @event onStoreDraft + * @param {tinymce.plugins.AutoSave} sender Plugin instance sending the event. + * @param {Object} draft Draft object containing the HTML contents of the editor. + */ + self.onStoreDraft = new Dispatcher(self); + + /** + * This event gets fired when a draft is restored from local storage. + * + * @event onStoreDraft + * @param {tinymce.plugins.AutoSave} sender Plugin instance sending the event. + * @param {Object} draft Draft object containing the HTML contents of the editor. + */ + self.onRestoreDraft = new Dispatcher(self); + + /** + * This event gets fired when a draft removed/expired. + * + * @event onRemoveDraft + * @param {tinymce.plugins.AutoSave} sender Plugin instance sending the event. + * @param {Object} draft Draft object containing the HTML contents of the editor. + */ + self.onRemoveDraft = new Dispatcher(self); + + // Add ask before unload dialog only add one unload handler + if (!unloadHandlerAdded) { + window.onbeforeunload = tinymce.plugins.AutoSave._beforeUnloadHandler; + unloadHandlerAdded = TRUE; + } + }, + + /** + * Returns information about the plugin as a name/value array. + * The current keys are longname, author, authorurl, infourl and version. + * + * @method getInfo + * @return {Object} Name/value array containing information about the plugin. + */ + getInfo : function() { + return { + longname : 'Auto save', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/autosave', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + /** + * Returns an expiration date UTC string. + * + * @method getExpDate + * @return {String} Expiration date UTC string. + */ + getExpDate : function() { + return new Date( + new Date().getTime() + this.editor.settings.autosave_retention + ).toUTCString(); + }, + + /** + * This method will setup the storage engine. If the browser has support for it. + * + * @method setupStorage + */ + setupStorage : function(ed) { + var self = this, testKey = PLUGIN_NAME + '_test', testVal = "OK"; + + self.key = PLUGIN_NAME + ed.id; + + // Loop though each storage engine type until we find one that works + tinymce.each([ + function() { + // Try HTML5 Local Storage + if (localStorage) { + localStorage.setItem(testKey, testVal); + + if (localStorage.getItem(testKey) === testVal) { + localStorage.removeItem(testKey); + + return localStorage; + } + } + }, + + function() { + // Try HTML5 Session Storage + if (sessionStorage) { + sessionStorage.setItem(testKey, testVal); + + if (sessionStorage.getItem(testKey) === testVal) { + sessionStorage.removeItem(testKey); + + return sessionStorage; + } + } + }, + + function() { + // Try IE userData + if (tinymce.isIE) { + ed.getElement().style.behavior = "url('#default#userData')"; + + // Fake localStorage on old IE + return { + autoExpires : TRUE, + + setItem : function(key, value) { + var userDataElement = ed.getElement(); + + userDataElement.setAttribute(key, value); + userDataElement.expires = self.getExpDate(); + userDataElement.save("TinyMCE"); + }, + + getItem : function(key) { + var userDataElement = ed.getElement(); + + userDataElement.load("TinyMCE"); + + return userDataElement.getAttribute(key); + }, + + removeItem : function(key) { + ed.getElement().removeAttribute(key); + } + }; + } + }, + ], function(setup) { + // Try executing each function to find a suitable storage engine + try { + self.storage = setup(); + + if (self.storage) + return false; + } catch (e) { + // Ignore + } + }); + }, + + /** + * This method will store the current contents in the the storage engine. + * + * @method storeDraft + */ + storeDraft : function() { + var self = this, storage = self.storage, editor = self.editor, expires, content; + + // Is the contents dirty + if (storage) { + // If there is no existing key and the contents hasn't been changed since + // it's original value then there is no point in saving a draft + if (!storage.getItem(self.key) && !editor.isDirty()) + return; + + // Store contents if the contents if longer than the minlength of characters + content = editor.getContent({draft: true}); + if (content.length > editor.settings.autosave_minlength) { + expires = self.getExpDate(); + + // Store expiration date if needed IE userData has auto expire built in + if (!self.storage.autoExpires) + self.storage.setItem(self.key + "_expires", expires); + + self.storage.setItem(self.key, content); + self.onStoreDraft.dispatch(self, { + expires : expires, + content : content + }); + } + } + }, + + /** + * This method will restore the contents from the storage engine back to the editor. + * + * @method restoreDraft + */ + restoreDraft : function() { + var self = this, storage = self.storage; + + if (storage) { + content = storage.getItem(self.key); + + if (content) { + self.editor.setContent(content); + self.onRestoreDraft.dispatch(self, { + content : content + }); + } + } + }, + + /** + * This method will return true/false if there is a local storage draft available. + * + * @method hasDraft + * @return {boolean} true/false state if there is a local draft. + */ + hasDraft : function() { + var self = this, storage = self.storage, expDate, exists; + + if (storage) { + // Does the item exist at all + exists = !!storage.getItem(self.key); + if (exists) { + // Storage needs autoexpire + if (!self.storage.autoExpires) { + expDate = new Date(storage.getItem(self.key + "_expires")); + + // Contents hasn't expired + if (new Date().getTime() < expDate.getTime()) + return TRUE; + + // Remove it if it has + self.removeDraft(); + } else + return TRUE; + } + } + + return false; + }, + + /** + * Removes the currently stored draft. + * + * @method removeDraft + */ + removeDraft : function() { + var self = this, storage = self.storage, key = self.key, content; + + if (storage) { + // Get current contents and remove the existing draft + content = storage.getItem(key); + storage.removeItem(key); + storage.removeItem(key + "_expires"); + + // Dispatch remove event if we had any contents + if (content) { + self.onRemoveDraft.dispatch(self, { + content : content + }); + } + } + }, + + "static" : { + // Internal unload handler will be called before the page is unloaded + _beforeUnloadHandler : function(e) { + var msg; + + tinymce.each(tinyMCE.editors, function(ed) { + // Store a draft for each editor instance + if (ed.plugins.autosave) + ed.plugins.autosave.storeDraft(); + + // Never ask in fullscreen mode + if (ed.getParam("fullscreen_is_enabled")) + return; + + // Setup a return message if the editor is dirty + if (!msg && ed.isDirty() && ed.getParam("autosave_ask_before_unload")) + msg = ed.getLang("autosave.unload_msg"); + }); + + return msg; + } + } + }); + + tinymce.PluginManager.add('autosave', tinymce.plugins.AutoSave); +})(tinymce); diff --git a/web/libs/tiny_mce/plugins/autosave/langs/en.js b/web/libs/tiny_mce/plugins/autosave/langs/en.js new file mode 100644 index 0000000..fce6bd3 --- /dev/null +++ b/web/libs/tiny_mce/plugins/autosave/langs/en.js @@ -0,0 +1,4 @@ +tinyMCE.addI18n('en.autosave',{ +restore_content: "Restore auto-saved content", +warning_message: "If you restore the saved content, you will lose all the content that is currently in the editor.\n\nAre you sure you want to restore the saved content?" +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/bbcode/editor_plugin.js b/web/libs/tiny_mce/plugins/bbcode/editor_plugin.js new file mode 100644 index 0000000..930fdff --- /dev/null +++ b/web/libs/tiny_mce/plugins/bbcode/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.BBCodePlugin",{init:function(a,b){var d=this,c=a.getParam("bbcode_dialect","punbb").toLowerCase();a.onBeforeSetContent.add(function(e,f){f.content=d["_"+c+"_bbcode2html"](f.content)});a.onPostProcess.add(function(e,f){if(f.set){f.content=d["_"+c+"_bbcode2html"](f.content)}if(f.get){f.content=d["_"+c+"_html2bbcode"](f.content)}})},getInfo:function(){return{longname:"BBCode Plugin",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/bbcode",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_punbb_html2bbcode:function(a){a=tinymce.trim(a);function b(c,d){a=a.replace(c,d)}b(/(.*?)<\/a>/gi,"[url=$1]$2[/url]");b(/(.*?)<\/font>/gi,"[code][color=$1]$2[/color][/code]");b(/(.*?)<\/font>/gi,"[quote][color=$1]$2[/color][/quote]");b(/(.*?)<\/font>/gi,"[code][color=$1]$2[/color][/code]");b(/(.*?)<\/font>/gi,"[quote][color=$1]$2[/color][/quote]");b(/(.*?)<\/span>/gi,"[color=$1]$2[/color]");b(/(.*?)<\/font>/gi,"[color=$1]$2[/color]");b(/(.*?)<\/span>/gi,"[size=$1]$2[/size]");b(/(.*?)<\/font>/gi,"$1");b(//gi,"[img]$1[/img]");b(/(.*?)<\/span>/gi,"[code]$1[/code]");b(/(.*?)<\/span>/gi,"[quote]$1[/quote]");b(/(.*?)<\/strong>/gi,"[code][b]$1[/b][/code]");b(/(.*?)<\/strong>/gi,"[quote][b]$1[/b][/quote]");b(/(.*?)<\/em>/gi,"[code][i]$1[/i][/code]");b(/(.*?)<\/em>/gi,"[quote][i]$1[/i][/quote]");b(/(.*?)<\/u>/gi,"[code][u]$1[/u][/code]");b(/(.*?)<\/u>/gi,"[quote][u]$1[/u][/quote]");b(/<\/(strong|b)>/gi,"[/b]");b(/<(strong|b)>/gi,"[b]");b(/<\/(em|i)>/gi,"[/i]");b(/<(em|i)>/gi,"[i]");b(/<\/u>/gi,"[/u]");b(/(.*?)<\/span>/gi,"[u]$1[/u]");b(//gi,"[u]");b(/]*>/gi,"[quote]");b(/<\/blockquote>/gi,"[/quote]");b(/
/gi,"\n");b(//gi,"\n");b(/
/gi,"\n");b(/

/gi,"");b(/<\/p>/gi,"\n");b(/ /gi," ");b(/"/gi,'"');b(/</gi,"<");b(/>/gi,">");b(/&/gi,"&");return a},_punbb_bbcode2html:function(a){a=tinymce.trim(a);function b(c,d){a=a.replace(c,d)}b(/\n/gi,"
");b(/\[b\]/gi,"");b(/\[\/b\]/gi,"");b(/\[i\]/gi,"");b(/\[\/i\]/gi,"");b(/\[u\]/gi,"");b(/\[\/u\]/gi,"");b(/\[url=([^\]]+)\](.*?)\[\/url\]/gi,'$2');b(/\[url\](.*?)\[\/url\]/gi,'$1');b(/\[img\](.*?)\[\/img\]/gi,'');b(/\[color=(.*?)\](.*?)\[\/color\]/gi,'$2');b(/\[code\](.*?)\[\/code\]/gi,'$1 ');b(/\[quote.*?\](.*?)\[\/quote\]/gi,'$1 ');return a}});tinymce.PluginManager.add("bbcode",tinymce.plugins.BBCodePlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/bbcode/editor_plugin_src.js b/web/libs/tiny_mce/plugins/bbcode/editor_plugin_src.js new file mode 100644 index 0000000..5586637 --- /dev/null +++ b/web/libs/tiny_mce/plugins/bbcode/editor_plugin_src.js @@ -0,0 +1,120 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.BBCodePlugin', { + init : function(ed, url) { + var t = this, dialect = ed.getParam('bbcode_dialect', 'punbb').toLowerCase(); + + ed.onBeforeSetContent.add(function(ed, o) { + o.content = t['_' + dialect + '_bbcode2html'](o.content); + }); + + ed.onPostProcess.add(function(ed, o) { + if (o.set) + o.content = t['_' + dialect + '_bbcode2html'](o.content); + + if (o.get) + o.content = t['_' + dialect + '_html2bbcode'](o.content); + }); + }, + + getInfo : function() { + return { + longname : 'BBCode Plugin', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/bbcode', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + // Private methods + + // HTML -> BBCode in PunBB dialect + _punbb_html2bbcode : function(s) { + s = tinymce.trim(s); + + function rep(re, str) { + s = s.replace(re, str); + }; + + // example: to [b] + rep(/(.*?)<\/a>/gi,"[url=$1]$2[/url]"); + rep(/(.*?)<\/font>/gi,"[code][color=$1]$2[/color][/code]"); + rep(/(.*?)<\/font>/gi,"[quote][color=$1]$2[/color][/quote]"); + rep(/(.*?)<\/font>/gi,"[code][color=$1]$2[/color][/code]"); + rep(/(.*?)<\/font>/gi,"[quote][color=$1]$2[/color][/quote]"); + rep(/(.*?)<\/span>/gi,"[color=$1]$2[/color]"); + rep(/(.*?)<\/font>/gi,"[color=$1]$2[/color]"); + rep(/(.*?)<\/span>/gi,"[size=$1]$2[/size]"); + rep(/(.*?)<\/font>/gi,"$1"); + rep(//gi,"[img]$1[/img]"); + rep(/(.*?)<\/span>/gi,"[code]$1[/code]"); + rep(/(.*?)<\/span>/gi,"[quote]$1[/quote]"); + rep(/(.*?)<\/strong>/gi,"[code][b]$1[/b][/code]"); + rep(/(.*?)<\/strong>/gi,"[quote][b]$1[/b][/quote]"); + rep(/(.*?)<\/em>/gi,"[code][i]$1[/i][/code]"); + rep(/(.*?)<\/em>/gi,"[quote][i]$1[/i][/quote]"); + rep(/(.*?)<\/u>/gi,"[code][u]$1[/u][/code]"); + rep(/(.*?)<\/u>/gi,"[quote][u]$1[/u][/quote]"); + rep(/<\/(strong|b)>/gi,"[/b]"); + rep(/<(strong|b)>/gi,"[b]"); + rep(/<\/(em|i)>/gi,"[/i]"); + rep(/<(em|i)>/gi,"[i]"); + rep(/<\/u>/gi,"[/u]"); + rep(/(.*?)<\/span>/gi,"[u]$1[/u]"); + rep(//gi,"[u]"); + rep(/]*>/gi,"[quote]"); + rep(/<\/blockquote>/gi,"[/quote]"); + rep(/
/gi,"\n"); + rep(//gi,"\n"); + rep(/
/gi,"\n"); + rep(/

/gi,""); + rep(/<\/p>/gi,"\n"); + rep(/ /gi," "); + rep(/"/gi,"\""); + rep(/</gi,"<"); + rep(/>/gi,">"); + rep(/&/gi,"&"); + + return s; + }, + + // BBCode -> HTML from PunBB dialect + _punbb_bbcode2html : function(s) { + s = tinymce.trim(s); + + function rep(re, str) { + s = s.replace(re, str); + }; + + // example: [b] to + rep(/\n/gi,"
"); + rep(/\[b\]/gi,""); + rep(/\[\/b\]/gi,""); + rep(/\[i\]/gi,""); + rep(/\[\/i\]/gi,""); + rep(/\[u\]/gi,""); + rep(/\[\/u\]/gi,""); + rep(/\[url=([^\]]+)\](.*?)\[\/url\]/gi,"$2"); + rep(/\[url\](.*?)\[\/url\]/gi,"$1"); + rep(/\[img\](.*?)\[\/img\]/gi,""); + rep(/\[color=(.*?)\](.*?)\[\/color\]/gi,"$2"); + rep(/\[code\](.*?)\[\/code\]/gi,"$1 "); + rep(/\[quote.*?\](.*?)\[\/quote\]/gi,"$1 "); + + return s; + } + }); + + // Register plugin + tinymce.PluginManager.add('bbcode', tinymce.plugins.BBCodePlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/contextmenu/editor_plugin.js b/web/libs/tiny_mce/plugins/contextmenu/editor_plugin.js new file mode 100644 index 0000000..9749e51 --- /dev/null +++ b/web/libs/tiny_mce/plugins/contextmenu/editor_plugin.js @@ -0,0 +1 @@ +(function(){var a=tinymce.dom.Event,c=tinymce.each,b=tinymce.DOM;tinymce.create("tinymce.plugins.ContextMenu",{init:function(d){var f=this,g;f.editor=d;f.onContextMenu=new tinymce.util.Dispatcher(this);d.onContextMenu.add(function(h,i){if(!i.ctrlKey){if(g){h.selection.setRng(g)}f._getMenu(h).showMenu(i.clientX,i.clientY);a.add(h.getDoc(),"click",function(j){e(h,j)});a.cancel(i)}});d.onRemove.add(function(){if(f._menu){f._menu.removeAll()}});function e(h,i){g=null;if(i&&i.button==2){g=h.selection.getRng();return}if(f._menu){f._menu.removeAll();f._menu.destroy();a.remove(h.getDoc(),"click",e)}}d.onMouseDown.add(e);d.onKeyDown.add(e)},getInfo:function(){return{longname:"Contextmenu",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/contextmenu",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_getMenu:function(h){var l=this,f=l._menu,i=h.selection,e=i.isCollapsed(),d=i.getNode()||h.getBody(),g,k,j;if(f){f.removeAll();f.destroy()}k=b.getPos(h.getContentAreaContainer());j=b.getPos(h.getContainer());f=h.controlManager.createDropMenu("contextmenu",{offset_x:k.x+h.getParam("contextmenu_offset_x",0),offset_y:k.y+h.getParam("contextmenu_offset_y",0),constrain:1});l._menu=f;f.add({title:"advanced.cut_desc",icon:"cut",cmd:"Cut"}).setDisabled(e);f.add({title:"advanced.copy_desc",icon:"copy",cmd:"Copy"}).setDisabled(e);f.add({title:"advanced.paste_desc",icon:"paste",cmd:"Paste"});if((d.nodeName=="A"&&!h.dom.getAttrib(d,"name"))||!e){f.addSeparator();f.add({title:"advanced.link_desc",icon:"link",cmd:h.plugins.advlink?"mceAdvLink":"mceLink",ui:true});f.add({title:"advanced.unlink_desc",icon:"unlink",cmd:"UnLink"})}f.addSeparator();f.add({title:"advanced.image_desc",icon:"image",cmd:h.plugins.advimage?"mceAdvImage":"mceImage",ui:true});f.addSeparator();g=f.addMenu({title:"contextmenu.align"});g.add({title:"contextmenu.left",icon:"justifyleft",cmd:"JustifyLeft"});g.add({title:"contextmenu.center",icon:"justifycenter",cmd:"JustifyCenter"});g.add({title:"contextmenu.right",icon:"justifyright",cmd:"JustifyRight"});g.add({title:"contextmenu.full",icon:"justifyfull",cmd:"JustifyFull"});l.onContextMenu.dispatch(l,f,d,e);return f}});tinymce.PluginManager.add("contextmenu",tinymce.plugins.ContextMenu)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/contextmenu/editor_plugin_src.js b/web/libs/tiny_mce/plugins/contextmenu/editor_plugin_src.js new file mode 100644 index 0000000..13813a6 --- /dev/null +++ b/web/libs/tiny_mce/plugins/contextmenu/editor_plugin_src.js @@ -0,0 +1,147 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + var Event = tinymce.dom.Event, each = tinymce.each, DOM = tinymce.DOM; + + /** + * This plugin a context menu to TinyMCE editor instances. + * + * @class tinymce.plugins.ContextMenu + */ + tinymce.create('tinymce.plugins.ContextMenu', { + /** + * Initializes the plugin, this will be executed after the plugin has been created. + * This call is done before the editor instance has finished it's initialization so use the onInit event + * of the editor instance to intercept that event. + * + * @method init + * @param {tinymce.Editor} ed Editor instance that the plugin is initialized in. + * @param {string} url Absolute URL to where the plugin is located. + */ + init : function(ed) { + var t = this, lastRng; + + t.editor = ed; + + /** + * This event gets fired when the context menu is shown. + * + * @event onContextMenu + * @param {tinymce.plugins.ContextMenu} sender Plugin instance sending the event. + * @param {tinymce.ui.DropMenu} menu Drop down menu to fill with more items if needed. + */ + t.onContextMenu = new tinymce.util.Dispatcher(this); + + ed.onContextMenu.add(function(ed, e) { + if (!e.ctrlKey) { + // Restore the last selection since it was removed + if (lastRng) + ed.selection.setRng(lastRng); + + t._getMenu(ed).showMenu(e.clientX, e.clientY); + Event.add(ed.getDoc(), 'click', function(e) { + hide(ed, e); + }); + Event.cancel(e); + } + }); + + ed.onRemove.add(function() { + if (t._menu) + t._menu.removeAll(); + }); + + function hide(ed, e) { + lastRng = null; + + // Since the contextmenu event moves + // the selection we need to store it away + if (e && e.button == 2) { + lastRng = ed.selection.getRng(); + return; + } + + if (t._menu) { + t._menu.removeAll(); + t._menu.destroy(); + Event.remove(ed.getDoc(), 'click', hide); + } + }; + + ed.onMouseDown.add(hide); + ed.onKeyDown.add(hide); + }, + + /** + * Returns information about the plugin as a name/value array. + * The current keys are longname, author, authorurl, infourl and version. + * + * @method getInfo + * @return {Object} Name/value array containing information about the plugin. + */ + getInfo : function() { + return { + longname : 'Contextmenu', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/contextmenu', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + _getMenu : function(ed) { + var t = this, m = t._menu, se = ed.selection, col = se.isCollapsed(), el = se.getNode() || ed.getBody(), am, p1, p2; + + if (m) { + m.removeAll(); + m.destroy(); + } + + p1 = DOM.getPos(ed.getContentAreaContainer()); + p2 = DOM.getPos(ed.getContainer()); + + m = ed.controlManager.createDropMenu('contextmenu', { + offset_x : p1.x + ed.getParam('contextmenu_offset_x', 0), + offset_y : p1.y + ed.getParam('contextmenu_offset_y', 0), + constrain : 1 + }); + + t._menu = m; + + m.add({title : 'advanced.cut_desc', icon : 'cut', cmd : 'Cut'}).setDisabled(col); + m.add({title : 'advanced.copy_desc', icon : 'copy', cmd : 'Copy'}).setDisabled(col); + m.add({title : 'advanced.paste_desc', icon : 'paste', cmd : 'Paste'}); + + if ((el.nodeName == 'A' && !ed.dom.getAttrib(el, 'name')) || !col) { + m.addSeparator(); + m.add({title : 'advanced.link_desc', icon : 'link', cmd : ed.plugins.advlink ? 'mceAdvLink' : 'mceLink', ui : true}); + m.add({title : 'advanced.unlink_desc', icon : 'unlink', cmd : 'UnLink'}); + } + + m.addSeparator(); + m.add({title : 'advanced.image_desc', icon : 'image', cmd : ed.plugins.advimage ? 'mceAdvImage' : 'mceImage', ui : true}); + + m.addSeparator(); + am = m.addMenu({title : 'contextmenu.align'}); + am.add({title : 'contextmenu.left', icon : 'justifyleft', cmd : 'JustifyLeft'}); + am.add({title : 'contextmenu.center', icon : 'justifycenter', cmd : 'JustifyCenter'}); + am.add({title : 'contextmenu.right', icon : 'justifyright', cmd : 'JustifyRight'}); + am.add({title : 'contextmenu.full', icon : 'justifyfull', cmd : 'JustifyFull'}); + + t.onContextMenu.dispatch(t, m, el, col); + + return m; + } + }); + + // Register plugin + tinymce.PluginManager.add('contextmenu', tinymce.plugins.ContextMenu); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/directionality/editor_plugin.js b/web/libs/tiny_mce/plugins/directionality/editor_plugin.js new file mode 100644 index 0000000..bce8e73 --- /dev/null +++ b/web/libs/tiny_mce/plugins/directionality/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.Directionality",{init:function(a,b){var c=this;c.editor=a;a.addCommand("mceDirectionLTR",function(){var d=a.dom.getParent(a.selection.getNode(),a.dom.isBlock);if(d){if(a.dom.getAttrib(d,"dir")!="ltr"){a.dom.setAttrib(d,"dir","ltr")}else{a.dom.setAttrib(d,"dir","")}}a.nodeChanged()});a.addCommand("mceDirectionRTL",function(){var d=a.dom.getParent(a.selection.getNode(),a.dom.isBlock);if(d){if(a.dom.getAttrib(d,"dir")!="rtl"){a.dom.setAttrib(d,"dir","rtl")}else{a.dom.setAttrib(d,"dir","")}}a.nodeChanged()});a.addButton("ltr",{title:"directionality.ltr_desc",cmd:"mceDirectionLTR"});a.addButton("rtl",{title:"directionality.rtl_desc",cmd:"mceDirectionRTL"});a.onNodeChange.add(c._nodeChange,c)},getInfo:function(){return{longname:"Directionality",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/directionality",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_nodeChange:function(b,a,e){var d=b.dom,c;e=d.getParent(e,d.isBlock);if(!e){a.setDisabled("ltr",1);a.setDisabled("rtl",1);return}c=d.getAttrib(e,"dir");a.setActive("ltr",c=="ltr");a.setDisabled("ltr",0);a.setActive("rtl",c=="rtl");a.setDisabled("rtl",0)}});tinymce.PluginManager.add("directionality",tinymce.plugins.Directionality)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/directionality/editor_plugin_src.js b/web/libs/tiny_mce/plugins/directionality/editor_plugin_src.js new file mode 100644 index 0000000..4444959 --- /dev/null +++ b/web/libs/tiny_mce/plugins/directionality/editor_plugin_src.js @@ -0,0 +1,82 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.Directionality', { + init : function(ed, url) { + var t = this; + + t.editor = ed; + + ed.addCommand('mceDirectionLTR', function() { + var e = ed.dom.getParent(ed.selection.getNode(), ed.dom.isBlock); + + if (e) { + if (ed.dom.getAttrib(e, "dir") != "ltr") + ed.dom.setAttrib(e, "dir", "ltr"); + else + ed.dom.setAttrib(e, "dir", ""); + } + + ed.nodeChanged(); + }); + + ed.addCommand('mceDirectionRTL', function() { + var e = ed.dom.getParent(ed.selection.getNode(), ed.dom.isBlock); + + if (e) { + if (ed.dom.getAttrib(e, "dir") != "rtl") + ed.dom.setAttrib(e, "dir", "rtl"); + else + ed.dom.setAttrib(e, "dir", ""); + } + + ed.nodeChanged(); + }); + + ed.addButton('ltr', {title : 'directionality.ltr_desc', cmd : 'mceDirectionLTR'}); + ed.addButton('rtl', {title : 'directionality.rtl_desc', cmd : 'mceDirectionRTL'}); + + ed.onNodeChange.add(t._nodeChange, t); + }, + + getInfo : function() { + return { + longname : 'Directionality', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/directionality', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + // Private methods + + _nodeChange : function(ed, cm, n) { + var dom = ed.dom, dir; + + n = dom.getParent(n, dom.isBlock); + if (!n) { + cm.setDisabled('ltr', 1); + cm.setDisabled('rtl', 1); + return; + } + + dir = dom.getAttrib(n, 'dir'); + cm.setActive('ltr', dir == "ltr"); + cm.setDisabled('ltr', 0); + cm.setActive('rtl', dir == "rtl"); + cm.setDisabled('rtl', 0); + } + }); + + // Register plugin + tinymce.PluginManager.add('directionality', tinymce.plugins.Directionality); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/emotions/editor_plugin.js b/web/libs/tiny_mce/plugins/emotions/editor_plugin.js new file mode 100644 index 0000000..dbdd8ff --- /dev/null +++ b/web/libs/tiny_mce/plugins/emotions/editor_plugin.js @@ -0,0 +1 @@ +(function(a){a.create("tinymce.plugins.EmotionsPlugin",{init:function(b,c){b.addCommand("mceEmotion",function(){b.windowManager.open({file:c+"/emotions.htm",width:250+parseInt(b.getLang("emotions.delta_width",0)),height:160+parseInt(b.getLang("emotions.delta_height",0)),inline:1},{plugin_url:c})});b.addButton("emotions",{title:"emotions.emotions_desc",cmd:"mceEmotion"})},getInfo:function(){return{longname:"Emotions",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/emotions",version:a.majorVersion+"."+a.minorVersion}}});a.PluginManager.add("emotions",a.plugins.EmotionsPlugin)})(tinymce); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/emotions/editor_plugin_src.js b/web/libs/tiny_mce/plugins/emotions/editor_plugin_src.js new file mode 100644 index 0000000..71d5416 --- /dev/null +++ b/web/libs/tiny_mce/plugins/emotions/editor_plugin_src.js @@ -0,0 +1,43 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function(tinymce) { + tinymce.create('tinymce.plugins.EmotionsPlugin', { + init : function(ed, url) { + // Register commands + ed.addCommand('mceEmotion', function() { + ed.windowManager.open({ + file : url + '/emotions.htm', + width : 250 + parseInt(ed.getLang('emotions.delta_width', 0)), + height : 160 + parseInt(ed.getLang('emotions.delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + // Register buttons + ed.addButton('emotions', {title : 'emotions.emotions_desc', cmd : 'mceEmotion'}); + }, + + getInfo : function() { + return { + longname : 'Emotions', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/emotions', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('emotions', tinymce.plugins.EmotionsPlugin); +})(tinymce); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/emotions/emotions.htm b/web/libs/tiny_mce/plugins/emotions/emotions.htm new file mode 100644 index 0000000..55a1d72 --- /dev/null +++ b/web/libs/tiny_mce/plugins/emotions/emotions.htm @@ -0,0 +1,40 @@ + + + + {#emotions_dlg.title} + + + + +

+
{#emotions_dlg.title}:

+ + + + + + + + + + + + + + + + + + + + + + + + + + +
{#emotions_dlg.cool}{#emotions_dlg.cry}{#emotions_dlg.embarassed}{#emotions_dlg.foot_in_mouth}
{#emotions_dlg.frown}{#emotions_dlg.innocent}{#emotions_dlg.kiss}{#emotions_dlg.laughing}
{#emotions_dlg.money_mouth}{#emotions_dlg.sealed}{#emotions_dlg.smile}{#emotions_dlg.surprised}
{#emotions_dlg.tongue-out}{#emotions_dlg.undecided}{#emotions_dlg.wink}{#emotions_dlg.yell}
+
+ + diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-cool.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-cool.gif new file mode 100644 index 0000000..ba90cc3 Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-cool.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-cry.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-cry.gif new file mode 100644 index 0000000..74d897a Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-cry.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-embarassed.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-embarassed.gif new file mode 100644 index 0000000..963a96b Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-embarassed.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-foot-in-mouth.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-foot-in-mouth.gif new file mode 100644 index 0000000..16f68cc Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-foot-in-mouth.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-frown.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-frown.gif new file mode 100644 index 0000000..716f55e Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-frown.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-innocent.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-innocent.gif new file mode 100644 index 0000000..334d49e Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-innocent.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-kiss.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-kiss.gif new file mode 100644 index 0000000..4efd549 Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-kiss.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-laughing.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-laughing.gif new file mode 100644 index 0000000..1606c11 Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-laughing.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-money-mouth.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-money-mouth.gif new file mode 100644 index 0000000..ca2451e Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-money-mouth.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-sealed.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-sealed.gif new file mode 100644 index 0000000..b33d3cc Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-sealed.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-smile.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-smile.gif new file mode 100644 index 0000000..e6a9e60 Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-smile.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-surprised.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-surprised.gif new file mode 100644 index 0000000..cb99cdd Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-surprised.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-tongue-out.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-tongue-out.gif new file mode 100644 index 0000000..2075dc1 Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-tongue-out.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-undecided.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-undecided.gif new file mode 100644 index 0000000..bef7e25 Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-undecided.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-wink.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-wink.gif new file mode 100644 index 0000000..9faf1af Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-wink.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/img/smiley-yell.gif b/web/libs/tiny_mce/plugins/emotions/img/smiley-yell.gif new file mode 100644 index 0000000..648e6e8 Binary files /dev/null and b/web/libs/tiny_mce/plugins/emotions/img/smiley-yell.gif differ diff --git a/web/libs/tiny_mce/plugins/emotions/js/emotions.js b/web/libs/tiny_mce/plugins/emotions/js/emotions.js new file mode 100644 index 0000000..c549367 --- /dev/null +++ b/web/libs/tiny_mce/plugins/emotions/js/emotions.js @@ -0,0 +1,22 @@ +tinyMCEPopup.requireLangPack(); + +var EmotionsDialog = { + init : function(ed) { + tinyMCEPopup.resizeToInnerSize(); + }, + + insert : function(file, title) { + var ed = tinyMCEPopup.editor, dom = ed.dom; + + tinyMCEPopup.execCommand('mceInsertContent', false, dom.createHTML('img', { + src : tinyMCEPopup.getWindowArg('plugin_url') + '/img/' + file, + alt : ed.getLang(title), + title : ed.getLang(title), + border : 0 + })); + + tinyMCEPopup.close(); + } +}; + +tinyMCEPopup.onInit.add(EmotionsDialog.init, EmotionsDialog); diff --git a/web/libs/tiny_mce/plugins/emotions/langs/en_dlg.js b/web/libs/tiny_mce/plugins/emotions/langs/en_dlg.js new file mode 100644 index 0000000..3b57ad9 --- /dev/null +++ b/web/libs/tiny_mce/plugins/emotions/langs/en_dlg.js @@ -0,0 +1,20 @@ +tinyMCE.addI18n('en.emotions_dlg',{ +title:"Insert emotion", +desc:"Emotions", +cool:"Cool", +cry:"Cry", +embarassed:"Embarassed", +foot_in_mouth:"Foot in mouth", +frown:"Frown", +innocent:"Innocent", +kiss:"Kiss", +laughing:"Laughing", +money_mouth:"Money mouth", +sealed:"Sealed", +smile:"Smile", +surprised:"Surprised", +tongue_out:"Tongue out", +undecided:"Undecided", +wink:"Wink", +yell:"Yell" +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/example/dialog.htm b/web/libs/tiny_mce/plugins/example/dialog.htm new file mode 100644 index 0000000..50b2b34 --- /dev/null +++ b/web/libs/tiny_mce/plugins/example/dialog.htm @@ -0,0 +1,22 @@ + + + + {#example_dlg.title} + + + + + +
+

Here is a example dialog.

+

Selected text:

+

Custom arg:

+ +
+ + +
+
+ + + diff --git a/web/libs/tiny_mce/plugins/example/editor_plugin.js b/web/libs/tiny_mce/plugins/example/editor_plugin.js new file mode 100644 index 0000000..ec1f81e --- /dev/null +++ b/web/libs/tiny_mce/plugins/example/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.PluginManager.requireLangPack("example");tinymce.create("tinymce.plugins.ExamplePlugin",{init:function(a,b){a.addCommand("mceExample",function(){a.windowManager.open({file:b+"/dialog.htm",width:320+parseInt(a.getLang("example.delta_width",0)),height:120+parseInt(a.getLang("example.delta_height",0)),inline:1},{plugin_url:b,some_custom_arg:"custom arg"})});a.addButton("example",{title:"example.desc",cmd:"mceExample",image:b+"/img/example.gif"});a.onNodeChange.add(function(d,c,e){c.setActive("example",e.nodeName=="IMG")})},createControl:function(b,a){return null},getInfo:function(){return{longname:"Example plugin",author:"Some author",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/example",version:"1.0"}}});tinymce.PluginManager.add("example",tinymce.plugins.ExamplePlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/example/editor_plugin_src.js b/web/libs/tiny_mce/plugins/example/editor_plugin_src.js new file mode 100644 index 0000000..9a0e7da --- /dev/null +++ b/web/libs/tiny_mce/plugins/example/editor_plugin_src.js @@ -0,0 +1,84 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + // Load plugin specific language pack + tinymce.PluginManager.requireLangPack('example'); + + tinymce.create('tinymce.plugins.ExamplePlugin', { + /** + * Initializes the plugin, this will be executed after the plugin has been created. + * This call is done before the editor instance has finished it's initialization so use the onInit event + * of the editor instance to intercept that event. + * + * @param {tinymce.Editor} ed Editor instance that the plugin is initialized in. + * @param {string} url Absolute URL to where the plugin is located. + */ + init : function(ed, url) { + // Register the command so that it can be invoked by using tinyMCE.activeEditor.execCommand('mceExample'); + ed.addCommand('mceExample', function() { + ed.windowManager.open({ + file : url + '/dialog.htm', + width : 320 + parseInt(ed.getLang('example.delta_width', 0)), + height : 120 + parseInt(ed.getLang('example.delta_height', 0)), + inline : 1 + }, { + plugin_url : url, // Plugin absolute URL + some_custom_arg : 'custom arg' // Custom argument + }); + }); + + // Register example button + ed.addButton('example', { + title : 'example.desc', + cmd : 'mceExample', + image : url + '/img/example.gif' + }); + + // Add a node change handler, selects the button in the UI when a image is selected + ed.onNodeChange.add(function(ed, cm, n) { + cm.setActive('example', n.nodeName == 'IMG'); + }); + }, + + /** + * Creates control instances based in the incomming name. This method is normally not + * needed since the addButton method of the tinymce.Editor class is a more easy way of adding buttons + * but you sometimes need to create more complex controls like listboxes, split buttons etc then this + * method can be used to create those. + * + * @param {String} n Name of the control to create. + * @param {tinymce.ControlManager} cm Control manager to use inorder to create new control. + * @return {tinymce.ui.Control} New control instance or null if no control was created. + */ + createControl : function(n, cm) { + return null; + }, + + /** + * Returns information about the plugin as a name/value array. + * The current keys are longname, author, authorurl, infourl and version. + * + * @return {Object} Name/value array containing information about the plugin. + */ + getInfo : function() { + return { + longname : 'Example plugin', + author : 'Some author', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/example', + version : "1.0" + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('example', tinymce.plugins.ExamplePlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/example/img/example.gif b/web/libs/tiny_mce/plugins/example/img/example.gif new file mode 100644 index 0000000..1ab5da4 Binary files /dev/null and b/web/libs/tiny_mce/plugins/example/img/example.gif differ diff --git a/web/libs/tiny_mce/plugins/example/js/dialog.js b/web/libs/tiny_mce/plugins/example/js/dialog.js new file mode 100644 index 0000000..fa83411 --- /dev/null +++ b/web/libs/tiny_mce/plugins/example/js/dialog.js @@ -0,0 +1,19 @@ +tinyMCEPopup.requireLangPack(); + +var ExampleDialog = { + init : function() { + var f = document.forms[0]; + + // Get the selected contents as text and place it in the input + f.someval.value = tinyMCEPopup.editor.selection.getContent({format : 'text'}); + f.somearg.value = tinyMCEPopup.getWindowArg('some_custom_arg'); + }, + + insert : function() { + // Insert the contents from the input into the document + tinyMCEPopup.editor.execCommand('mceInsertContent', false, document.forms[0].someval.value); + tinyMCEPopup.close(); + } +}; + +tinyMCEPopup.onInit.add(ExampleDialog.init, ExampleDialog); diff --git a/web/libs/tiny_mce/plugins/example/langs/en.js b/web/libs/tiny_mce/plugins/example/langs/en.js new file mode 100644 index 0000000..e0784f8 --- /dev/null +++ b/web/libs/tiny_mce/plugins/example/langs/en.js @@ -0,0 +1,3 @@ +tinyMCE.addI18n('en.example',{ + desc : 'This is just a template button' +}); diff --git a/web/libs/tiny_mce/plugins/example/langs/en_dlg.js b/web/libs/tiny_mce/plugins/example/langs/en_dlg.js new file mode 100644 index 0000000..ebcf948 --- /dev/null +++ b/web/libs/tiny_mce/plugins/example/langs/en_dlg.js @@ -0,0 +1,3 @@ +tinyMCE.addI18n('en.example_dlg',{ + title : 'This is just a example title' +}); diff --git a/web/libs/tiny_mce/plugins/fullpage/css/fullpage.css b/web/libs/tiny_mce/plugins/fullpage/css/fullpage.css new file mode 100644 index 0000000..7a3334f --- /dev/null +++ b/web/libs/tiny_mce/plugins/fullpage/css/fullpage.css @@ -0,0 +1,182 @@ +/* Hide the advanced tab */ +#advanced_tab { + display: none; +} + +#metatitle, #metakeywords, #metadescription, #metaauthor, #metacopyright { + width: 280px; +} + +#doctype, #docencoding { + width: 200px; +} + +#langcode { + width: 30px; +} + +#bgimage { + width: 220px; +} + +#fontface { + width: 240px; +} + +#leftmargin, #rightmargin, #topmargin, #bottommargin { + width: 50px; +} + +.panel_wrapper div.current { + height: 400px; +} + +#stylesheet, #style { + width: 240px; +} + +/* Head list classes */ + +.headlistwrapper { + width: 100%; +} + +.addbutton, .removebutton, .moveupbutton, .movedownbutton { + border-top: 1px solid; + border-left: 1px solid; + border-bottom: 1px solid; + border-right: 1px solid; + border-color: #F0F0EE; + cursor: default; + display: block; + width: 20px; + height: 20px; +} + +#doctypes { + width: 200px; +} + +.addbutton:hover, .removebutton:hover, .moveupbutton:hover, .movedownbutton:hover { + border: 1px solid #0A246A; + background-color: #B6BDD2; +} + +.addbutton { + background-image: url('../images/add.gif'); + float: left; + margin-right: 3px; +} + +.removebutton { + background-image: url('../images/remove.gif'); + float: left; +} + +.moveupbutton { + background-image: url('../images/move_up.gif'); + float: left; + margin-right: 3px; +} + +.movedownbutton { + background-image: url('../images/move_down.gif'); + float: left; +} + +.selected { + border: 1px solid #0A246A; + background-color: #B6BDD2; +} + +.toolbar { + width: 100%; +} + +#headlist { + width: 100%; + margin-top: 3px; + font-size: 11px; +} + +#info, #title_element, #meta_element, #script_element, #style_element, #base_element, #link_element, #comment_element, #unknown_element { + display: none; +} + +#addmenu { + position: absolute; + border: 1px solid gray; + display: none; + z-index: 100; + background-color: white; +} + +#addmenu a { + display: block; + width: 100%; + line-height: 20px; + text-decoration: none; + background-color: white; +} + +#addmenu a:hover { + background-color: #B6BDD2; + color: black; +} + +#addmenu span { + padding-left: 10px; + padding-right: 10px; +} + +#updateElementPanel { + display: none; +} + +#script_element .panel_wrapper div.current { + height: 108px; +} + +#style_element .panel_wrapper div.current { + height: 108px; +} + +#link_element .panel_wrapper div.current { + height: 140px; +} + +#element_script_value { + width: 100%; + height: 100px; +} + +#element_comment_value { + width: 100%; + height: 120px; +} + +#element_style_value { + width: 100%; + height: 100px; +} + +#element_title, #element_script_src, #element_meta_name, #element_meta_content, #element_base_href, #element_link_href, #element_link_title { + width: 250px; +} + +.updateElementButton { + margin-top: 3px; +} + +/* MSIE specific styles */ + +* html .addbutton, * html .removebutton, * html .moveupbutton, * html .movedownbutton { + width: 22px; + height: 22px; +} + +textarea { + height: 55px; +} + +.panel_wrapper div.current {height:420px;} \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/fullpage/editor_plugin.js b/web/libs/tiny_mce/plugins/fullpage/editor_plugin.js new file mode 100644 index 0000000..aeaa669 --- /dev/null +++ b/web/libs/tiny_mce/plugins/fullpage/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.FullPagePlugin",{init:function(a,b){var c=this;c.editor=a;a.addCommand("mceFullPageProperties",function(){a.windowManager.open({file:b+"/fullpage.htm",width:430+parseInt(a.getLang("fullpage.delta_width",0)),height:495+parseInt(a.getLang("fullpage.delta_height",0)),inline:1},{plugin_url:b,head_html:c.head})});a.addButton("fullpage",{title:"fullpage.desc",cmd:"mceFullPageProperties"});a.onBeforeSetContent.add(c._setContent,c);a.onSetContent.add(c._setBodyAttribs,c);a.onGetContent.add(c._getContent,c)},getInfo:function(){return{longname:"Fullpage",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/fullpage",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_setBodyAttribs:function(d,a){var l,c,e,g,b,h,j,f=this.head.match(/body(.*?)>/i);if(f&&f[1]){l=f[1].match(/\s*(\w+\s*=\s*".*?"|\w+\s*=\s*'.*?'|\w+\s*=\s*\w+|\w+)\s*/g);if(l){for(c=0,e=l.length;c",a);h.head=f.substring(0,a+1);j=f.indexOf("\n'}h.head+=d.getParam("fullpage_default_doctype",'');h.head+="\n\n\n"+d.getParam("fullpage_default_title","Untitled document")+"\n";if(g=d.getParam("fullpage_default_encoding")){h.head+='\n'}if(g=d.getParam("fullpage_default_font_family")){i+="font-family: "+g+";"}if(g=d.getParam("fullpage_default_font_size")){i+="font-size: "+g+";"}if(g=d.getParam("fullpage_default_text_color")){i+="color: "+g+";"}h.head+="\n\n";h.foot="\n\n"}},_getContent:function(a,c){var b=this;if(!c.source_view||!a.getParam("fullpage_hide_in_source_view")){c.content=tinymce.trim(b.head)+"\n"+tinymce.trim(c.content)+"\n"+tinymce.trim(b.foot)}}});tinymce.PluginManager.add("fullpage",tinymce.plugins.FullPagePlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/fullpage/editor_plugin_src.js b/web/libs/tiny_mce/plugins/fullpage/editor_plugin_src.js new file mode 100644 index 0000000..a2c9df8 --- /dev/null +++ b/web/libs/tiny_mce/plugins/fullpage/editor_plugin_src.js @@ -0,0 +1,153 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.FullPagePlugin', { + init : function(ed, url) { + var t = this; + + t.editor = ed; + + // Register commands + ed.addCommand('mceFullPageProperties', function() { + ed.windowManager.open({ + file : url + '/fullpage.htm', + width : 430 + parseInt(ed.getLang('fullpage.delta_width', 0)), + height : 495 + parseInt(ed.getLang('fullpage.delta_height', 0)), + inline : 1 + }, { + plugin_url : url, + head_html : t.head + }); + }); + + // Register buttons + ed.addButton('fullpage', {title : 'fullpage.desc', cmd : 'mceFullPageProperties'}); + + ed.onBeforeSetContent.add(t._setContent, t); + ed.onSetContent.add(t._setBodyAttribs, t); + ed.onGetContent.add(t._getContent, t); + }, + + getInfo : function() { + return { + longname : 'Fullpage', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/fullpage', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + // Private plugin internal methods + + _setBodyAttribs : function(ed, o) { + var bdattr, i, len, kv, k, v, t, attr = this.head.match(/body(.*?)>/i); + + if (attr && attr[1]) { + bdattr = attr[1].match(/\s*(\w+\s*=\s*".*?"|\w+\s*=\s*'.*?'|\w+\s*=\s*\w+|\w+)\s*/g); + + if (bdattr) { + for(i = 0, len = bdattr.length; i < len; i++) { + kv = bdattr[i].split('='); + k = kv[0].replace(/\s/,''); + v = kv[1]; + + if (v) { + v = v.replace(/^\s+/,'').replace(/\s+$/,''); + t = v.match(/^["'](.*)["']$/); + + if (t) + v = t[1]; + } else + v = k; + + ed.dom.setAttrib(ed.getBody(), 'style', v); + } + } + } + }, + + _createSerializer : function() { + return new tinymce.dom.Serializer({ + dom : this.editor.dom, + apply_source_formatting : true + }); + }, + + _setContent : function(ed, o) { + var t = this, sp, ep, c = o.content, v, st = ''; + + // Ignore raw updated if we already have a head, this will fix issues with undo/redo keeping the head/foot separate + if (o.format == 'raw' && t.head) + return; + + if (o.source_view && ed.getParam('fullpage_hide_in_source_view')) + return; + + // Parse out head, body and footer + c = c.replace(/<(\/?)BODY/gi, '<$1body'); + sp = c.indexOf('', sp); + t.head = c.substring(0, sp + 1); + + ep = c.indexOf('\n'; + + t.head += ed.getParam('fullpage_default_doctype', ''); + t.head += '\n\n\n' + ed.getParam('fullpage_default_title', 'Untitled document') + '\n'; + + if (v = ed.getParam('fullpage_default_encoding')) + t.head += '\n'; + + if (v = ed.getParam('fullpage_default_font_family')) + st += 'font-family: ' + v + ';'; + + if (v = ed.getParam('fullpage_default_font_size')) + st += 'font-size: ' + v + ';'; + + if (v = ed.getParam('fullpage_default_text_color')) + st += 'color: ' + v + ';'; + + t.head += '\n\n'; + t.foot = '\n\n'; + } + }, + + _getContent : function(ed, o) { + var t = this; + + if (!o.source_view || !ed.getParam('fullpage_hide_in_source_view')) + o.content = tinymce.trim(t.head) + '\n' + tinymce.trim(o.content) + '\n' + tinymce.trim(t.foot); + } + }); + + // Register plugin + tinymce.PluginManager.add('fullpage', tinymce.plugins.FullPagePlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/fullpage/fullpage.htm b/web/libs/tiny_mce/plugins/fullpage/fullpage.htm new file mode 100644 index 0000000..c32afaf --- /dev/null +++ b/web/libs/tiny_mce/plugins/fullpage/fullpage.htm @@ -0,0 +1,571 @@ + + + + {#fullpage_dlg.title} + + + + + + + +
+ + +
+
+
+ {#fullpage_dlg.meta_props} + + + + + + + + + + + + + + + + + + + + + + + + + + +
 
 
 
 
 
  + +
+
+ +
+ {#fullpage_dlg.langprops} + + + + + + + + + + + + + + + + + + + + + + +
+ +
  + +
 
+ +
 
+
+
+ +
+
+ {#fullpage_dlg.appearance_textprops} + + + + + + + + + + + + + + + + +
+ +
+ +
+ + + + + +
 
+
+
+ +
+ {#fullpage_dlg.appearance_bgprops} + + + + + + + + + + +
+ + + + + +
 
+
+ + + + + +
 
+
+
+ +
+ {#fullpage_dlg.appearance_marginprops} + + + + + + + + + + + + + + +
+
+ +
+ {#fullpage_dlg.appearance_linkprops} + + + + + + + + + + + + + + + + + + + +
+ + + + + +
+
+ + + + + +
 
+
+ + + + + +
 
+
  
+
+ +
+ {#fullpage_dlg.appearance_style} + + + + + + + + + + +
+ + + + +
 
+
+
+ +
+ + +
+ {#fullpage_dlg.head_elements} + +
+
+
+ + +
+
+ + +
+
+
+ +
+
+ +
+ {#fullpage_dlg.meta_element} + + + + + + + + + + + + + + +
+ + +
+ +
+ {#fullpage_dlg.title_element} + + + + + + +
+ + +
+ +
+ {#fullpage_dlg.script_element} + + + +
+ +
+
+ + + + + + + + + + + + + + + + + +
+ + + + +
 
+
+ +
+ +
+
+ + +
+ +
+ {#fullpage_dlg.style_element} + + + +
+ +
+
+ + + + + + + + + +
+
+ +
+ +
+
+ + +
+ +
+ {#fullpage_dlg.base_element} + + + + + + + + + + +
+ + +
+ + + +
+ {#fullpage_dlg.comment_element} + + + + +
+
+
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/fullpage/js/fullpage.js b/web/libs/tiny_mce/plugins/fullpage/js/fullpage.js new file mode 100644 index 0000000..a1bb719 --- /dev/null +++ b/web/libs/tiny_mce/plugins/fullpage/js/fullpage.js @@ -0,0 +1,471 @@ +/** + * fullpage.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +tinyMCEPopup.requireLangPack(); + +var doc; + +var defaultDocTypes = + 'XHTML 1.0 Transitional=,' + + 'XHTML 1.0 Frameset=,' + + 'XHTML 1.0 Strict=,' + + 'XHTML 1.1=,' + + 'HTML 4.01 Transitional=,' + + 'HTML 4.01 Strict=,' + + 'HTML 4.01 Frameset='; + +var defaultEncodings = + 'Western european (iso-8859-1)=iso-8859-1,' + + 'Central European (iso-8859-2)=iso-8859-2,' + + 'Unicode (UTF-8)=utf-8,' + + 'Chinese traditional (Big5)=big5,' + + 'Cyrillic (iso-8859-5)=iso-8859-5,' + + 'Japanese (iso-2022-jp)=iso-2022-jp,' + + 'Greek (iso-8859-7)=iso-8859-7,' + + 'Korean (iso-2022-kr)=iso-2022-kr,' + + 'ASCII (us-ascii)=us-ascii'; + +var defaultMediaTypes = + 'all=all,' + + 'screen=screen,' + + 'print=print,' + + 'tty=tty,' + + 'tv=tv,' + + 'projection=projection,' + + 'handheld=handheld,' + + 'braille=braille,' + + 'aural=aural'; + +var defaultFontNames = 'Arial=arial,helvetica,sans-serif;Courier New=courier new,courier,monospace;Georgia=georgia,times new roman,times,serif;Tahoma=tahoma,arial,helvetica,sans-serif;Times New Roman=times new roman,times,serif;Verdana=verdana,arial,helvetica,sans-serif;Impact=impact;WingDings=wingdings'; +var defaultFontSizes = '10px,11px,12px,13px,14px,15px,16px'; + +function init() { + var f = document.forms['fullpage'], el = f.elements, e, i, p, doctypes, encodings, mediaTypes, fonts, ed = tinyMCEPopup.editor, dom = tinyMCEPopup.dom, style; + + // Setup doctype select box + doctypes = ed.getParam("fullpage_doctypes", defaultDocTypes).split(','); + for (i=0; i 1) + addSelectValue(f, 'doctypes', p[0], p[1]); + } + + // Setup fonts select box + fonts = ed.getParam("fullpage_fonts", defaultFontNames).split(';'); + for (i=0; i 1) + addSelectValue(f, 'fontface', p[0], p[1]); + } + + // Setup fontsize select box + fonts = ed.getParam("fullpage_fontsizes", defaultFontSizes).split(','); + for (i=0; i 1) { + addSelectValue(f, 'element_style_media', p[0], p[1]); + addSelectValue(f, 'element_link_media', p[0], p[1]); + } + } + + // Setup encodings select box + encodings = ed.getParam("fullpage_encodings", defaultEncodings).split(','); + for (i=0; i 1) { + addSelectValue(f, 'docencoding', p[0], p[1]); + addSelectValue(f, 'element_script_charset', p[0], p[1]); + addSelectValue(f, 'element_link_charset', p[0], p[1]); + } + } + + document.getElementById('bgcolor_pickcontainer').innerHTML = getColorPickerHTML('bgcolor_pick','bgcolor'); + document.getElementById('link_color_pickcontainer').innerHTML = getColorPickerHTML('link_color_pick','link_color'); + //document.getElementById('hover_color_pickcontainer').innerHTML = getColorPickerHTML('hover_color_pick','hover_color'); + document.getElementById('visited_color_pickcontainer').innerHTML = getColorPickerHTML('visited_color_pick','visited_color'); + document.getElementById('active_color_pickcontainer').innerHTML = getColorPickerHTML('active_color_pick','active_color'); + document.getElementById('textcolor_pickcontainer').innerHTML = getColorPickerHTML('textcolor_pick','textcolor'); + document.getElementById('stylesheet_browsercontainer').innerHTML = getBrowserHTML('stylesheetbrowser','stylesheet','file','fullpage'); + document.getElementById('link_href_pickcontainer').innerHTML = getBrowserHTML('link_href_browser','element_link_href','file','fullpage'); + document.getElementById('script_src_pickcontainer').innerHTML = getBrowserHTML('script_src_browser','element_script_src','file','fullpage'); + document.getElementById('bgimage_pickcontainer').innerHTML = getBrowserHTML('bgimage_browser','bgimage','image','fullpage'); + + // Resize some elements + if (isVisible('stylesheetbrowser')) + document.getElementById('stylesheet').style.width = '220px'; + + if (isVisible('link_href_browser')) + document.getElementById('element_link_href').style.width = '230px'; + + if (isVisible('bgimage_browser')) + document.getElementById('bgimage').style.width = '210px'; + + // Add iframe + dom.add(document.body, 'iframe', {id : 'documentIframe', src : 'javascript:""', style : {display : 'none'}}); + doc = dom.get('documentIframe').contentWindow.document; + h = tinyMCEPopup.getWindowArg('head_html'); + + // Preprocess the HTML disable scripts and urls + h = h.replace(/ + + + +
+ +
+ + + + + diff --git a/web/libs/tiny_mce/plugins/iespell/editor_plugin.js b/web/libs/tiny_mce/plugins/iespell/editor_plugin.js new file mode 100644 index 0000000..e9cba10 --- /dev/null +++ b/web/libs/tiny_mce/plugins/iespell/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.IESpell",{init:function(a,b){var c=this,d;if(!tinymce.isIE){return}c.editor=a;a.addCommand("mceIESpell",function(){try{d=new ActiveXObject("ieSpell.ieSpellExtension");d.CheckDocumentNode(a.getDoc().documentElement)}catch(f){if(f.number==-2146827859){a.windowManager.confirm(a.getLang("iespell.download"),function(e){if(e){window.open("http://www.iespell.com/download.php","ieSpellDownload","")}})}else{a.windowManager.alert("Error Loading ieSpell: Exception "+f.number)}}});a.addButton("iespell",{title:"iespell.iespell_desc",cmd:"mceIESpell"})},getInfo:function(){return{longname:"IESpell (IE Only)",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/iespell",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("iespell",tinymce.plugins.IESpell)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/iespell/editor_plugin_src.js b/web/libs/tiny_mce/plugins/iespell/editor_plugin_src.js new file mode 100644 index 0000000..1b2bb98 --- /dev/null +++ b/web/libs/tiny_mce/plugins/iespell/editor_plugin_src.js @@ -0,0 +1,54 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.IESpell', { + init : function(ed, url) { + var t = this, sp; + + if (!tinymce.isIE) + return; + + t.editor = ed; + + // Register commands + ed.addCommand('mceIESpell', function() { + try { + sp = new ActiveXObject("ieSpell.ieSpellExtension"); + sp.CheckDocumentNode(ed.getDoc().documentElement); + } catch (e) { + if (e.number == -2146827859) { + ed.windowManager.confirm(ed.getLang("iespell.download"), function(s) { + if (s) + window.open('http://www.iespell.com/download.php', 'ieSpellDownload', ''); + }); + } else + ed.windowManager.alert("Error Loading ieSpell: Exception " + e.number); + } + }); + + // Register buttons + ed.addButton('iespell', {title : 'iespell.iespell_desc', cmd : 'mceIESpell'}); + }, + + getInfo : function() { + return { + longname : 'IESpell (IE Only)', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/iespell', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('iespell', tinymce.plugins.IESpell); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/inlinepopups/editor_plugin.js b/web/libs/tiny_mce/plugins/inlinepopups/editor_plugin.js new file mode 100644 index 0000000..07ea477 --- /dev/null +++ b/web/libs/tiny_mce/plugins/inlinepopups/editor_plugin.js @@ -0,0 +1 @@ +(function(){var d=tinymce.DOM,b=tinymce.dom.Element,a=tinymce.dom.Event,e=tinymce.each,c=tinymce.is;tinymce.create("tinymce.plugins.InlinePopups",{init:function(f,g){f.onBeforeRenderUI.add(function(){f.windowManager=new tinymce.InlineWindowManager(f);d.loadCSS(g+"/skins/"+(f.settings.inlinepopups_skin||"clearlooks2")+"/window.css")})},getInfo:function(){return{longname:"InlinePopups",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/inlinepopups",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.create("tinymce.InlineWindowManager:tinymce.WindowManager",{InlineWindowManager:function(f){var g=this;g.parent(f);g.zIndex=300000;g.count=0;g.windows={}},open:function(r,j){var y=this,i,k="",q=y.editor,g=0,s=0,h,m,n,o,l,v,x;r=r||{};j=j||{};if(!r.inline){return y.parent(r,j)}if(!r.type){y.bookmark=q.selection.getBookmark(1)}i=d.uniqueId();h=d.getViewPort();r.width=parseInt(r.width||320);r.height=parseInt(r.height||240)+(tinymce.isIE?8:0);r.min_width=parseInt(r.min_width||150);r.min_height=parseInt(r.min_height||100);r.max_width=parseInt(r.max_width||2000);r.max_height=parseInt(r.max_height||2000);r.left=r.left||Math.round(Math.max(h.x,h.x+(h.w/2)-(r.width/2)));r.top=r.top||Math.round(Math.max(h.y,h.y+(h.h/2)-(r.height/2)));r.movable=r.resizable=true;j.mce_width=r.width;j.mce_height=r.height;j.mce_inline=true;j.mce_window_id=i;j.mce_auto_focus=r.auto_focus;y.features=r;y.params=j;y.onOpen.dispatch(y,r,j);if(r.type){k+=" mceModal";if(r.type){k+=" mce"+r.type.substring(0,1).toUpperCase()+r.type.substring(1)}r.resizable=false}if(r.statusbar){k+=" mceStatusbar"}if(r.resizable){k+=" mceResizable"}if(r.minimizable){k+=" mceMinimizable"}if(r.maximizable){k+=" mceMaximizable"}if(r.movable){k+=" mceMovable"}y._addAll(d.doc.body,["div",{id:i,"class":q.settings.inlinepopups_skin||"clearlooks2",style:"width:100px;height:100px"},["div",{id:i+"_wrapper","class":"mceWrapper"+k},["div",{id:i+"_top","class":"mceTop"},["div",{"class":"mceLeft"}],["div",{"class":"mceCenter"}],["div",{"class":"mceRight"}],["span",{id:i+"_title"},r.title||""]],["div",{id:i+"_middle","class":"mceMiddle"},["div",{id:i+"_left","class":"mceLeft"}],["span",{id:i+"_content"}],["div",{id:i+"_right","class":"mceRight"}]],["div",{id:i+"_bottom","class":"mceBottom"},["div",{"class":"mceLeft"}],["div",{"class":"mceCenter"}],["div",{"class":"mceRight"}],["span",{id:i+"_status"},"Content"]],["a",{"class":"mceMove",tabindex:"-1",href:"javascript:;"}],["a",{"class":"mceMin",tabindex:"-1",href:"javascript:;",onmousedown:"return false;"}],["a",{"class":"mceMax",tabindex:"-1",href:"javascript:;",onmousedown:"return false;"}],["a",{"class":"mceMed",tabindex:"-1",href:"javascript:;",onmousedown:"return false;"}],["a",{"class":"mceClose",tabindex:"-1",href:"javascript:;",onmousedown:"return false;"}],["a",{id:i+"_resize_n","class":"mceResize mceResizeN",tabindex:"-1",href:"javascript:;"}],["a",{id:i+"_resize_s","class":"mceResize mceResizeS",tabindex:"-1",href:"javascript:;"}],["a",{id:i+"_resize_w","class":"mceResize mceResizeW",tabindex:"-1",href:"javascript:;"}],["a",{id:i+"_resize_e","class":"mceResize mceResizeE",tabindex:"-1",href:"javascript:;"}],["a",{id:i+"_resize_nw","class":"mceResize mceResizeNW",tabindex:"-1",href:"javascript:;"}],["a",{id:i+"_resize_ne","class":"mceResize mceResizeNE",tabindex:"-1",href:"javascript:;"}],["a",{id:i+"_resize_sw","class":"mceResize mceResizeSW",tabindex:"-1",href:"javascript:;"}],["a",{id:i+"_resize_se","class":"mceResize mceResizeSE",tabindex:"-1",href:"javascript:;"}]]]);d.setStyles(i,{top:-10000,left:-10000});if(tinymce.isGecko){d.setStyle(i,"overflow","auto")}if(!r.type){g+=d.get(i+"_left").clientWidth;g+=d.get(i+"_right").clientWidth;s+=d.get(i+"_top").clientHeight;s+=d.get(i+"_bottom").clientHeight}d.setStyles(i,{top:r.top,left:r.left,width:r.width+g,height:r.height+s});x=r.url||r.file;if(x){if(tinymce.relaxedDomain){x+=(x.indexOf("?")==-1?"?":"&")+"mce_rdomain="+tinymce.relaxedDomain}x=tinymce._addVer(x)}if(!r.type){d.add(i+"_content","iframe",{id:i+"_ifr",src:'javascript:""',frameBorder:0,style:"border:0;width:10px;height:10px"});d.setStyles(i+"_ifr",{width:r.width,height:r.height});d.setAttrib(i+"_ifr","src",x)}else{d.add(i+"_wrapper","a",{id:i+"_ok","class":"mceButton mceOk",href:"javascript:;",onmousedown:"return false;"},"Ok");if(r.type=="confirm"){d.add(i+"_wrapper","a",{"class":"mceButton mceCancel",href:"javascript:;",onmousedown:"return false;"},"Cancel")}d.add(i+"_middle","div",{"class":"mceIcon"});d.setHTML(i+"_content",r.content.replace("\n","
"))}n=a.add(i,"mousedown",function(t){var u=t.target,f,p;f=y.windows[i];y.focus(i);if(u.nodeName=="A"||u.nodeName=="a"){if(u.className=="mceMax"){f.oldPos=f.element.getXY();f.oldSize=f.element.getSize();p=d.getViewPort();p.w-=2;p.h-=2;f.element.moveTo(p.x,p.y);f.element.resizeTo(p.w,p.h);d.setStyles(i+"_ifr",{width:p.w-f.deltaWidth,height:p.h-f.deltaHeight});d.addClass(i+"_wrapper","mceMaximized")}else{if(u.className=="mceMed"){f.element.moveTo(f.oldPos.x,f.oldPos.y);f.element.resizeTo(f.oldSize.w,f.oldSize.h);f.iframeElement.resizeTo(f.oldSize.w-f.deltaWidth,f.oldSize.h-f.deltaHeight);d.removeClass(i+"_wrapper","mceMaximized")}else{if(u.className=="mceMove"){return y._startDrag(i,t,u.className)}else{if(d.hasClass(u,"mceResize")){return y._startDrag(i,t,u.className.substring(13))}}}}}});o=a.add(i,"click",function(f){var p=f.target;y.focus(i);if(p.nodeName=="A"||p.nodeName=="a"){switch(p.className){case"mceClose":y.close(null,i);return a.cancel(f);case"mceButton mceOk":case"mceButton mceCancel":r.button_func(p.className=="mceButton mceOk");return a.cancel(f)}}});v=y.windows[i]={id:i,mousedown_func:n,click_func:o,element:new b(i,{blocker:1,container:q.getContainer()}),iframeElement:new b(i+"_ifr"),features:r,deltaWidth:g,deltaHeight:s};v.iframeElement.on("focus",function(){y.focus(i)});if(y.count==0&&y.editor.getParam("dialog_type","modal")=="modal"){d.add(d.doc.body,"div",{id:"mceModalBlocker","class":(y.editor.settings.inlinepopups_skin||"clearlooks2")+"_modalBlocker",style:{zIndex:y.zIndex-1}});d.show("mceModalBlocker")}else{d.setStyle("mceModalBlocker","z-index",y.zIndex-1)}if(tinymce.isIE6||/Firefox\/2\./.test(navigator.userAgent)||(tinymce.isIE&&!d.boxModel)){d.setStyles("mceModalBlocker",{position:"absolute",left:h.x,top:h.y,width:h.w-2,height:h.h-2})}y.focus(i);y._fixIELayout(i,1);if(d.get(i+"_ok")){d.get(i+"_ok").focus()}y.count++;return v},focus:function(h){var g=this,f;if(f=g.windows[h]){f.zIndex=this.zIndex++;f.element.setStyle("zIndex",f.zIndex);f.element.update();h=h+"_wrapper";d.removeClass(g.lastId,"mceFocus");d.addClass(h,"mceFocus");g.lastId=h}},_addAll:function(k,h){var g,l,f=this,j=tinymce.DOM;if(c(h,"string")){k.appendChild(j.doc.createTextNode(h))}else{if(h.length){k=k.appendChild(j.create(h[0],h[1]));for(g=2;gf){i=m;f=m.zIndex}});if(i){h.focus(i.id)}}},setTitle:function(f,g){var h;f=this._findId(f);if(h=d.get(f+"_title")){h.innerHTML=d.encode(g)}},alert:function(g,f,j){var i=this,h;h=i.open({title:i,type:"alert",button_func:function(k){if(f){f.call(k||i,k)}i.close(null,h.id)},content:d.encode(i.editor.getLang(g,g)),inline:1,width:400,height:130})},confirm:function(g,f,j){var i=this,h;h=i.open({title:i,type:"confirm",button_func:function(k){if(f){f.call(k||i,k)}i.close(null,h.id)},content:d.encode(i.editor.getLang(g,g)),inline:1,width:400,height:130})},_findId:function(f){var g=this;if(typeof(f)=="string"){return f}e(g.windows,function(h){var i=d.get(h.id+"_ifr");if(i&&f==i.contentWindow){f=h.id;return false}});return f},_fixIELayout:function(i,h){var f,g;if(!tinymce.isIE6){return}e(["n","s","w","e","nw","ne","sw","se"],function(j){var k=d.get(i+"_resize_"+j);d.setStyles(k,{width:h?k.clientWidth:"",height:h?k.clientHeight:"",cursor:d.getStyle(k,"cursor",1)});d.setStyle(i+"_bottom","bottom","-1px");k=0});if(f=this.windows[i]){f.element.hide();f.element.show();e(d.select("div,a",i),function(k,j){if(k.currentStyle.backgroundImage!="none"){g=new Image();g.src=k.currentStyle.backgroundImage.replace(/url\(\"(.+)\"\)/,"$1")}});d.get(i).style.filter=""}}});tinymce.PluginManager.add("inlinepopups",tinymce.plugins.InlinePopups)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/inlinepopups/editor_plugin_src.js b/web/libs/tiny_mce/plugins/inlinepopups/editor_plugin_src.js new file mode 100644 index 0000000..e991683 --- /dev/null +++ b/web/libs/tiny_mce/plugins/inlinepopups/editor_plugin_src.js @@ -0,0 +1,635 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + var DOM = tinymce.DOM, Element = tinymce.dom.Element, Event = tinymce.dom.Event, each = tinymce.each, is = tinymce.is; + + tinymce.create('tinymce.plugins.InlinePopups', { + init : function(ed, url) { + // Replace window manager + ed.onBeforeRenderUI.add(function() { + ed.windowManager = new tinymce.InlineWindowManager(ed); + DOM.loadCSS(url + '/skins/' + (ed.settings.inlinepopups_skin || 'clearlooks2') + "/window.css"); + }); + }, + + getInfo : function() { + return { + longname : 'InlinePopups', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/inlinepopups', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + tinymce.create('tinymce.InlineWindowManager:tinymce.WindowManager', { + InlineWindowManager : function(ed) { + var t = this; + + t.parent(ed); + t.zIndex = 300000; + t.count = 0; + t.windows = {}; + }, + + open : function(f, p) { + var t = this, id, opt = '', ed = t.editor, dw = 0, dh = 0, vp, po, mdf, clf, we, w, u; + + f = f || {}; + p = p || {}; + + // Run native windows + if (!f.inline) + return t.parent(f, p); + + // Only store selection if the type is a normal window + if (!f.type) + t.bookmark = ed.selection.getBookmark(1); + + id = DOM.uniqueId(); + vp = DOM.getViewPort(); + f.width = parseInt(f.width || 320); + f.height = parseInt(f.height || 240) + (tinymce.isIE ? 8 : 0); + f.min_width = parseInt(f.min_width || 150); + f.min_height = parseInt(f.min_height || 100); + f.max_width = parseInt(f.max_width || 2000); + f.max_height = parseInt(f.max_height || 2000); + f.left = f.left || Math.round(Math.max(vp.x, vp.x + (vp.w / 2.0) - (f.width / 2.0))); + f.top = f.top || Math.round(Math.max(vp.y, vp.y + (vp.h / 2.0) - (f.height / 2.0))); + f.movable = f.resizable = true; + p.mce_width = f.width; + p.mce_height = f.height; + p.mce_inline = true; + p.mce_window_id = id; + p.mce_auto_focus = f.auto_focus; + + // Transpose +// po = DOM.getPos(ed.getContainer()); +// f.left -= po.x; +// f.top -= po.y; + + t.features = f; + t.params = p; + t.onOpen.dispatch(t, f, p); + + if (f.type) { + opt += ' mceModal'; + + if (f.type) + opt += ' mce' + f.type.substring(0, 1).toUpperCase() + f.type.substring(1); + + f.resizable = false; + } + + if (f.statusbar) + opt += ' mceStatusbar'; + + if (f.resizable) + opt += ' mceResizable'; + + if (f.minimizable) + opt += ' mceMinimizable'; + + if (f.maximizable) + opt += ' mceMaximizable'; + + if (f.movable) + opt += ' mceMovable'; + + // Create DOM objects + t._addAll(DOM.doc.body, + ['div', {id : id, 'class' : ed.settings.inlinepopups_skin || 'clearlooks2', style : 'width:100px;height:100px'}, + ['div', {id : id + '_wrapper', 'class' : 'mceWrapper' + opt}, + ['div', {id : id + '_top', 'class' : 'mceTop'}, + ['div', {'class' : 'mceLeft'}], + ['div', {'class' : 'mceCenter'}], + ['div', {'class' : 'mceRight'}], + ['span', {id : id + '_title'}, f.title || ''] + ], + + ['div', {id : id + '_middle', 'class' : 'mceMiddle'}, + ['div', {id : id + '_left', 'class' : 'mceLeft'}], + ['span', {id : id + '_content'}], + ['div', {id : id + '_right', 'class' : 'mceRight'}] + ], + + ['div', {id : id + '_bottom', 'class' : 'mceBottom'}, + ['div', {'class' : 'mceLeft'}], + ['div', {'class' : 'mceCenter'}], + ['div', {'class' : 'mceRight'}], + ['span', {id : id + '_status'}, 'Content'] + ], + + ['a', {'class' : 'mceMove', tabindex : '-1', href : 'javascript:;'}], + ['a', {'class' : 'mceMin', tabindex : '-1', href : 'javascript:;', onmousedown : 'return false;'}], + ['a', {'class' : 'mceMax', tabindex : '-1', href : 'javascript:;', onmousedown : 'return false;'}], + ['a', {'class' : 'mceMed', tabindex : '-1', href : 'javascript:;', onmousedown : 'return false;'}], + ['a', {'class' : 'mceClose', tabindex : '-1', href : 'javascript:;', onmousedown : 'return false;'}], + ['a', {id : id + '_resize_n', 'class' : 'mceResize mceResizeN', tabindex : '-1', href : 'javascript:;'}], + ['a', {id : id + '_resize_s', 'class' : 'mceResize mceResizeS', tabindex : '-1', href : 'javascript:;'}], + ['a', {id : id + '_resize_w', 'class' : 'mceResize mceResizeW', tabindex : '-1', href : 'javascript:;'}], + ['a', {id : id + '_resize_e', 'class' : 'mceResize mceResizeE', tabindex : '-1', href : 'javascript:;'}], + ['a', {id : id + '_resize_nw', 'class' : 'mceResize mceResizeNW', tabindex : '-1', href : 'javascript:;'}], + ['a', {id : id + '_resize_ne', 'class' : 'mceResize mceResizeNE', tabindex : '-1', href : 'javascript:;'}], + ['a', {id : id + '_resize_sw', 'class' : 'mceResize mceResizeSW', tabindex : '-1', href : 'javascript:;'}], + ['a', {id : id + '_resize_se', 'class' : 'mceResize mceResizeSE', tabindex : '-1', href : 'javascript:;'}] + ] + ] + ); + + DOM.setStyles(id, {top : -10000, left : -10000}); + + // Fix gecko rendering bug, where the editors iframe messed with window contents + if (tinymce.isGecko) + DOM.setStyle(id, 'overflow', 'auto'); + + // Measure borders + if (!f.type) { + dw += DOM.get(id + '_left').clientWidth; + dw += DOM.get(id + '_right').clientWidth; + dh += DOM.get(id + '_top').clientHeight; + dh += DOM.get(id + '_bottom').clientHeight; + } + + // Resize window + DOM.setStyles(id, {top : f.top, left : f.left, width : f.width + dw, height : f.height + dh}); + + u = f.url || f.file; + if (u) { + if (tinymce.relaxedDomain) + u += (u.indexOf('?') == -1 ? '?' : '&') + 'mce_rdomain=' + tinymce.relaxedDomain; + + u = tinymce._addVer(u); + } + + if (!f.type) { + DOM.add(id + '_content', 'iframe', {id : id + '_ifr', src : 'javascript:""', frameBorder : 0, style : 'border:0;width:10px;height:10px'}); + DOM.setStyles(id + '_ifr', {width : f.width, height : f.height}); + DOM.setAttrib(id + '_ifr', 'src', u); + } else { + DOM.add(id + '_wrapper', 'a', {id : id + '_ok', 'class' : 'mceButton mceOk', href : 'javascript:;', onmousedown : 'return false;'}, 'Ok'); + + if (f.type == 'confirm') + DOM.add(id + '_wrapper', 'a', {'class' : 'mceButton mceCancel', href : 'javascript:;', onmousedown : 'return false;'}, 'Cancel'); + + DOM.add(id + '_middle', 'div', {'class' : 'mceIcon'}); + DOM.setHTML(id + '_content', f.content.replace('\n', '
')); + } + + // Register events + mdf = Event.add(id, 'mousedown', function(e) { + var n = e.target, w, vp; + + w = t.windows[id]; + t.focus(id); + + if (n.nodeName == 'A' || n.nodeName == 'a') { + if (n.className == 'mceMax') { + w.oldPos = w.element.getXY(); + w.oldSize = w.element.getSize(); + + vp = DOM.getViewPort(); + + // Reduce viewport size to avoid scrollbars + vp.w -= 2; + vp.h -= 2; + + w.element.moveTo(vp.x, vp.y); + w.element.resizeTo(vp.w, vp.h); + DOM.setStyles(id + '_ifr', {width : vp.w - w.deltaWidth, height : vp.h - w.deltaHeight}); + DOM.addClass(id + '_wrapper', 'mceMaximized'); + } else if (n.className == 'mceMed') { + // Reset to old size + w.element.moveTo(w.oldPos.x, w.oldPos.y); + w.element.resizeTo(w.oldSize.w, w.oldSize.h); + w.iframeElement.resizeTo(w.oldSize.w - w.deltaWidth, w.oldSize.h - w.deltaHeight); + + DOM.removeClass(id + '_wrapper', 'mceMaximized'); + } else if (n.className == 'mceMove') + return t._startDrag(id, e, n.className); + else if (DOM.hasClass(n, 'mceResize')) + return t._startDrag(id, e, n.className.substring(13)); + } + }); + + clf = Event.add(id, 'click', function(e) { + var n = e.target; + + t.focus(id); + + if (n.nodeName == 'A' || n.nodeName == 'a') { + switch (n.className) { + case 'mceClose': + t.close(null, id); + return Event.cancel(e); + + case 'mceButton mceOk': + case 'mceButton mceCancel': + f.button_func(n.className == 'mceButton mceOk'); + return Event.cancel(e); + } + } + }); + + // Add window + w = t.windows[id] = { + id : id, + mousedown_func : mdf, + click_func : clf, + element : new Element(id, {blocker : 1, container : ed.getContainer()}), + iframeElement : new Element(id + '_ifr'), + features : f, + deltaWidth : dw, + deltaHeight : dh + }; + + w.iframeElement.on('focus', function() { + t.focus(id); + }); + + // Setup blocker + if (t.count == 0 && t.editor.getParam('dialog_type', 'modal') == 'modal') { + DOM.add(DOM.doc.body, 'div', { + id : 'mceModalBlocker', + 'class' : (t.editor.settings.inlinepopups_skin || 'clearlooks2') + '_modalBlocker', + style : {zIndex : t.zIndex - 1} + }); + + DOM.show('mceModalBlocker'); // Reduces flicker in IE + } else + DOM.setStyle('mceModalBlocker', 'z-index', t.zIndex - 1); + + if (tinymce.isIE6 || /Firefox\/2\./.test(navigator.userAgent) || (tinymce.isIE && !DOM.boxModel)) + DOM.setStyles('mceModalBlocker', {position : 'absolute', left : vp.x, top : vp.y, width : vp.w - 2, height : vp.h - 2}); + + t.focus(id); + t._fixIELayout(id, 1); + + // Focus ok button + if (DOM.get(id + '_ok')) + DOM.get(id + '_ok').focus(); + + t.count++; + + return w; + }, + + focus : function(id) { + var t = this, w; + + if (w = t.windows[id]) { + w.zIndex = this.zIndex++; + w.element.setStyle('zIndex', w.zIndex); + w.element.update(); + + id = id + '_wrapper'; + DOM.removeClass(t.lastId, 'mceFocus'); + DOM.addClass(id, 'mceFocus'); + t.lastId = id; + } + }, + + _addAll : function(te, ne) { + var i, n, t = this, dom = tinymce.DOM; + + if (is(ne, 'string')) + te.appendChild(dom.doc.createTextNode(ne)); + else if (ne.length) { + te = te.appendChild(dom.create(ne[0], ne[1])); + + for (i=2; i ix) { + fw = w; + ix = w.zIndex; + } + }); + + if (fw) + t.focus(fw.id); + } + }, + + setTitle : function(w, ti) { + var e; + + w = this._findId(w); + + if (e = DOM.get(w + '_title')) + e.innerHTML = DOM.encode(ti); + }, + + alert : function(txt, cb, s) { + var t = this, w; + + w = t.open({ + title : t, + type : 'alert', + button_func : function(s) { + if (cb) + cb.call(s || t, s); + + t.close(null, w.id); + }, + content : DOM.encode(t.editor.getLang(txt, txt)), + inline : 1, + width : 400, + height : 130 + }); + }, + + confirm : function(txt, cb, s) { + var t = this, w; + + w = t.open({ + title : t, + type : 'confirm', + button_func : function(s) { + if (cb) + cb.call(s || t, s); + + t.close(null, w.id); + }, + content : DOM.encode(t.editor.getLang(txt, txt)), + inline : 1, + width : 400, + height : 130 + }); + }, + + // Internal functions + + _findId : function(w) { + var t = this; + + if (typeof(w) == 'string') + return w; + + each(t.windows, function(wo) { + var ifr = DOM.get(wo.id + '_ifr'); + + if (ifr && w == ifr.contentWindow) { + w = wo.id; + return false; + } + }); + + return w; + }, + + _fixIELayout : function(id, s) { + var w, img; + + if (!tinymce.isIE6) + return; + + // Fixes the bug where hover flickers and does odd things in IE6 + each(['n','s','w','e','nw','ne','sw','se'], function(v) { + var e = DOM.get(id + '_resize_' + v); + + DOM.setStyles(e, { + width : s ? e.clientWidth : '', + height : s ? e.clientHeight : '', + cursor : DOM.getStyle(e, 'cursor', 1) + }); + + DOM.setStyle(id + "_bottom", 'bottom', '-1px'); + + e = 0; + }); + + // Fixes graphics glitch + if (w = this.windows[id]) { + // Fixes rendering bug after resize + w.element.hide(); + w.element.show(); + + // Forced a repaint of the window + //DOM.get(id).style.filter = ''; + + // IE has a bug where images used in CSS won't get loaded + // sometimes when the cache in the browser is disabled + // This fix tries to solve it by loading the images using the image object + each(DOM.select('div,a', id), function(e, i) { + if (e.currentStyle.backgroundImage != 'none') { + img = new Image(); + img.src = e.currentStyle.backgroundImage.replace(/url\(\"(.+)\"\)/, '$1'); + } + }); + + DOM.get(id).style.filter = ''; + } + } + }); + + // Register plugin + tinymce.PluginManager.add('inlinepopups', tinymce.plugins.InlinePopups); +})(); + diff --git a/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/alert.gif b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/alert.gif new file mode 100644 index 0000000..94abd08 Binary files /dev/null and b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/alert.gif differ diff --git a/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/button.gif b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/button.gif new file mode 100644 index 0000000..e671094 Binary files /dev/null and b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/button.gif differ diff --git a/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/buttons.gif b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/buttons.gif new file mode 100644 index 0000000..6baf64a Binary files /dev/null and b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/buttons.gif differ diff --git a/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/confirm.gif b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/confirm.gif new file mode 100644 index 0000000..497307a Binary files /dev/null and b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/confirm.gif differ diff --git a/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/corners.gif b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/corners.gif new file mode 100644 index 0000000..c894b2e Binary files /dev/null and b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/corners.gif differ diff --git a/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/horizontal.gif b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/horizontal.gif new file mode 100644 index 0000000..c2a2ad4 Binary files /dev/null and b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/horizontal.gif differ diff --git a/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/vertical.gif b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/vertical.gif new file mode 100644 index 0000000..43a735f Binary files /dev/null and b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/img/vertical.gif differ diff --git a/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/window.css b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/window.css new file mode 100644 index 0000000..5e6fd7d --- /dev/null +++ b/web/libs/tiny_mce/plugins/inlinepopups/skins/clearlooks2/window.css @@ -0,0 +1,90 @@ +/* Clearlooks 2 */ + +/* Reset */ +.clearlooks2, .clearlooks2 div, .clearlooks2 span, .clearlooks2 a {vertical-align:baseline; text-align:left; position:absolute; border:0; padding:0; margin:0; background:transparent; font-family:Arial,Verdana; font-size:11px; color:#000; text-decoration:none; font-weight:normal; width:auto; height:auto; overflow:hidden; display:block} + +/* General */ +.clearlooks2 {position:absolute; direction:ltr} +.clearlooks2 .mceWrapper {position:static} +.mceEventBlocker {position:fixed; left:0; top:0; background:url(img/horizontal.gif) no-repeat 0 -75px; width:100%; height:100%} +.clearlooks2 .mcePlaceHolder {border:1px solid #000; background:#888; top:0; left:0; opacity:0.5; -ms-filter:'alpha(opacity=50)'; filter:alpha(opacity=50)} +.clearlooks2_modalBlocker {position:fixed; left:0; top:0; width:100%; height:100%; background:#FFF; opacity:0.6; -ms-filter:'alpha(opacity=60)'; filter:alpha(opacity=60); display:none} + +/* Top */ +.clearlooks2 .mceTop, .clearlooks2 .mceTop div {top:0; width:100%; height:23px} +.clearlooks2 .mceTop .mceLeft {width:6px; background:url(img/corners.gif)} +.clearlooks2 .mceTop .mceCenter {right:6px; width:100%; height:23px; background:url(img/horizontal.gif) 12px 0; clip:rect(auto auto auto 12px)} +.clearlooks2 .mceTop .mceRight {right:0; width:6px; height:23px; background:url(img/corners.gif) -12px 0} +.clearlooks2 .mceTop span {width:100%; text-align:center; vertical-align:middle; line-height:23px; font-weight:bold} +.clearlooks2 .mceFocus .mceTop .mceLeft {background:url(img/corners.gif) -6px 0} +.clearlooks2 .mceFocus .mceTop .mceCenter {background:url(img/horizontal.gif) 0 -23px} +.clearlooks2 .mceFocus .mceTop .mceRight {background:url(img/corners.gif) -18px 0} +.clearlooks2 .mceFocus .mceTop span {color:#FFF} + +/* Middle */ +.clearlooks2 .mceMiddle, .clearlooks2 .mceMiddle div {top:0} +.clearlooks2 .mceMiddle {width:100%; height:100%; clip:rect(23px auto auto auto)} +.clearlooks2 .mceMiddle .mceLeft {left:0; width:5px; height:100%; background:url(img/vertical.gif) -5px 0} +.clearlooks2 .mceMiddle span {top:23px; left:5px; width:100%; height:100%; background:#FFF} +.clearlooks2 .mceMiddle .mceRight {right:0; width:5px; height:100%; background:url(img/vertical.gif)} + +/* Bottom */ +.clearlooks2 .mceBottom, .clearlooks2 .mceBottom div {height:6px} +.clearlooks2 .mceBottom {left:0; bottom:0; width:100%} +.clearlooks2 .mceBottom div {top:0} +.clearlooks2 .mceBottom .mceLeft {left:0; width:5px; background:url(img/corners.gif) -34px -6px} +.clearlooks2 .mceBottom .mceCenter {left:5px; width:100%; background:url(img/horizontal.gif) 0 -46px} +.clearlooks2 .mceBottom .mceRight {right:0; width:5px; background: url(img/corners.gif) -34px 0} +.clearlooks2 .mceBottom span {display:none} +.clearlooks2 .mceStatusbar .mceBottom, .clearlooks2 .mceStatusbar .mceBottom div {height:23px} +.clearlooks2 .mceStatusbar .mceBottom .mceLeft {background:url(img/corners.gif) -29px 0} +.clearlooks2 .mceStatusbar .mceBottom .mceCenter {background:url(img/horizontal.gif) 0 -52px} +.clearlooks2 .mceStatusbar .mceBottom .mceRight {background:url(img/corners.gif) -24px 0} +.clearlooks2 .mceStatusbar .mceBottom span {display:block; left:7px; font-family:Arial, Verdana; font-size:11px; line-height:23px} + +/* Actions */ +.clearlooks2 a {width:29px; height:16px; top:3px;} +.clearlooks2 .mceClose {right:6px; background:url(img/buttons.gif) -87px 0} +.clearlooks2 .mceMin {display:none; right:68px; background:url(img/buttons.gif) 0 0} +.clearlooks2 .mceMed {display:none; right:37px; background:url(img/buttons.gif) -29px 0} +.clearlooks2 .mceMax {display:none; right:37px; background:url(img/buttons.gif) -58px 0} +.clearlooks2 .mceMove {display:none;width:100%;cursor:move;background:url(img/corners.gif) no-repeat -100px -100px} +.clearlooks2 .mceMovable .mceMove {display:block} +.clearlooks2 .mceFocus .mceClose {right:6px; background:url(img/buttons.gif) -87px -16px} +.clearlooks2 .mceFocus .mceMin {right:68px; background:url(img/buttons.gif) 0 -16px} +.clearlooks2 .mceFocus .mceMed {right:37px; background:url(img/buttons.gif) -29px -16px} +.clearlooks2 .mceFocus .mceMax {right:37px; background:url(img/buttons.gif) -58px -16px} +.clearlooks2 .mceFocus .mceClose:hover {right:6px; background:url(img/buttons.gif) -87px -32px} +.clearlooks2 .mceFocus .mceClose:hover {right:6px; background:url(img/buttons.gif) -87px -32px} +.clearlooks2 .mceFocus .mceMin:hover {right:68px; background:url(img/buttons.gif) 0 -32px} +.clearlooks2 .mceFocus .mceMed:hover {right:37px; background:url(img/buttons.gif) -29px -32px} +.clearlooks2 .mceFocus .mceMax:hover {right:37px; background:url(img/buttons.gif) -58px -32px} + +/* Resize */ +.clearlooks2 .mceResize {top:auto; left:auto; display:none; width:5px; height:5px; background:url(img/horizontal.gif) no-repeat 0 -75px} +.clearlooks2 .mceResizable .mceResize {display:block} +.clearlooks2 .mceResizable .mceMin, .clearlooks2 .mceMax {display:none} +.clearlooks2 .mceMinimizable .mceMin {display:block} +.clearlooks2 .mceMaximizable .mceMax {display:block} +.clearlooks2 .mceMaximized .mceMed {display:block} +.clearlooks2 .mceMaximized .mceMax {display:none} +.clearlooks2 a.mceResizeN {top:0; left:0; width:100%; cursor:n-resize} +.clearlooks2 a.mceResizeNW {top:0; left:0; cursor:nw-resize} +.clearlooks2 a.mceResizeNE {top:0; right:0; cursor:ne-resize} +.clearlooks2 a.mceResizeW {top:0; left:0; height:100%; cursor:w-resize;} +.clearlooks2 a.mceResizeE {top:0; right:0; height:100%; cursor:e-resize} +.clearlooks2 a.mceResizeS {bottom:0; left:0; width:100%; cursor:s-resize} +.clearlooks2 a.mceResizeSW {bottom:0; left:0; cursor:sw-resize} +.clearlooks2 a.mceResizeSE {bottom:0; right:0; cursor:se-resize} + +/* Alert/Confirm */ +.clearlooks2 .mceButton {font-weight:bold; bottom:10px; width:80px; height:30px; background:url(img/button.gif); line-height:30px; vertical-align:middle; text-align:center; outline:0} +.clearlooks2 .mceMiddle .mceIcon {left:15px; top:35px; width:32px; height:32px} +.clearlooks2 .mceAlert .mceMiddle span, .clearlooks2 .mceConfirm .mceMiddle span {background:transparent;left:60px; top:35px; width:320px; height:50px; font-weight:bold; overflow:auto; white-space:normal} +.clearlooks2 a:hover {font-weight:bold;} +.clearlooks2 .mceAlert .mceMiddle, .clearlooks2 .mceConfirm .mceMiddle {background:#D6D7D5} +.clearlooks2 .mceAlert .mceOk {left:50%; top:auto; margin-left: -40px} +.clearlooks2 .mceAlert .mceIcon {background:url(img/alert.gif)} +.clearlooks2 .mceConfirm .mceOk {left:50%; top:auto; margin-left: -90px} +.clearlooks2 .mceConfirm .mceCancel {left:50%; top:auto} +.clearlooks2 .mceConfirm .mceIcon {background:url(img/confirm.gif)} \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/inlinepopups/template.htm b/web/libs/tiny_mce/plugins/inlinepopups/template.htm new file mode 100644 index 0000000..f9ec642 --- /dev/null +++ b/web/libs/tiny_mce/plugins/inlinepopups/template.htm @@ -0,0 +1,387 @@ + + + +Template for dialogs + + + + +
+
+
+
+
+
+
+ Blured +
+ +
+
+ Content +
+
+ +
+
+
+
+ Statusbar text. +
+ + + + + + + + + + + + + + +
+
+ +
+
+
+
+
+
+ Focused +
+ +
+
+ Content +
+
+ +
+
+
+
+ Statusbar text. +
+ + + + + + + + + + + + + + +
+
+ +
+
+
+
+
+
+ Statusbar +
+ +
+
+ Content +
+
+ +
+
+
+
+ Statusbar text. +
+ + + + + + + + + + + + + + +
+
+ +
+
+
+
+
+
+ Statusbar, Resizable +
+ +
+
+ Content +
+
+ +
+
+
+
+ Statusbar text. +
+ + + + + + + + + + + + + + +
+
+ +
+
+
+
+
+
+ Resizable, Maximizable +
+ +
+
+ Content +
+
+ +
+
+
+
+ Statusbar text. +
+ + + + + + + + + + + + + + +
+
+ +
+
+
+
+
+
+ Blurred, Maximizable, Statusbar, Resizable +
+ +
+
+ Content +
+
+ +
+
+
+
+ Statusbar text. +
+ + + + + + + + + + + + + + +
+
+ +
+
+
+
+
+
+ Maximized, Maximizable, Minimizable +
+ +
+
+ Content +
+
+ +
+
+
+
+ Statusbar text. +
+ + + + + + + + + + + + + + +
+
+ +
+
+
+
+
+
+ Blured +
+ +
+
+ Content +
+
+ +
+
+
+
+ Statusbar text. +
+ + + + + + + + + + + + + + +
+
+ +
+
+
+
+
+
+ Alert +
+ +
+
+ + This is a very long error message. This is a very long error message. + This is a very long error message. This is a very long error message. + This is a very long error message. This is a very long error message. + This is a very long error message. This is a very long error message. + This is a very long error message. This is a very long error message. + This is a very long error message. This is a very long error message. + +
+
+
+ +
+
+
+
+
+ + + Ok + +
+
+ +
+
+
+
+
+
+ Confirm +
+ +
+
+ + This is a very long error message. This is a very long error message. + This is a very long error message. This is a very long error message. + This is a very long error message. This is a very long error message. + This is a very long error message. This is a very long error message. + This is a very long error message. This is a very long error message. + This is a very long error message. This is a very long error message. + +
+
+
+ +
+
+
+
+
+ + + Ok + Cancel + +
+
+
+ + + diff --git a/web/libs/tiny_mce/plugins/insertdatetime/editor_plugin.js b/web/libs/tiny_mce/plugins/insertdatetime/editor_plugin.js new file mode 100644 index 0000000..938ce6b --- /dev/null +++ b/web/libs/tiny_mce/plugins/insertdatetime/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.InsertDateTime",{init:function(a,b){var c=this;c.editor=a;a.addCommand("mceInsertDate",function(){var d=c._getDateTime(new Date(),a.getParam("plugin_insertdate_dateFormat",a.getLang("insertdatetime.date_fmt")));a.execCommand("mceInsertContent",false,d)});a.addCommand("mceInsertTime",function(){var d=c._getDateTime(new Date(),a.getParam("plugin_insertdate_timeFormat",a.getLang("insertdatetime.time_fmt")));a.execCommand("mceInsertContent",false,d)});a.addButton("insertdate",{title:"insertdatetime.insertdate_desc",cmd:"mceInsertDate"});a.addButton("inserttime",{title:"insertdatetime.inserttime_desc",cmd:"mceInsertTime"})},getInfo:function(){return{longname:"Insert date/time",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/insertdatetime",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_getDateTime:function(e,a){var c=this.editor;function b(g,d){g=""+g;if(g.length-1){a[c].style.zIndex=g[j];a[j].style.zIndex=g[c]}else{if(g[c]>0){a[c].style.zIndex=g[c]-1}}}else{for(f=0;fg[c]){j=f;break}}if(j>-1){a[c].style.zIndex=g[j];a[j].style.zIndex=g[c]}else{a[c].style.zIndex=g[c]+1}}b.execCommand("mceRepaint")},_getParentLayer:function(a){return this.editor.dom.getParent(a,function(b){return b.nodeType==1&&/^(absolute|relative|static)$/i.test(b.style.position)})},_insertLayer:function(){var a=this.editor,b=a.dom.getPos(a.dom.getParent(a.selection.getNode(),"*"));a.dom.add(a.getBody(),"div",{style:{position:"absolute",left:b.x,top:(b.y>20?b.y:20),width:100,height:100},"class":"mceItemVisualAid"},a.selection.getContent()||a.getLang("layer.content"))},_toggleAbsolute:function(){var a=this.editor,b=this._getParentLayer(a.selection.getNode());if(!b){b=a.dom.getParent(a.selection.getNode(),"DIV,P,IMG")}if(b){if(b.style.position.toLowerCase()=="absolute"){a.dom.setStyles(b,{position:"",left:"",top:"",width:"",height:""});a.dom.removeClass(b,"mceItemVisualAid")}else{if(b.style.left==""){b.style.left=20+"px"}if(b.style.top==""){b.style.top=20+"px"}if(b.style.width==""){b.style.width=b.width?(b.width+"px"):"100px"}if(b.style.height==""){b.style.height=b.height?(b.height+"px"):"100px"}b.style.position="absolute";a.addVisual(a.getBody())}a.execCommand("mceRepaint");a.nodeChanged()}}});tinymce.PluginManager.add("layer",tinymce.plugins.Layer)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/layer/editor_plugin_src.js b/web/libs/tiny_mce/plugins/layer/editor_plugin_src.js new file mode 100644 index 0000000..d5aa865 --- /dev/null +++ b/web/libs/tiny_mce/plugins/layer/editor_plugin_src.js @@ -0,0 +1,212 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.Layer', { + init : function(ed, url) { + var t = this; + + t.editor = ed; + + // Register commands + ed.addCommand('mceInsertLayer', t._insertLayer, t); + + ed.addCommand('mceMoveForward', function() { + t._move(1); + }); + + ed.addCommand('mceMoveBackward', function() { + t._move(-1); + }); + + ed.addCommand('mceMakeAbsolute', function() { + t._toggleAbsolute(); + }); + + // Register buttons + ed.addButton('moveforward', {title : 'layer.forward_desc', cmd : 'mceMoveForward'}); + ed.addButton('movebackward', {title : 'layer.backward_desc', cmd : 'mceMoveBackward'}); + ed.addButton('absolute', {title : 'layer.absolute_desc', cmd : 'mceMakeAbsolute'}); + ed.addButton('insertlayer', {title : 'layer.insertlayer_desc', cmd : 'mceInsertLayer'}); + + ed.onInit.add(function() { + if (tinymce.isIE) + ed.getDoc().execCommand('2D-Position', false, true); + }); + + ed.onNodeChange.add(t._nodeChange, t); + ed.onVisualAid.add(t._visualAid, t); + }, + + getInfo : function() { + return { + longname : 'Layer', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/layer', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + // Private methods + + _nodeChange : function(ed, cm, n) { + var le, p; + + le = this._getParentLayer(n); + p = ed.dom.getParent(n, 'DIV,P,IMG'); + + if (!p) { + cm.setDisabled('absolute', 1); + cm.setDisabled('moveforward', 1); + cm.setDisabled('movebackward', 1); + } else { + cm.setDisabled('absolute', 0); + cm.setDisabled('moveforward', !le); + cm.setDisabled('movebackward', !le); + cm.setActive('absolute', le && le.style.position.toLowerCase() == "absolute"); + } + }, + + // Private methods + + _visualAid : function(ed, e, s) { + var dom = ed.dom; + + tinymce.each(dom.select('div,p', e), function(e) { + if (/^(absolute|relative|static)$/i.test(e.style.position)) { + if (s) + dom.addClass(e, 'mceItemVisualAid'); + else + dom.removeClass(e, 'mceItemVisualAid'); + } + }); + }, + + _move : function(d) { + var ed = this.editor, i, z = [], le = this._getParentLayer(ed.selection.getNode()), ci = -1, fi = -1, nl; + + nl = []; + tinymce.walk(ed.getBody(), function(n) { + if (n.nodeType == 1 && /^(absolute|relative|static)$/i.test(n.style.position)) + nl.push(n); + }, 'childNodes'); + + // Find z-indexes + for (i=0; i -1) { + nl[ci].style.zIndex = z[fi]; + nl[fi].style.zIndex = z[ci]; + } else { + if (z[ci] > 0) + nl[ci].style.zIndex = z[ci] - 1; + } + } else { + // Move forward + + // Try find a higher one + for (i=0; i z[ci]) { + fi = i; + break; + } + } + + if (fi > -1) { + nl[ci].style.zIndex = z[fi]; + nl[fi].style.zIndex = z[ci]; + } else + nl[ci].style.zIndex = z[ci] + 1; + } + + ed.execCommand('mceRepaint'); + }, + + _getParentLayer : function(n) { + return this.editor.dom.getParent(n, function(n) { + return n.nodeType == 1 && /^(absolute|relative|static)$/i.test(n.style.position); + }); + }, + + _insertLayer : function() { + var ed = this.editor, p = ed.dom.getPos(ed.dom.getParent(ed.selection.getNode(), '*')); + + ed.dom.add(ed.getBody(), 'div', { + style : { + position : 'absolute', + left : p.x, + top : (p.y > 20 ? p.y : 20), + width : 100, + height : 100 + }, + 'class' : 'mceItemVisualAid' + }, ed.selection.getContent() || ed.getLang('layer.content')); + }, + + _toggleAbsolute : function() { + var ed = this.editor, le = this._getParentLayer(ed.selection.getNode()); + + if (!le) + le = ed.dom.getParent(ed.selection.getNode(), 'DIV,P,IMG'); + + if (le) { + if (le.style.position.toLowerCase() == "absolute") { + ed.dom.setStyles(le, { + position : '', + left : '', + top : '', + width : '', + height : '' + }); + + ed.dom.removeClass(le, 'mceItemVisualAid'); + } else { + if (le.style.left == "") + le.style.left = 20 + 'px'; + + if (le.style.top == "") + le.style.top = 20 + 'px'; + + if (le.style.width == "") + le.style.width = le.width ? (le.width + 'px') : '100px'; + + if (le.style.height == "") + le.style.height = le.height ? (le.height + 'px') : '100px'; + + le.style.position = "absolute"; + ed.addVisual(ed.getBody()); + } + + ed.execCommand('mceRepaint'); + ed.nodeChanged(); + } + } + }); + + // Register plugin + tinymce.PluginManager.add('layer', tinymce.plugins.Layer); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/legacyoutput/editor_plugin.js b/web/libs/tiny_mce/plugins/legacyoutput/editor_plugin.js new file mode 100644 index 0000000..29d43c5 --- /dev/null +++ b/web/libs/tiny_mce/plugins/legacyoutput/editor_plugin.js @@ -0,0 +1 @@ +(function(a){a.onAddEditor.addToTop(function(c,b){b.settings.inline_styles=false});a.create("tinymce.plugins.LegacyOutput",{init:function(b){b.onInit.add(function(){var c="p,h1,h2,h3,h4,h5,h6,td,th,div,ul,ol,li,table,img",e=a.explode(b.settings.font_size_style_values),d=b.serializer;b.formatter.register({alignleft:{selector:c,attributes:{align:"left"}},aligncenter:{selector:c,attributes:{align:"center"}},alignright:{selector:c,attributes:{align:"right"}},alignfull:{selector:c,attributes:{align:"full"}},bold:{inline:"b"},italic:{inline:"i"},underline:{inline:"u"},strikethrough:{inline:"strike"},fontname:{inline:"font",attributes:{face:"%value"}},fontsize:{inline:"font",attributes:{size:function(f){return a.inArray(e,f.value)+1}}},forecolor:{inline:"font",styles:{color:"%value"}},hilitecolor:{inline:"font",styles:{backgroundColor:"%value"}}});d._setup();a.each("b,i,u,strike".split(","),function(f){var g=d.rules[f];if(!g){d.addRules(f)}});if(!d.rules.font){d.addRules("font[face|size|color|style]")}a.each(c.split(","),function(f){var h=d.rules[f],g;if(h){a.each(h.attribs,function(j,i){if(i.name=="align"){g=true;return false}});if(!g){h.attribs.push({name:"align"})}}});b.onNodeChange.add(function(g,k){var j,f,h,i;f=g.dom.getParent(g.selection.getNode(),"font");if(f){h=f.face;i=f.size}if(j=k.get("fontselect")){j.select(function(l){return l==h})}if(j=k.get("fontsizeselect")){j.select(function(m){var l=a.inArray(e,m.fontSize);return l+1==i})}})})},getInfo:function(){return{longname:"LegacyOutput",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/legacyoutput",version:a.majorVersion+"."+a.minorVersion}}});a.PluginManager.add("legacyoutput",a.plugins.LegacyOutput)})(tinymce); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/legacyoutput/editor_plugin_src.js b/web/libs/tiny_mce/plugins/legacyoutput/editor_plugin_src.js new file mode 100644 index 0000000..e852da1 --- /dev/null +++ b/web/libs/tiny_mce/plugins/legacyoutput/editor_plugin_src.js @@ -0,0 +1,136 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + * + * This plugin will force TinyMCE to produce deprecated legacy output such as font elements, u elements, align + * attributes and so forth. There are a few cases where these old items might be needed for example in email applications or with Flash + * + * However you should NOT use this plugin if you are building some system that produces web contents such as a CMS. All these elements are + * not apart of the newer specifications for HTML and XHTML. + */ + +(function(tinymce) { + // Override inline_styles setting to force TinyMCE to produce deprecated contents + tinymce.onAddEditor.addToTop(function(tinymce, editor) { + editor.settings.inline_styles = false; + }); + + // Create the legacy ouput plugin + tinymce.create('tinymce.plugins.LegacyOutput', { + init : function(editor) { + editor.onInit.add(function() { + var alignElements = 'p,h1,h2,h3,h4,h5,h6,td,th,div,ul,ol,li,table,img', + fontSizes = tinymce.explode(editor.settings.font_size_style_values), + serializer = editor.serializer; + + // Override some internal formats to produce legacy elements and attributes + editor.formatter.register({ + // Change alignment formats to use the deprecated align attribute + alignleft : {selector : alignElements, attributes : {align : 'left'}}, + aligncenter : {selector : alignElements, attributes : {align : 'center'}}, + alignright : {selector : alignElements, attributes : {align : 'right'}}, + alignfull : {selector : alignElements, attributes : {align : 'full'}}, + + // Change the basic formatting elements to use deprecated element types + bold : {inline : 'b'}, + italic : {inline : 'i'}, + underline : {inline : 'u'}, + strikethrough : {inline : 'strike'}, + + // Change font size and font family to use the deprecated font element + fontname : {inline : 'font', attributes : {face : '%value'}}, + fontsize : { + inline : 'font', + attributes : { + size : function(vars) { + return tinymce.inArray(fontSizes, vars.value) + 1; + } + } + }, + + // Setup font elements for colors as well + forecolor : {inline : 'font', styles : {color : '%value'}}, + hilitecolor : {inline : 'font', styles : {backgroundColor : '%value'}} + }); + + // Force parsing of the serializer rules + serializer._setup(); + + // Check that deprecated elements are allowed if not add them + tinymce.each('b,i,u,strike'.split(','), function(name) { + var rule = serializer.rules[name]; + + if (!rule) + serializer.addRules(name); + }); + + // Add font element if it's missing + if (!serializer.rules["font"]) + serializer.addRules("font[face|size|color|style]"); + + // Add the missing and depreacted align attribute for the serialization engine + tinymce.each(alignElements.split(','), function(name) { + var rule = serializer.rules[name], found; + + if (rule) { + tinymce.each(rule.attribs, function(name, attr) { + if (attr.name == 'align') { + found = true; + return false; + } + }); + + if (!found) + rule.attribs.push({name : 'align'}); + } + }); + + // Listen for the onNodeChange event so that we can do special logic for the font size and font name drop boxes + editor.onNodeChange.add(function(editor, control_manager) { + var control, fontElm, fontName, fontSize; + + // Find font element get it's name and size + fontElm = editor.dom.getParent(editor.selection.getNode(), 'font'); + if (fontElm) { + fontName = fontElm.face; + fontSize = fontElm.size; + } + + // Select/unselect the font name in droplist + if (control = control_manager.get('fontselect')) { + control.select(function(value) { + return value == fontName; + }); + } + + // Select/unselect the font size in droplist + if (control = control_manager.get('fontsizeselect')) { + control.select(function(value) { + var index = tinymce.inArray(fontSizes, value.fontSize); + + return index + 1 == fontSize; + }); + } + }); + }); + }, + + getInfo : function() { + return { + longname : 'LegacyOutput', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/legacyoutput', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('legacyoutput', tinymce.plugins.LegacyOutput); +})(tinymce); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/media/css/content.css b/web/libs/tiny_mce/plugins/media/css/content.css new file mode 100644 index 0000000..1bf6a75 --- /dev/null +++ b/web/libs/tiny_mce/plugins/media/css/content.css @@ -0,0 +1,6 @@ +.mceItemFlash, .mceItemShockWave, .mceItemQuickTime, .mceItemWindowsMedia, .mceItemRealMedia {border:1px dotted #cc0000; background-position:center; background-repeat:no-repeat; background-color:#ffffcc;} +.mceItemShockWave {background-image: url(../img/shockwave.gif);} +.mceItemFlash {background-image:url(../img/flash.gif);} +.mceItemQuickTime {background-image:url(../img/quicktime.gif);} +.mceItemWindowsMedia {background-image:url(../img/windowsmedia.gif);} +.mceItemRealMedia {background-image:url(../img/realmedia.gif);} diff --git a/web/libs/tiny_mce/plugins/media/css/media.css b/web/libs/tiny_mce/plugins/media/css/media.css new file mode 100644 index 0000000..2d08794 --- /dev/null +++ b/web/libs/tiny_mce/plugins/media/css/media.css @@ -0,0 +1,16 @@ +#id, #name, #hspace, #vspace, #class_name, #align { width: 100px } +#hspace, #vspace { width: 50px } +#flash_quality, #flash_align, #flash_scale, #flash_salign, #flash_wmode { width: 100px } +#flash_base, #flash_flashvars { width: 240px } +#width, #height { width: 40px } +#src, #media_type { width: 250px } +#class { width: 120px } +#prev { margin: 0; border: 1px solid black; width: 380px; height: 230px; overflow: auto } +.panel_wrapper div.current { height: 390px; overflow: auto } +#flash_options, #shockwave_options, #qt_options, #wmp_options, #rmp_options { display: none } +.mceAddSelectValue { background-color: #DDDDDD } +#qt_starttime, #qt_endtime, #qt_fov, #qt_href, #qt_moveid, #qt_moviename, #qt_node, #qt_pan, #qt_qtsrc, #qt_qtsrcchokespeed, #qt_target, #qt_tilt, #qt_urlsubstituten, #qt_volume { width: 70px } +#wmp_balance, #wmp_baseurl, #wmp_captioningid, #wmp_currentmarker, #wmp_currentposition, #wmp_defaultframe, #wmp_playcount, #wmp_rate, #wmp_uimode, #wmp_volume { width: 70px } +#rmp_console, #rmp_numloop, #rmp_controls, #rmp_scriptcallbacks { width: 70px } +#shockwave_swvolume, #shockwave_swframe, #shockwave_swurl, #shockwave_swstretchvalign, #shockwave_swstretchhalign, #shockwave_swstretchstyle { width: 90px } +#qt_qtsrc { width: 200px } diff --git a/web/libs/tiny_mce/plugins/media/editor_plugin.js b/web/libs/tiny_mce/plugins/media/editor_plugin.js new file mode 100644 index 0000000..4bbe367 --- /dev/null +++ b/web/libs/tiny_mce/plugins/media/editor_plugin.js @@ -0,0 +1 @@ +(function(){var a=tinymce.each;tinymce.create("tinymce.plugins.MediaPlugin",{init:function(b,c){var e=this;e.editor=b;e.url=c;function f(g){return/^(mceItemFlash|mceItemShockWave|mceItemWindowsMedia|mceItemQuickTime|mceItemRealMedia)$/.test(g.className)}b.onPreInit.add(function(){b.serializer.addRules("param[name|value|_mce_value]")});b.addCommand("mceMedia",function(){b.windowManager.open({file:c+"/media.htm",width:430+parseInt(b.getLang("media.delta_width",0)),height:470+parseInt(b.getLang("media.delta_height",0)),inline:1},{plugin_url:c})});b.addButton("media",{title:"media.desc",cmd:"mceMedia"});b.onNodeChange.add(function(h,g,i){g.setActive("media",i.nodeName=="IMG"&&f(i))});b.onInit.add(function(){var g={mceItemFlash:"flash",mceItemShockWave:"shockwave",mceItemWindowsMedia:"windowsmedia",mceItemQuickTime:"quicktime",mceItemRealMedia:"realmedia"};b.selection.onSetContent.add(function(){e._spansToImgs(b.getBody())});b.selection.onBeforeSetContent.add(e._objectsToSpans,e);if(b.settings.content_css!==false){b.dom.loadCSS(c+"/css/content.css")}if(b.theme&&b.theme.onResolveName){b.theme.onResolveName.add(function(h,i){if(i.name=="img"){a(g,function(l,j){if(b.dom.hasClass(i.node,j)){i.name=l;i.title=b.dom.getAttrib(i.node,"title");return false}})}})}if(b&&b.plugins.contextmenu){b.plugins.contextmenu.onContextMenu.add(function(i,h,j){if(j.nodeName=="IMG"&&/mceItem(Flash|ShockWave|WindowsMedia|QuickTime|RealMedia)/.test(j.className)){h.add({title:"media.edit",icon:"media",cmd:"mceMedia"})}})}});b.onBeforeSetContent.add(e._objectsToSpans,e);b.onSetContent.add(function(){e._spansToImgs(b.getBody())});b.onPreProcess.add(function(g,i){var h=g.dom;if(i.set){e._spansToImgs(i.node);a(h.select("IMG",i.node),function(k){var j;if(f(k)){j=e._parse(k.title);h.setAttrib(k,"width",h.getAttrib(k,"width",j.width||100));h.setAttrib(k,"height",h.getAttrib(k,"height",j.height||100))}})}if(i.get){a(h.select("IMG",i.node),function(m){var l,j,k;if(g.getParam("media_use_script")){if(f(m)){m.className=m.className.replace(/mceItem/g,"mceTemp")}return}switch(m.className){case"mceItemFlash":l="d27cdb6e-ae6d-11cf-96b8-444553540000";j="http://download.macromedia.com/pub/shockwave/cabs/flash/swflash.cab#version=6,0,40,0";k="application/x-shockwave-flash";break;case"mceItemShockWave":l="166b1bca-3f9c-11cf-8075-444553540000";j="http://download.macromedia.com/pub/shockwave/cabs/director/sw.cab#version=8,5,1,0";k="application/x-director";break;case"mceItemWindowsMedia":l=g.getParam("media_wmp6_compatible")?"05589fa1-c356-11ce-bf01-00aa0055595a":"6bf52a52-394a-11d3-b153-00c04f79faa6";j="http://activex.microsoft.com/activex/controls/mplayer/en/nsmp2inf.cab#Version=5,1,52,701";k="application/x-mplayer2";break;case"mceItemQuickTime":l="02bf25d5-8c17-4b23-bc80-d3488abddc6b";j="http://www.apple.com/qtactivex/qtplugin.cab#version=6,0,2,0";k="video/quicktime";break;case"mceItemRealMedia":l="cfcdaa03-8be4-11cf-b84b-0020afbbccfa";j="http://download.macromedia.com/pub/shockwave/cabs/flash/swflash.cab#version=6,0,40,0";k="audio/x-pn-realaudio-plugin";break}if(l){h.replace(e._buildObj({classid:l,codebase:j,type:k},m),m)}})}});b.onPostProcess.add(function(g,h){h.content=h.content.replace(/_mce_value=/g,"value=")});function d(g,h){h=new RegExp(h+'="([^"]+)"',"g").exec(g);return h?b.dom.decode(h[1]):""}b.onPostProcess.add(function(g,h){if(g.getParam("media_use_script")){h.content=h.content.replace(/]+>/g,function(j){var i=d(j,"class");if(/^(mceTempFlash|mceTempShockWave|mceTempWindowsMedia|mceTempQuickTime|mceTempRealMedia)$/.test(i)){at=e._parse(d(j,"title"));at.width=d(j,"width");at.height=d(j,"height");j=''; + } + + return im; + }); + } + }); + }, + + getInfo : function() { + return { + longname : 'Media', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/media', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + // Private methods + _objectsToSpans : function(ed, o) { + var t = this, h = o.content; + + h = h.replace(/]*>\s*write(Flash|ShockWave|WindowsMedia|QuickTime|RealMedia)\(\{([^\)]*)\}\);\s*<\/script>/gi, function(a, b, c) { + var o = t._parse(c); + + return '' + }); + + h = h.replace(/]*)>/gi, ''); + h = h.replace(/]*)\/?>/gi, ''); + h = h.replace(/]*)>/gi, ''); + h = h.replace(/<\/(object)([^>]*)>/gi, ''); + h = h.replace(/<\/embed>/gi, ''); + h = h.replace(/]*)>/gi, function(a, b) {return ''}); + h = h.replace(/\/ class=\"mceItemParam\"><\/span>/gi, 'class="mceItemParam">'); + + o.content = h; + }, + + _buildObj : function(o, n) { + var ob, ed = this.editor, dom = ed.dom, p = this._parse(n.title), stc; + + stc = ed.getParam('media_strict', true) && o.type == 'application/x-shockwave-flash'; + + p.width = o.width = dom.getAttrib(n, 'width') || 100; + p.height = o.height = dom.getAttrib(n, 'height') || 100; + + if (p.src) + p.src = ed.convertURL(p.src, 'src', n); + + if (stc) { + ob = dom.create('span', { + id : p.id, + _mce_name : 'object', + type : 'application/x-shockwave-flash', + data : p.src, + style : dom.getAttrib(n, 'style'), + width : o.width, + height : o.height + }); + } else { + ob = dom.create('span', { + id : p.id, + _mce_name : 'object', + classid : "clsid:" + o.classid, + style : dom.getAttrib(n, 'style'), + codebase : o.codebase, + width : o.width, + height : o.height + }); + } + + each (p, function(v, k) { + if (!/^(width|height|codebase|classid|id|_cx|_cy)$/.test(k)) { + // Use url instead of src in IE for Windows media + if (o.type == 'application/x-mplayer2' && k == 'src' && !p.url) + k = 'url'; + + if (v) + dom.add(ob, 'span', {_mce_name : 'param', name : k, '_mce_value' : v}); + } + }); + + if (!stc) + dom.add(ob, 'span', tinymce.extend({_mce_name : 'embed', type : o.type, style : dom.getAttrib(n, 'style')}, p)); + + return ob; + }, + + _spansToImgs : function(p) { + var t = this, dom = t.editor.dom, im, ci; + + each(dom.select('span', p), function(n) { + // Convert object into image + if (dom.getAttrib(n, 'class') == 'mceItemObject') { + ci = dom.getAttrib(n, "classid").toLowerCase().replace(/\s+/g, ''); + + switch (ci) { + case 'clsid:d27cdb6e-ae6d-11cf-96b8-444553540000': + dom.replace(t._createImg('mceItemFlash', n), n); + break; + + case 'clsid:166b1bca-3f9c-11cf-8075-444553540000': + dom.replace(t._createImg('mceItemShockWave', n), n); + break; + + case 'clsid:6bf52a52-394a-11d3-b153-00c04f79faa6': + case 'clsid:22d6f312-b0f6-11d0-94ab-0080c74c7e95': + case 'clsid:05589fa1-c356-11ce-bf01-00aa0055595a': + dom.replace(t._createImg('mceItemWindowsMedia', n), n); + break; + + case 'clsid:02bf25d5-8c17-4b23-bc80-d3488abddc6b': + dom.replace(t._createImg('mceItemQuickTime', n), n); + break; + + case 'clsid:cfcdaa03-8be4-11cf-b84b-0020afbbccfa': + dom.replace(t._createImg('mceItemRealMedia', n), n); + break; + + default: + dom.replace(t._createImg('mceItemFlash', n), n); + } + + return; + } + + // Convert embed into image + if (dom.getAttrib(n, 'class') == 'mceItemEmbed') { + switch (dom.getAttrib(n, 'type')) { + case 'application/x-shockwave-flash': + dom.replace(t._createImg('mceItemFlash', n), n); + break; + + case 'application/x-director': + dom.replace(t._createImg('mceItemShockWave', n), n); + break; + + case 'application/x-mplayer2': + dom.replace(t._createImg('mceItemWindowsMedia', n), n); + break; + + case 'video/quicktime': + dom.replace(t._createImg('mceItemQuickTime', n), n); + break; + + case 'audio/x-pn-realaudio-plugin': + dom.replace(t._createImg('mceItemRealMedia', n), n); + break; + + default: + dom.replace(t._createImg('mceItemFlash', n), n); + } + } + }); + }, + + _createImg : function(cl, n) { + var im, dom = this.editor.dom, pa = {}, ti = '', args; + + args = ['id', 'name', 'width', 'height', 'bgcolor', 'align', 'flashvars', 'src', 'wmode', 'allowfullscreen', 'quality', 'data']; + + // Create image + im = dom.create('img', { + src : this.url + '/img/trans.gif', + width : dom.getAttrib(n, 'width') || 100, + height : dom.getAttrib(n, 'height') || 100, + style : dom.getAttrib(n, 'style'), + 'class' : cl + }); + + // Setup base parameters + each(args, function(na) { + var v = dom.getAttrib(n, na); + + if (v) + pa[na] = v; + }); + + // Add optional parameters + each(dom.select('span', n), function(n) { + if (dom.hasClass(n, 'mceItemParam')) + pa[dom.getAttrib(n, 'name')] = dom.getAttrib(n, '_mce_value'); + }); + + // Use src not movie + if (pa.movie) { + pa.src = pa.movie; + delete pa.movie; + } + + // No src try data + if (!pa.src) { + pa.src = pa.data; + delete pa.data; + } + + // Merge with embed args + n = dom.select('.mceItemEmbed', n)[0]; + if (n) { + each(args, function(na) { + var v = dom.getAttrib(n, na); + + if (v && !pa[na]) + pa[na] = v; + }); + } + + delete pa.width; + delete pa.height; + + im.title = this._serialize(pa); + + return im; + }, + + _parse : function(s) { + return tinymce.util.JSON.parse('{' + s + '}'); + }, + + _serialize : function(o) { + return tinymce.util.JSON.serialize(o).replace(/[{}]/g, ''); + } + }); + + // Register plugin + tinymce.PluginManager.add('media', tinymce.plugins.MediaPlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/media/img/flash.gif b/web/libs/tiny_mce/plugins/media/img/flash.gif new file mode 100644 index 0000000..cb192e6 Binary files /dev/null and b/web/libs/tiny_mce/plugins/media/img/flash.gif differ diff --git a/web/libs/tiny_mce/plugins/media/img/flv_player.swf b/web/libs/tiny_mce/plugins/media/img/flv_player.swf new file mode 100644 index 0000000..042c2ab Binary files /dev/null and b/web/libs/tiny_mce/plugins/media/img/flv_player.swf differ diff --git a/web/libs/tiny_mce/plugins/media/img/quicktime.gif b/web/libs/tiny_mce/plugins/media/img/quicktime.gif new file mode 100644 index 0000000..3b04991 Binary files /dev/null and b/web/libs/tiny_mce/plugins/media/img/quicktime.gif differ diff --git a/web/libs/tiny_mce/plugins/media/img/realmedia.gif b/web/libs/tiny_mce/plugins/media/img/realmedia.gif new file mode 100644 index 0000000..fdfe0b9 Binary files /dev/null and b/web/libs/tiny_mce/plugins/media/img/realmedia.gif differ diff --git a/web/libs/tiny_mce/plugins/media/img/shockwave.gif b/web/libs/tiny_mce/plugins/media/img/shockwave.gif new file mode 100644 index 0000000..5f235df Binary files /dev/null and b/web/libs/tiny_mce/plugins/media/img/shockwave.gif differ diff --git a/web/libs/tiny_mce/plugins/media/img/trans.gif b/web/libs/tiny_mce/plugins/media/img/trans.gif new file mode 100644 index 0000000..3884865 Binary files /dev/null and b/web/libs/tiny_mce/plugins/media/img/trans.gif differ diff --git a/web/libs/tiny_mce/plugins/media/img/windowsmedia.gif b/web/libs/tiny_mce/plugins/media/img/windowsmedia.gif new file mode 100644 index 0000000..ab50f2d Binary files /dev/null and b/web/libs/tiny_mce/plugins/media/img/windowsmedia.gif differ diff --git a/web/libs/tiny_mce/plugins/media/js/embed.js b/web/libs/tiny_mce/plugins/media/js/embed.js new file mode 100644 index 0000000..f8dc810 --- /dev/null +++ b/web/libs/tiny_mce/plugins/media/js/embed.js @@ -0,0 +1,73 @@ +/** + * This script contains embed functions for common plugins. This scripts are complety free to use for any purpose. + */ + +function writeFlash(p) { + writeEmbed( + 'D27CDB6E-AE6D-11cf-96B8-444553540000', + 'http://download.macromedia.com/pub/shockwave/cabs/flash/swflash.cab#version=6,0,40,0', + 'application/x-shockwave-flash', + p + ); +} + +function writeShockWave(p) { + writeEmbed( + '166B1BCA-3F9C-11CF-8075-444553540000', + 'http://download.macromedia.com/pub/shockwave/cabs/director/sw.cab#version=8,5,1,0', + 'application/x-director', + p + ); +} + +function writeQuickTime(p) { + writeEmbed( + '02BF25D5-8C17-4B23-BC80-D3488ABDDC6B', + 'http://www.apple.com/qtactivex/qtplugin.cab#version=6,0,2,0', + 'video/quicktime', + p + ); +} + +function writeRealMedia(p) { + writeEmbed( + 'CFCDAA03-8BE4-11cf-B84B-0020AFBBCCFA', + 'http://download.macromedia.com/pub/shockwave/cabs/flash/swflash.cab#version=6,0,40,0', + 'audio/x-pn-realaudio-plugin', + p + ); +} + +function writeWindowsMedia(p) { + p.url = p.src; + writeEmbed( + '6BF52A52-394A-11D3-B153-00C04F79FAA6', + 'http://activex.microsoft.com/activex/controls/mplayer/en/nsmp2inf.cab#Version=5,1,52,701', + 'application/x-mplayer2', + p + ); +} + +function writeEmbed(cls, cb, mt, p) { + var h = '', n; + + h += ''; + + h += ''); + +function init() { + var pl = "", f, val; + var type = "flash", fe, i; + + ed = tinyMCEPopup.editor; + + tinyMCEPopup.resizeToInnerSize(); + f = document.forms[0] + + fe = ed.selection.getNode(); + if (/mceItem(Flash|ShockWave|WindowsMedia|QuickTime|RealMedia)/.test(ed.dom.getAttrib(fe, 'class'))) { + pl = fe.title; + + switch (ed.dom.getAttrib(fe, 'class')) { + case 'mceItemFlash': + type = 'flash'; + break; + + case 'mceItemFlashVideo': + type = 'flv'; + break; + + case 'mceItemShockWave': + type = 'shockwave'; + break; + + case 'mceItemWindowsMedia': + type = 'wmp'; + break; + + case 'mceItemQuickTime': + type = 'qt'; + break; + + case 'mceItemRealMedia': + type = 'rmp'; + break; + } + + document.forms[0].insert.value = ed.getLang('update', 'Insert', true); + } + + document.getElementById('filebrowsercontainer').innerHTML = getBrowserHTML('filebrowser','src','media','media'); + document.getElementById('qtsrcfilebrowsercontainer').innerHTML = getBrowserHTML('qtsrcfilebrowser','qt_qtsrc','media','media'); + document.getElementById('bgcolor_pickcontainer').innerHTML = getColorPickerHTML('bgcolor_pick','bgcolor'); + + var html = getMediaListHTML('medialist','src','media','media'); + if (html == "") + document.getElementById("linklistrow").style.display = 'none'; + else + document.getElementById("linklistcontainer").innerHTML = html; + + // Resize some elements + if (isVisible('filebrowser')) + document.getElementById('src').style.width = '230px'; + + // Setup form + if (pl != "") { + pl = tinyMCEPopup.editor.plugins.media._parse(pl); + + switch (type) { + case "flash": + setBool(pl, 'flash', 'play'); + setBool(pl, 'flash', 'loop'); + setBool(pl, 'flash', 'menu'); + setBool(pl, 'flash', 'swliveconnect'); + setStr(pl, 'flash', 'quality'); + setStr(pl, 'flash', 'scale'); + setStr(pl, 'flash', 'salign'); + setStr(pl, 'flash', 'wmode'); + setStr(pl, 'flash', 'base'); + setStr(pl, 'flash', 'flashvars'); + break; + + case "qt": + setBool(pl, 'qt', 'loop'); + setBool(pl, 'qt', 'autoplay'); + setBool(pl, 'qt', 'cache'); + setBool(pl, 'qt', 'controller'); + setBool(pl, 'qt', 'correction'); + setBool(pl, 'qt', 'enablejavascript'); + setBool(pl, 'qt', 'kioskmode'); + setBool(pl, 'qt', 'autohref'); + setBool(pl, 'qt', 'playeveryframe'); + setBool(pl, 'qt', 'tarsetcache'); + setStr(pl, 'qt', 'scale'); + setStr(pl, 'qt', 'starttime'); + setStr(pl, 'qt', 'endtime'); + setStr(pl, 'qt', 'tarset'); + setStr(pl, 'qt', 'qtsrcchokespeed'); + setStr(pl, 'qt', 'volume'); + setStr(pl, 'qt', 'qtsrc'); + break; + + case "shockwave": + setBool(pl, 'shockwave', 'sound'); + setBool(pl, 'shockwave', 'progress'); + setBool(pl, 'shockwave', 'autostart'); + setBool(pl, 'shockwave', 'swliveconnect'); + setStr(pl, 'shockwave', 'swvolume'); + setStr(pl, 'shockwave', 'swstretchstyle'); + setStr(pl, 'shockwave', 'swstretchhalign'); + setStr(pl, 'shockwave', 'swstretchvalign'); + break; + + case "wmp": + setBool(pl, 'wmp', 'autostart'); + setBool(pl, 'wmp', 'enabled'); + setBool(pl, 'wmp', 'enablecontextmenu'); + setBool(pl, 'wmp', 'fullscreen'); + setBool(pl, 'wmp', 'invokeurls'); + setBool(pl, 'wmp', 'mute'); + setBool(pl, 'wmp', 'stretchtofit'); + setBool(pl, 'wmp', 'windowlessvideo'); + setStr(pl, 'wmp', 'balance'); + setStr(pl, 'wmp', 'baseurl'); + setStr(pl, 'wmp', 'captioningid'); + setStr(pl, 'wmp', 'currentmarker'); + setStr(pl, 'wmp', 'currentposition'); + setStr(pl, 'wmp', 'defaultframe'); + setStr(pl, 'wmp', 'playcount'); + setStr(pl, 'wmp', 'rate'); + setStr(pl, 'wmp', 'uimode'); + setStr(pl, 'wmp', 'volume'); + break; + + case "rmp": + setBool(pl, 'rmp', 'autostart'); + setBool(pl, 'rmp', 'loop'); + setBool(pl, 'rmp', 'autogotourl'); + setBool(pl, 'rmp', 'center'); + setBool(pl, 'rmp', 'imagestatus'); + setBool(pl, 'rmp', 'maintainaspect'); + setBool(pl, 'rmp', 'nojava'); + setBool(pl, 'rmp', 'prefetch'); + setBool(pl, 'rmp', 'shuffle'); + setStr(pl, 'rmp', 'console'); + setStr(pl, 'rmp', 'controls'); + setStr(pl, 'rmp', 'numloop'); + setStr(pl, 'rmp', 'scriptcallbacks'); + break; + } + + setStr(pl, null, 'src'); + setStr(pl, null, 'id'); + setStr(pl, null, 'name'); + setStr(pl, null, 'vspace'); + setStr(pl, null, 'hspace'); + setStr(pl, null, 'bgcolor'); + setStr(pl, null, 'align'); + setStr(pl, null, 'width'); + setStr(pl, null, 'height'); + + if ((val = ed.dom.getAttrib(fe, "width")) != "") + pl.width = f.width.value = val; + + if ((val = ed.dom.getAttrib(fe, "height")) != "") + pl.height = f.height.value = val; + + oldWidth = pl.width ? parseInt(pl.width) : 0; + oldHeight = pl.height ? parseInt(pl.height) : 0; + } else + oldWidth = oldHeight = 0; + + selectByValue(f, 'media_type', type); + changedType(type); + updateColor('bgcolor_pick', 'bgcolor'); + + TinyMCE_EditableSelects.init(); + generatePreview(); +} + +function insertMedia() { + var fe, f = document.forms[0], h; + + tinyMCEPopup.restoreSelection(); + + if (!AutoValidator.validate(f)) { + tinyMCEPopup.alert(ed.getLang('invalid_data')); + return false; + } + + f.width.value = f.width.value == "" ? 100 : f.width.value; + f.height.value = f.height.value == "" ? 100 : f.height.value; + + fe = ed.selection.getNode(); + if (fe != null && /mceItem(Flash|ShockWave|WindowsMedia|QuickTime|RealMedia)/.test(ed.dom.getAttrib(fe, 'class'))) { + switch (f.media_type.options[f.media_type.selectedIndex].value) { + case "flash": + fe.className = "mceItemFlash"; + break; + + case "flv": + fe.className = "mceItemFlashVideo"; + break; + + case "shockwave": + fe.className = "mceItemShockWave"; + break; + + case "qt": + fe.className = "mceItemQuickTime"; + break; + + case "wmp": + fe.className = "mceItemWindowsMedia"; + break; + + case "rmp": + fe.className = "mceItemRealMedia"; + break; + } + + if (fe.width != f.width.value || fe.height != f.height.value) + ed.execCommand('mceRepaint'); + + fe.title = serializeParameters(); + fe.width = f.width.value; + fe.height = f.height.value; + fe.style.width = f.width.value + (f.width.value.indexOf('%') == -1 ? 'px' : ''); + fe.style.height = f.height.value + (f.height.value.indexOf('%') == -1 ? 'px' : ''); + fe.align = f.align.options[f.align.selectedIndex].value; + } else { + h = ' 0) { + var html = ""; + + html += ''; + + return html; + } + + return ""; +} + +function getType(v) { + var fo, i, c, el, x, f = document.forms[0]; + + fo = ed.getParam("media_types", "flash=swf;flv=flv;shockwave=dcr;qt=mov,qt,mpg,mp3,mp4,mpeg;shockwave=dcr;wmp=avi,wmv,wm,asf,asx,wmx,wvx;rmp=rm,ra,ram").split(';'); + + // YouTube + if (v.match(/watch\?v=(.+)(.*)/)) { + f.width.value = '425'; + f.height.value = '350'; + f.src.value = 'http://www.youtube.com/v/' + v.match(/v=(.*)(.*)/)[0].split('=')[1]; + return 'flash'; + } + + // Google video + if (v.indexOf('http://video.google.com/videoplay?docid=') == 0) { + f.width.value = '425'; + f.height.value = '326'; + f.src.value = 'http://video.google.com/googleplayer.swf?docId=' + v.substring('http://video.google.com/videoplay?docid='.length) + '&hl=en'; + return 'flash'; + } + + for (i=0; i 0 ? s.substring(0, s.length - 1) : s; + + return s; +} + +function setBool(pl, p, n) { + if (typeof(pl[n]) == "undefined") + return; + + document.forms[0].elements[p + "_" + n].checked = pl[n] != 'false'; +} + +function setStr(pl, p, n) { + var f = document.forms[0], e = f.elements[(p != null ? p + "_" : '') + n]; + + if (typeof(pl[n]) == "undefined") + return; + + if (e.type == "text") + e.value = pl[n]; + else + selectByValue(f, (p != null ? p + "_" : '') + n, pl[n]); +} + +function getBool(p, n, d, tv, fv) { + var v = document.forms[0].elements[p + "_" + n].checked; + + tv = typeof(tv) == 'undefined' ? 'true' : "'" + jsEncode(tv) + "'"; + fv = typeof(fv) == 'undefined' ? 'false' : "'" + jsEncode(fv) + "'"; + + return (v == d) ? '' : n + (v ? ':' + tv + ',' : ":\'" + fv + "\',"); +} + +function getStr(p, n, d) { + var e = document.forms[0].elements[(p != null ? p + "_" : "") + n]; + var v = e.type == "text" ? e.value : e.options[e.selectedIndex].value; + + if (n == 'src') + v = tinyMCEPopup.editor.convertURL(v, 'src', null); + + return ((n == d || v == '') ? '' : n + ":'" + jsEncode(v) + "',"); +} + +function getInt(p, n, d) { + var e = document.forms[0].elements[(p != null ? p + "_" : "") + n]; + var v = e.type == "text" ? e.value : e.options[e.selectedIndex].value; + + return ((n == d || v == '') ? '' : n + ":" + v.replace(/[^0-9]+/g, '') + ","); +} + +function jsEncode(s) { + s = s.replace(new RegExp('\\\\', 'g'), '\\\\'); + s = s.replace(new RegExp('"', 'g'), '\\"'); + s = s.replace(new RegExp("'", 'g'), "\\'"); + + return s; +} + +function generatePreview(c) { + var f = document.forms[0], p = document.getElementById('prev'), h = '', cls, pl, n, type, codebase, wp, hp, nw, nh; + + p.innerHTML = ''; + + nw = parseInt(f.width.value); + nh = parseInt(f.height.value); + + if (f.width.value != "" && f.height.value != "") { + if (f.constrain.checked) { + if (c == 'width' && oldWidth != 0) { + wp = nw / oldWidth; + nh = Math.round(wp * nh); + f.height.value = nh; + } else if (c == 'height' && oldHeight != 0) { + hp = nh / oldHeight; + nw = Math.round(hp * nw); + f.width.value = nw; + } + } + } + + if (f.width.value != "") + oldWidth = nw; + + if (f.height.value != "") + oldHeight = nh; + + // After constrain + pl = serializeParameters(); + + switch (f.media_type.options[f.media_type.selectedIndex].value) { + case "flash": + cls = 'clsid:D27CDB6E-AE6D-11cf-96B8-444553540000'; + codebase = 'http://download.macromedia.com/pub/shockwave/cabs/flash/swflash.cab#version=6,0,40,0'; + type = 'application/x-shockwave-flash'; + break; + + case "shockwave": + cls = 'clsid:166B1BCA-3F9C-11CF-8075-444553540000'; + codebase = 'http://download.macromedia.com/pub/shockwave/cabs/director/sw.cab#version=8,5,1,0'; + type = 'application/x-director'; + break; + + case "qt": + cls = 'clsid:02BF25D5-8C17-4B23-BC80-D3488ABDDC6B'; + codebase = 'http://www.apple.com/qtactivex/qtplugin.cab#version=6,0,2,0'; + type = 'video/quicktime'; + break; + + case "wmp": + cls = ed.getParam('media_wmp6_compatible') ? 'clsid:05589FA1-C356-11CE-BF01-00AA0055595A' : 'clsid:6BF52A52-394A-11D3-B153-00C04F79FAA6'; + codebase = 'http://activex.microsoft.com/activex/controls/mplayer/en/nsmp2inf.cab#Version=5,1,52,701'; + type = 'application/x-mplayer2'; + break; + + case "rmp": + cls = 'clsid:CFCDAA03-8BE4-11cf-B84B-0020AFBBCCFA'; + codebase = 'http://activex.microsoft.com/activex/controls/mplayer/en/nsmp2inf.cab#Version=5,1,52,701'; + type = 'audio/x-pn-realaudio-plugin'; + break; + } + + if (pl == '') { + p.innerHTML = ''; + return; + } + + pl = tinyMCEPopup.editor.plugins.media._parse(pl); + + if (!pl.src) { + p.innerHTML = ''; + return; + } + + pl.src = tinyMCEPopup.editor.documentBaseURI.toAbsolute(pl.src); + pl.width = !pl.width ? 100 : pl.width; + pl.height = !pl.height ? 100 : pl.height; + pl.id = !pl.id ? 'obj' : pl.id; + pl.name = !pl.name ? 'eobj' : pl.name; + pl.align = !pl.align ? '' : pl.align; + + // Avoid annoying warning about insecure items + if (!tinymce.isIE || document.location.protocol != 'https:') { + h += ''; + + for (n in pl) { + h += ''; + + // Add extra url parameter if it's an absolute URL + if (n == 'src' && pl[n].indexOf('://') != -1) + h += ''; + } + } + + h += ' + + + {#media_dlg.title} + + + + + + + + + +
+ + +
+
+
+ {#media_dlg.general} + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + +
 
+
+ + + + + + +
x   
+
+
+ +
+ {#media_dlg.preview} + +
+
+ +
+
+ {#media_dlg.advanced} + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + +
 
+
+
+ +
+ {#media_dlg.flash_options} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + +
+ + + +
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + + + + + + + +
+
+ +
+ {#media_dlg.flv_options} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+
+ +
+ {#media_dlg.qt_options} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+  
+ + + + + +
 
+
+
+ +
+ {#media_dlg.wmp_options} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+
+ +
+ {#media_dlg.rmp_options} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+   +
+
+ +
+ {#media_dlg.shockwave_options} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + +
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+ + + + + +
+
+
+
+
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/nonbreaking/editor_plugin.js b/web/libs/tiny_mce/plugins/nonbreaking/editor_plugin.js new file mode 100644 index 0000000..eb40a6a --- /dev/null +++ b/web/libs/tiny_mce/plugins/nonbreaking/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.Nonbreaking",{init:function(a,b){var c=this;c.editor=a;a.addCommand("mceNonBreaking",function(){a.execCommand("mceInsertContent",false,(a.plugins.visualchars&&a.plugins.visualchars.state)?' ':" ")});a.addButton("nonbreaking",{title:"nonbreaking.nonbreaking_desc",cmd:"mceNonBreaking"});if(a.getParam("nonbreaking_force_tab")){a.onKeyDown.add(function(d,f){if(tinymce.isIE&&f.keyCode==9){d.execCommand("mceNonBreaking");d.execCommand("mceNonBreaking");d.execCommand("mceNonBreaking");tinymce.dom.Event.cancel(f)}})}},getInfo:function(){return{longname:"Nonbreaking space",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/nonbreaking",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("nonbreaking",tinymce.plugins.Nonbreaking)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/nonbreaking/editor_plugin_src.js b/web/libs/tiny_mce/plugins/nonbreaking/editor_plugin_src.js new file mode 100644 index 0000000..ca83ee2 --- /dev/null +++ b/web/libs/tiny_mce/plugins/nonbreaking/editor_plugin_src.js @@ -0,0 +1,53 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.Nonbreaking', { + init : function(ed, url) { + var t = this; + + t.editor = ed; + + // Register commands + ed.addCommand('mceNonBreaking', function() { + ed.execCommand('mceInsertContent', false, (ed.plugins.visualchars && ed.plugins.visualchars.state) ? ' ' : ' '); + }); + + // Register buttons + ed.addButton('nonbreaking', {title : 'nonbreaking.nonbreaking_desc', cmd : 'mceNonBreaking'}); + + if (ed.getParam('nonbreaking_force_tab')) { + ed.onKeyDown.add(function(ed, e) { + if (tinymce.isIE && e.keyCode == 9) { + ed.execCommand('mceNonBreaking'); + ed.execCommand('mceNonBreaking'); + ed.execCommand('mceNonBreaking'); + tinymce.dom.Event.cancel(e); + } + }); + } + }, + + getInfo : function() { + return { + longname : 'Nonbreaking space', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/nonbreaking', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + + // Private methods + }); + + // Register plugin + tinymce.PluginManager.add('nonbreaking', tinymce.plugins.Nonbreaking); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/noneditable/editor_plugin.js b/web/libs/tiny_mce/plugins/noneditable/editor_plugin.js new file mode 100644 index 0000000..9945cd8 --- /dev/null +++ b/web/libs/tiny_mce/plugins/noneditable/editor_plugin.js @@ -0,0 +1 @@ +(function(){var a=tinymce.dom.Event;tinymce.create("tinymce.plugins.NonEditablePlugin",{init:function(d,e){var f=this,c,b;f.editor=d;c=d.getParam("noneditable_editable_class","mceEditable");b=d.getParam("noneditable_noneditable_class","mceNonEditable");d.onNodeChange.addToTop(function(h,g,k){var j,i;j=h.dom.getParent(h.selection.getStart(),function(l){return h.dom.hasClass(l,b)});i=h.dom.getParent(h.selection.getEnd(),function(l){return h.dom.hasClass(l,b)});if(j||i){f._setDisabled(1);return false}else{f._setDisabled(0)}})},getInfo:function(){return{longname:"Non editable elements",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/noneditable",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_block:function(c,d){var b=d.keyCode;if((b>32&&b<41)||(b>111&&b<124)){return}return a.cancel(d)},_setDisabled:function(d){var c=this,b=c.editor;tinymce.each(b.controlManager.controls,function(e){e.setDisabled(d)});if(d!==c.disabled){if(d){b.onKeyDown.addToTop(c._block);b.onKeyPress.addToTop(c._block);b.onKeyUp.addToTop(c._block);b.onPaste.addToTop(c._block)}else{b.onKeyDown.remove(c._block);b.onKeyPress.remove(c._block);b.onKeyUp.remove(c._block);b.onPaste.remove(c._block)}c.disabled=d}}});tinymce.PluginManager.add("noneditable",tinymce.plugins.NonEditablePlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/noneditable/editor_plugin_src.js b/web/libs/tiny_mce/plugins/noneditable/editor_plugin_src.js new file mode 100644 index 0000000..656c971 --- /dev/null +++ b/web/libs/tiny_mce/plugins/noneditable/editor_plugin_src.js @@ -0,0 +1,90 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + var Event = tinymce.dom.Event; + + tinymce.create('tinymce.plugins.NonEditablePlugin', { + init : function(ed, url) { + var t = this, editClass, nonEditClass; + + t.editor = ed; + editClass = ed.getParam("noneditable_editable_class", "mceEditable"); + nonEditClass = ed.getParam("noneditable_noneditable_class", "mceNonEditable"); + + ed.onNodeChange.addToTop(function(ed, cm, n) { + var sc, ec; + + // Block if start or end is inside a non editable element + sc = ed.dom.getParent(ed.selection.getStart(), function(n) { + return ed.dom.hasClass(n, nonEditClass); + }); + + ec = ed.dom.getParent(ed.selection.getEnd(), function(n) { + return ed.dom.hasClass(n, nonEditClass); + }); + + // Block or unblock + if (sc || ec) { + t._setDisabled(1); + return false; + } else + t._setDisabled(0); + }); + }, + + getInfo : function() { + return { + longname : 'Non editable elements', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/noneditable', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + _block : function(ed, e) { + var k = e.keyCode; + + // Don't block arrow keys, pg up/down, and F1-F12 + if ((k > 32 && k < 41) || (k > 111 && k < 124)) + return; + + return Event.cancel(e); + }, + + _setDisabled : function(s) { + var t = this, ed = t.editor; + + tinymce.each(ed.controlManager.controls, function(c) { + c.setDisabled(s); + }); + + if (s !== t.disabled) { + if (s) { + ed.onKeyDown.addToTop(t._block); + ed.onKeyPress.addToTop(t._block); + ed.onKeyUp.addToTop(t._block); + ed.onPaste.addToTop(t._block); + } else { + ed.onKeyDown.remove(t._block); + ed.onKeyPress.remove(t._block); + ed.onKeyUp.remove(t._block); + ed.onPaste.remove(t._block); + } + + t.disabled = s; + } + } + }); + + // Register plugin + tinymce.PluginManager.add('noneditable', tinymce.plugins.NonEditablePlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/pagebreak/css/content.css b/web/libs/tiny_mce/plugins/pagebreak/css/content.css new file mode 100644 index 0000000..c949d58 --- /dev/null +++ b/web/libs/tiny_mce/plugins/pagebreak/css/content.css @@ -0,0 +1 @@ +.mcePageBreak {display:block;border:0;width:100%;height:12px;border-top:1px dotted #ccc;margin-top:15px;background:#fff url(../img/pagebreak.gif) no-repeat center top;} diff --git a/web/libs/tiny_mce/plugins/pagebreak/editor_plugin.js b/web/libs/tiny_mce/plugins/pagebreak/editor_plugin.js new file mode 100644 index 0000000..a212f69 --- /dev/null +++ b/web/libs/tiny_mce/plugins/pagebreak/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.PageBreakPlugin",{init:function(b,d){var f='',a="mcePageBreak",c=b.getParam("pagebreak_separator",""),e;e=new RegExp(c.replace(/[\?\.\*\[\]\(\)\{\}\+\^\$\:]/g,function(g){return"\\"+g}),"g");b.addCommand("mcePageBreak",function(){b.execCommand("mceInsertContent",0,f)});b.addButton("pagebreak",{title:"pagebreak.desc",cmd:a});b.onInit.add(function(){if(b.settings.content_css!==false){b.dom.loadCSS(d+"/css/content.css")}if(b.theme.onResolveName){b.theme.onResolveName.add(function(g,h){if(h.node.nodeName=="IMG"&&b.dom.hasClass(h.node,a)){h.name="pagebreak"}})}});b.onClick.add(function(g,h){h=h.target;if(h.nodeName==="IMG"&&g.dom.hasClass(h,a)){g.selection.select(h)}});b.onNodeChange.add(function(h,g,i){g.setActive("pagebreak",i.nodeName==="IMG"&&h.dom.hasClass(i,a))});b.onBeforeSetContent.add(function(g,h){h.content=h.content.replace(e,f)});b.onPostProcess.add(function(g,h){if(h.get){h.content=h.content.replace(/]+>/g,function(i){if(i.indexOf('class="mcePageBreak')!==-1){i=c}return i})}})},getInfo:function(){return{longname:"PageBreak",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/pagebreak",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("pagebreak",tinymce.plugins.PageBreakPlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/pagebreak/editor_plugin_src.js b/web/libs/tiny_mce/plugins/pagebreak/editor_plugin_src.js new file mode 100644 index 0000000..4e1eb0a --- /dev/null +++ b/web/libs/tiny_mce/plugins/pagebreak/editor_plugin_src.js @@ -0,0 +1,77 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.PageBreakPlugin', { + init : function(ed, url) { + var pb = '', cls = 'mcePageBreak', sep = ed.getParam('pagebreak_separator', ''), pbRE; + + pbRE = new RegExp(sep.replace(/[\?\.\*\[\]\(\)\{\}\+\^\$\:]/g, function(a) {return '\\' + a;}), 'g'); + + // Register commands + ed.addCommand('mcePageBreak', function() { + ed.execCommand('mceInsertContent', 0, pb); + }); + + // Register buttons + ed.addButton('pagebreak', {title : 'pagebreak.desc', cmd : cls}); + + ed.onInit.add(function() { + if (ed.settings.content_css !== false) + ed.dom.loadCSS(url + "/css/content.css"); + + if (ed.theme.onResolveName) { + ed.theme.onResolveName.add(function(th, o) { + if (o.node.nodeName == 'IMG' && ed.dom.hasClass(o.node, cls)) + o.name = 'pagebreak'; + }); + } + }); + + ed.onClick.add(function(ed, e) { + e = e.target; + + if (e.nodeName === 'IMG' && ed.dom.hasClass(e, cls)) + ed.selection.select(e); + }); + + ed.onNodeChange.add(function(ed, cm, n) { + cm.setActive('pagebreak', n.nodeName === 'IMG' && ed.dom.hasClass(n, cls)); + }); + + ed.onBeforeSetContent.add(function(ed, o) { + o.content = o.content.replace(pbRE, pb); + }); + + ed.onPostProcess.add(function(ed, o) { + if (o.get) + o.content = o.content.replace(/]+>/g, function(im) { + if (im.indexOf('class="mcePageBreak') !== -1) + im = sep; + + return im; + }); + }); + }, + + getInfo : function() { + return { + longname : 'PageBreak', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/pagebreak', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('pagebreak', tinymce.plugins.PageBreakPlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/pagebreak/img/pagebreak.gif b/web/libs/tiny_mce/plugins/pagebreak/img/pagebreak.gif new file mode 100644 index 0000000..acdf408 Binary files /dev/null and b/web/libs/tiny_mce/plugins/pagebreak/img/pagebreak.gif differ diff --git a/web/libs/tiny_mce/plugins/pagebreak/img/trans.gif b/web/libs/tiny_mce/plugins/pagebreak/img/trans.gif new file mode 100644 index 0000000..3884865 Binary files /dev/null and b/web/libs/tiny_mce/plugins/pagebreak/img/trans.gif differ diff --git a/web/libs/tiny_mce/plugins/paste/editor_plugin.js b/web/libs/tiny_mce/plugins/paste/editor_plugin.js new file mode 100644 index 0000000..3785ab2 --- /dev/null +++ b/web/libs/tiny_mce/plugins/paste/editor_plugin.js @@ -0,0 +1 @@ +(function(){var c=tinymce.each,d=null,a={paste_auto_cleanup_on_paste:true,paste_block_drop:false,paste_retain_style_properties:"none",paste_strip_class_attributes:"mso",paste_remove_spans:false,paste_remove_styles:false,paste_remove_styles_if_webkit:true,paste_convert_middot_lists:true,paste_convert_headers_to_strong:false,paste_dialog_width:"450",paste_dialog_height:"400",paste_text_use_dialog:false,paste_text_sticky:false,paste_text_notifyalways:false,paste_text_linebreaktype:"p",paste_text_replacements:[[/\u2026/g,"..."],[/[\x93\x94\u201c\u201d]/g,'"'],[/[\x60\x91\x92\u2018\u2019]/g,"'"]]};function b(e,f){return e.getParam(f,a[f])}tinymce.create("tinymce.plugins.PastePlugin",{init:function(e,f){var g=this;g.editor=e;g.url=f;g.onPreProcess=new tinymce.util.Dispatcher(g);g.onPostProcess=new tinymce.util.Dispatcher(g);g.onPreProcess.add(g._preProcess);g.onPostProcess.add(g._postProcess);g.onPreProcess.add(function(j,k){e.execCallback("paste_preprocess",j,k)});g.onPostProcess.add(function(j,k){e.execCallback("paste_postprocess",j,k)});e.pasteAsPlainText=false;function i(l,j){var k=e.dom;g.onPreProcess.dispatch(g,l);l.node=k.create("div",0,l.content);g.onPostProcess.dispatch(g,l);l.content=e.serializer.serialize(l.node,{getInner:1});if((!j)&&(e.pasteAsPlainText)){g._insertPlainText(e,k,l.content);if(!b(e,"paste_text_sticky")){e.pasteAsPlainText=false;e.controlManager.setActive("pastetext",false)}}else{if(/<(p|h[1-6]|ul|ol)/.test(l.content)){g._insertBlockContent(e,k,l.content)}else{g._insert(l.content)}}}e.addCommand("mceInsertClipboardContent",function(j,k){i(k,true)});if(!b(e,"paste_text_use_dialog")){e.addCommand("mcePasteText",function(k,j){var l=tinymce.util.Cookie;e.pasteAsPlainText=!e.pasteAsPlainText;e.controlManager.setActive("pastetext",e.pasteAsPlainText);if((e.pasteAsPlainText)&&(!l.get("tinymcePasteText"))){if(b(e,"paste_text_sticky")){e.windowManager.alert(e.translate("paste.plaintext_mode_sticky"))}else{e.windowManager.alert(e.translate("paste.plaintext_mode_sticky"))}if(!b(e,"paste_text_notifyalways")){l.set("tinymcePasteText","1",new Date(new Date().getFullYear()+1,12,31))}}})}e.addButton("pastetext",{title:"paste.paste_text_desc",cmd:"mcePasteText"});e.addButton("selectall",{title:"paste.selectall_desc",cmd:"selectall"});function h(s){var m,q,k,l=e.selection,p=e.dom,r=e.getBody(),j;if(e.pasteAsPlainText&&(s.clipboardData||p.doc.dataTransfer)){s.preventDefault();i({content:(s.clipboardData||p.doc.dataTransfer).getData("Text")},true);return}if(p.get("_mcePaste")){return}m=p.add(r,"div",{id:"_mcePaste","class":"mcePaste"},'\uFEFF
');if(r!=e.getDoc().body){j=p.getPos(e.selection.getStart(),r).y}else{j=r.scrollTop}p.setStyles(m,{position:"absolute",left:-10000,top:j,width:1,height:1,overflow:"hidden"});if(tinymce.isIE){k=p.doc.body.createTextRange();k.moveToElementText(m);k.execCommand("Paste");p.remove(m);if(m.innerHTML==="\uFEFF"){e.execCommand("mcePasteWord");s.preventDefault();return}i({content:m.innerHTML});return tinymce.dom.Event.cancel(s)}else{function o(n){n.preventDefault()}p.bind(e.getDoc(),"mousedown",o);p.bind(e.getDoc(),"keydown",o);q=e.selection.getRng();m=m.firstChild;k=e.getDoc().createRange();k.setStart(m,0);k.setEnd(m,1);l.setRng(k);window.setTimeout(function(){var t="",n=p.select("div.mcePaste");c(n,function(v){var u=v.firstChild;if(u&&u.nodeName=="DIV"&&u.style.marginTop&&u.style.backgroundColor){p.remove(u,1)}c(p.select("div.mcePaste",v),function(w){p.remove(w,1)});c(p.select("span.Apple-style-span",v),function(w){p.remove(w,1)});c(p.select("br[_mce_bogus]",v),function(w){p.remove(w)});t+=v.innerHTML});c(n,function(u){p.remove(u)});if(q){l.setRng(q)}i({content:t});p.unbind(e.getDoc(),"mousedown",o);p.unbind(e.getDoc(),"keydown",o)},0)}}if(b(e,"paste_auto_cleanup_on_paste")){if(tinymce.isOpera||/Firefox\/2/.test(navigator.userAgent)){e.onKeyDown.add(function(j,k){if(((tinymce.isMac?k.metaKey:k.ctrlKey)&&k.keyCode==86)||(k.shiftKey&&k.keyCode==45)){h(k)}})}else{e.onPaste.addToTop(function(j,k){return h(k)})}}if(b(e,"paste_block_drop")){e.onInit.add(function(){e.dom.bind(e.getBody(),["dragend","dragover","draggesture","dragdrop","drop","drag"],function(j){j.preventDefault();j.stopPropagation();return false})})}g._legacySupport()},getInfo:function(){return{longname:"Paste text/word",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/paste",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_preProcess:function(i,f){var l=this.editor,k=f.content,q=tinymce.grep,p=tinymce.explode,g=tinymce.trim,m,j;function e(h){c(h,function(o){if(o.constructor==RegExp){k=k.replace(o,"")}else{k=k.replace(o[0],o[1])}})}if(/class="?Mso|style="[^"]*\bmso-|w:WordDocument/i.test(k)||f.wordContent){f.wordContent=true;e([/^\s*( )+/gi,/( |]*>)+\s*$/gi]);if(b(l,"paste_convert_headers_to_strong")){k=k.replace(/

]*class="?MsoHeading"?[^>]*>(.*?)<\/p>/gi,"

$1

")}if(b(l,"paste_convert_middot_lists")){e([[//gi,"$&__MCE_ITEM__"],[/(]+(?:mso-list:|:\s*symbol)[^>]+>)/gi,"$1__MCE_ITEM__"]])}e([//gi,/<(!|script[^>]*>.*?<\/script(?=[>\s])|\/?(\?xml(:\w+)?|img|meta|link|style|\w:\w+)(?=[\s\/>]))[^>]*>/gi,[/<(\/?)s>/gi,"<$1strike>"],[/ /gi,"\u00a0"]]);do{m=k.length;k=k.replace(/(<[a-z][^>]*\s)(?:id|name|language|type|on\w+|\w+:\w+)=(?:"[^"]*"|\w+)\s?/gi,"$1")}while(m!=k.length);if(b(l,"paste_retain_style_properties").replace(/^none$/i,"").length==0){k=k.replace(/<\/?span[^>]*>/gi,"")}else{e([[/([\s\u00a0]*)<\/span>/gi,function(o,h){return(h.length>0)?h.replace(/./," ").slice(Math.floor(h.length/2)).split("").join("\u00a0"):""}],[/(<[a-z][^>]*)\sstyle="([^"]*)"/gi,function(u,h,t){var v=[],o=0,r=p(g(t).replace(/"/gi,"'"),";");c(r,function(s){var w,y,z=p(s,":");function x(A){return A+((A!=="0")&&(/\d$/.test(A)))?"px":""}if(z.length==2){w=z[0].toLowerCase();y=z[1].toLowerCase();switch(w){case"mso-padding-alt":case"mso-padding-top-alt":case"mso-padding-right-alt":case"mso-padding-bottom-alt":case"mso-padding-left-alt":case"mso-margin-alt":case"mso-margin-top-alt":case"mso-margin-right-alt":case"mso-margin-bottom-alt":case"mso-margin-left-alt":case"mso-table-layout-alt":case"mso-height":case"mso-width":case"mso-vertical-align-alt":v[o++]=w.replace(/^mso-|-alt$/g,"")+":"+x(y);return;case"horiz-align":v[o++]="text-align:"+y;return;case"vert-align":v[o++]="vertical-align:"+y;return;case"font-color":case"mso-foreground":v[o++]="color:"+y;return;case"mso-background":case"mso-highlight":v[o++]="background:"+y;return;case"mso-default-height":v[o++]="min-height:"+x(y);return;case"mso-default-width":v[o++]="min-width:"+x(y);return;case"mso-padding-between-alt":v[o++]="border-collapse:separate;border-spacing:"+x(y);return;case"text-line-through":if((y=="single")||(y=="double")){v[o++]="text-decoration:line-through"}return;case"mso-zero-height":if(y=="yes"){v[o++]="display:none"}return}if(/^(mso|column|font-emph|lang|layout|line-break|list-image|nav|panose|punct|row|ruby|sep|size|src|tab-|table-border|text-(?!align|decor|indent|trans)|top-bar|version|vnd|word-break)/.test(w)){return}v[o++]=w+":"+z[1]}});if(o>0){return h+' style="'+v.join(";")+'"'}else{return h}}]])}}if(b(l,"paste_convert_headers_to_strong")){e([[/]*>/gi,"

"],[/<\/h[1-6][^>]*>/gi,"

"]])}j=b(l,"paste_strip_class_attributes");if(j!=="none"){function n(r,o){if(j==="all"){return""}var h=q(p(o.replace(/^(["'])(.*)\1$/,"$2")," "),function(s){return(/^(?!mso)/i.test(s))});return h.length?' class="'+h.join(" ")+'"':""}k=k.replace(/ class="([^"]+)"/gi,n);k=k.replace(/ class=(\w+)/gi,n)}if(b(l,"paste_remove_spans")){k=k.replace(/<\/?span[^>]*>/gi,"")}f.content=k},_postProcess:function(h,j){var g=this,f=g.editor,i=f.dom,e;if(j.wordContent){c(i.select("a",j.node),function(k){if(!k.href||k.href.indexOf("#_Toc")!=-1){i.remove(k,1)}});if(b(f,"paste_convert_middot_lists")){g._convertLists(h,j)}e=b(f,"paste_retain_style_properties");if((tinymce.is(e,"string"))&&(e!=="all")&&(e!=="*")){e=tinymce.explode(e.replace(/^none$/i,""));c(i.select("*",j.node),function(n){var o={},l=0,m,p,k;if(e){for(m=0;m0){i.setStyles(n,o)}else{if(n.nodeName=="SPAN"&&!n.className){i.remove(n,true)}}})}}if(b(f,"paste_remove_styles")||(b(f,"paste_remove_styles_if_webkit")&&tinymce.isWebKit)){c(i.select("*[style]",j.node),function(k){k.removeAttribute("style");k.removeAttribute("_mce_style")})}else{if(tinymce.isWebKit){c(i.select("*",j.node),function(k){k.removeAttribute("_mce_style")})}}},_convertLists:function(h,f){var j=h.editor.dom,i,m,e=-1,g,n=[],l,k;c(j.select("p",f.node),function(u){var r,v="",t,s,o,q;for(r=u.firstChild;r&&r.nodeType==3;r=r.nextSibling){v+=r.nodeValue}v=u.innerHTML.replace(/<\/?\w+[^>]*>/gi,"").replace(/ /g,"\u00a0");if(/^(__MCE_ITEM__)+[\u2022\u00b7\u00a7\u00d8o]\s*\u00a0*/.test(v)){t="ul"}if(/^__MCE_ITEM__\s*\w+\.\s*\u00a0{2,}/.test(v)){t="ol"}if(t){g=parseFloat(u.style.marginLeft||0);if(g>e){n.push(g)}if(!i||t!=l){i=j.create(t);j.insertAfter(i,u)}else{if(g>e){i=m.appendChild(j.create(t))}else{if(g]*>/gi,"");if(t=="ul"&&/^[\u2022\u00b7\u00a7\u00d8o]/.test(p)){j.remove(w)}else{if(/^[\s\S]*\w+\.( |\u00a0)*\s*/.test(p)){j.remove(w)}}});s=u.innerHTML;if(t=="ul"){s=u.innerHTML.replace(/__MCE_ITEM__/g,"").replace(/^[\u2022\u00b7\u00a7\u00d8o]\s*( |\u00a0)+\s*/,"")}else{s=u.innerHTML.replace(/__MCE_ITEM__/g,"").replace(/^\s*\w+\.( |\u00a0)+\s*/,"")}m=i.appendChild(j.create("li",0,s));j.remove(u);e=g;l=t}else{i=e=0}});k=f.node.innerHTML;if(k.indexOf("__MCE_ITEM__")!=-1){f.node.innerHTML=k.replace(/__MCE_ITEM__/g,"")}},_insertBlockContent:function(l,h,m){var f,j,g=l.selection,q,n,e,o,i,k="mce_marker";function p(t){var s;if(tinymce.isIE){s=l.getDoc().body.createTextRange();s.moveToElementText(t);s.collapse(false);s.select()}else{g.select(t,1);g.collapse(false)}}this._insert('',1);j=h.get(k);f=h.getParent(j,"p,h1,h2,h3,h4,h5,h6,ul,ol,th,td");if(f&&!/TD|TH/.test(f.nodeName)){j=h.split(f,j);c(h.create("div",0,m).childNodes,function(r){q=j.parentNode.insertBefore(r.cloneNode(true),j)});p(q)}else{h.setOuterHTML(j,m);g.select(l.getBody(),1);g.collapse(0)}while(n=h.get(k)){h.remove(n)}n=g.getStart();e=h.getViewPort(l.getWin());o=l.dom.getPos(n).y;i=n.clientHeight;if(oe.y+e.h){l.getDoc().body.scrollTop=o0)){if(!d){d=("34,quot,38,amp,39,apos,60,lt,62,gt,"+j.serializer.settings.entities).split(",")}if(/<(?:p|br|h[1-6]|ul|ol|dl|table|t[rdh]|div|blockquote|fieldset|pre|address|center)[^>]*>/i.test(v)){q([/[\n\r]+/g])}else{q([/\r+/g])}q([[/<\/(?:p|h[1-6]|ul|ol|dl|table|div|blockquote|fieldset|pre|address|center)>/gi,"\n\n"],[/]*>|<\/tr>/gi,"\n"],[/<\/t[dh]>\s*]*>/gi,"\t"],/<[a-z!\/?][^>]*>/gi,[/ /gi," "],[/&(#\d+|[a-z0-9]{1,10});/gi,function(i,h){if(h.charAt(0)==="#"){return String.fromCharCode(h.slice(1))}else{return((i=y(d,h))>0)?String.fromCharCode(d[i-1]):" "}}],[/(?:(?!\n)\s)*(\n+)(?:(?!\n)\s)*/gi,"$1"],[/\n{3,}/g,"\n\n"],/^\s+|\s+$/g]);v=x.encode(v);if(!s.isCollapsed()){z.execCommand("Delete",false,null)}if(m(o,"array")||(m(o,"array"))){q(o)}else{if(m(o,"string")){q(new RegExp(o,"gi"))}}if(g=="none"){q([[/\n+/g," "]])}else{if(g=="br"){q([[/\n/g,"
"]])}else{q([/^\s+|\s+$/g,[/\n\n/g,"

"],[/\n/g,"
"]])}}if((l=v.indexOf("

"))!=-1){k=v.lastIndexOf("

");r=s.getNode();e=[];do{if(r.nodeType==1){if(r.nodeName=="TD"||r.nodeName=="BODY"){break}e[e.length]=r}}while(r=r.parentNode);if(e.length>0){p=v.substring(0,l);f="";for(t=0,u=e.length;t";f+="<"+e[e.length-t-1].nodeName.toLowerCase()+">"}if(l==k){v=p+f+v.substring(l+7)}else{v=p+v.substring(l+4,k+4)+f+v.substring(k+7)}}}j.execCommand("mceInsertRawHTML",false,v+' ');window.setTimeout(function(){var h=x.get("_plain_text_marker"),B,i,A,w;s.select(h,false);z.execCommand("Delete",false,null);h=null;B=s.getStart();i=x.getViewPort(n);A=x.getPos(B).y;w=B.clientHeight;if((Ai.y+i.h)){z.body.scrollTop=A

]*class="?MsoHeading"?[^>]*>(.*?)<\/p>/gi, "

$1

"); + } + + if (getParam(ed, "paste_convert_middot_lists")) { + process([ + [//gi, '$&__MCE_ITEM__'], // Convert supportLists to a list item marker + [/(]+(?:mso-list:|:\s*symbol)[^>]+>)/gi, '$1__MCE_ITEM__'] // Convert mso-list and symbol spans to item markers + ]); + } + + process([ + // Word comments like conditional comments etc + //gi, + + // Remove comments, scripts (e.g., msoShowComment), XML tag, VML content, MS Office namespaced tags, and a few other tags + /<(!|script[^>]*>.*?<\/script(?=[>\s])|\/?(\?xml(:\w+)?|img|meta|link|style|\w:\w+)(?=[\s\/>]))[^>]*>/gi, + + // Convert into for line-though + [/<(\/?)s>/gi, "<$1strike>"], + + // Replace nsbp entites to char since it's easier to handle + [/ /gi, "\u00a0"] + ]); + + // Remove bad attributes, with or without quotes, ensuring that attribute text is really inside a tag. + // If JavaScript had a RegExp look-behind, we could have integrated this with the last process() array and got rid of the loop. But alas, it does not, so we cannot. + do { + len = h.length; + h = h.replace(/(<[a-z][^>]*\s)(?:id|name|language|type|on\w+|\w+:\w+)=(?:"[^"]*"|\w+)\s?/gi, "$1"); + } while (len != h.length); + + // Remove all spans if no styles is to be retained + if (getParam(ed, "paste_retain_style_properties").replace(/^none$/i, "").length == 0) { + h = h.replace(/<\/?span[^>]*>/gi, ""); + } else { + // We're keeping styles, so at least clean them up. + // CSS Reference: http://msdn.microsoft.com/en-us/library/aa155477.aspx + + process([ + // Convert ___ to string of alternating breaking/non-breaking spaces of same length + [/([\s\u00a0]*)<\/span>/gi, + function(str, spaces) { + return (spaces.length > 0)? spaces.replace(/./, " ").slice(Math.floor(spaces.length/2)).split("").join("\u00a0") : ""; + } + ], + + // Examine all styles: delete junk, transform some, and keep the rest + [/(<[a-z][^>]*)\sstyle="([^"]*)"/gi, + function(str, tag, style) { + var n = [], + i = 0, + s = explode(trim(style).replace(/"/gi, "'"), ";"); + + // Examine each style definition within the tag's style attribute + each(s, function(v) { + var name, value, + parts = explode(v, ":"); + + function ensureUnits(v) { + return v + ((v !== "0") && (/\d$/.test(v)))? "px" : ""; + } + + if (parts.length == 2) { + name = parts[0].toLowerCase(); + value = parts[1].toLowerCase(); + + // Translate certain MS Office styles into their CSS equivalents + switch (name) { + case "mso-padding-alt": + case "mso-padding-top-alt": + case "mso-padding-right-alt": + case "mso-padding-bottom-alt": + case "mso-padding-left-alt": + case "mso-margin-alt": + case "mso-margin-top-alt": + case "mso-margin-right-alt": + case "mso-margin-bottom-alt": + case "mso-margin-left-alt": + case "mso-table-layout-alt": + case "mso-height": + case "mso-width": + case "mso-vertical-align-alt": + n[i++] = name.replace(/^mso-|-alt$/g, "") + ":" + ensureUnits(value); + return; + + case "horiz-align": + n[i++] = "text-align:" + value; + return; + + case "vert-align": + n[i++] = "vertical-align:" + value; + return; + + case "font-color": + case "mso-foreground": + n[i++] = "color:" + value; + return; + + case "mso-background": + case "mso-highlight": + n[i++] = "background:" + value; + return; + + case "mso-default-height": + n[i++] = "min-height:" + ensureUnits(value); + return; + + case "mso-default-width": + n[i++] = "min-width:" + ensureUnits(value); + return; + + case "mso-padding-between-alt": + n[i++] = "border-collapse:separate;border-spacing:" + ensureUnits(value); + return; + + case "text-line-through": + if ((value == "single") || (value == "double")) { + n[i++] = "text-decoration:line-through"; + } + return; + + case "mso-zero-height": + if (value == "yes") { + n[i++] = "display:none"; + } + return; + } + + // Eliminate all MS Office style definitions that have no CSS equivalent by examining the first characters in the name + if (/^(mso|column|font-emph|lang|layout|line-break|list-image|nav|panose|punct|row|ruby|sep|size|src|tab-|table-border|text-(?!align|decor|indent|trans)|top-bar|version|vnd|word-break)/.test(name)) { + return; + } + + // If it reached this point, it must be a valid CSS style + n[i++] = name + ":" + parts[1]; // Lower-case name, but keep value case + } + }); + + // If style attribute contained any valid styles the re-write it; otherwise delete style attribute. + if (i > 0) { + return tag + ' style="' + n.join(';') + '"'; + } else { + return tag; + } + } + ] + ]); + } + } + + // Replace headers with + if (getParam(ed, "paste_convert_headers_to_strong")) { + process([ + [/]*>/gi, "

"], + [/<\/h[1-6][^>]*>/gi, "

"] + ]); + } + + // Class attribute options are: leave all as-is ("none"), remove all ("all"), or remove only those starting with mso ("mso"). + // Note:- paste_strip_class_attributes: "none", verify_css_classes: true is also a good variation. + stripClass = getParam(ed, "paste_strip_class_attributes"); + + if (stripClass !== "none") { + function removeClasses(match, g1) { + if (stripClass === "all") + return ''; + + var cls = grep(explode(g1.replace(/^(["'])(.*)\1$/, "$2"), " "), + function(v) { + return (/^(?!mso)/i.test(v)); + } + ); + + return cls.length ? ' class="' + cls.join(" ") + '"' : ''; + }; + + h = h.replace(/ class="([^"]+)"/gi, removeClasses); + h = h.replace(/ class=(\w+)/gi, removeClasses); + } + + // Remove spans option + if (getParam(ed, "paste_remove_spans")) { + h = h.replace(/<\/?span[^>]*>/gi, ""); + } + + //console.log('After preprocess:' + h); + + o.content = h; + }, + + /** + * Various post process items. + */ + _postProcess : function(pl, o) { + var t = this, ed = t.editor, dom = ed.dom, styleProps; + + if (o.wordContent) { + // Remove named anchors or TOC links + each(dom.select('a', o.node), function(a) { + if (!a.href || a.href.indexOf('#_Toc') != -1) + dom.remove(a, 1); + }); + + if (getParam(ed, "paste_convert_middot_lists")) { + t._convertLists(pl, o); + } + + // Process styles + styleProps = getParam(ed, "paste_retain_style_properties"); // retained properties + + // Process only if a string was specified and not equal to "all" or "*" + if ((tinymce.is(styleProps, "string")) && (styleProps !== "all") && (styleProps !== "*")) { + styleProps = tinymce.explode(styleProps.replace(/^none$/i, "")); + + // Retains some style properties + each(dom.select('*', o.node), function(el) { + var newStyle = {}, npc = 0, i, sp, sv; + + // Store a subset of the existing styles + if (styleProps) { + for (i = 0; i < styleProps.length; i++) { + sp = styleProps[i]; + sv = dom.getStyle(el, sp); + + if (sv) { + newStyle[sp] = sv; + npc++; + } + } + } + + // Remove all of the existing styles + dom.setAttrib(el, 'style', ''); + + if (styleProps && npc > 0) + dom.setStyles(el, newStyle); // Add back the stored subset of styles + else // Remove empty span tags that do not have class attributes + if (el.nodeName == 'SPAN' && !el.className) + dom.remove(el, true); + }); + } + } + + // Remove all style information or only specifically on WebKit to avoid the style bug on that browser + if (getParam(ed, "paste_remove_styles") || (getParam(ed, "paste_remove_styles_if_webkit") && tinymce.isWebKit)) { + each(dom.select('*[style]', o.node), function(el) { + el.removeAttribute('style'); + el.removeAttribute('_mce_style'); + }); + } else { + if (tinymce.isWebKit) { + // We need to compress the styles on WebKit since if you paste it will become + // Removing the mce_style that contains the real value will force the Serializer engine to compress the styles + each(dom.select('*', o.node), function(el) { + el.removeAttribute('_mce_style'); + }); + } + } + }, + + /** + * Converts the most common bullet and number formats in Office into a real semantic UL/LI list. + */ + _convertLists : function(pl, o) { + var dom = pl.editor.dom, listElm, li, lastMargin = -1, margin, levels = [], lastType, html; + + // Convert middot lists into real semantic lists + each(dom.select('p', o.node), function(p) { + var sib, val = '', type, html, idx, parents; + + // Get text node value at beginning of paragraph + for (sib = p.firstChild; sib && sib.nodeType == 3; sib = sib.nextSibling) + val += sib.nodeValue; + + val = p.innerHTML.replace(/<\/?\w+[^>]*>/gi, '').replace(/ /g, '\u00a0'); + + // Detect unordered lists look for bullets + if (/^(__MCE_ITEM__)+[\u2022\u00b7\u00a7\u00d8o]\s*\u00a0*/.test(val)) + type = 'ul'; + + // Detect ordered lists 1., a. or ixv. + if (/^__MCE_ITEM__\s*\w+\.\s*\u00a0{2,}/.test(val)) + type = 'ol'; + + // Check if node value matches the list pattern: o   + if (type) { + margin = parseFloat(p.style.marginLeft || 0); + + if (margin > lastMargin) + levels.push(margin); + + if (!listElm || type != lastType) { + listElm = dom.create(type); + dom.insertAfter(listElm, p); + } else { + // Nested list element + if (margin > lastMargin) { + listElm = li.appendChild(dom.create(type)); + } else if (margin < lastMargin) { + // Find parent level based on margin value + idx = tinymce.inArray(levels, margin); + parents = dom.getParents(listElm.parentNode, type); + listElm = parents[parents.length - 1 - idx] || listElm; + } + } + + // Remove middot or number spans if they exists + each(dom.select('span', p), function(span) { + var html = span.innerHTML.replace(/<\/?\w+[^>]*>/gi, ''); + + // Remove span with the middot or the number + if (type == 'ul' && /^[\u2022\u00b7\u00a7\u00d8o]/.test(html)) + dom.remove(span); + else if (/^[\s\S]*\w+\.( |\u00a0)*\s*/.test(html)) + dom.remove(span); + }); + + html = p.innerHTML; + + // Remove middot/list items + if (type == 'ul') + html = p.innerHTML.replace(/__MCE_ITEM__/g, '').replace(/^[\u2022\u00b7\u00a7\u00d8o]\s*( |\u00a0)+\s*/, ''); + else + html = p.innerHTML.replace(/__MCE_ITEM__/g, '').replace(/^\s*\w+\.( |\u00a0)+\s*/, ''); + + // Create li and add paragraph data into the new li + li = listElm.appendChild(dom.create('li', 0, html)); + dom.remove(p); + + lastMargin = margin; + lastType = type; + } else + listElm = lastMargin = 0; // End list element + }); + + // Remove any left over makers + html = o.node.innerHTML; + if (html.indexOf('__MCE_ITEM__') != -1) + o.node.innerHTML = html.replace(/__MCE_ITEM__/g, ''); + }, + + /** + * This method will split the current block parent and insert the contents inside the split position. + * This logic can be improved so text nodes at the start/end remain in the start/end block elements + */ + _insertBlockContent : function(ed, dom, content) { + var parentBlock, marker, sel = ed.selection, last, elm, vp, y, elmHeight, markerId = 'mce_marker'; + + function select(n) { + var r; + + if (tinymce.isIE) { + r = ed.getDoc().body.createTextRange(); + r.moveToElementText(n); + r.collapse(false); + r.select(); + } else { + sel.select(n, 1); + sel.collapse(false); + } + } + + // Insert a marker for the caret position + this._insert('', 1); + marker = dom.get(markerId); + parentBlock = dom.getParent(marker, 'p,h1,h2,h3,h4,h5,h6,ul,ol,th,td'); + + // If it's a parent block but not a table cell + if (parentBlock && !/TD|TH/.test(parentBlock.nodeName)) { + // Split parent block + marker = dom.split(parentBlock, marker); + + // Insert nodes before the marker + each(dom.create('div', 0, content).childNodes, function(n) { + last = marker.parentNode.insertBefore(n.cloneNode(true), marker); + }); + + // Move caret after marker + select(last); + } else { + dom.setOuterHTML(marker, content); + sel.select(ed.getBody(), 1); + sel.collapse(0); + } + + // Remove marker if it's left + while (elm = dom.get(markerId)) + dom.remove(elm); + + // Get element, position and height + elm = sel.getStart(); + vp = dom.getViewPort(ed.getWin()); + y = ed.dom.getPos(elm).y; + elmHeight = elm.clientHeight; + + // Is element within viewport if not then scroll it into view + if (y < vp.y || y + elmHeight > vp.y + vp.h) + ed.getDoc().body.scrollTop = y < vp.y ? y : y - vp.h + 25; + }, + + /** + * Inserts the specified contents at the caret position. + */ + _insert : function(h, skip_undo) { + var ed = this.editor, r = ed.selection.getRng(); + + // First delete the contents seems to work better on WebKit when the selection spans multiple list items or multiple table cells. + if (!ed.selection.isCollapsed() && r.startContainer != r.endContainer) + ed.getDoc().execCommand('Delete', false, null); + + // It's better to use the insertHTML method on Gecko since it will combine paragraphs correctly before inserting the contents + ed.execCommand(tinymce.isGecko ? 'insertHTML' : 'mceInsertContent', false, h, {skip_undo : skip_undo}); + }, + + /** + * Instead of the old plain text method which tried to re-create a paste operation, the + * new approach adds a plain text mode toggle switch that changes the behavior of paste. + * This function is passed the same input that the regular paste plugin produces. + * It performs additional scrubbing and produces (and inserts) the plain text. + * This approach leverages all of the great existing functionality in the paste + * plugin, and requires minimal changes to add the new functionality. + * Speednet - June 2009 + */ + _insertPlainText : function(ed, dom, h) { + var i, len, pos, rpos, node, breakElms, before, after, + w = ed.getWin(), + d = ed.getDoc(), + sel = ed.selection, + is = tinymce.is, + inArray = tinymce.inArray, + linebr = getParam(ed, "paste_text_linebreaktype"), + rl = getParam(ed, "paste_text_replacements"); + + function process(items) { + each(items, function(v) { + if (v.constructor == RegExp) + h = h.replace(v, ""); + else + h = h.replace(v[0], v[1]); + }); + }; + + if ((typeof(h) === "string") && (h.length > 0)) { + if (!entities) + entities = ("34,quot,38,amp,39,apos,60,lt,62,gt," + ed.serializer.settings.entities).split(","); + + // If HTML content with line-breaking tags, then remove all cr/lf chars because only tags will break a line + if (/<(?:p|br|h[1-6]|ul|ol|dl|table|t[rdh]|div|blockquote|fieldset|pre|address|center)[^>]*>/i.test(h)) { + process([ + /[\n\r]+/g + ]); + } else { + // Otherwise just get rid of carriage returns (only need linefeeds) + process([ + /\r+/g + ]); + } + + process([ + [/<\/(?:p|h[1-6]|ul|ol|dl|table|div|blockquote|fieldset|pre|address|center)>/gi, "\n\n"], // Block tags get a blank line after them + [/]*>|<\/tr>/gi, "\n"], // Single linebreak for
tags and table rows + [/<\/t[dh]>\s*]*>/gi, "\t"], // Table cells get tabs betweem them + /<[a-z!\/?][^>]*>/gi, // Delete all remaining tags + [/ /gi, " "], // Convert non-break spaces to regular spaces (remember, *plain text*) + [ + // HTML entity + /&(#\d+|[a-z0-9]{1,10});/gi, + + // Replace with actual character + function(e, s) { + if (s.charAt(0) === "#") { + return String.fromCharCode(s.slice(1)); + } + else { + return ((e = inArray(entities, s)) > 0)? String.fromCharCode(entities[e-1]) : " "; + } + } + ], + [/(?:(?!\n)\s)*(\n+)(?:(?!\n)\s)*/gi, "$1"], // Cool little RegExp deletes whitespace around linebreak chars. + [/\n{3,}/g, "\n\n"], // Max. 2 consecutive linebreaks + /^\s+|\s+$/g // Trim the front & back + ]); + + h = dom.encode(h); + + // Delete any highlighted text before pasting + if (!sel.isCollapsed()) { + d.execCommand("Delete", false, null); + } + + // Perform default or custom replacements + if (is(rl, "array") || (is(rl, "array"))) { + process(rl); + } + else if (is(rl, "string")) { + process(new RegExp(rl, "gi")); + } + + // Treat paragraphs as specified in the config + if (linebr == "none") { + process([ + [/\n+/g, " "] + ]); + } + else if (linebr == "br") { + process([ + [/\n/g, "
"] + ]); + } + else { + process([ + /^\s+|\s+$/g, + [/\n\n/g, "

"], + [/\n/g, "
"] + ]); + } + + // This next piece of code handles the situation where we're pasting more than one paragraph of plain + // text, and we are pasting the content into the middle of a block node in the editor. The block + // node gets split at the selection point into "Para A" and "Para B" (for the purposes of explaining). + // The first paragraph of the pasted text is appended to "Para A", and the last paragraph of the + // pasted text is prepended to "Para B". Any other paragraphs of pasted text are placed between + // "Para A" and "Para B". This code solves a host of problems with the original plain text plugin and + // now handles styles correctly. (Pasting plain text into a styled paragraph is supposed to make the + // plain text take the same style as the existing paragraph.) + if ((pos = h.indexOf("

")) != -1) { + rpos = h.lastIndexOf("

"); + node = sel.getNode(); + breakElms = []; // Get list of elements to break + + do { + if (node.nodeType == 1) { + // Don't break tables and break at body + if (node.nodeName == "TD" || node.nodeName == "BODY") { + break; + } + + breakElms[breakElms.length] = node; + } + } while (node = node.parentNode); + + // Are we in the middle of a block node? + if (breakElms.length > 0) { + before = h.substring(0, pos); + after = ""; + + for (i=0, len=breakElms.length; i"; + after += "<" + breakElms[breakElms.length-i-1].nodeName.toLowerCase() + ">"; + } + + if (pos == rpos) { + h = before + after + h.substring(pos+7); + } + else { + h = before + h.substring(pos+4, rpos+4) + after + h.substring(rpos+7); + } + } + } + + // Insert content at the caret, plus add a marker for repositioning the caret + ed.execCommand("mceInsertRawHTML", false, h + ' '); + + // Reposition the caret to the marker, which was placed immediately after the inserted content. + // Needs to be done asynchronously (in window.setTimeout) or else it doesn't work in all browsers. + // The second part of the code scrolls the content up if the caret is positioned off-screen. + // This is only necessary for WebKit browsers, but it doesn't hurt to use for all. + window.setTimeout(function() { + var marker = dom.get('_plain_text_marker'), + elm, vp, y, elmHeight; + + sel.select(marker, false); + d.execCommand("Delete", false, null); + marker = null; + + // Get element, position and height + elm = sel.getStart(); + vp = dom.getViewPort(w); + y = dom.getPos(elm).y; + elmHeight = elm.clientHeight; + + // Is element within viewport if not then scroll it into view + if ((y < vp.y) || (y + elmHeight > vp.y + vp.h)) { + d.body.scrollTop = y < vp.y ? y : y - vp.h + 25; + } + }, 0); + } + }, + + /** + * This method will open the old style paste dialogs. Some users might want the old behavior but still use the new cleanup engine. + */ + _legacySupport : function() { + var t = this, ed = t.editor; + + // Register command(s) for backwards compatibility + ed.addCommand("mcePasteWord", function() { + ed.windowManager.open({ + file: t.url + "/pasteword.htm", + width: parseInt(getParam(ed, "paste_dialog_width")), + height: parseInt(getParam(ed, "paste_dialog_height")), + inline: 1 + }); + }); + + if (getParam(ed, "paste_text_use_dialog")) { + ed.addCommand("mcePasteText", function() { + ed.windowManager.open({ + file : t.url + "/pastetext.htm", + width: parseInt(getParam(ed, "paste_dialog_width")), + height: parseInt(getParam(ed, "paste_dialog_height")), + inline : 1 + }); + }); + } + + // Register button for backwards compatibility + ed.addButton("pasteword", {title : "paste.paste_word_desc", cmd : "mcePasteWord"}); + } + }); + + // Register plugin + tinymce.PluginManager.add("paste", tinymce.plugins.PastePlugin); +})(); diff --git a/web/libs/tiny_mce/plugins/paste/js/pastetext.js b/web/libs/tiny_mce/plugins/paste/js/pastetext.js new file mode 100644 index 0000000..c524f9e --- /dev/null +++ b/web/libs/tiny_mce/plugins/paste/js/pastetext.js @@ -0,0 +1,36 @@ +tinyMCEPopup.requireLangPack(); + +var PasteTextDialog = { + init : function() { + this.resize(); + }, + + insert : function() { + var h = tinyMCEPopup.dom.encode(document.getElementById('content').value), lines; + + // Convert linebreaks into paragraphs + if (document.getElementById('linebreaks').checked) { + lines = h.split(/\r?\n/); + if (lines.length > 1) { + h = ''; + tinymce.each(lines, function(row) { + h += '

' + row + '

'; + }); + } + } + + tinyMCEPopup.editor.execCommand('mceInsertClipboardContent', false, {content : h}); + tinyMCEPopup.close(); + }, + + resize : function() { + var vp = tinyMCEPopup.dom.getViewPort(window), el; + + el = document.getElementById('content'); + + el.style.width = (vp.w - 20) + 'px'; + el.style.height = (vp.h - 90) + 'px'; + } +}; + +tinyMCEPopup.onInit.add(PasteTextDialog.init, PasteTextDialog); diff --git a/web/libs/tiny_mce/plugins/paste/js/pasteword.js b/web/libs/tiny_mce/plugins/paste/js/pasteword.js new file mode 100644 index 0000000..a52731c --- /dev/null +++ b/web/libs/tiny_mce/plugins/paste/js/pasteword.js @@ -0,0 +1,51 @@ +tinyMCEPopup.requireLangPack(); + +var PasteWordDialog = { + init : function() { + var ed = tinyMCEPopup.editor, el = document.getElementById('iframecontainer'), ifr, doc, css, cssHTML = ''; + + // Create iframe + el.innerHTML = ''; + ifr = document.getElementById('iframe'); + doc = ifr.contentWindow.document; + + // Force absolute CSS urls + css = [ed.baseURI.toAbsolute("themes/" + ed.settings.theme + "/skins/" + ed.settings.skin + "/content.css")]; + css = css.concat(tinymce.explode(ed.settings.content_css) || []); + tinymce.each(css, function(u) { + cssHTML += ''; + }); + + // Write content into iframe + doc.open(); + doc.write('' + cssHTML + ''); + doc.close(); + + doc.designMode = 'on'; + this.resize(); + + window.setTimeout(function() { + ifr.contentWindow.focus(); + }, 10); + }, + + insert : function() { + var h = document.getElementById('iframe').contentWindow.document.body.innerHTML; + + tinyMCEPopup.editor.execCommand('mceInsertClipboardContent', false, {content : h, wordContent : true}); + tinyMCEPopup.close(); + }, + + resize : function() { + var vp = tinyMCEPopup.dom.getViewPort(window), el; + + el = document.getElementById('iframe'); + + if (el) { + el.style.width = (vp.w - 20) + 'px'; + el.style.height = (vp.h - 90) + 'px'; + } + } +}; + +tinyMCEPopup.onInit.add(PasteWordDialog.init, PasteWordDialog); diff --git a/web/libs/tiny_mce/plugins/paste/langs/en_dlg.js b/web/libs/tiny_mce/plugins/paste/langs/en_dlg.js new file mode 100644 index 0000000..eeac778 --- /dev/null +++ b/web/libs/tiny_mce/plugins/paste/langs/en_dlg.js @@ -0,0 +1,5 @@ +tinyMCE.addI18n('en.paste_dlg',{ +text_title:"Use CTRL+V on your keyboard to paste the text into the window.", +text_linebreaks:"Keep linebreaks", +word_title:"Use CTRL+V on your keyboard to paste the text into the window." +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/paste/pastetext.htm b/web/libs/tiny_mce/plugins/paste/pastetext.htm new file mode 100644 index 0000000..b655945 --- /dev/null +++ b/web/libs/tiny_mce/plugins/paste/pastetext.htm @@ -0,0 +1,27 @@ + + + {#paste.paste_text_desc} + + + + +
+
{#paste.paste_text_desc}
+ +
+ +
+ +
+ +
{#paste_dlg.text_title}
+ + + +
+ + +
+
+ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/paste/pasteword.htm b/web/libs/tiny_mce/plugins/paste/pasteword.htm new file mode 100644 index 0000000..0f6bb41 --- /dev/null +++ b/web/libs/tiny_mce/plugins/paste/pasteword.htm @@ -0,0 +1,21 @@ + + + {#paste.paste_word_desc} + + + + +
+
{#paste.paste_word_desc}
+ +
{#paste_dlg.word_title}
+ +
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/preview/editor_plugin.js b/web/libs/tiny_mce/plugins/preview/editor_plugin.js new file mode 100644 index 0000000..507909c --- /dev/null +++ b/web/libs/tiny_mce/plugins/preview/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.Preview",{init:function(a,b){var d=this,c=tinymce.explode(a.settings.content_css);d.editor=a;tinymce.each(c,function(f,e){c[e]=a.documentBaseURI.toAbsolute(f)});a.addCommand("mcePreview",function(){a.windowManager.open({file:a.getParam("plugin_preview_pageurl",b+"/preview.html"),width:parseInt(a.getParam("plugin_preview_width","550")),height:parseInt(a.getParam("plugin_preview_height","600")),resizable:"yes",scrollbars:"yes",popup_css:c?c.join(","):a.baseURI.toAbsolute("themes/"+a.settings.theme+"/skins/"+a.settings.skin+"/content.css"),inline:a.getParam("plugin_preview_inline",1)},{base:a.documentBaseURI.getURI()})});a.addButton("preview",{title:"preview.preview_desc",cmd:"mcePreview"})},getInfo:function(){return{longname:"Preview",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/preview",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("preview",tinymce.plugins.Preview)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/preview/editor_plugin_src.js b/web/libs/tiny_mce/plugins/preview/editor_plugin_src.js new file mode 100644 index 0000000..80f00f0 --- /dev/null +++ b/web/libs/tiny_mce/plugins/preview/editor_plugin_src.js @@ -0,0 +1,53 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.Preview', { + init : function(ed, url) { + var t = this, css = tinymce.explode(ed.settings.content_css); + + t.editor = ed; + + // Force absolute CSS urls + tinymce.each(css, function(u, k) { + css[k] = ed.documentBaseURI.toAbsolute(u); + }); + + ed.addCommand('mcePreview', function() { + ed.windowManager.open({ + file : ed.getParam("plugin_preview_pageurl", url + "/preview.html"), + width : parseInt(ed.getParam("plugin_preview_width", "550")), + height : parseInt(ed.getParam("plugin_preview_height", "600")), + resizable : "yes", + scrollbars : "yes", + popup_css : css ? css.join(',') : ed.baseURI.toAbsolute("themes/" + ed.settings.theme + "/skins/" + ed.settings.skin + "/content.css"), + inline : ed.getParam("plugin_preview_inline", 1) + }, { + base : ed.documentBaseURI.getURI() + }); + }); + + ed.addButton('preview', {title : 'preview.preview_desc', cmd : 'mcePreview'}); + }, + + getInfo : function() { + return { + longname : 'Preview', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/preview', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('preview', tinymce.plugins.Preview); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/preview/example.html b/web/libs/tiny_mce/plugins/preview/example.html new file mode 100644 index 0000000..b2c3d90 --- /dev/null +++ b/web/libs/tiny_mce/plugins/preview/example.html @@ -0,0 +1,28 @@ + + + + + +Example of a custom preview page + + + +Editor contents:
+
+ +
+ + + diff --git a/web/libs/tiny_mce/plugins/preview/jscripts/embed.js b/web/libs/tiny_mce/plugins/preview/jscripts/embed.js new file mode 100644 index 0000000..f8dc810 --- /dev/null +++ b/web/libs/tiny_mce/plugins/preview/jscripts/embed.js @@ -0,0 +1,73 @@ +/** + * This script contains embed functions for common plugins. This scripts are complety free to use for any purpose. + */ + +function writeFlash(p) { + writeEmbed( + 'D27CDB6E-AE6D-11cf-96B8-444553540000', + 'http://download.macromedia.com/pub/shockwave/cabs/flash/swflash.cab#version=6,0,40,0', + 'application/x-shockwave-flash', + p + ); +} + +function writeShockWave(p) { + writeEmbed( + '166B1BCA-3F9C-11CF-8075-444553540000', + 'http://download.macromedia.com/pub/shockwave/cabs/director/sw.cab#version=8,5,1,0', + 'application/x-director', + p + ); +} + +function writeQuickTime(p) { + writeEmbed( + '02BF25D5-8C17-4B23-BC80-D3488ABDDC6B', + 'http://www.apple.com/qtactivex/qtplugin.cab#version=6,0,2,0', + 'video/quicktime', + p + ); +} + +function writeRealMedia(p) { + writeEmbed( + 'CFCDAA03-8BE4-11cf-B84B-0020AFBBCCFA', + 'http://download.macromedia.com/pub/shockwave/cabs/flash/swflash.cab#version=6,0,40,0', + 'audio/x-pn-realaudio-plugin', + p + ); +} + +function writeWindowsMedia(p) { + p.url = p.src; + writeEmbed( + '6BF52A52-394A-11D3-B153-00C04F79FAA6', + 'http://activex.microsoft.com/activex/controls/mplayer/en/nsmp2inf.cab#Version=5,1,52,701', + 'application/x-mplayer2', + p + ); +} + +function writeEmbed(cls, cb, mt, p) { + var h = '', n; + + h += ''; + + h += ' + + + + + +{#preview.preview_desc} + + + + + diff --git a/web/libs/tiny_mce/plugins/print/editor_plugin.js b/web/libs/tiny_mce/plugins/print/editor_plugin.js new file mode 100644 index 0000000..b5b3a55 --- /dev/null +++ b/web/libs/tiny_mce/plugins/print/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.Print",{init:function(a,b){a.addCommand("mcePrint",function(){a.getWin().print()});a.addButton("print",{title:"print.print_desc",cmd:"mcePrint"})},getInfo:function(){return{longname:"Print",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/print",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("print",tinymce.plugins.Print)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/print/editor_plugin_src.js b/web/libs/tiny_mce/plugins/print/editor_plugin_src.js new file mode 100644 index 0000000..3933fe6 --- /dev/null +++ b/web/libs/tiny_mce/plugins/print/editor_plugin_src.js @@ -0,0 +1,34 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.Print', { + init : function(ed, url) { + ed.addCommand('mcePrint', function() { + ed.getWin().print(); + }); + + ed.addButton('print', {title : 'print.print_desc', cmd : 'mcePrint'}); + }, + + getInfo : function() { + return { + longname : 'Print', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/print', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('print', tinymce.plugins.Print); +})(); diff --git a/web/libs/tiny_mce/plugins/save/editor_plugin.js b/web/libs/tiny_mce/plugins/save/editor_plugin.js new file mode 100644 index 0000000..8e93996 --- /dev/null +++ b/web/libs/tiny_mce/plugins/save/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.Save",{init:function(a,b){var c=this;c.editor=a;a.addCommand("mceSave",c._save,c);a.addCommand("mceCancel",c._cancel,c);a.addButton("save",{title:"save.save_desc",cmd:"mceSave"});a.addButton("cancel",{title:"save.cancel_desc",cmd:"mceCancel"});a.onNodeChange.add(c._nodeChange,c);a.addShortcut("ctrl+s",a.getLang("save.save_desc"),"mceSave")},getInfo:function(){return{longname:"Save",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/save",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_nodeChange:function(b,a,c){var b=this.editor;if(b.getParam("save_enablewhendirty")){a.setDisabled("save",!b.isDirty());a.setDisabled("cancel",!b.isDirty())}},_save:function(){var c=this.editor,a,e,d,b;a=tinymce.DOM.get(c.id).form||tinymce.DOM.getParent(c.id,"form");if(c.getParam("save_enablewhendirty")&&!c.isDirty()){return}tinyMCE.triggerSave();if(e=c.getParam("save_onsavecallback")){if(c.execCallback("save_onsavecallback",c)){c.startContent=tinymce.trim(c.getContent({format:"raw"}));c.nodeChanged()}return}if(a){c.isNotDirty=true;if(a.onsubmit==null||a.onsubmit()!=false){a.submit()}c.nodeChanged()}else{c.windowManager.alert("Error: No form element found.")}},_cancel:function(){var a=this.editor,c,b=tinymce.trim(a.startContent);if(c=a.getParam("save_oncancelcallback")){a.execCallback("save_oncancelcallback",a);return}a.setContent(b);a.undoManager.clear();a.nodeChanged()}});tinymce.PluginManager.add("save",tinymce.plugins.Save)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/save/editor_plugin_src.js b/web/libs/tiny_mce/plugins/save/editor_plugin_src.js new file mode 100644 index 0000000..f5a3de8 --- /dev/null +++ b/web/libs/tiny_mce/plugins/save/editor_plugin_src.js @@ -0,0 +1,101 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.Save', { + init : function(ed, url) { + var t = this; + + t.editor = ed; + + // Register commands + ed.addCommand('mceSave', t._save, t); + ed.addCommand('mceCancel', t._cancel, t); + + // Register buttons + ed.addButton('save', {title : 'save.save_desc', cmd : 'mceSave'}); + ed.addButton('cancel', {title : 'save.cancel_desc', cmd : 'mceCancel'}); + + ed.onNodeChange.add(t._nodeChange, t); + ed.addShortcut('ctrl+s', ed.getLang('save.save_desc'), 'mceSave'); + }, + + getInfo : function() { + return { + longname : 'Save', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/save', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + // Private methods + + _nodeChange : function(ed, cm, n) { + var ed = this.editor; + + if (ed.getParam('save_enablewhendirty')) { + cm.setDisabled('save', !ed.isDirty()); + cm.setDisabled('cancel', !ed.isDirty()); + } + }, + + // Private methods + + _save : function() { + var ed = this.editor, formObj, os, i, elementId; + + formObj = tinymce.DOM.get(ed.id).form || tinymce.DOM.getParent(ed.id, 'form'); + + if (ed.getParam("save_enablewhendirty") && !ed.isDirty()) + return; + + tinyMCE.triggerSave(); + + // Use callback instead + if (os = ed.getParam("save_onsavecallback")) { + if (ed.execCallback('save_onsavecallback', ed)) { + ed.startContent = tinymce.trim(ed.getContent({format : 'raw'})); + ed.nodeChanged(); + } + + return; + } + + if (formObj) { + ed.isNotDirty = true; + + if (formObj.onsubmit == null || formObj.onsubmit() != false) + formObj.submit(); + + ed.nodeChanged(); + } else + ed.windowManager.alert("Error: No form element found."); + }, + + _cancel : function() { + var ed = this.editor, os, h = tinymce.trim(ed.startContent); + + // Use callback instead + if (os = ed.getParam("save_oncancelcallback")) { + ed.execCallback('save_oncancelcallback', ed); + return; + } + + ed.setContent(h); + ed.undoManager.clear(); + ed.nodeChanged(); + } + }); + + // Register plugin + tinymce.PluginManager.add('save', tinymce.plugins.Save); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/searchreplace/css/searchreplace.css b/web/libs/tiny_mce/plugins/searchreplace/css/searchreplace.css new file mode 100644 index 0000000..ecdf58c --- /dev/null +++ b/web/libs/tiny_mce/plugins/searchreplace/css/searchreplace.css @@ -0,0 +1,6 @@ +.panel_wrapper {height:85px;} +.panel_wrapper div.current {height:85px;} + +/* IE */ +* html .panel_wrapper {height:100px;} +* html .panel_wrapper div.current {height:100px;} diff --git a/web/libs/tiny_mce/plugins/searchreplace/editor_plugin.js b/web/libs/tiny_mce/plugins/searchreplace/editor_plugin.js new file mode 100644 index 0000000..cd9c985 --- /dev/null +++ b/web/libs/tiny_mce/plugins/searchreplace/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.SearchReplacePlugin",{init:function(a,c){function b(d){a.windowManager.open({file:c+"/searchreplace.htm",width:420+parseInt(a.getLang("searchreplace.delta_width",0)),height:170+parseInt(a.getLang("searchreplace.delta_height",0)),inline:1,auto_focus:0},{mode:d,search_string:a.selection.getContent({format:"text"}),plugin_url:c})}a.addCommand("mceSearch",function(){b("search")});a.addCommand("mceReplace",function(){b("replace")});a.addButton("search",{title:"searchreplace.search_desc",cmd:"mceSearch"});a.addButton("replace",{title:"searchreplace.replace_desc",cmd:"mceReplace"});a.addShortcut("ctrl+f","searchreplace.search_desc","mceSearch")},getInfo:function(){return{longname:"Search/Replace",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/searchreplace",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("searchreplace",tinymce.plugins.SearchReplacePlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/searchreplace/editor_plugin_src.js b/web/libs/tiny_mce/plugins/searchreplace/editor_plugin_src.js new file mode 100644 index 0000000..1433a06 --- /dev/null +++ b/web/libs/tiny_mce/plugins/searchreplace/editor_plugin_src.js @@ -0,0 +1,57 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.SearchReplacePlugin', { + init : function(ed, url) { + function open(m) { + ed.windowManager.open({ + file : url + '/searchreplace.htm', + width : 420 + parseInt(ed.getLang('searchreplace.delta_width', 0)), + height : 170 + parseInt(ed.getLang('searchreplace.delta_height', 0)), + inline : 1, + auto_focus : 0 + }, { + mode : m, + search_string : ed.selection.getContent({format : 'text'}), + plugin_url : url + }); + }; + + // Register commands + ed.addCommand('mceSearch', function() { + open('search'); + }); + + ed.addCommand('mceReplace', function() { + open('replace'); + }); + + // Register buttons + ed.addButton('search', {title : 'searchreplace.search_desc', cmd : 'mceSearch'}); + ed.addButton('replace', {title : 'searchreplace.replace_desc', cmd : 'mceReplace'}); + + ed.addShortcut('ctrl+f', 'searchreplace.search_desc', 'mceSearch'); + }, + + getInfo : function() { + return { + longname : 'Search/Replace', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/searchreplace', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('searchreplace', tinymce.plugins.SearchReplacePlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/searchreplace/js/searchreplace.js b/web/libs/tiny_mce/plugins/searchreplace/js/searchreplace.js new file mode 100644 index 0000000..c0a6243 --- /dev/null +++ b/web/libs/tiny_mce/plugins/searchreplace/js/searchreplace.js @@ -0,0 +1,130 @@ +tinyMCEPopup.requireLangPack(); + +var SearchReplaceDialog = { + init : function(ed) { + var f = document.forms[0], m = tinyMCEPopup.getWindowArg("mode"); + + this.switchMode(m); + + f[m + '_panel_searchstring'].value = tinyMCEPopup.getWindowArg("search_string"); + + // Focus input field + f[m + '_panel_searchstring'].focus(); + }, + + switchMode : function(m) { + var f, lm = this.lastMode; + + if (lm != m) { + f = document.forms[0]; + + if (lm) { + f[m + '_panel_searchstring'].value = f[lm + '_panel_searchstring'].value; + f[m + '_panel_backwardsu'].checked = f[lm + '_panel_backwardsu'].checked; + f[m + '_panel_backwardsd'].checked = f[lm + '_panel_backwardsd'].checked; + f[m + '_panel_casesensitivebox'].checked = f[lm + '_panel_casesensitivebox'].checked; + } + + mcTabs.displayTab(m + '_tab', m + '_panel'); + document.getElementById("replaceBtn").style.display = (m == "replace") ? "inline" : "none"; + document.getElementById("replaceAllBtn").style.display = (m == "replace") ? "inline" : "none"; + this.lastMode = m; + } + }, + + searchNext : function(a) { + var ed = tinyMCEPopup.editor, se = ed.selection, r = se.getRng(), f, m = this.lastMode, s, b, fl = 0, w = ed.getWin(), wm = ed.windowManager, fo = 0; + + // Get input + f = document.forms[0]; + s = f[m + '_panel_searchstring'].value; + b = f[m + '_panel_backwardsu'].checked; + ca = f[m + '_panel_casesensitivebox'].checked; + rs = f['replace_panel_replacestring'].value; + + if (s == '') + return; + + function fix() { + // Correct Firefox graphics glitches + r = se.getRng().cloneRange(); + ed.getDoc().execCommand('SelectAll', false, null); + se.setRng(r); + }; + + function replace() { + if (tinymce.isIE) + ed.selection.getRng().duplicate().pasteHTML(rs); // Needs to be duplicated due to selection bug in IE + else + ed.getDoc().execCommand('InsertHTML', false, rs); + }; + + // IE flags + if (ca) + fl = fl | 4; + + switch (a) { + case 'all': + // Move caret to beginning of text + ed.execCommand('SelectAll'); + ed.selection.collapse(true); + + if (tinymce.isIE) { + while (r.findText(s, b ? -1 : 1, fl)) { + r.scrollIntoView(); + r.select(); + replace(); + fo = 1; + + if (b) { + r.moveEnd("character", -(rs.length)); // Otherwise will loop forever + } + } + + tinyMCEPopup.storeSelection(); + } else { + while (w.find(s, ca, b, false, false, false, false)) { + replace(); + fo = 1; + } + } + + if (fo) + tinyMCEPopup.alert(ed.getLang('searchreplace_dlg.allreplaced')); + else + tinyMCEPopup.alert(ed.getLang('searchreplace_dlg.notfound')); + + return; + + case 'current': + if (!ed.selection.isCollapsed()) + replace(); + + break; + } + + se.collapse(b); + r = se.getRng(); + + // Whats the point + if (!s) + return; + + if (tinymce.isIE) { + if (r.findText(s, b ? -1 : 1, fl)) { + r.scrollIntoView(); + r.select(); + } else + tinyMCEPopup.alert(ed.getLang('searchreplace_dlg.notfound')); + + tinyMCEPopup.storeSelection(); + } else { + if (!w.find(s, ca, b, false, false, false, false)) + tinyMCEPopup.alert(ed.getLang('searchreplace_dlg.notfound')); + else + fix(); + } + } +}; + +tinyMCEPopup.onInit.add(SearchReplaceDialog.init, SearchReplaceDialog); diff --git a/web/libs/tiny_mce/plugins/searchreplace/langs/en_dlg.js b/web/libs/tiny_mce/plugins/searchreplace/langs/en_dlg.js new file mode 100644 index 0000000..370959a --- /dev/null +++ b/web/libs/tiny_mce/plugins/searchreplace/langs/en_dlg.js @@ -0,0 +1,16 @@ +tinyMCE.addI18n('en.searchreplace_dlg',{ +searchnext_desc:"Find again", +notfound:"The search has been completed. The search string could not be found.", +search_title:"Find", +replace_title:"Find/Replace", +allreplaced:"All occurrences of the search string were replaced.", +findwhat:"Find what", +replacewith:"Replace with", +direction:"Direction", +up:"Up", +down:"Down", +mcase:"Match case", +findnext:"Find next", +replace:"Replace", +replaceall:"Replace all" +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/searchreplace/searchreplace.htm b/web/libs/tiny_mce/plugins/searchreplace/searchreplace.htm new file mode 100644 index 0000000..d0424cf --- /dev/null +++ b/web/libs/tiny_mce/plugins/searchreplace/searchreplace.htm @@ -0,0 +1,99 @@ + + + + {#searchreplace_dlg.replace_title} + + + + + + + +
+ + +
+
+ + + + + + + + + + + +
+ + + + + + + + +
+
+ + + + + +
+
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + + + + +
+
+ + + + + +
+
+
+ +
+ +
+ + + + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/spellchecker/css/content.css b/web/libs/tiny_mce/plugins/spellchecker/css/content.css new file mode 100644 index 0000000..24efa02 --- /dev/null +++ b/web/libs/tiny_mce/plugins/spellchecker/css/content.css @@ -0,0 +1 @@ +.mceItemHiddenSpellWord {background:url(../img/wline.gif) repeat-x bottom left; cursor:default;} diff --git a/web/libs/tiny_mce/plugins/spellchecker/editor_plugin.js b/web/libs/tiny_mce/plugins/spellchecker/editor_plugin.js new file mode 100644 index 0000000..a9ec3b9 --- /dev/null +++ b/web/libs/tiny_mce/plugins/spellchecker/editor_plugin.js @@ -0,0 +1 @@ +(function(){var a=tinymce.util.JSONRequest,c=tinymce.each,b=tinymce.DOM;tinymce.create("tinymce.plugins.SpellcheckerPlugin",{getInfo:function(){return{longname:"Spellchecker",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/spellchecker",version:tinymce.majorVersion+"."+tinymce.minorVersion}},init:function(e,f){var g=this,d;g.url=f;g.editor=e;g.rpcUrl=e.getParam("spellchecker_rpc_url","{backend}");if(g.rpcUrl=="{backend}"){if(tinymce.isIE){return}g.hasSupport=true;e.onContextMenu.addToTop(function(h,i){if(g.active){return false}})}e.addCommand("mceSpellCheck",function(){if(g.rpcUrl=="{backend}"){g.editor.getBody().spellcheck=g.active=!g.active;return}if(!g.active){e.setProgressState(1);g._sendRPC("checkWords",[g.selectedLang,g._getWords()],function(h){if(h.length>0){g.active=1;g._markWords(h);e.setProgressState(0);e.nodeChanged()}else{e.setProgressState(0);if(e.getParam("spellchecker_report_no_misspellings",true)){e.windowManager.alert("spellchecker.no_mpell")}}})}else{g._done()}});e.onInit.add(function(){if(e.settings.content_css!==false){e.dom.loadCSS(f+"/css/content.css")}});e.onClick.add(g._showMenu,g);e.onContextMenu.add(g._showMenu,g);e.onBeforeGetContent.add(function(){if(g.active){g._removeWords()}});e.onNodeChange.add(function(i,h){h.setActive("spellchecker",g.active)});e.onSetContent.add(function(){g._done()});e.onBeforeGetContent.add(function(){g._done()});e.onBeforeExecCommand.add(function(h,i){if(i=="mceFullScreen"){g._done()}});g.languages={};c(e.getParam("spellchecker_languages","+English=en,Danish=da,Dutch=nl,Finnish=fi,French=fr,German=de,Italian=it,Polish=pl,Portuguese=pt,Spanish=es,Swedish=sv","hash"),function(i,h){if(h.indexOf("+")===0){h=h.substring(1);g.selectedLang=i}g.languages[h]=i})},createControl:function(h,d){var f=this,g,e=f.editor;if(h=="spellchecker"){if(f.rpcUrl=="{backend}"){if(f.hasSupport){g=d.createButton(h,{title:"spellchecker.desc",cmd:"mceSpellCheck",scope:f})}return g}g=d.createSplitButton(h,{title:"spellchecker.desc",cmd:"mceSpellCheck",scope:f});g.onRenderMenu.add(function(j,i){i.add({title:"spellchecker.langs","class":"mceMenuItemTitle"}).setDisabled(1);c(f.languages,function(n,m){var p={icon:1},l;p.onclick=function(){l.setSelected(1);f.selectedItem.setSelected(0);f.selectedItem=l;f.selectedLang=n};p.title=m;l=i.add(p);l.setSelected(n==f.selectedLang);if(n==f.selectedLang){f.selectedItem=l}})});return g}},_walk:function(i,g){var h=this.editor.getDoc(),e;if(h.createTreeWalker){e=h.createTreeWalker(i,NodeFilter.SHOW_TEXT,null,false);while((i=e.nextNode())!=null){g.call(this,i)}}else{tinymce.walk(i,g,"childNodes")}},_getSeparators:function(){var e="",d,f=this.editor.getParam("spellchecker_word_separator_chars",'\\s!"#$%&()*+,-./:;<=>?@[]^_{|}§©«®±¶·¸»¼½¾¿×÷¤\u201d\u201c');for(d=0;d$1$2');q=q.replace(g,'$1$2');j.replace(j.create("span",{"class":"mceItemHidden"},q),r)}}});l.moveToBookmark(m)},_showMenu:function(h,j){var i=this,h=i.editor,d=i._menu,l,k=h.dom,g=k.getViewPort(h.getWin()),f=j.target;j=0;if(!d){l=b.getPos(h.getContentAreaContainer());d=h.controlManager.createDropMenu("spellcheckermenu",{offset_x:l.x,offset_y:l.y,"class":"mceNoIcons"});i._menu=d}if(k.hasClass(f,"mceItemHiddenSpellWord")){d.removeAll();d.add({title:"spellchecker.wait","class":"mceMenuItemTitle"}).setDisabled(1);i._sendRPC("getSuggestions",[i.selectedLang,k.decode(f.innerHTML)],function(m){var e;d.removeAll();if(m.length>0){d.add({title:"spellchecker.sug","class":"mceMenuItemTitle"}).setDisabled(1);c(m,function(n){d.add({title:n,onclick:function(){k.replace(h.getDoc().createTextNode(n),f);i._checkDone()}})});d.addSeparator()}else{d.add({title:"spellchecker.no_sug","class":"mceMenuItemTitle"}).setDisabled(1)}e=i.editor.getParam("spellchecker_enable_ignore_rpc","");d.add({title:"spellchecker.ignore_word",onclick:function(){var n=f.innerHTML;k.remove(f,1);i._checkDone();if(e){h.setProgressState(1);i._sendRPC("ignoreWord",[i.selectedLang,n],function(o){h.setProgressState(0)})}}});d.add({title:"spellchecker.ignore_words",onclick:function(){var n=f.innerHTML;i._removeWords(k.decode(n));i._checkDone();if(e){h.setProgressState(1);i._sendRPC("ignoreWords",[i.selectedLang,n],function(o){h.setProgressState(0)})}}});if(i.editor.getParam("spellchecker_enable_learn_rpc")){d.add({title:"spellchecker.learn_word",onclick:function(){var n=f.innerHTML;k.remove(f,1);i._checkDone();h.setProgressState(1);i._sendRPC("learnWord",[i.selectedLang,n],function(o){h.setProgressState(0)})}})}d.update()});h.selection.select(f);l=k.getPos(f);d.showMenu(l.x,l.y+f.offsetHeight-g.y);return tinymce.dom.Event.cancel(j)}else{d.hideMenu()}},_checkDone:function(){var e=this,d=e.editor,g=d.dom,f;c(g.select("span"),function(h){if(h&&g.hasClass(h,"mceItemHiddenSpellWord")){f=true;return false}});if(!f){e._done()}},_done:function(){var d=this,e=d.active;if(d.active){d.active=0;d._removeWords();if(d._menu){d._menu.hideMenu()}if(e){d.editor.nodeChanged()}}},_sendRPC:function(e,g,d){var f=this;a.sendRPC({url:f.rpcUrl,method:e,params:g,success:d,error:function(i,h){f.editor.setProgressState(0);f.editor.windowManager.alert(i.errstr||("Error response: "+h.responseText))}})}});tinymce.PluginManager.add("spellchecker",tinymce.plugins.SpellcheckerPlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/spellchecker/editor_plugin_src.js b/web/libs/tiny_mce/plugins/spellchecker/editor_plugin_src.js new file mode 100644 index 0000000..d8680ba --- /dev/null +++ b/web/libs/tiny_mce/plugins/spellchecker/editor_plugin_src.js @@ -0,0 +1,417 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + var JSONRequest = tinymce.util.JSONRequest, each = tinymce.each, DOM = tinymce.DOM; + + tinymce.create('tinymce.plugins.SpellcheckerPlugin', { + getInfo : function() { + return { + longname : 'Spellchecker', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/spellchecker', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + init : function(ed, url) { + var t = this, cm; + + t.url = url; + t.editor = ed; + t.rpcUrl = ed.getParam("spellchecker_rpc_url", "{backend}"); + + if (t.rpcUrl == '{backend}') { + // Sniff if the browser supports native spellchecking (Don't know of a better way) + if (tinymce.isIE) + return; + + t.hasSupport = true; + + // Disable the context menu when spellchecking is active + ed.onContextMenu.addToTop(function(ed, e) { + if (t.active) + return false; + }); + } + + // Register commands + ed.addCommand('mceSpellCheck', function() { + if (t.rpcUrl == '{backend}') { + // Enable/disable native spellchecker + t.editor.getBody().spellcheck = t.active = !t.active; + return; + } + + if (!t.active) { + ed.setProgressState(1); + t._sendRPC('checkWords', [t.selectedLang, t._getWords()], function(r) { + if (r.length > 0) { + t.active = 1; + t._markWords(r); + ed.setProgressState(0); + ed.nodeChanged(); + } else { + ed.setProgressState(0); + + if (ed.getParam('spellchecker_report_no_misspellings', true)) + ed.windowManager.alert('spellchecker.no_mpell'); + } + }); + } else + t._done(); + }); + + ed.onInit.add(function() { + if (ed.settings.content_css !== false) + ed.dom.loadCSS(url + '/css/content.css'); + }); + + ed.onClick.add(t._showMenu, t); + ed.onContextMenu.add(t._showMenu, t); + ed.onBeforeGetContent.add(function() { + if (t.active) + t._removeWords(); + }); + + ed.onNodeChange.add(function(ed, cm) { + cm.setActive('spellchecker', t.active); + }); + + ed.onSetContent.add(function() { + t._done(); + }); + + ed.onBeforeGetContent.add(function() { + t._done(); + }); + + ed.onBeforeExecCommand.add(function(ed, cmd) { + if (cmd == 'mceFullScreen') + t._done(); + }); + + // Find selected language + t.languages = {}; + each(ed.getParam('spellchecker_languages', '+English=en,Danish=da,Dutch=nl,Finnish=fi,French=fr,German=de,Italian=it,Polish=pl,Portuguese=pt,Spanish=es,Swedish=sv', 'hash'), function(v, k) { + if (k.indexOf('+') === 0) { + k = k.substring(1); + t.selectedLang = v; + } + + t.languages[k] = v; + }); + }, + + createControl : function(n, cm) { + var t = this, c, ed = t.editor; + + if (n == 'spellchecker') { + // Use basic button if we use the native spellchecker + if (t.rpcUrl == '{backend}') { + // Create simple toggle button if we have native support + if (t.hasSupport) + c = cm.createButton(n, {title : 'spellchecker.desc', cmd : 'mceSpellCheck', scope : t}); + + return c; + } + + c = cm.createSplitButton(n, {title : 'spellchecker.desc', cmd : 'mceSpellCheck', scope : t}); + + c.onRenderMenu.add(function(c, m) { + m.add({title : 'spellchecker.langs', 'class' : 'mceMenuItemTitle'}).setDisabled(1); + each(t.languages, function(v, k) { + var o = {icon : 1}, mi; + + o.onclick = function() { + mi.setSelected(1); + t.selectedItem.setSelected(0); + t.selectedItem = mi; + t.selectedLang = v; + }; + + o.title = k; + mi = m.add(o); + mi.setSelected(v == t.selectedLang); + + if (v == t.selectedLang) + t.selectedItem = mi; + }) + }); + + return c; + } + }, + + // Internal functions + + _walk : function(n, f) { + var d = this.editor.getDoc(), w; + + if (d.createTreeWalker) { + w = d.createTreeWalker(n, NodeFilter.SHOW_TEXT, null, false); + + while ((n = w.nextNode()) != null) + f.call(this, n); + } else + tinymce.walk(n, f, 'childNodes'); + }, + + _getSeparators : function() { + var re = '', i, str = this.editor.getParam('spellchecker_word_separator_chars', '\\s!"#$%&()*+,-./:;<=>?@[\]^_{|}§©«®±¶·¸»¼½¾¿×÷¤\u201d\u201c'); + + // Build word separator regexp + for (i=0; i$1$2'); + v = v.replace(r3, '$1$2'); + + dom.replace(dom.create('span', {'class' : 'mceItemHidden'}, v), n); + } + } + }); + + se.moveToBookmark(b); + }, + + _showMenu : function(ed, e) { + var t = this, ed = t.editor, m = t._menu, p1, dom = ed.dom, vp = dom.getViewPort(ed.getWin()), wordSpan = e.target; + + e = 0; // Fixes IE memory leak + + if (!m) { + p1 = DOM.getPos(ed.getContentAreaContainer()); + //p2 = DOM.getPos(ed.getContainer()); + + m = ed.controlManager.createDropMenu('spellcheckermenu', { + offset_x : p1.x, + offset_y : p1.y, + 'class' : 'mceNoIcons' + }); + + t._menu = m; + } + + if (dom.hasClass(wordSpan, 'mceItemHiddenSpellWord')) { + m.removeAll(); + m.add({title : 'spellchecker.wait', 'class' : 'mceMenuItemTitle'}).setDisabled(1); + + t._sendRPC('getSuggestions', [t.selectedLang, dom.decode(wordSpan.innerHTML)], function(r) { + var ignoreRpc; + + m.removeAll(); + + if (r.length > 0) { + m.add({title : 'spellchecker.sug', 'class' : 'mceMenuItemTitle'}).setDisabled(1); + each(r, function(v) { + m.add({title : v, onclick : function() { + dom.replace(ed.getDoc().createTextNode(v), wordSpan); + t._checkDone(); + }}); + }); + + m.addSeparator(); + } else + m.add({title : 'spellchecker.no_sug', 'class' : 'mceMenuItemTitle'}).setDisabled(1); + + ignoreRpc = t.editor.getParam("spellchecker_enable_ignore_rpc", ''); + m.add({ + title : 'spellchecker.ignore_word', + onclick : function() { + var word = wordSpan.innerHTML; + + dom.remove(wordSpan, 1); + t._checkDone(); + + // tell the server if we need to + if (ignoreRpc) { + ed.setProgressState(1); + t._sendRPC('ignoreWord', [t.selectedLang, word], function(r) { + ed.setProgressState(0); + }); + } + } + }); + + m.add({ + title : 'spellchecker.ignore_words', + onclick : function() { + var word = wordSpan.innerHTML; + + t._removeWords(dom.decode(word)); + t._checkDone(); + + // tell the server if we need to + if (ignoreRpc) { + ed.setProgressState(1); + t._sendRPC('ignoreWords', [t.selectedLang, word], function(r) { + ed.setProgressState(0); + }); + } + } + }); + + + if (t.editor.getParam("spellchecker_enable_learn_rpc")) { + m.add({ + title : 'spellchecker.learn_word', + onclick : function() { + var word = wordSpan.innerHTML; + + dom.remove(wordSpan, 1); + t._checkDone(); + + ed.setProgressState(1); + t._sendRPC('learnWord', [t.selectedLang, word], function(r) { + ed.setProgressState(0); + }); + } + }); + } + + m.update(); + }); + + ed.selection.select(wordSpan); + p1 = dom.getPos(wordSpan); + m.showMenu(p1.x, p1.y + wordSpan.offsetHeight - vp.y); + + return tinymce.dom.Event.cancel(e); + } else + m.hideMenu(); + }, + + _checkDone : function() { + var t = this, ed = t.editor, dom = ed.dom, o; + + each(dom.select('span'), function(n) { + if (n && dom.hasClass(n, 'mceItemHiddenSpellWord')) { + o = true; + return false; + } + }); + + if (!o) + t._done(); + }, + + _done : function() { + var t = this, la = t.active; + + if (t.active) { + t.active = 0; + t._removeWords(); + + if (t._menu) + t._menu.hideMenu(); + + if (la) + t.editor.nodeChanged(); + } + }, + + _sendRPC : function(m, p, cb) { + var t = this; + + JSONRequest.sendRPC({ + url : t.rpcUrl, + method : m, + params : p, + success : cb, + error : function(e, x) { + t.editor.setProgressState(0); + t.editor.windowManager.alert(e.errstr || ('Error response: ' + x.responseText)); + } + }); + } + }); + + // Register plugin + tinymce.PluginManager.add('spellchecker', tinymce.plugins.SpellcheckerPlugin); +})(); diff --git a/web/libs/tiny_mce/plugins/spellchecker/img/wline.gif b/web/libs/tiny_mce/plugins/spellchecker/img/wline.gif new file mode 100644 index 0000000..7d0a4db Binary files /dev/null and b/web/libs/tiny_mce/plugins/spellchecker/img/wline.gif differ diff --git a/web/libs/tiny_mce/plugins/style/css/props.css b/web/libs/tiny_mce/plugins/style/css/props.css new file mode 100644 index 0000000..eb1f264 --- /dev/null +++ b/web/libs/tiny_mce/plugins/style/css/props.css @@ -0,0 +1,13 @@ +#text_font {width:250px;} +#text_size {width:70px;} +.mceAddSelectValue {background:#DDD;} +select, #block_text_indent, #box_width, #box_height, #box_padding_top, #box_padding_right, #box_padding_bottom, #box_padding_left {width:70px;} +#box_margin_top, #box_margin_right, #box_margin_bottom, #box_margin_left, #positioning_width, #positioning_height, #positioning_zindex {width:70px;} +#positioning_placement_top, #positioning_placement_right, #positioning_placement_bottom, #positioning_placement_left {width:70px;} +#positioning_clip_top, #positioning_clip_right, #positioning_clip_bottom, #positioning_clip_left {width:70px;} +.panel_wrapper div.current {padding-top:10px;height:230px;} +.delim {border-left:1px solid gray;} +.tdelim {border-bottom:1px solid gray;} +#block_display {width:145px;} +#list_type {width:115px;} +.disabled {background:#EEE;} diff --git a/web/libs/tiny_mce/plugins/style/editor_plugin.js b/web/libs/tiny_mce/plugins/style/editor_plugin.js new file mode 100644 index 0000000..cab2153 --- /dev/null +++ b/web/libs/tiny_mce/plugins/style/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.StylePlugin",{init:function(a,b){a.addCommand("mceStyleProps",function(){a.windowManager.open({file:b+"/props.htm",width:480+parseInt(a.getLang("style.delta_width",0)),height:320+parseInt(a.getLang("style.delta_height",0)),inline:1},{plugin_url:b,style_text:a.selection.getNode().style.cssText})});a.addCommand("mceSetElementStyle",function(d,c){if(e=a.selection.getNode()){a.dom.setAttrib(e,"style",c);a.execCommand("mceRepaint")}});a.onNodeChange.add(function(d,c,f){c.setDisabled("styleprops",f.nodeName==="BODY")});a.addButton("styleprops",{title:"style.desc",cmd:"mceStyleProps"})},getInfo:function(){return{longname:"Style",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/style",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("style",tinymce.plugins.StylePlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/style/editor_plugin_src.js b/web/libs/tiny_mce/plugins/style/editor_plugin_src.js new file mode 100644 index 0000000..5f7755f --- /dev/null +++ b/web/libs/tiny_mce/plugins/style/editor_plugin_src.js @@ -0,0 +1,55 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.StylePlugin', { + init : function(ed, url) { + // Register commands + ed.addCommand('mceStyleProps', function() { + ed.windowManager.open({ + file : url + '/props.htm', + width : 480 + parseInt(ed.getLang('style.delta_width', 0)), + height : 320 + parseInt(ed.getLang('style.delta_height', 0)), + inline : 1 + }, { + plugin_url : url, + style_text : ed.selection.getNode().style.cssText + }); + }); + + ed.addCommand('mceSetElementStyle', function(ui, v) { + if (e = ed.selection.getNode()) { + ed.dom.setAttrib(e, 'style', v); + ed.execCommand('mceRepaint'); + } + }); + + ed.onNodeChange.add(function(ed, cm, n) { + cm.setDisabled('styleprops', n.nodeName === 'BODY'); + }); + + // Register buttons + ed.addButton('styleprops', {title : 'style.desc', cmd : 'mceStyleProps'}); + }, + + getInfo : function() { + return { + longname : 'Style', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/style', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('style', tinymce.plugins.StylePlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/style/js/props.js b/web/libs/tiny_mce/plugins/style/js/props.js new file mode 100644 index 0000000..a8dd93d --- /dev/null +++ b/web/libs/tiny_mce/plugins/style/js/props.js @@ -0,0 +1,641 @@ +tinyMCEPopup.requireLangPack(); + +var defaultFonts = "" + + "Arial, Helvetica, sans-serif=Arial, Helvetica, sans-serif;" + + "Times New Roman, Times, serif=Times New Roman, Times, serif;" + + "Courier New, Courier, mono=Courier New, Courier, mono;" + + "Times New Roman, Times, serif=Times New Roman, Times, serif;" + + "Georgia, Times New Roman, Times, serif=Georgia, Times New Roman, Times, serif;" + + "Verdana, Arial, Helvetica, sans-serif=Verdana, Arial, Helvetica, sans-serif;" + + "Geneva, Arial, Helvetica, sans-serif=Geneva, Arial, Helvetica, sans-serif"; + +var defaultSizes = "9;10;12;14;16;18;24;xx-small;x-small;small;medium;large;x-large;xx-large;smaller;larger"; +var defaultMeasurement = "+pixels=px;points=pt;inches=in;centimetres=cm;millimetres=mm;picas=pc;ems=em;exs=ex;%"; +var defaultSpacingMeasurement = "pixels=px;points=pt;inches=in;centimetres=cm;millimetres=mm;picas=pc;+ems=em;exs=ex;%"; +var defaultIndentMeasurement = "pixels=px;+points=pt;inches=in;centimetres=cm;millimetres=mm;picas=pc;ems=em;exs=ex;%"; +var defaultWeight = "normal;bold;bolder;lighter;100;200;300;400;500;600;700;800;900"; +var defaultTextStyle = "normal;italic;oblique"; +var defaultVariant = "normal;small-caps"; +var defaultLineHeight = "normal"; +var defaultAttachment = "fixed;scroll"; +var defaultRepeat = "no-repeat;repeat;repeat-x;repeat-y"; +var defaultPosH = "left;center;right"; +var defaultPosV = "top;center;bottom"; +var defaultVAlign = "baseline;sub;super;top;text-top;middle;bottom;text-bottom"; +var defaultDisplay = "inline;block;list-item;run-in;compact;marker;table;inline-table;table-row-group;table-header-group;table-footer-group;table-row;table-column-group;table-column;table-cell;table-caption;none"; +var defaultBorderStyle = "none;solid;dashed;dotted;double;groove;ridge;inset;outset"; +var defaultBorderWidth = "thin;medium;thick"; +var defaultListType = "disc;circle;square;decimal;lower-roman;upper-roman;lower-alpha;upper-alpha;none"; + +function init() { + var ce = document.getElementById('container'), h; + + ce.style.cssText = tinyMCEPopup.getWindowArg('style_text'); + + h = getBrowserHTML('background_image_browser','background_image','image','advimage'); + document.getElementById("background_image_browser").innerHTML = h; + + document.getElementById('text_color_pickcontainer').innerHTML = getColorPickerHTML('text_color_pick','text_color'); + document.getElementById('background_color_pickcontainer').innerHTML = getColorPickerHTML('background_color_pick','background_color'); + document.getElementById('border_color_top_pickcontainer').innerHTML = getColorPickerHTML('border_color_top_pick','border_color_top'); + document.getElementById('border_color_right_pickcontainer').innerHTML = getColorPickerHTML('border_color_right_pick','border_color_right'); + document.getElementById('border_color_bottom_pickcontainer').innerHTML = getColorPickerHTML('border_color_bottom_pick','border_color_bottom'); + document.getElementById('border_color_left_pickcontainer').innerHTML = getColorPickerHTML('border_color_left_pick','border_color_left'); + + fillSelect(0, 'text_font', 'style_font', defaultFonts, ';', true); + fillSelect(0, 'text_size', 'style_font_size', defaultSizes, ';', true); + fillSelect(0, 'text_size_measurement', 'style_font_size_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'text_case', 'style_text_case', "capitalize;uppercase;lowercase", ';', true); + fillSelect(0, 'text_weight', 'style_font_weight', defaultWeight, ';', true); + fillSelect(0, 'text_style', 'style_font_style', defaultTextStyle, ';', true); + fillSelect(0, 'text_variant', 'style_font_variant', defaultVariant, ';', true); + fillSelect(0, 'text_lineheight', 'style_font_line_height', defaultLineHeight, ';', true); + fillSelect(0, 'text_lineheight_measurement', 'style_font_line_height_measurement', defaultMeasurement, ';', true); + + fillSelect(0, 'background_attachment', 'style_background_attachment', defaultAttachment, ';', true); + fillSelect(0, 'background_repeat', 'style_background_repeat', defaultRepeat, ';', true); + + fillSelect(0, 'background_hpos_measurement', 'style_background_hpos_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'background_vpos_measurement', 'style_background_vpos_measurement', defaultMeasurement, ';', true); + + fillSelect(0, 'background_hpos', 'style_background_hpos', defaultPosH, ';', true); + fillSelect(0, 'background_vpos', 'style_background_vpos', defaultPosV, ';', true); + + fillSelect(0, 'block_wordspacing', 'style_wordspacing', 'normal', ';', true); + fillSelect(0, 'block_wordspacing_measurement', 'style_wordspacing_measurement', defaultSpacingMeasurement, ';', true); + fillSelect(0, 'block_letterspacing', 'style_letterspacing', 'normal', ';', true); + fillSelect(0, 'block_letterspacing_measurement', 'style_letterspacing_measurement', defaultSpacingMeasurement, ';', true); + fillSelect(0, 'block_vertical_alignment', 'style_vertical_alignment', defaultVAlign, ';', true); + fillSelect(0, 'block_text_align', 'style_text_align', "left;right;center;justify", ';', true); + fillSelect(0, 'block_whitespace', 'style_whitespace', "normal;pre;nowrap", ';', true); + fillSelect(0, 'block_display', 'style_display', defaultDisplay, ';', true); + fillSelect(0, 'block_text_indent_measurement', 'style_text_indent_measurement', defaultIndentMeasurement, ';', true); + + fillSelect(0, 'box_width_measurement', 'style_box_width_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'box_height_measurement', 'style_box_height_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'box_float', 'style_float', 'left;right;none', ';', true); + fillSelect(0, 'box_clear', 'style_clear', 'left;right;both;none', ';', true); + fillSelect(0, 'box_padding_left_measurement', 'style_padding_left_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'box_padding_top_measurement', 'style_padding_top_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'box_padding_bottom_measurement', 'style_padding_bottom_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'box_padding_right_measurement', 'style_padding_right_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'box_margin_left_measurement', 'style_margin_left_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'box_margin_top_measurement', 'style_margin_top_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'box_margin_bottom_measurement', 'style_margin_bottom_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'box_margin_right_measurement', 'style_margin_right_measurement', defaultMeasurement, ';', true); + + fillSelect(0, 'border_style_top', 'style_border_style_top', defaultBorderStyle, ';', true); + fillSelect(0, 'border_style_right', 'style_border_style_right', defaultBorderStyle, ';', true); + fillSelect(0, 'border_style_bottom', 'style_border_style_bottom', defaultBorderStyle, ';', true); + fillSelect(0, 'border_style_left', 'style_border_style_left', defaultBorderStyle, ';', true); + + fillSelect(0, 'border_width_top', 'style_border_width_top', defaultBorderWidth, ';', true); + fillSelect(0, 'border_width_right', 'style_border_width_right', defaultBorderWidth, ';', true); + fillSelect(0, 'border_width_bottom', 'style_border_width_bottom', defaultBorderWidth, ';', true); + fillSelect(0, 'border_width_left', 'style_border_width_left', defaultBorderWidth, ';', true); + + fillSelect(0, 'border_width_top_measurement', 'style_border_width_top_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'border_width_right_measurement', 'style_border_width_right_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'border_width_bottom_measurement', 'style_border_width_bottom_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'border_width_left_measurement', 'style_border_width_left_measurement', defaultMeasurement, ';', true); + + fillSelect(0, 'list_type', 'style_list_type', defaultListType, ';', true); + fillSelect(0, 'list_position', 'style_list_position', "inside;outside", ';', true); + + fillSelect(0, 'positioning_type', 'style_positioning_type', "absolute;relative;static", ';', true); + fillSelect(0, 'positioning_visibility', 'style_positioning_visibility', "inherit;visible;hidden", ';', true); + + fillSelect(0, 'positioning_width_measurement', 'style_positioning_width_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'positioning_height_measurement', 'style_positioning_height_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'positioning_overflow', 'style_positioning_overflow', "visible;hidden;scroll;auto", ';', true); + + fillSelect(0, 'positioning_placement_top_measurement', 'style_positioning_placement_top_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'positioning_placement_right_measurement', 'style_positioning_placement_right_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'positioning_placement_bottom_measurement', 'style_positioning_placement_bottom_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'positioning_placement_left_measurement', 'style_positioning_placement_left_measurement', defaultMeasurement, ';', true); + + fillSelect(0, 'positioning_clip_top_measurement', 'style_positioning_clip_top_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'positioning_clip_right_measurement', 'style_positioning_clip_right_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'positioning_clip_bottom_measurement', 'style_positioning_clip_bottom_measurement', defaultMeasurement, ';', true); + fillSelect(0, 'positioning_clip_left_measurement', 'style_positioning_clip_left_measurement', defaultMeasurement, ';', true); + + TinyMCE_EditableSelects.init(); + setupFormData(); + showDisabledControls(); +} + +function setupFormData() { + var ce = document.getElementById('container'), f = document.forms[0], s, b, i; + + // Setup text fields + + selectByValue(f, 'text_font', ce.style.fontFamily, true, true); + selectByValue(f, 'text_size', getNum(ce.style.fontSize), true, true); + selectByValue(f, 'text_size_measurement', getMeasurement(ce.style.fontSize)); + selectByValue(f, 'text_weight', ce.style.fontWeight, true, true); + selectByValue(f, 'text_style', ce.style.fontStyle, true, true); + selectByValue(f, 'text_lineheight', getNum(ce.style.lineHeight), true, true); + selectByValue(f, 'text_lineheight_measurement', getMeasurement(ce.style.lineHeight)); + selectByValue(f, 'text_case', ce.style.textTransform, true, true); + selectByValue(f, 'text_variant', ce.style.fontVariant, true, true); + f.text_color.value = tinyMCEPopup.editor.dom.toHex(ce.style.color); + updateColor('text_color_pick', 'text_color'); + f.text_underline.checked = inStr(ce.style.textDecoration, 'underline'); + f.text_overline.checked = inStr(ce.style.textDecoration, 'overline'); + f.text_linethrough.checked = inStr(ce.style.textDecoration, 'line-through'); + f.text_blink.checked = inStr(ce.style.textDecoration, 'blink'); + + // Setup background fields + + f.background_color.value = tinyMCEPopup.editor.dom.toHex(ce.style.backgroundColor); + updateColor('background_color_pick', 'background_color'); + f.background_image.value = ce.style.backgroundImage.replace(new RegExp("url\\('?([^']*)'?\\)", 'gi'), "$1"); + selectByValue(f, 'background_repeat', ce.style.backgroundRepeat, true, true); + selectByValue(f, 'background_attachment', ce.style.backgroundAttachment, true, true); + selectByValue(f, 'background_hpos', getNum(getVal(ce.style.backgroundPosition, 0)), true, true); + selectByValue(f, 'background_hpos_measurement', getMeasurement(getVal(ce.style.backgroundPosition, 0))); + selectByValue(f, 'background_vpos', getNum(getVal(ce.style.backgroundPosition, 1)), true, true); + selectByValue(f, 'background_vpos_measurement', getMeasurement(getVal(ce.style.backgroundPosition, 1))); + + // Setup block fields + + selectByValue(f, 'block_wordspacing', getNum(ce.style.wordSpacing), true, true); + selectByValue(f, 'block_wordspacing_measurement', getMeasurement(ce.style.wordSpacing)); + selectByValue(f, 'block_letterspacing', getNum(ce.style.letterSpacing), true, true); + selectByValue(f, 'block_letterspacing_measurement', getMeasurement(ce.style.letterSpacing)); + selectByValue(f, 'block_vertical_alignment', ce.style.verticalAlign, true, true); + selectByValue(f, 'block_text_align', ce.style.textAlign, true, true); + f.block_text_indent.value = getNum(ce.style.textIndent); + selectByValue(f, 'block_text_indent_measurement', getMeasurement(ce.style.textIndent)); + selectByValue(f, 'block_whitespace', ce.style.whiteSpace, true, true); + selectByValue(f, 'block_display', ce.style.display, true, true); + + // Setup box fields + + f.box_width.value = getNum(ce.style.width); + selectByValue(f, 'box_width_measurement', getMeasurement(ce.style.width)); + + f.box_height.value = getNum(ce.style.height); + selectByValue(f, 'box_height_measurement', getMeasurement(ce.style.height)); + + if (tinymce.isGecko) + selectByValue(f, 'box_float', ce.style.cssFloat, true, true); + else + selectByValue(f, 'box_float', ce.style.styleFloat, true, true); + + selectByValue(f, 'box_clear', ce.style.clear, true, true); + + setupBox(f, ce, 'box_padding', 'padding', ''); + setupBox(f, ce, 'box_margin', 'margin', ''); + + // Setup border fields + + setupBox(f, ce, 'border_style', 'border', 'Style'); + setupBox(f, ce, 'border_width', 'border', 'Width'); + setupBox(f, ce, 'border_color', 'border', 'Color'); + + updateColor('border_color_top_pick', 'border_color_top'); + updateColor('border_color_right_pick', 'border_color_right'); + updateColor('border_color_bottom_pick', 'border_color_bottom'); + updateColor('border_color_left_pick', 'border_color_left'); + + f.elements.border_color_top.value = tinyMCEPopup.editor.dom.toHex(f.elements.border_color_top.value); + f.elements.border_color_right.value = tinyMCEPopup.editor.dom.toHex(f.elements.border_color_right.value); + f.elements.border_color_bottom.value = tinyMCEPopup.editor.dom.toHex(f.elements.border_color_bottom.value); + f.elements.border_color_left.value = tinyMCEPopup.editor.dom.toHex(f.elements.border_color_left.value); + + // Setup list fields + + selectByValue(f, 'list_type', ce.style.listStyleType, true, true); + selectByValue(f, 'list_position', ce.style.listStylePosition, true, true); + f.list_bullet_image.value = ce.style.listStyleImage.replace(new RegExp("url\\('?([^']*)'?\\)", 'gi'), "$1"); + + // Setup box fields + + selectByValue(f, 'positioning_type', ce.style.position, true, true); + selectByValue(f, 'positioning_visibility', ce.style.visibility, true, true); + selectByValue(f, 'positioning_overflow', ce.style.overflow, true, true); + f.positioning_zindex.value = ce.style.zIndex ? ce.style.zIndex : ""; + + f.positioning_width.value = getNum(ce.style.width); + selectByValue(f, 'positioning_width_measurement', getMeasurement(ce.style.width)); + + f.positioning_height.value = getNum(ce.style.height); + selectByValue(f, 'positioning_height_measurement', getMeasurement(ce.style.height)); + + setupBox(f, ce, 'positioning_placement', '', '', ['top', 'right', 'bottom', 'left']); + + s = ce.style.clip.replace(new RegExp("rect\\('?([^']*)'?\\)", 'gi'), "$1"); + s = s.replace(/,/g, ' '); + + if (!hasEqualValues([getVal(s, 0), getVal(s, 1), getVal(s, 2), getVal(s, 3)])) { + f.positioning_clip_top.value = getNum(getVal(s, 0)); + selectByValue(f, 'positioning_clip_top_measurement', getMeasurement(getVal(s, 0))); + f.positioning_clip_right.value = getNum(getVal(s, 1)); + selectByValue(f, 'positioning_clip_right_measurement', getMeasurement(getVal(s, 1))); + f.positioning_clip_bottom.value = getNum(getVal(s, 2)); + selectByValue(f, 'positioning_clip_bottom_measurement', getMeasurement(getVal(s, 2))); + f.positioning_clip_left.value = getNum(getVal(s, 3)); + selectByValue(f, 'positioning_clip_left_measurement', getMeasurement(getVal(s, 3))); + } else { + f.positioning_clip_top.value = getNum(getVal(s, 0)); + selectByValue(f, 'positioning_clip_top_measurement', getMeasurement(getVal(s, 0))); + f.positioning_clip_right.value = f.positioning_clip_bottom.value = f.positioning_clip_left.value; + } + +// setupBox(f, ce, '', 'border', 'Color'); +} + +function getMeasurement(s) { + return s.replace(/^([0-9.]+)(.*)$/, "$2"); +} + +function getNum(s) { + if (new RegExp('^(?:[0-9.]+)(?:[a-z%]+)$', 'gi').test(s)) + return s.replace(/[^0-9.]/g, ''); + + return s; +} + +function inStr(s, n) { + return new RegExp(n, 'gi').test(s); +} + +function getVal(s, i) { + var a = s.split(' '); + + if (a.length > 1) + return a[i]; + + return ""; +} + +function setValue(f, n, v) { + if (f.elements[n].type == "text") + f.elements[n].value = v; + else + selectByValue(f, n, v, true, true); +} + +function setupBox(f, ce, fp, pr, sf, b) { + if (typeof(b) == "undefined") + b = ['Top', 'Right', 'Bottom', 'Left']; + + if (isSame(ce, pr, sf, b)) { + f.elements[fp + "_same"].checked = true; + + setValue(f, fp + "_top", getNum(ce.style[pr + b[0] + sf])); + f.elements[fp + "_top"].disabled = false; + + f.elements[fp + "_right"].value = ""; + f.elements[fp + "_right"].disabled = true; + f.elements[fp + "_bottom"].value = ""; + f.elements[fp + "_bottom"].disabled = true; + f.elements[fp + "_left"].value = ""; + f.elements[fp + "_left"].disabled = true; + + if (f.elements[fp + "_top_measurement"]) { + selectByValue(f, fp + '_top_measurement', getMeasurement(ce.style[pr + b[0] + sf])); + f.elements[fp + "_left_measurement"].disabled = true; + f.elements[fp + "_bottom_measurement"].disabled = true; + f.elements[fp + "_right_measurement"].disabled = true; + } + } else { + f.elements[fp + "_same"].checked = false; + + setValue(f, fp + "_top", getNum(ce.style[pr + b[0] + sf])); + f.elements[fp + "_top"].disabled = false; + + setValue(f, fp + "_right", getNum(ce.style[pr + b[1] + sf])); + f.elements[fp + "_right"].disabled = false; + + setValue(f, fp + "_bottom", getNum(ce.style[pr + b[2] + sf])); + f.elements[fp + "_bottom"].disabled = false; + + setValue(f, fp + "_left", getNum(ce.style[pr + b[3] + sf])); + f.elements[fp + "_left"].disabled = false; + + if (f.elements[fp + "_top_measurement"]) { + selectByValue(f, fp + '_top_measurement', getMeasurement(ce.style[pr + b[0] + sf])); + selectByValue(f, fp + '_right_measurement', getMeasurement(ce.style[pr + b[1] + sf])); + selectByValue(f, fp + '_bottom_measurement', getMeasurement(ce.style[pr + b[2] + sf])); + selectByValue(f, fp + '_left_measurement', getMeasurement(ce.style[pr + b[3] + sf])); + f.elements[fp + "_left_measurement"].disabled = false; + f.elements[fp + "_bottom_measurement"].disabled = false; + f.elements[fp + "_right_measurement"].disabled = false; + } + } +} + +function isSame(e, pr, sf, b) { + var a = [], i, x; + + if (typeof(b) == "undefined") + b = ['Top', 'Right', 'Bottom', 'Left']; + + if (typeof(sf) == "undefined" || sf == null) + sf = ""; + + a[0] = e.style[pr + b[0] + sf]; + a[1] = e.style[pr + b[1] + sf]; + a[2] = e.style[pr + b[2] + sf]; + a[3] = e.style[pr + b[3] + sf]; + + for (i=0; i 0 ? s.substring(1) : s; + + if (f.text_none.checked) + s = "none"; + + ce.style.textDecoration = s; + + // Build background styles + + ce.style.backgroundColor = f.background_color.value; + ce.style.backgroundImage = f.background_image.value != "" ? "url(" + f.background_image.value + ")" : ""; + ce.style.backgroundRepeat = f.background_repeat.value; + ce.style.backgroundAttachment = f.background_attachment.value; + + if (f.background_hpos.value != "") { + s = ""; + s += f.background_hpos.value + (isNum(f.background_hpos.value) ? f.background_hpos_measurement.value : "") + " "; + s += f.background_vpos.value + (isNum(f.background_vpos.value) ? f.background_vpos_measurement.value : ""); + ce.style.backgroundPosition = s; + } + + // Build block styles + + ce.style.wordSpacing = f.block_wordspacing.value + (isNum(f.block_wordspacing.value) ? f.block_wordspacing_measurement.value : ""); + ce.style.letterSpacing = f.block_letterspacing.value + (isNum(f.block_letterspacing.value) ? f.block_letterspacing_measurement.value : ""); + ce.style.verticalAlign = f.block_vertical_alignment.value; + ce.style.textAlign = f.block_text_align.value; + ce.style.textIndent = f.block_text_indent.value + (isNum(f.block_text_indent.value) ? f.block_text_indent_measurement.value : ""); + ce.style.whiteSpace = f.block_whitespace.value; + ce.style.display = f.block_display.value; + + // Build box styles + + ce.style.width = f.box_width.value + (isNum(f.box_width.value) ? f.box_width_measurement.value : ""); + ce.style.height = f.box_height.value + (isNum(f.box_height.value) ? f.box_height_measurement.value : ""); + ce.style.styleFloat = f.box_float.value; + + if (tinymce.isGecko) + ce.style.cssFloat = f.box_float.value; + + ce.style.clear = f.box_clear.value; + + if (!f.box_padding_same.checked) { + ce.style.paddingTop = f.box_padding_top.value + (isNum(f.box_padding_top.value) ? f.box_padding_top_measurement.value : ""); + ce.style.paddingRight = f.box_padding_right.value + (isNum(f.box_padding_right.value) ? f.box_padding_right_measurement.value : ""); + ce.style.paddingBottom = f.box_padding_bottom.value + (isNum(f.box_padding_bottom.value) ? f.box_padding_bottom_measurement.value : ""); + ce.style.paddingLeft = f.box_padding_left.value + (isNum(f.box_padding_left.value) ? f.box_padding_left_measurement.value : ""); + } else + ce.style.padding = f.box_padding_top.value + (isNum(f.box_padding_top.value) ? f.box_padding_top_measurement.value : ""); + + if (!f.box_margin_same.checked) { + ce.style.marginTop = f.box_margin_top.value + (isNum(f.box_margin_top.value) ? f.box_margin_top_measurement.value : ""); + ce.style.marginRight = f.box_margin_right.value + (isNum(f.box_margin_right.value) ? f.box_margin_right_measurement.value : ""); + ce.style.marginBottom = f.box_margin_bottom.value + (isNum(f.box_margin_bottom.value) ? f.box_margin_bottom_measurement.value : ""); + ce.style.marginLeft = f.box_margin_left.value + (isNum(f.box_margin_left.value) ? f.box_margin_left_measurement.value : ""); + } else + ce.style.margin = f.box_margin_top.value + (isNum(f.box_margin_top.value) ? f.box_margin_top_measurement.value : ""); + + // Build border styles + + if (!f.border_style_same.checked) { + ce.style.borderTopStyle = f.border_style_top.value; + ce.style.borderRightStyle = f.border_style_right.value; + ce.style.borderBottomStyle = f.border_style_bottom.value; + ce.style.borderLeftStyle = f.border_style_left.value; + } else + ce.style.borderStyle = f.border_style_top.value; + + if (!f.border_width_same.checked) { + ce.style.borderTopWidth = f.border_width_top.value + (isNum(f.border_width_top.value) ? f.border_width_top_measurement.value : ""); + ce.style.borderRightWidth = f.border_width_right.value + (isNum(f.border_width_right.value) ? f.border_width_right_measurement.value : ""); + ce.style.borderBottomWidth = f.border_width_bottom.value + (isNum(f.border_width_bottom.value) ? f.border_width_bottom_measurement.value : ""); + ce.style.borderLeftWidth = f.border_width_left.value + (isNum(f.border_width_left.value) ? f.border_width_left_measurement.value : ""); + } else + ce.style.borderWidth = f.border_width_top.value + (isNum(f.border_width_top.value) ? f.border_width_top_measurement.value : ""); + + if (!f.border_color_same.checked) { + ce.style.borderTopColor = f.border_color_top.value; + ce.style.borderRightColor = f.border_color_right.value; + ce.style.borderBottomColor = f.border_color_bottom.value; + ce.style.borderLeftColor = f.border_color_left.value; + } else + ce.style.borderColor = f.border_color_top.value; + + // Build list styles + + ce.style.listStyleType = f.list_type.value; + ce.style.listStylePosition = f.list_position.value; + ce.style.listStyleImage = f.list_bullet_image.value != "" ? "url(" + f.list_bullet_image.value + ")" : ""; + + // Build positioning styles + + ce.style.position = f.positioning_type.value; + ce.style.visibility = f.positioning_visibility.value; + + if (ce.style.width == "") + ce.style.width = f.positioning_width.value + (isNum(f.positioning_width.value) ? f.positioning_width_measurement.value : ""); + + if (ce.style.height == "") + ce.style.height = f.positioning_height.value + (isNum(f.positioning_height.value) ? f.positioning_height_measurement.value : ""); + + ce.style.zIndex = f.positioning_zindex.value; + ce.style.overflow = f.positioning_overflow.value; + + if (!f.positioning_placement_same.checked) { + ce.style.top = f.positioning_placement_top.value + (isNum(f.positioning_placement_top.value) ? f.positioning_placement_top_measurement.value : ""); + ce.style.right = f.positioning_placement_right.value + (isNum(f.positioning_placement_right.value) ? f.positioning_placement_right_measurement.value : ""); + ce.style.bottom = f.positioning_placement_bottom.value + (isNum(f.positioning_placement_bottom.value) ? f.positioning_placement_bottom_measurement.value : ""); + ce.style.left = f.positioning_placement_left.value + (isNum(f.positioning_placement_left.value) ? f.positioning_placement_left_measurement.value : ""); + } else { + s = f.positioning_placement_top.value + (isNum(f.positioning_placement_top.value) ? f.positioning_placement_top_measurement.value : ""); + ce.style.top = s; + ce.style.right = s; + ce.style.bottom = s; + ce.style.left = s; + } + + if (!f.positioning_clip_same.checked) { + s = "rect("; + s += (isNum(f.positioning_clip_top.value) ? f.positioning_clip_top.value + f.positioning_clip_top_measurement.value : "auto") + " "; + s += (isNum(f.positioning_clip_right.value) ? f.positioning_clip_right.value + f.positioning_clip_right_measurement.value : "auto") + " "; + s += (isNum(f.positioning_clip_bottom.value) ? f.positioning_clip_bottom.value + f.positioning_clip_bottom_measurement.value : "auto") + " "; + s += (isNum(f.positioning_clip_left.value) ? f.positioning_clip_left.value + f.positioning_clip_left_measurement.value : "auto"); + s += ")"; + + if (s != "rect(auto auto auto auto)") + ce.style.clip = s; + } else { + s = "rect("; + t = isNum(f.positioning_clip_top.value) ? f.positioning_clip_top.value + f.positioning_clip_top_measurement.value : "auto"; + s += t + " "; + s += t + " "; + s += t + " "; + s += t + ")"; + + if (s != "rect(auto auto auto auto)") + ce.style.clip = s; + } + + ce.style.cssText = ce.style.cssText; +} + +function isNum(s) { + return new RegExp('[0-9]+', 'g').test(s); +} + +function showDisabledControls() { + var f = document.forms, i, a; + + for (i=0; i 1) { + addSelectValue(f, s, p[0], p[1]); + + if (se) + selectByValue(f, s, p[1]); + } else { + addSelectValue(f, s, p[0], p[0]); + + if (se) + selectByValue(f, s, p[0]); + } + } +} + +function toggleSame(ce, pre) { + var el = document.forms[0].elements, i; + + if (ce.checked) { + el[pre + "_top"].disabled = false; + el[pre + "_right"].disabled = true; + el[pre + "_bottom"].disabled = true; + el[pre + "_left"].disabled = true; + + if (el[pre + "_top_measurement"]) { + el[pre + "_top_measurement"].disabled = false; + el[pre + "_right_measurement"].disabled = true; + el[pre + "_bottom_measurement"].disabled = true; + el[pre + "_left_measurement"].disabled = true; + } + } else { + el[pre + "_top"].disabled = false; + el[pre + "_right"].disabled = false; + el[pre + "_bottom"].disabled = false; + el[pre + "_left"].disabled = false; + + if (el[pre + "_top_measurement"]) { + el[pre + "_top_measurement"].disabled = false; + el[pre + "_right_measurement"].disabled = false; + el[pre + "_bottom_measurement"].disabled = false; + el[pre + "_left_measurement"].disabled = false; + } + } + + showDisabledControls(); +} + +function synch(fr, to) { + var f = document.forms[0]; + + f.elements[to].value = f.elements[fr].value; + + if (f.elements[fr + "_measurement"]) + selectByValue(f, to + "_measurement", f.elements[fr + "_measurement"].value); +} + +tinyMCEPopup.onInit.add(init); diff --git a/web/libs/tiny_mce/plugins/style/langs/en_dlg.js b/web/libs/tiny_mce/plugins/style/langs/en_dlg.js new file mode 100644 index 0000000..5026313 --- /dev/null +++ b/web/libs/tiny_mce/plugins/style/langs/en_dlg.js @@ -0,0 +1,63 @@ +tinyMCE.addI18n('en.style_dlg',{ +title:"Edit CSS Style", +apply:"Apply", +text_tab:"Text", +background_tab:"Background", +block_tab:"Block", +box_tab:"Box", +border_tab:"Border", +list_tab:"List", +positioning_tab:"Positioning", +text_props:"Text", +text_font:"Font", +text_size:"Size", +text_weight:"Weight", +text_style:"Style", +text_variant:"Variant", +text_lineheight:"Line height", +text_case:"Case", +text_color:"Color", +text_decoration:"Decoration", +text_overline:"overline", +text_underline:"underline", +text_striketrough:"strikethrough", +text_blink:"blink", +text_none:"none", +background_color:"Background color", +background_image:"Background image", +background_repeat:"Repeat", +background_attachment:"Attachment", +background_hpos:"Horizontal position", +background_vpos:"Vertical position", +block_wordspacing:"Word spacing", +block_letterspacing:"Letter spacing", +block_vertical_alignment:"Vertical alignment", +block_text_align:"Text align", +block_text_indent:"Text indent", +block_whitespace:"Whitespace", +block_display:"Display", +box_width:"Width", +box_height:"Height", +box_float:"Float", +box_clear:"Clear", +padding:"Padding", +same:"Same for all", +top:"Top", +right:"Right", +bottom:"Bottom", +left:"Left", +margin:"Margin", +style:"Style", +width:"Width", +height:"Height", +color:"Color", +list_type:"Type", +bullet_image:"Bullet image", +position:"Position", +positioning_type:"Type", +visibility:"Visibility", +zindex:"Z-index", +overflow:"Overflow", +placement:"Placement", +clip:"Clip" +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/style/props.htm b/web/libs/tiny_mce/plugins/style/props.htm new file mode 100644 index 0000000..549ed04 --- /dev/null +++ b/web/libs/tiny_mce/plugins/style/props.htm @@ -0,0 +1,723 @@ + + + + {#style_dlg.title} + + + + + + + + + +
+ + +
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + +
 
+
+ +
+ + + +
+ + + + + + +
+ +  
+
+ +
+ + + + + +
 
+
{#style_dlg.text_decoration} + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
 
+
+ + + + +
 
+
+ + + + + + +
 
+
+ + + + + + +
 
+
+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
 
+
+ + + + + + +
 
+
+ + + + + + +
 
+
+
+ +
+ + + + + + + + + + + + + + +
+ + + + + + +
 
+
   
+ + + + + + +
 
+
   
+
+
+ {#style_dlg.padding} + + + + + + + + + + + + + + + + + + + + + + +
 
+ + + + + + +
 
+
+ + + + + + +
 
+
+ + + + + + +
 
+
+ + + + + + +
 
+
+
+
+ +
+
+ {#style_dlg.margin} + + + + + + + + + + + + + + + + + + + + + + +
 
+ + + + + + +
 
+
+ + + + + + +
 
+
+ + + + + + +
 
+
+ + + + + + +
 
+
+
+
+
+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
  {#style_dlg.style} {#style_dlg.width} {#style_dlg.color}
      
{#style_dlg.top}   + + + + + + +
 
+
  + + + + + +
 
+
{#style_dlg.right}   + + + + + + +
 
+
  + + + + + +
 
+
{#style_dlg.bottom}   + + + + + + +
 
+
  + + + + + +
 
+
{#style_dlg.left}   + + + + + + +
 
+
  + + + + + +
 
+
+
+ +
+ + + + + + + + + + + + + + + +
+
+ +
+ + + + + + + + + + + + + + + + + + + + + +
   
+ + + + + + +
 
+
   
+ + + + + + +
 
+
   
+ +
+
+ {#style_dlg.placement} + + + + + + + + + + + + + + + + + + + + + + +
 
{#style_dlg.top} + + + + + + +
 
+
{#style_dlg.right} + + + + + + +
 
+
{#style_dlg.bottom} + + + + + + +
 
+
{#style_dlg.left} + + + + + + +
 
+
+
+
+ +
+
+ {#style_dlg.clip} + + + + + + + + + + + + + + + + + + + + + + +
 
{#style_dlg.top} + + + + + + +
 
+
{#style_dlg.right} + + + + + + +
 
+
{#style_dlg.bottom} + + + + + + +
 
+
{#style_dlg.left} + + + + + + +
 
+
+
+
+
+
+
+ +
+ + + +
+
+ +
+
+
+ + + diff --git a/web/libs/tiny_mce/plugins/tabfocus/editor_plugin.js b/web/libs/tiny_mce/plugins/tabfocus/editor_plugin.js new file mode 100644 index 0000000..27d2440 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tabfocus/editor_plugin.js @@ -0,0 +1 @@ +(function(){var c=tinymce.DOM,a=tinymce.dom.Event,d=tinymce.each,b=tinymce.explode;tinymce.create("tinymce.plugins.TabFocusPlugin",{init:function(f,g){function e(i,j){if(j.keyCode===9){return a.cancel(j)}}function h(l,p){var j,m,o,n,k;function q(i){o=c.getParent(l.id,"form");n=o.elements;if(o){d(n,function(s,r){if(s.id==l.id){j=r;return false}});if(i>0){for(m=j+1;m=0;m--){if(n[m].type!="hidden"){return n[m]}}}}return null}if(p.keyCode===9){k=b(l.getParam("tab_focus",l.getParam("tabfocus_elements",":prev,:next")));if(k.length==1){k[1]=k[0];k[0]=":prev"}if(p.shiftKey){if(k[0]==":prev"){n=q(-1)}else{n=c.get(k[0])}}else{if(k[1]==":next"){n=q(1)}else{n=c.get(k[1])}}if(n){if(l=tinymce.get(n.id||n.name)){l.focus()}else{window.setTimeout(function(){window.focus();n.focus()},10)}return a.cancel(p)}}}f.onKeyUp.add(e);if(tinymce.isGecko){f.onKeyPress.add(h);f.onKeyDown.add(e)}else{f.onKeyDown.add(h)}f.onInit.add(function(){d(c.select("a:first,a:last",f.getContainer()),function(i){a.add(i,"focus",function(){f.focus()})})})},getInfo:function(){return{longname:"Tabfocus",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/tabfocus",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("tabfocus",tinymce.plugins.TabFocusPlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tabfocus/editor_plugin_src.js b/web/libs/tiny_mce/plugins/tabfocus/editor_plugin_src.js new file mode 100644 index 0000000..c2be2f4 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tabfocus/editor_plugin_src.js @@ -0,0 +1,112 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + var DOM = tinymce.DOM, Event = tinymce.dom.Event, each = tinymce.each, explode = tinymce.explode; + + tinymce.create('tinymce.plugins.TabFocusPlugin', { + init : function(ed, url) { + function tabCancel(ed, e) { + if (e.keyCode === 9) + return Event.cancel(e); + }; + + function tabHandler(ed, e) { + var x, i, f, el, v; + + function find(d) { + f = DOM.getParent(ed.id, 'form'); + el = f.elements; + + if (f) { + each(el, function(e, i) { + if (e.id == ed.id) { + x = i; + return false; + } + }); + + if (d > 0) { + for (i = x + 1; i < el.length; i++) { + if (el[i].type != 'hidden') + return el[i]; + } + } else { + for (i = x - 1; i >= 0; i--) { + if (el[i].type != 'hidden') + return el[i]; + } + } + } + + return null; + }; + + if (e.keyCode === 9) { + v = explode(ed.getParam('tab_focus', ed.getParam('tabfocus_elements', ':prev,:next'))); + + if (v.length == 1) { + v[1] = v[0]; + v[0] = ':prev'; + } + + // Find element to focus + if (e.shiftKey) { + if (v[0] == ':prev') + el = find(-1); + else + el = DOM.get(v[0]); + } else { + if (v[1] == ':next') + el = find(1); + else + el = DOM.get(v[1]); + } + + if (el) { + if (ed = tinymce.get(el.id || el.name)) + ed.focus(); + else + window.setTimeout(function() {window.focus();el.focus();}, 10); + + return Event.cancel(e); + } + } + }; + + ed.onKeyUp.add(tabCancel); + + if (tinymce.isGecko) { + ed.onKeyPress.add(tabHandler); + ed.onKeyDown.add(tabCancel); + } else + ed.onKeyDown.add(tabHandler); + + ed.onInit.add(function() { + each(DOM.select('a:first,a:last', ed.getContainer()), function(n) { + Event.add(n, 'focus', function() {ed.focus();}); + }); + }); + }, + + getInfo : function() { + return { + longname : 'Tabfocus', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/tabfocus', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('tabfocus', tinymce.plugins.TabFocusPlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/table/cell.htm b/web/libs/tiny_mce/plugins/table/cell.htm new file mode 100644 index 0000000..d243e1d --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/cell.htm @@ -0,0 +1,178 @@ + + + + {#table_dlg.cell_title} + + + + + + + + +
+ + +
+
+
+ {#table_dlg.general_props} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + +
+ + + +
+ +
+
+
+ +
+
+ {#table_dlg.advanced_props} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + + + + +
 
+
+ + + + + +
 
+
+ + + + + +
 
+
+
+
+
+ +
+
+ +
+ + + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/table/css/cell.css b/web/libs/tiny_mce/plugins/table/css/cell.css new file mode 100644 index 0000000..a067ecd --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/css/cell.css @@ -0,0 +1,17 @@ +/* CSS file for cell dialog in the table plugin */ + +.panel_wrapper div.current { + height: 200px; +} + +.advfield { + width: 200px; +} + +#action { + margin-bottom: 3px; +} + +#class { + width: 150px; +} \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/table/css/row.css b/web/libs/tiny_mce/plugins/table/css/row.css new file mode 100644 index 0000000..1f7755d --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/css/row.css @@ -0,0 +1,25 @@ +/* CSS file for row dialog in the table plugin */ + +.panel_wrapper div.current { + height: 200px; +} + +.advfield { + width: 200px; +} + +#action { + margin-bottom: 3px; +} + +#rowtype,#align,#valign,#class,#height { + width: 150px; +} + +#height { + width: 50px; +} + +.col2 { + padding-left: 20px; +} diff --git a/web/libs/tiny_mce/plugins/table/css/table.css b/web/libs/tiny_mce/plugins/table/css/table.css new file mode 100644 index 0000000..d11c3f6 --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/css/table.css @@ -0,0 +1,13 @@ +/* CSS file for table dialog in the table plugin */ + +.panel_wrapper div.current { + height: 245px; +} + +.advfield { + width: 200px; +} + +#class { + width: 150px; +} diff --git a/web/libs/tiny_mce/plugins/table/editor_plugin.js b/web/libs/tiny_mce/plugins/table/editor_plugin.js new file mode 100644 index 0000000..266d7d5 --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/editor_plugin.js @@ -0,0 +1 @@ +(function(b){var c=b.each;function a(F,E,I){var e,J,B,n;r();n=E.getParent(I.getStart(),"th,td");if(n){J=D(n);B=G();n=v(J.x,J.y)}function w(L,K){L=L.cloneNode(K);L.removeAttribute("id");return L}function r(){var K=0;e=[];c(["thead","tbody","tfoot"],function(L){var M=E.select(L+" tr",F);c(M,function(N,O){O+=K;c(E.select("td,th",N),function(U,P){var Q,R,S,T;if(e[O]){while(e[O][P]){P++}}S=g(U,"rowspan");T=g(U,"colspan");for(R=O;R'}return false}},"childNodes");K=w(K,false);K.rowSpan=K.colSpan=1;if(L){K.appendChild(L)}else{if(!b.isIE){K.innerHTML='
'}}return K}function p(){var K=E.createRng();c(E.select("tr",F),function(L){if(L.cells.length==0){E.remove(L)}});if(E.select("tr",F).length==0){K.setStartAfter(F);K.setEndAfter(F);I.setRng(K);E.remove(F);return}c(E.select("thead,tbody,tfoot",F),function(L){if(L.rows.length==0){E.remove(L)}});r();row=e[Math.min(e.length-1,J.y)];if(row){I.select(row[Math.min(row.length-1,J.x)].elm,true);I.collapse(true)}}function s(Q,O,S,P){var N,L,K,M,R;N=e[O][Q].elm.parentNode;for(K=1;K<=S;K++){N=E.getNext(N,"tr");if(N){for(L=Q;L>=0;L--){R=e[O+K][L].elm;if(R.parentNode==N){for(M=1;M<=P;M++){E.insertAfter(d(R),R)}break}}if(L==-1){for(M=1;M<=P;M++){N.insertBefore(d(N.cells[0]),N.cells[0])}}}}}function A(){c(e,function(K,L){c(K,function(N,M){var Q,P,R,O;if(h(N)){N=N.elm;Q=g(N,"colspan");P=g(N,"rowspan");if(Q>1||P>1){N.colSpan=N.rowSpan=1;for(O=0;O1){P.rowSpan=rowSpan+1;continue}}else{if(K>0&&e[K-1][O]){S=e[K-1][O].elm;rowSpan=g(S,"rowspan");if(rowSpan>1){S.rowSpan=rowSpan+1;continue}}}L=d(P);L.colSpan=P.colSpan;R.appendChild(L);M=P}}if(R.hasChildNodes()){if(!N){E.insertAfter(R,Q)}else{Q.parentNode.insertBefore(R,Q)}}}function f(L){var M,K;c(e,function(N,O){c(N,function(Q,P){if(h(Q)){M=P;if(L){return false}}});if(L){return !M}});c(e,function(Q,R){var N=Q[M].elm,O,P;if(N!=K){P=g(N,"colspan");O=g(N,"rowspan");if(P==1){if(!L){E.insertAfter(d(N),N);s(M,R,O-1,P)}else{N.parentNode.insertBefore(d(N),N);s(M,R,O-1,P)}}else{N.colSpan++}K=N}})}function m(){var K=[];c(e,function(L,M){c(L,function(O,N){if(h(O)&&b.inArray(K,N)===-1){c(e,function(R){var P=R[N].elm,Q;Q=g(P,"colspan");if(Q>1){P.colSpan=Q-1}else{E.remove(P)}});K.push(N)}})});p()}function l(){var L;function K(O){var N,P,M;N=E.getNext(O,"tr");c(O.cells,function(Q){var R=g(Q,"rowspan");if(R>1){Q.rowSpan=R-1;P=D(Q);s(P.x,P.y,1,1)}});P=D(O.cells[0]);c(e[P.y],function(Q){var R;Q=Q.elm;if(Q!=M){R=g(Q,"rowspan");if(R<=1){E.remove(Q)}else{Q.rowSpan=R-1}M=Q}})}L=j();c(L.reverse(),function(M){K(M)});p()}function C(){var K=j();E.remove(K);p();return K}function H(){var K=j();c(K,function(M,L){K[L]=w(M,true)});return K}function z(M,L){var N=j(),K=N[L?0:N.length-1],O=K.cells.length;c(e,function(Q){var P;O=0;c(Q,function(S,R){if(S.real){O+=S.colspan}if(S.elm.parentNode==K){P=1}});if(P){return false}});if(!L){M.reverse()}c(M,function(R){var Q=R.cells.length,P;for(i=0;iL){L=P}if(O>K){K=O}if(Q.real){S=Q.colspan-1;R=Q.rowspan-1;if(S){if(P+S>L){L=P+S}}if(R){if(O+R>K){K=O+R}}}}})});return{x:L,y:K}}function t(Q){var N,M,S,R,L,K,O,P;B=D(Q);if(J&&B){N=Math.min(J.x,B.x);M=Math.min(J.y,B.y);S=Math.max(J.x,B.x);R=Math.max(J.y,B.y);L=S;K=R;for(y=M;y<=K;y++){Q=e[y][N];if(!Q.real){if(N-(Q.colspan-1)L){L=x+O}}if(P){if(y+P>K){K=y+P}}}}}E.removeClass(E.select("td.mceSelected,th.mceSelected"),"mceSelected");for(y=M;y<=K;y++){for(x=N;x<=L;x++){E.addClass(e[y][x].elm,"mceSelected")}}}}b.extend(this,{deleteTable:q,split:A,merge:o,insertRow:k,insertCol:f,deleteCols:m,deleteRows:l,cutRows:C,copyRows:H,pasteRows:z,getPos:D,setStartCell:u,setEndCell:t})}b.create("tinymce.plugins.TablePlugin",{init:function(e,f){var d,j;function h(m){var l=e.selection,k=e.dom.getParent(m||l.getNode(),"table");if(k){return new a(k,e.dom,l)}}function g(){e.getBody().style.webkitUserSelect="";e.dom.removeClass(e.dom.select("td.mceSelected,th.mceSelected"),"mceSelected")}c([["table","table.desc","mceInsertTable",true],["delete_table","table.del","mceTableDelete"],["delete_col","table.delete_col_desc","mceTableDeleteCol"],["delete_row","table.delete_row_desc","mceTableDeleteRow"],["col_after","table.col_after_desc","mceTableInsertColAfter"],["col_before","table.col_before_desc","mceTableInsertColBefore"],["row_after","table.row_after_desc","mceTableInsertRowAfter"],["row_before","table.row_before_desc","mceTableInsertRowBefore"],["row_props","table.row_desc","mceTableRowProps",true],["cell_props","table.cell_desc","mceTableCellProps",true],["split_cells","table.split_cells_desc","mceTableSplitCells",true],["merge_cells","table.merge_cells_desc","mceTableMergeCells",true]],function(k){e.addButton(k[0],{title:k[1],cmd:k[2],ui:k[3]})});if(!b.isIE){e.onClick.add(function(k,l){l=l.target;if(l.nodeName==="TABLE"){k.selection.select(l)}})}e.onNodeChange.add(function(l,k,o){var m;o=l.selection.getStart();m=l.dom.getParent(o,"td,th,caption");k.setActive("table",o.nodeName==="TABLE"||!!m);if(m&&m.nodeName==="CAPTION"){m=0}k.setDisabled("delete_table",!m);k.setDisabled("delete_col",!m);k.setDisabled("delete_table",!m);k.setDisabled("delete_row",!m);k.setDisabled("col_after",!m);k.setDisabled("col_before",!m);k.setDisabled("row_after",!m);k.setDisabled("row_before",!m);k.setDisabled("row_props",!m);k.setDisabled("cell_props",!m);k.setDisabled("split_cells",!m);k.setDisabled("merge_cells",!m)});e.onInit.add(function(l){var k,o,p=l.dom,m;d=l.windowManager;l.onMouseDown.add(function(q,r){if(r.button!=2){g();o=p.getParent(r.target,"td,th");k=p.getParent(o,"table")}});p.bind(l.getDoc(),"mouseover",function(t){var r,q,s=t.target;if(o&&(m||s!=o)&&(s.nodeName=="TD"||s.nodeName=="TH")){q=p.getParent(s,"table");if(q==k){if(!m){m=h(q);m.setStartCell(o);l.getBody().style.webkitUserSelect="none"}m.setEndCell(s)}r=l.selection.getSel();if(r.removeAllRanges){r.removeAllRanges()}else{r.empty()}t.preventDefault()}});l.onMouseUp.add(function(z,A){var r,t=z.selection,B,C=t.getSel(),q,u,s,w;if(o){if(m){z.getBody().style.webkitUserSelect=""}function v(D,F){var E=new b.dom.TreeWalker(D,D);do{if(D.nodeType==3&&b.trim(D.nodeValue).length!=0){if(F){r.setStart(D,0)}else{r.setEnd(D,D.nodeValue.length)}return}if(D.nodeName=="BR"){if(F){r.setStartBefore(D)}else{r.setEndBefore(D)}return}}while(D=(F?E.next():E.prev()))}B=p.select("td.mceSelected,th.mceSelected");if(B.length>0){r=p.createRng();u=B[0];w=B[B.length-1];v(u,1);q=new b.dom.TreeWalker(u,p.getParent(B[0],"table"));do{if(u.nodeName=="TD"||u.nodeName=="TH"){if(!p.hasClass(u,"mceSelected")){break}s=u}}while(u=q.next());v(s);t.setRng(r)}z.nodeChanged();o=m=k=null}});l.onKeyUp.add(function(q,r){g()});if(l&&l.plugins.contextmenu){l.plugins.contextmenu.onContextMenu.add(function(s,q,u){var v,t=l.selection,r=t.getNode()||l.getBody();if(l.dom.getParent(u,"td")||l.dom.getParent(u,"th")||l.dom.select("td.mceSelected,th.mceSelected").length){q.removeAll();if(r.nodeName=="A"&&!l.dom.getAttrib(r,"name")){q.add({title:"advanced.link_desc",icon:"link",cmd:l.plugins.advlink?"mceAdvLink":"mceLink",ui:true});q.add({title:"advanced.unlink_desc",icon:"unlink",cmd:"UnLink"});q.addSeparator()}if(r.nodeName=="IMG"&&r.className.indexOf("mceItem")==-1){q.add({title:"advanced.image_desc",icon:"image",cmd:l.plugins.advimage?"mceAdvImage":"mceImage",ui:true});q.addSeparator()}q.add({title:"table.desc",icon:"table",cmd:"mceInsertTable",value:{action:"insert"}});q.add({title:"table.props_desc",icon:"table_props",cmd:"mceInsertTable"});q.add({title:"table.del",icon:"delete_table",cmd:"mceTableDelete"});q.addSeparator();v=q.addMenu({title:"table.cell"});v.add({title:"table.cell_desc",icon:"cell_props",cmd:"mceTableCellProps"});v.add({title:"table.split_cells_desc",icon:"split_cells",cmd:"mceTableSplitCells"});v.add({title:"table.merge_cells_desc",icon:"merge_cells",cmd:"mceTableMergeCells"});v=q.addMenu({title:"table.row"});v.add({title:"table.row_desc",icon:"row_props",cmd:"mceTableRowProps"});v.add({title:"table.row_before_desc",icon:"row_before",cmd:"mceTableInsertRowBefore"});v.add({title:"table.row_after_desc",icon:"row_after",cmd:"mceTableInsertRowAfter"});v.add({title:"table.delete_row_desc",icon:"delete_row",cmd:"mceTableDeleteRow"});v.addSeparator();v.add({title:"table.cut_row_desc",icon:"cut",cmd:"mceTableCutRow"});v.add({title:"table.copy_row_desc",icon:"copy",cmd:"mceTableCopyRow"});v.add({title:"table.paste_row_before_desc",icon:"paste",cmd:"mceTablePasteRowBefore"}).setDisabled(!j);v.add({title:"table.paste_row_after_desc",icon:"paste",cmd:"mceTablePasteRowAfter"}).setDisabled(!j);v=q.addMenu({title:"table.col"});v.add({title:"table.col_before_desc",icon:"col_before",cmd:"mceTableInsertColBefore"});v.add({title:"table.col_after_desc",icon:"col_after",cmd:"mceTableInsertColAfter"});v.add({title:"table.delete_col_desc",icon:"delete_col",cmd:"mceTableDeleteCol"})}else{q.add({title:"table.desc",icon:"table",cmd:"mceInsertTable"})}})}if(!b.isIE){function n(){var q;for(q=l.getBody().lastChild;q&&q.nodeType==3&&!q.nodeValue.length;q=q.previousSibling){}if(q&&q.nodeName=="TABLE"){l.dom.add(l.getBody(),"p",null,'
')}}if(b.isGecko){l.onKeyDown.add(function(r,t){var q,s,u=r.dom;if(t.keyCode==37||t.keyCode==38){q=r.selection.getRng();s=u.getParent(q.startContainer,"table");if(s&&r.getBody().firstChild==s){if(isAtStart(q,s)){q=u.createRng();q.setStartBefore(s);q.setEndBefore(s);r.selection.setRng(q);t.preventDefault()}}}})}l.onKeyUp.add(n);l.onSetContent.add(n);l.onVisualAid.add(n);l.onPreProcess.add(function(q,s){var r=s.node.lastChild;if(r&&r.childNodes.length==1&&r.firstChild.nodeName=="BR"){q.dom.remove(r)}});n()}});c({mceTableSplitCells:function(k){k.split()},mceTableMergeCells:function(l){var m,n,k;k=e.dom.getParent(e.selection.getNode(),"th,td");if(k){m=k.rowSpan;n=k.colSpan}if(!e.dom.select("td.mceSelected,th.mceSelected").length){d.open({url:f+"/merge_cells.htm",width:240+parseInt(e.getLang("table.merge_cells_delta_width",0)),height:110+parseInt(e.getLang("table.merge_cells_delta_height",0)),inline:1},{rows:m,cols:n,onaction:function(o){l.merge(k,o.cols,o.rows)},plugin_url:f})}else{l.merge()}},mceTableInsertRowBefore:function(k){k.insertRow(true)},mceTableInsertRowAfter:function(k){k.insertRow()},mceTableInsertColBefore:function(k){k.insertCol(true)},mceTableInsertColAfter:function(k){k.insertCol()},mceTableDeleteCol:function(k){k.deleteCols()},mceTableDeleteRow:function(k){k.deleteRows()},mceTableCutRow:function(k){j=k.cutRows()},mceTableCopyRow:function(k){j=k.copyRows()},mceTablePasteRowBefore:function(k){k.pasteRows(j,true)},mceTablePasteRowAfter:function(k){k.pasteRows(j)},mceTableDelete:function(k){k.deleteTable()}},function(l,k){e.addCommand(k,function(){var m=h();if(m){l(m);e.execCommand("mceRepaint");g()}})});c({mceInsertTable:function(k){d.open({url:f+"/table.htm",width:400+parseInt(e.getLang("table.table_delta_width",0)),height:320+parseInt(e.getLang("table.table_delta_height",0)),inline:1},{plugin_url:f,action:k?k.action:0})},mceTableRowProps:function(){d.open({url:f+"/row.htm",width:400+parseInt(e.getLang("table.rowprops_delta_width",0)),height:295+parseInt(e.getLang("table.rowprops_delta_height",0)),inline:1},{plugin_url:f})},mceTableCellProps:function(){d.open({url:f+"/cell.htm",width:400+parseInt(e.getLang("table.cellprops_delta_width",0)),height:295+parseInt(e.getLang("table.cellprops_delta_height",0)),inline:1},{plugin_url:f})}},function(l,k){e.addCommand(k,function(m,n){l(n)})})}});b.PluginManager.add("table",b.plugins.TablePlugin)})(tinymce); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/table/editor_plugin_src.js b/web/libs/tiny_mce/plugins/table/editor_plugin_src.js new file mode 100644 index 0000000..c2f307f --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/editor_plugin_src.js @@ -0,0 +1,1125 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function(tinymce) { + var each = tinymce.each; + + /** + * Table Grid class. + */ + function TableGrid(table, dom, selection) { + var grid, startPos, endPos, selectedCell; + + buildGrid(); + selectedCell = dom.getParent(selection.getStart(), 'th,td'); + if (selectedCell) { + startPos = getPos(selectedCell); + endPos = findEndPos(); + selectedCell = getCell(startPos.x, startPos.y); + } + + function cloneNode(node, children) { + node = node.cloneNode(children); + node.removeAttribute('id'); + + return node; + } + + function buildGrid() { + var startY = 0; + + grid = []; + + each(['thead', 'tbody', 'tfoot'], function(part) { + var rows = dom.select(part + ' tr', table); + + each(rows, function(tr, y) { + y += startY; + + each(dom.select('td,th', tr), function(td, x) { + var x2, y2, rowspan, colspan; + + // Skip over existing cells produced by rowspan + if (grid[y]) { + while (grid[y][x]) + x++; + } + + // Get col/rowspan from cell + rowspan = getSpanVal(td, 'rowspan'); + colspan = getSpanVal(td, 'colspan'); + + // Fill out rowspan/colspan right and down + for (y2 = y; y2 < y + rowspan; y2++) { + if (!grid[y2]) + grid[y2] = []; + + for (x2 = x; x2 < x + colspan; x2++) { + grid[y2][x2] = { + part : part, + real : y2 == y && x2 == x, + elm : td, + rowspan : rowspan, + colspan : colspan + }; + } + } + }); + }); + + startY += rows.length; + }); + }; + + function getCell(x, y) { + var row; + + row = grid[y]; + if (row) + return row[x]; + }; + + function getSpanVal(td, name) { + return parseInt(td.getAttribute(name) || 1); + }; + + function isCellSelected(cell) { + return dom.hasClass(cell.elm, 'mceSelected') || cell == selectedCell; + }; + + function getSelectedRows() { + var rows = []; + + each(table.rows, function(row) { + each(row.cells, function(cell) { + if (dom.hasClass(cell, 'mceSelected') || cell == selectedCell.elm) { + rows.push(row); + return false; + } + }); + }); + + return rows; + }; + + function deleteTable() { + var rng = dom.createRng(); + + rng.setStartAfter(table); + rng.setEndAfter(table); + + selection.setRng(rng); + + dom.remove(table); + }; + + function cloneCell(cell) { + var formatNode; + + // Clone formats + tinymce.walk(cell, function(node) { + var curNode; + + if (node.nodeType == 3) { + each(dom.getParents(node.parentNode, null, cell).reverse(), function(node) { + node = cloneNode(node, false); + + if (!formatNode) + formatNode = curNode = node; + else if (curNode) + curNode.appendChild(node); + + curNode = node; + }); + + // Add something to the inner node + if (curNode) + curNode.innerHTML = tinymce.isIE ? ' ' : '
'; + + return false; + } + }, 'childNodes'); + + cell = cloneNode(cell, false); + cell.rowSpan = cell.colSpan = 1; + + if (formatNode) { + cell.appendChild(formatNode); + } else { + if (!tinymce.isIE) + cell.innerHTML = '
'; + } + + return cell; + }; + + function cleanup() { + var rng = dom.createRng(); + + // Empty rows + each(dom.select('tr', table), function(tr) { + if (tr.cells.length == 0) + dom.remove(tr); + }); + + // Empty table + if (dom.select('tr', table).length == 0) { + rng.setStartAfter(table); + rng.setEndAfter(table); + selection.setRng(rng); + dom.remove(table); + return; + } + + // Empty header/body/footer + each(dom.select('thead,tbody,tfoot', table), function(part) { + if (part.rows.length == 0) + dom.remove(part); + }); + + // Restore selection to start position if it still exists + buildGrid(); + + // Restore the selection to the closest table position + row = grid[Math.min(grid.length - 1, startPos.y)]; + if (row) { + selection.select(row[Math.min(row.length - 1, startPos.x)].elm, true); + selection.collapse(true); + } + }; + + function fillLeftDown(x, y, rows, cols) { + var tr, x2, r, c, cell; + + tr = grid[y][x].elm.parentNode; + for (r = 1; r <= rows; r++) { + tr = dom.getNext(tr, 'tr'); + + if (tr) { + // Loop left to find real cell + for (x2 = x; x2 >= 0; x2--) { + cell = grid[y + r][x2].elm; + + if (cell.parentNode == tr) { + // Append clones after + for (c = 1; c <= cols; c++) + dom.insertAfter(cloneCell(cell), cell); + + break; + } + } + + if (x2 == -1) { + // Insert nodes before first cell + for (c = 1; c <= cols; c++) + tr.insertBefore(cloneCell(tr.cells[0]), tr.cells[0]); + } + } + } + }; + + function split() { + each(grid, function(row, y) { + each(row, function(cell, x) { + var colSpan, rowSpan, newCell, i; + + if (isCellSelected(cell)) { + cell = cell.elm; + colSpan = getSpanVal(cell, 'colspan'); + rowSpan = getSpanVal(cell, 'rowspan'); + + if (colSpan > 1 || rowSpan > 1) { + cell.colSpan = cell.rowSpan = 1; + + // Insert cells right + for (i = 0; i < colSpan - 1; i++) + dom.insertAfter(cloneCell(cell), cell); + + fillLeftDown(x, y, rowSpan - 1, colSpan); + } + } + }); + }); + }; + + function merge(cell, cols, rows) { + var startX, startY, endX, endY, x, y, startCell, endCell, cell, children; + + // Use specified cell and cols/rows + if (cell) { + pos = getPos(cell); + startX = pos.x; + startY = pos.y; + endX = startX + (cols - 1); + endY = startY + (rows - 1); + } else { + // Use selection + startX = startPos.x; + startY = startPos.y; + endX = endPos.x; + endY = endPos.y; + } + + // Find start/end cells + startCell = getCell(startX, startY); + endCell = getCell(endX, endY); + + // Check if the cells exists and if they are of the same part for example tbody = tbody + if (startCell && endCell && startCell.part == endCell.part) { + // Split and rebuild grid + split(); + buildGrid(); + + // Set row/col span to start cell + startCell = getCell(startX, startY).elm; + startCell.colSpan = (endX - startX) + 1; + startCell.rowSpan = (endY - startY) + 1; + + // Remove other cells and add it's contents to the start cell + for (y = startY; y <= endY; y++) { + for (x = startX; x <= endX; x++) { + cell = grid[y][x].elm; + + if (cell != startCell) { + // Move children to startCell + children = tinymce.grep(cell.childNodes); + each(children, function(node, i) { + // Jump over last BR element + if (node.nodeName != 'BR' || i != children.length - 1) + startCell.appendChild(node); + }); + + // Remove cell + dom.remove(cell); + } + } + } + + // Remove empty rows etc and restore caret location + cleanup(); + } + }; + + function insertRow(before) { + var posY, cell, lastCell, x, rowElm, newRow, newCell, otherCell; + + // Find first/last row + each(grid, function(row, y) { + each(row, function(cell, x) { + if (isCellSelected(cell)) { + cell = cell.elm; + rowElm = cell.parentNode; + newRow = cloneNode(rowElm, false); + posY = y; + + if (before) + return false; + } + }); + + if (before) + return !posY; + }); + + for (x = 0; x < grid[0].length; x++) { + cell = grid[posY][x].elm; + + if (cell != lastCell) { + if (!before) { + rowSpan = getSpanVal(cell, 'rowspan'); + if (rowSpan > 1) { + cell.rowSpan = rowSpan + 1; + continue; + } + } else { + // Check if cell above can be expanded + if (posY > 0 && grid[posY - 1][x]) { + otherCell = grid[posY - 1][x].elm; + rowSpan = getSpanVal(otherCell, 'rowspan'); + if (rowSpan > 1) { + otherCell.rowSpan = rowSpan + 1; + continue; + } + } + } + + // Insert new cell into new row + newCell = cloneCell(cell) + newCell.colSpan = cell.colSpan; + newRow.appendChild(newCell); + + lastCell = cell; + } + } + + if (newRow.hasChildNodes()) { + if (!before) + dom.insertAfter(newRow, rowElm); + else + rowElm.parentNode.insertBefore(newRow, rowElm); + } + }; + + function insertCol(before) { + var posX, lastCell; + + // Find first/last column + each(grid, function(row, y) { + each(row, function(cell, x) { + if (isCellSelected(cell)) { + posX = x; + + if (before) + return false; + } + }); + + if (before) + return !posX; + }); + + each(grid, function(row, y) { + var cell = row[posX].elm, rowSpan, colSpan; + + if (cell != lastCell) { + colSpan = getSpanVal(cell, 'colspan'); + rowSpan = getSpanVal(cell, 'rowspan'); + + if (colSpan == 1) { + if (!before) { + dom.insertAfter(cloneCell(cell), cell); + fillLeftDown(posX, y, rowSpan - 1, colSpan); + } else { + cell.parentNode.insertBefore(cloneCell(cell), cell); + fillLeftDown(posX, y, rowSpan - 1, colSpan); + } + } else + cell.colSpan++; + + lastCell = cell; + } + }); + }; + + function deleteCols() { + var cols = []; + + // Get selected column indexes + each(grid, function(row, y) { + each(row, function(cell, x) { + if (isCellSelected(cell) && tinymce.inArray(cols, x) === -1) { + each(grid, function(row) { + var cell = row[x].elm, colSpan; + + colSpan = getSpanVal(cell, 'colspan'); + + if (colSpan > 1) + cell.colSpan = colSpan - 1; + else + dom.remove(cell); + }); + + cols.push(x); + } + }); + }); + + cleanup(); + }; + + function deleteRows() { + var rows; + + function deleteRow(tr) { + var nextTr, pos, lastCell; + + nextTr = dom.getNext(tr, 'tr'); + + // Move down row spanned cells + each(tr.cells, function(cell) { + var rowSpan = getSpanVal(cell, 'rowspan'); + + if (rowSpan > 1) { + cell.rowSpan = rowSpan - 1; + pos = getPos(cell); + fillLeftDown(pos.x, pos.y, 1, 1); + } + }); + + // Delete cells + pos = getPos(tr.cells[0]); + each(grid[pos.y], function(cell) { + var rowSpan; + + cell = cell.elm; + + if (cell != lastCell) { + rowSpan = getSpanVal(cell, 'rowspan'); + + if (rowSpan <= 1) + dom.remove(cell); + else + cell.rowSpan = rowSpan - 1; + + lastCell = cell; + } + }); + }; + + // Get selected rows and move selection out of scope + rows = getSelectedRows(); + + // Delete all selected rows + each(rows.reverse(), function(tr) { + deleteRow(tr); + }); + + cleanup(); + }; + + function cutRows() { + var rows = getSelectedRows(); + + dom.remove(rows); + cleanup(); + + return rows; + }; + + function copyRows() { + var rows = getSelectedRows(); + + each(rows, function(row, i) { + rows[i] = cloneNode(row, true); + }); + + return rows; + }; + + function pasteRows(rows, before) { + var selectedRows = getSelectedRows(), + targetRow = selectedRows[before ? 0 : selectedRows.length - 1], + targetCellCount = targetRow.cells.length; + + // Calc target cell count + each(grid, function(row) { + var match; + + targetCellCount = 0; + each(row, function(cell, x) { + if (cell.real) + targetCellCount += cell.colspan; + + if (cell.elm.parentNode == targetRow) + match = 1; + }); + + if (match) + return false; + }); + + if (!before) + rows.reverse(); + + each(rows, function(row) { + var cellCount = row.cells.length, cell; + + // Remove col/rowspans + for (i = 0; i < cellCount; i++) { + cell = row.cells[i]; + cell.colSpan = cell.rowSpan = 1; + } + + // Needs more cells + for (i = cellCount; i < targetCellCount; i++) + row.appendChild(cloneCell(row.cells[cellCount - 1])); + + // Needs less cells + for (i = targetCellCount; i < cellCount; i++) + dom.remove(row.cells[i]); + + // Add before/after + if (before) + targetRow.parentNode.insertBefore(row, targetRow); + else + dom.insertAfter(row, targetRow); + }); + }; + + function getPos(target) { + var pos; + + each(grid, function(row, y) { + each(row, function(cell, x) { + if (cell.elm == target) { + pos = {x : x, y : y}; + return false; + } + }); + + return !pos; + }); + + return pos; + }; + + function setStartCell(cell) { + startPos = getPos(cell); + }; + + function findEndPos() { + var pos, maxX, maxY; + + maxX = maxY = 0; + + each(grid, function(row, y) { + each(row, function(cell, x) { + var colSpan, rowSpan; + + if (isCellSelected(cell)) { + cell = grid[y][x]; + + if (x > maxX) + maxX = x; + + if (y > maxY) + maxY = y; + + if (cell.real) { + colSpan = cell.colspan - 1; + rowSpan = cell.rowspan - 1; + + if (colSpan) { + if (x + colSpan > maxX) + maxX = x + colSpan; + } + + if (rowSpan) { + if (y + rowSpan > maxY) + maxY = y + rowSpan; + } + } + } + }); + }); + + return {x : maxX, y : maxY}; + }; + + function setEndCell(cell) { + var startX, startY, endX, endY, maxX, maxY, colSpan, rowSpan; + + endPos = getPos(cell); + + if (startPos && endPos) { + // Get start/end positions + startX = Math.min(startPos.x, endPos.x); + startY = Math.min(startPos.y, endPos.y); + endX = Math.max(startPos.x, endPos.x); + endY = Math.max(startPos.y, endPos.y); + + // Expand end positon to include spans + maxX = endX; + maxY = endY; + + // Expand startX + for (y = startY; y <= maxY; y++) { + cell = grid[y][startX]; + + if (!cell.real) { + if (startX - (cell.colspan - 1) < startX) + startX -= cell.colspan - 1; + } + } + + // Expand startY + for (x = startX; x <= maxX; x++) { + cell = grid[startY][x]; + + if (!cell.real) { + if (startY - (cell.rowspan - 1) < startY) + startY -= cell.rowspan - 1; + } + } + + // Find max X, Y + for (y = startY; y <= endY; y++) { + for (x = startX; x <= endX; x++) { + cell = grid[y][x]; + + if (cell.real) { + colSpan = cell.colspan - 1; + rowSpan = cell.rowspan - 1; + + if (colSpan) { + if (x + colSpan > maxX) + maxX = x + colSpan; + } + + if (rowSpan) { + if (y + rowSpan > maxY) + maxY = y + rowSpan; + } + } + } + } + + // Remove current selection + dom.removeClass(dom.select('td.mceSelected,th.mceSelected'), 'mceSelected'); + + // Add new selection + for (y = startY; y <= maxY; y++) { + for (x = startX; x <= maxX; x++) + dom.addClass(grid[y][x].elm, 'mceSelected'); + } + } + }; + + // Expose to public + tinymce.extend(this, { + deleteTable : deleteTable, + split : split, + merge : merge, + insertRow : insertRow, + insertCol : insertCol, + deleteCols : deleteCols, + deleteRows : deleteRows, + cutRows : cutRows, + copyRows : copyRows, + pasteRows : pasteRows, + getPos : getPos, + setStartCell : setStartCell, + setEndCell : setEndCell + }); + }; + + tinymce.create('tinymce.plugins.TablePlugin', { + init : function(ed, url) { + var winMan, clipboardRows; + + function createTableGrid(node) { + var selection = ed.selection, tblElm = ed.dom.getParent(node || selection.getNode(), 'table'); + + if (tblElm) + return new TableGrid(tblElm, ed.dom, selection); + }; + + function cleanup() { + // Restore selection possibilities + ed.getBody().style.webkitUserSelect = ''; + ed.dom.removeClass(ed.dom.select('td.mceSelected,th.mceSelected'), 'mceSelected'); + }; + + // Register buttons + each([ + ['table', 'table.desc', 'mceInsertTable', true], + ['delete_table', 'table.del', 'mceTableDelete'], + ['delete_col', 'table.delete_col_desc', 'mceTableDeleteCol'], + ['delete_row', 'table.delete_row_desc', 'mceTableDeleteRow'], + ['col_after', 'table.col_after_desc', 'mceTableInsertColAfter'], + ['col_before', 'table.col_before_desc', 'mceTableInsertColBefore'], + ['row_after', 'table.row_after_desc', 'mceTableInsertRowAfter'], + ['row_before', 'table.row_before_desc', 'mceTableInsertRowBefore'], + ['row_props', 'table.row_desc', 'mceTableRowProps', true], + ['cell_props', 'table.cell_desc', 'mceTableCellProps', true], + ['split_cells', 'table.split_cells_desc', 'mceTableSplitCells', true], + ['merge_cells', 'table.merge_cells_desc', 'mceTableMergeCells', true] + ], function(c) { + ed.addButton(c[0], {title : c[1], cmd : c[2], ui : c[3]}); + }); + + // Select whole table is a table border is clicked + if (!tinymce.isIE) { + ed.onClick.add(function(ed, e) { + e = e.target; + + if (e.nodeName === 'TABLE') + ed.selection.select(e); + }); + } + + // Handle node change updates + ed.onNodeChange.add(function(ed, cm, n) { + var p; + + n = ed.selection.getStart(); + p = ed.dom.getParent(n, 'td,th,caption'); + cm.setActive('table', n.nodeName === 'TABLE' || !!p); + + // Disable table tools if we are in caption + if (p && p.nodeName === 'CAPTION') + p = 0; + + cm.setDisabled('delete_table', !p); + cm.setDisabled('delete_col', !p); + cm.setDisabled('delete_table', !p); + cm.setDisabled('delete_row', !p); + cm.setDisabled('col_after', !p); + cm.setDisabled('col_before', !p); + cm.setDisabled('row_after', !p); + cm.setDisabled('row_before', !p); + cm.setDisabled('row_props', !p); + cm.setDisabled('cell_props', !p); + cm.setDisabled('split_cells', !p); + cm.setDisabled('merge_cells', !p); + }); + + ed.onInit.add(function(ed) { + var startTable, startCell, dom = ed.dom, tableGrid; + + winMan = ed.windowManager; + + // Add cell selection logic + ed.onMouseDown.add(function(ed, e) { + if (e.button != 2) { + cleanup(); + + startCell = dom.getParent(e.target, 'td,th'); + startTable = dom.getParent(startCell, 'table'); + } + }); + + dom.bind(ed.getDoc(), 'mouseover', function(e) { + var sel, table, target = e.target; + + if (startCell && (tableGrid || target != startCell) && (target.nodeName == 'TD' || target.nodeName == 'TH')) { + table = dom.getParent(target, 'table'); + if (table == startTable) { + if (!tableGrid) { + tableGrid = createTableGrid(table); + tableGrid.setStartCell(startCell); + + ed.getBody().style.webkitUserSelect = 'none'; + } + + tableGrid.setEndCell(target); + } + + // Remove current selection + sel = ed.selection.getSel(); + + if (sel.removeAllRanges) + sel.removeAllRanges(); + else + sel.empty(); + + e.preventDefault(); + } + }); + + ed.onMouseUp.add(function(ed, e) { + var rng, sel = ed.selection, selectedCells, nativeSel = sel.getSel(), walker, node, lastNode, endNode; + + // Move selection to startCell + if (startCell) { + if (tableGrid) + ed.getBody().style.webkitUserSelect = ''; + + function setPoint(node, start) { + var walker = new tinymce.dom.TreeWalker(node, node); + + do { + // Text node + if (node.nodeType == 3 && tinymce.trim(node.nodeValue).length != 0) { + if (start) + rng.setStart(node, 0); + else + rng.setEnd(node, node.nodeValue.length); + + return; + } + + // BR element + if (node.nodeName == 'BR') { + if (start) + rng.setStartBefore(node); + else + rng.setEndBefore(node); + + return; + } + } while (node = (start ? walker.next() : walker.prev())); + }; + + // Try to expand text selection as much as we can only Gecko supports cell selection + selectedCells = dom.select('td.mceSelected,th.mceSelected'); + if (selectedCells.length > 0) { + rng = dom.createRng(); + node = selectedCells[0]; + endNode = selectedCells[selectedCells.length - 1]; + + setPoint(node, 1); + walker = new tinymce.dom.TreeWalker(node, dom.getParent(selectedCells[0], 'table')); + + do { + if (node.nodeName == 'TD' || node.nodeName == 'TH') { + if (!dom.hasClass(node, 'mceSelected')) + break; + + lastNode = node; + } + } while (node = walker.next()); + + setPoint(lastNode); + + sel.setRng(rng); + } + + ed.nodeChanged(); + startCell = tableGrid = startTable = null; + } + }); + + ed.onKeyUp.add(function(ed, e) { + cleanup(); + }); + + // Add context menu + if (ed && ed.plugins.contextmenu) { + ed.plugins.contextmenu.onContextMenu.add(function(th, m, e) { + var sm, se = ed.selection, el = se.getNode() || ed.getBody(); + + if (ed.dom.getParent(e, 'td') || ed.dom.getParent(e, 'th') || ed.dom.select('td.mceSelected,th.mceSelected').length) { + m.removeAll(); + + if (el.nodeName == 'A' && !ed.dom.getAttrib(el, 'name')) { + m.add({title : 'advanced.link_desc', icon : 'link', cmd : ed.plugins.advlink ? 'mceAdvLink' : 'mceLink', ui : true}); + m.add({title : 'advanced.unlink_desc', icon : 'unlink', cmd : 'UnLink'}); + m.addSeparator(); + } + + if (el.nodeName == 'IMG' && el.className.indexOf('mceItem') == -1) { + m.add({title : 'advanced.image_desc', icon : 'image', cmd : ed.plugins.advimage ? 'mceAdvImage' : 'mceImage', ui : true}); + m.addSeparator(); + } + + m.add({title : 'table.desc', icon : 'table', cmd : 'mceInsertTable', value : {action : 'insert'}}); + m.add({title : 'table.props_desc', icon : 'table_props', cmd : 'mceInsertTable'}); + m.add({title : 'table.del', icon : 'delete_table', cmd : 'mceTableDelete'}); + m.addSeparator(); + + // Cell menu + sm = m.addMenu({title : 'table.cell'}); + sm.add({title : 'table.cell_desc', icon : 'cell_props', cmd : 'mceTableCellProps'}); + sm.add({title : 'table.split_cells_desc', icon : 'split_cells', cmd : 'mceTableSplitCells'}); + sm.add({title : 'table.merge_cells_desc', icon : 'merge_cells', cmd : 'mceTableMergeCells'}); + + // Row menu + sm = m.addMenu({title : 'table.row'}); + sm.add({title : 'table.row_desc', icon : 'row_props', cmd : 'mceTableRowProps'}); + sm.add({title : 'table.row_before_desc', icon : 'row_before', cmd : 'mceTableInsertRowBefore'}); + sm.add({title : 'table.row_after_desc', icon : 'row_after', cmd : 'mceTableInsertRowAfter'}); + sm.add({title : 'table.delete_row_desc', icon : 'delete_row', cmd : 'mceTableDeleteRow'}); + sm.addSeparator(); + sm.add({title : 'table.cut_row_desc', icon : 'cut', cmd : 'mceTableCutRow'}); + sm.add({title : 'table.copy_row_desc', icon : 'copy', cmd : 'mceTableCopyRow'}); + sm.add({title : 'table.paste_row_before_desc', icon : 'paste', cmd : 'mceTablePasteRowBefore'}).setDisabled(!clipboardRows); + sm.add({title : 'table.paste_row_after_desc', icon : 'paste', cmd : 'mceTablePasteRowAfter'}).setDisabled(!clipboardRows); + + // Column menu + sm = m.addMenu({title : 'table.col'}); + sm.add({title : 'table.col_before_desc', icon : 'col_before', cmd : 'mceTableInsertColBefore'}); + sm.add({title : 'table.col_after_desc', icon : 'col_after', cmd : 'mceTableInsertColAfter'}); + sm.add({title : 'table.delete_col_desc', icon : 'delete_col', cmd : 'mceTableDeleteCol'}); + } else + m.add({title : 'table.desc', icon : 'table', cmd : 'mceInsertTable'}); + }); + } + + // Fixes an issue on Gecko where it's impossible to place the caret behind a table + // This fix will force a paragraph element after the table but only when the forced_root_block setting is enabled + if (!tinymce.isIE) { + function fixTableCaretPos() { + var last; + + // Skip empty text nodes form the end + for (last = ed.getBody().lastChild; last && last.nodeType == 3 && !last.nodeValue.length; last = last.previousSibling) ; + + if (last && last.nodeName == 'TABLE') + ed.dom.add(ed.getBody(), 'p', null, '
'); + }; + + // Fixes an bug where it's impossible to place the caret before a table in Gecko + // this fix solves it by detecting when the caret is at the beginning of such a table + // and then manually moves the caret infront of the table + if (tinymce.isGecko) { + ed.onKeyDown.add(function(ed, e) { + var rng, table, dom = ed.dom; + + // On gecko it's not possible to place the caret before a table + if (e.keyCode == 37 || e.keyCode == 38) { + rng = ed.selection.getRng(); + table = dom.getParent(rng.startContainer, 'table'); + + if (table && ed.getBody().firstChild == table) { + if (isAtStart(rng, table)) { + rng = dom.createRng(); + + rng.setStartBefore(table); + rng.setEndBefore(table); + + ed.selection.setRng(rng); + + e.preventDefault(); + } + } + } + }); + } + + ed.onKeyUp.add(fixTableCaretPos); + ed.onSetContent.add(fixTableCaretPos); + ed.onVisualAid.add(fixTableCaretPos); + + ed.onPreProcess.add(function(ed, o) { + var last = o.node.lastChild; + + if (last && last.childNodes.length == 1 && last.firstChild.nodeName == 'BR') + ed.dom.remove(last); + }); + + fixTableCaretPos(); + } + }); + + // Register action commands + each({ + mceTableSplitCells : function(grid) { + grid.split(); + }, + + mceTableMergeCells : function(grid) { + var rowSpan, colSpan, cell; + + cell = ed.dom.getParent(ed.selection.getNode(), 'th,td'); + if (cell) { + rowSpan = cell.rowSpan; + colSpan = cell.colSpan; + } + + if (!ed.dom.select('td.mceSelected,th.mceSelected').length) { + winMan.open({ + url : url + '/merge_cells.htm', + width : 240 + parseInt(ed.getLang('table.merge_cells_delta_width', 0)), + height : 110 + parseInt(ed.getLang('table.merge_cells_delta_height', 0)), + inline : 1 + }, { + rows : rowSpan, + cols : colSpan, + onaction : function(data) { + grid.merge(cell, data.cols, data.rows); + }, + plugin_url : url + }); + } else + grid.merge(); + }, + + mceTableInsertRowBefore : function(grid) { + grid.insertRow(true); + }, + + mceTableInsertRowAfter : function(grid) { + grid.insertRow(); + }, + + mceTableInsertColBefore : function(grid) { + grid.insertCol(true); + }, + + mceTableInsertColAfter : function(grid) { + grid.insertCol(); + }, + + mceTableDeleteCol : function(grid) { + grid.deleteCols(); + }, + + mceTableDeleteRow : function(grid) { + grid.deleteRows(); + }, + + mceTableCutRow : function(grid) { + clipboardRows = grid.cutRows(); + }, + + mceTableCopyRow : function(grid) { + clipboardRows = grid.copyRows(); + }, + + mceTablePasteRowBefore : function(grid) { + grid.pasteRows(clipboardRows, true); + }, + + mceTablePasteRowAfter : function(grid) { + grid.pasteRows(clipboardRows); + }, + + mceTableDelete : function(grid) { + grid.deleteTable(); + } + }, function(func, name) { + ed.addCommand(name, function() { + var grid = createTableGrid(); + + if (grid) { + func(grid); + ed.execCommand('mceRepaint'); + cleanup(); + } + }); + }); + + // Register dialog commands + each({ + mceInsertTable : function(val) { + winMan.open({ + url : url + '/table.htm', + width : 400 + parseInt(ed.getLang('table.table_delta_width', 0)), + height : 320 + parseInt(ed.getLang('table.table_delta_height', 0)), + inline : 1 + }, { + plugin_url : url, + action : val ? val.action : 0 + }); + }, + + mceTableRowProps : function() { + winMan.open({ + url : url + '/row.htm', + width : 400 + parseInt(ed.getLang('table.rowprops_delta_width', 0)), + height : 295 + parseInt(ed.getLang('table.rowprops_delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + }, + + mceTableCellProps : function() { + winMan.open({ + url : url + '/cell.htm', + width : 400 + parseInt(ed.getLang('table.cellprops_delta_width', 0)), + height : 295 + parseInt(ed.getLang('table.cellprops_delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + } + }, function(func, name) { + ed.addCommand(name, function(ui, val) { + func(val); + }); + }); + } + }); + + // Register plugin + tinymce.PluginManager.add('table', tinymce.plugins.TablePlugin); +})(tinymce); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/table/js/cell.js b/web/libs/tiny_mce/plugins/table/js/cell.js new file mode 100644 index 0000000..b5fc1fd --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/js/cell.js @@ -0,0 +1,286 @@ +tinyMCEPopup.requireLangPack(); + +var ed; + +function init() { + ed = tinyMCEPopup.editor; + tinyMCEPopup.resizeToInnerSize(); + + document.getElementById('backgroundimagebrowsercontainer').innerHTML = getBrowserHTML('backgroundimagebrowser','backgroundimage','image','table'); + document.getElementById('bordercolor_pickcontainer').innerHTML = getColorPickerHTML('bordercolor_pick','bordercolor'); + document.getElementById('bgcolor_pickcontainer').innerHTML = getColorPickerHTML('bgcolor_pick','bgcolor') + + var inst = ed; + var tdElm = ed.dom.getParent(ed.selection.getStart(), "td,th"); + var formObj = document.forms[0]; + var st = ed.dom.parseStyle(ed.dom.getAttrib(tdElm, "style")); + + // Get table cell data + var celltype = tdElm.nodeName.toLowerCase(); + var align = ed.dom.getAttrib(tdElm, 'align'); + var valign = ed.dom.getAttrib(tdElm, 'valign'); + var width = trimSize(getStyle(tdElm, 'width', 'width')); + var height = trimSize(getStyle(tdElm, 'height', 'height')); + var bordercolor = convertRGBToHex(getStyle(tdElm, 'bordercolor', 'borderLeftColor')); + var bgcolor = convertRGBToHex(getStyle(tdElm, 'bgcolor', 'backgroundColor')); + var className = ed.dom.getAttrib(tdElm, 'class'); + var backgroundimage = getStyle(tdElm, 'background', 'backgroundImage').replace(new RegExp("url\\(['\"]?([^'\"]*)['\"]?\\)", 'gi'), "$1"); + var id = ed.dom.getAttrib(tdElm, 'id'); + var lang = ed.dom.getAttrib(tdElm, 'lang'); + var dir = ed.dom.getAttrib(tdElm, 'dir'); + var scope = ed.dom.getAttrib(tdElm, 'scope'); + + // Setup form + addClassesToList('class', 'table_cell_styles'); + TinyMCE_EditableSelects.init(); + + if (!ed.dom.hasClass(tdElm, 'mceSelected')) { + formObj.bordercolor.value = bordercolor; + formObj.bgcolor.value = bgcolor; + formObj.backgroundimage.value = backgroundimage; + formObj.width.value = width; + formObj.height.value = height; + formObj.id.value = id; + formObj.lang.value = lang; + formObj.style.value = ed.dom.serializeStyle(st); + selectByValue(formObj, 'align', align); + selectByValue(formObj, 'valign', valign); + selectByValue(formObj, 'class', className, true, true); + selectByValue(formObj, 'celltype', celltype); + selectByValue(formObj, 'dir', dir); + selectByValue(formObj, 'scope', scope); + + // Resize some elements + if (isVisible('backgroundimagebrowser')) + document.getElementById('backgroundimage').style.width = '180px'; + + updateColor('bordercolor_pick', 'bordercolor'); + updateColor('bgcolor_pick', 'bgcolor'); + } else + tinyMCEPopup.dom.hide('action'); +} + +function updateAction() { + var el, inst = ed, tdElm, trElm, tableElm, formObj = document.forms[0]; + + tinyMCEPopup.restoreSelection(); + el = ed.selection.getStart(); + tdElm = ed.dom.getParent(el, "td,th"); + trElm = ed.dom.getParent(el, "tr"); + tableElm = ed.dom.getParent(el, "table"); + + // Cell is selected + if (ed.dom.hasClass(tdElm, 'mceSelected')) { + // Update all selected sells + tinymce.each(ed.dom.select('td.mceSelected,th.mceSelected'), function(td) { + updateCell(td); + }); + + ed.addVisual(); + ed.nodeChanged(); + inst.execCommand('mceEndUndoLevel'); + tinyMCEPopup.close(); + return; + } + + ed.execCommand('mceBeginUndoLevel'); + + switch (getSelectValue(formObj, 'action')) { + case "cell": + var celltype = getSelectValue(formObj, 'celltype'); + var scope = getSelectValue(formObj, 'scope'); + + function doUpdate(s) { + if (s) { + updateCell(tdElm); + + ed.addVisual(); + ed.nodeChanged(); + inst.execCommand('mceEndUndoLevel'); + tinyMCEPopup.close(); + } + }; + + if (ed.getParam("accessibility_warnings", 1)) { + if (celltype == "th" && scope == "") + tinyMCEPopup.confirm(ed.getLang('table_dlg.missing_scope', '', true), doUpdate); + else + doUpdate(1); + + return; + } + + updateCell(tdElm); + break; + + case "row": + var cell = trElm.firstChild; + + if (cell.nodeName != "TD" && cell.nodeName != "TH") + cell = nextCell(cell); + + do { + cell = updateCell(cell, true); + } while ((cell = nextCell(cell)) != null); + + break; + + case "all": + var rows = tableElm.getElementsByTagName("tr"); + + for (var i=0; i 0) { + tinymce.each(tableElm.rows, function(tr) { + var i; + + for (i = 0; i < tr.cells.length; i++) { + if (dom.hasClass(tr.cells[i], 'mceSelected')) { + updateRow(tr, true); + return; + } + } + }); + + inst.addVisual(); + inst.nodeChanged(); + inst.execCommand('mceEndUndoLevel'); + tinyMCEPopup.close(); + return; + } + + inst.execCommand('mceBeginUndoLevel'); + + switch (action) { + case "row": + updateRow(trElm); + break; + + case "all": + var rows = tableElm.getElementsByTagName("tr"); + + for (var i=0; i colLimit) { + tinyMCEPopup.alert(inst.getLang('table_dlg.col_limit').replace(/\{\$cols\}/g, colLimit)); + return false; + } else if (rowLimit && rows > rowLimit) { + tinyMCEPopup.alert(inst.getLang('table_dlg.row_limit').replace(/\{\$rows\}/g, rowLimit)); + return false; + } else if (cellLimit && cols * rows > cellLimit) { + tinyMCEPopup.alert(inst.getLang('table_dlg.cell_limit').replace(/\{\$cells\}/g, cellLimit)); + return false; + } + + // Update table + if (action == "update") { + inst.execCommand('mceBeginUndoLevel'); + + dom.setAttrib(elm, 'cellPadding', cellpadding, true); + dom.setAttrib(elm, 'cellSpacing', cellspacing, true); + dom.setAttrib(elm, 'border', border); + dom.setAttrib(elm, 'align', align); + dom.setAttrib(elm, 'frame', frame); + dom.setAttrib(elm, 'rules', rules); + dom.setAttrib(elm, 'class', className); + dom.setAttrib(elm, 'style', style); + dom.setAttrib(elm, 'id', id); + dom.setAttrib(elm, 'summary', summary); + dom.setAttrib(elm, 'dir', dir); + dom.setAttrib(elm, 'lang', lang); + + capEl = inst.dom.select('caption', elm)[0]; + + if (capEl && !caption) + capEl.parentNode.removeChild(capEl); + + if (!capEl && caption) { + capEl = elm.ownerDocument.createElement('caption'); + + if (!tinymce.isIE) + capEl.innerHTML = '
'; + + elm.insertBefore(capEl, elm.firstChild); + } + + if (width && inst.settings.inline_styles) { + dom.setStyle(elm, 'width', width); + dom.setAttrib(elm, 'width', ''); + } else { + dom.setAttrib(elm, 'width', width, true); + dom.setStyle(elm, 'width', ''); + } + + // Remove these since they are not valid XHTML + dom.setAttrib(elm, 'borderColor', ''); + dom.setAttrib(elm, 'bgColor', ''); + dom.setAttrib(elm, 'background', ''); + + if (height && inst.settings.inline_styles) { + dom.setStyle(elm, 'height', height); + dom.setAttrib(elm, 'height', ''); + } else { + dom.setAttrib(elm, 'height', height, true); + dom.setStyle(elm, 'height', ''); + } + + if (background != '') + elm.style.backgroundImage = "url('" + background + "')"; + else + elm.style.backgroundImage = ''; + +/* if (tinyMCEPopup.getParam("inline_styles")) { + if (width != '') + elm.style.width = getCSSSize(width); + }*/ + + if (bordercolor != "") { + elm.style.borderColor = bordercolor; + elm.style.borderStyle = elm.style.borderStyle == "" ? "solid" : elm.style.borderStyle; + elm.style.borderWidth = border == "" ? "1px" : border; + } else + elm.style.borderColor = ''; + + elm.style.backgroundColor = bgcolor; + elm.style.height = getCSSSize(height); + + inst.addVisual(); + + // Fix for stange MSIE align bug + //elm.outerHTML = elm.outerHTML; + + inst.nodeChanged(); + inst.execCommand('mceEndUndoLevel'); + + // Repaint if dimensions changed + if (formObj.width.value != orgTableWidth || formObj.height.value != orgTableHeight) + inst.execCommand('mceRepaint'); + + tinyMCEPopup.close(); + return true; + } + + // Create new table + html += ''); + + tinymce.each('h1,h2,h3,h4,h5,h6,p'.split(','), function(n) { + if (patt) + patt += ','; + + patt += n + ' ._mce_marker'; + }); + + tinymce.each(inst.dom.select(patt), function(n) { + inst.dom.split(inst.dom.getParent(n, 'h1,h2,h3,h4,h5,h6,p'), n); + }); + + dom.setOuterHTML(dom.select('br._mce_marker')[0], html); + } else + inst.execCommand('mceInsertContent', false, html); + + tinymce.each(dom.select('table[_mce_new]'), function(node) { + var td = dom.select('td', node); + + inst.selection.select(td[0], true); + inst.selection.collapse(); + + dom.setAttrib(node, '_mce_new', ''); + }); + + inst.addVisual(); + inst.execCommand('mceEndUndoLevel'); + + tinyMCEPopup.close(); +} + +function makeAttrib(attrib, value) { + var formObj = document.forms[0]; + var valueElm = formObj.elements[attrib]; + + if (typeof(value) == "undefined" || value == null) { + value = ""; + + if (valueElm) + value = valueElm.value; + } + + if (value == "") + return ""; + + // XML encode it + value = value.replace(/&/g, '&'); + value = value.replace(/\"/g, '"'); + value = value.replace(//g, '>'); + + return ' ' + attrib + '="' + value + '"'; +} + +function init() { + tinyMCEPopup.resizeToInnerSize(); + + document.getElementById('backgroundimagebrowsercontainer').innerHTML = getBrowserHTML('backgroundimagebrowser','backgroundimage','image','table'); + document.getElementById('backgroundimagebrowsercontainer').innerHTML = getBrowserHTML('backgroundimagebrowser','backgroundimage','image','table'); + document.getElementById('bordercolor_pickcontainer').innerHTML = getColorPickerHTML('bordercolor_pick','bordercolor'); + document.getElementById('bgcolor_pickcontainer').innerHTML = getColorPickerHTML('bgcolor_pick','bgcolor'); + + var cols = 2, rows = 2, border = tinyMCEPopup.getParam('table_default_border', '0'), cellpadding = tinyMCEPopup.getParam('table_default_cellpadding', ''), cellspacing = tinyMCEPopup.getParam('table_default_cellspacing', ''); + var align = "", width = "", height = "", bordercolor = "", bgcolor = "", className = ""; + var id = "", summary = "", style = "", dir = "", lang = "", background = "", bgcolor = "", bordercolor = "", rules, frame; + var inst = tinyMCEPopup.editor, dom = inst.dom; + var formObj = document.forms[0]; + var elm = dom.getParent(inst.selection.getNode(), "table"); + + action = tinyMCEPopup.getWindowArg('action'); + + if (!action) + action = elm ? "update" : "insert"; + + if (elm && action != "insert") { + var rowsAr = elm.rows; + var cols = 0; + for (var i=0; i cols) + cols = rowsAr[i].cells.length; + + cols = cols; + rows = rowsAr.length; + + st = dom.parseStyle(dom.getAttrib(elm, "style")); + border = trimSize(getStyle(elm, 'border', 'borderWidth')); + cellpadding = dom.getAttrib(elm, 'cellpadding', ""); + cellspacing = dom.getAttrib(elm, 'cellspacing', ""); + width = trimSize(getStyle(elm, 'width', 'width')); + height = trimSize(getStyle(elm, 'height', 'height')); + bordercolor = convertRGBToHex(getStyle(elm, 'bordercolor', 'borderLeftColor')); + bgcolor = convertRGBToHex(getStyle(elm, 'bgcolor', 'backgroundColor')); + align = dom.getAttrib(elm, 'align', align); + frame = dom.getAttrib(elm, 'frame'); + rules = dom.getAttrib(elm, 'rules'); + className = tinymce.trim(dom.getAttrib(elm, 'class').replace(/mceItem.+/g, '')); + id = dom.getAttrib(elm, 'id'); + summary = dom.getAttrib(elm, 'summary'); + style = dom.serializeStyle(st); + dir = dom.getAttrib(elm, 'dir'); + lang = dom.getAttrib(elm, 'lang'); + background = getStyle(elm, 'background', 'backgroundImage').replace(new RegExp("url\\(['\"]?([^'\"]*)['\"]?\\)", 'gi'), "$1"); + formObj.caption.checked = elm.getElementsByTagName('caption').length > 0; + + orgTableWidth = width; + orgTableHeight = height; + + action = "update"; + formObj.insert.value = inst.getLang('update'); + } + + addClassesToList('class', "table_styles"); + TinyMCE_EditableSelects.init(); + + // Update form + selectByValue(formObj, 'align', align); + selectByValue(formObj, 'tframe', frame); + selectByValue(formObj, 'rules', rules); + selectByValue(formObj, 'class', className, true, true); + formObj.cols.value = cols; + formObj.rows.value = rows; + formObj.border.value = border; + formObj.cellpadding.value = cellpadding; + formObj.cellspacing.value = cellspacing; + formObj.width.value = width; + formObj.height.value = height; + formObj.bordercolor.value = bordercolor; + formObj.bgcolor.value = bgcolor; + formObj.id.value = id; + formObj.summary.value = summary; + formObj.style.value = style; + formObj.dir.value = dir; + formObj.lang.value = lang; + formObj.backgroundimage.value = background; + + updateColor('bordercolor_pick', 'bordercolor'); + updateColor('bgcolor_pick', 'bgcolor'); + + // Resize some elements + if (isVisible('backgroundimagebrowser')) + document.getElementById('backgroundimage').style.width = '180px'; + + // Disable some fields in update mode + if (action == "update") { + formObj.cols.disabled = true; + formObj.rows.disabled = true; + } +} + +function changedSize() { + var formObj = document.forms[0]; + var st = dom.parseStyle(formObj.style.value); + +/* var width = formObj.width.value; + if (width != "") + st['width'] = tinyMCEPopup.getParam("inline_styles") ? getCSSSize(width) : ""; + else + st['width'] = "";*/ + + var height = formObj.height.value; + if (height != "") + st['height'] = getCSSSize(height); + else + st['height'] = ""; + + formObj.style.value = dom.serializeStyle(st); +} + +function changedBackgroundImage() { + var formObj = document.forms[0]; + var st = dom.parseStyle(formObj.style.value); + + st['background-image'] = "url('" + formObj.backgroundimage.value + "')"; + + formObj.style.value = dom.serializeStyle(st); +} + +function changedBorder() { + var formObj = document.forms[0]; + var st = dom.parseStyle(formObj.style.value); + + // Update border width if the element has a color + if (formObj.border.value != "" && formObj.bordercolor.value != "") + st['border-width'] = formObj.border.value + "px"; + + formObj.style.value = dom.serializeStyle(st); +} + +function changedColor() { + var formObj = document.forms[0]; + var st = dom.parseStyle(formObj.style.value); + + st['background-color'] = formObj.bgcolor.value; + + if (formObj.bordercolor.value != "") { + st['border-color'] = formObj.bordercolor.value; + + // Add border-width if it's missing + if (!st['border-width']) + st['border-width'] = formObj.border.value == "" ? "1px" : formObj.border.value + "px"; + } + + formObj.style.value = dom.serializeStyle(st); +} + +function changedStyle() { + var formObj = document.forms[0]; + var st = dom.parseStyle(formObj.style.value); + + if (st['background-image']) + formObj.backgroundimage.value = st['background-image'].replace(new RegExp("url\\(['\"]?([^'\"]*)['\"]?\\)", 'gi'), "$1"); + else + formObj.backgroundimage.value = ''; + + if (st['width']) + formObj.width.value = trimSize(st['width']); + + if (st['height']) + formObj.height.value = trimSize(st['height']); + + if (st['background-color']) { + formObj.bgcolor.value = st['background-color']; + updateColor('bgcolor_pick','bgcolor'); + } + + if (st['border-color']) { + formObj.bordercolor.value = st['border-color']; + updateColor('bordercolor_pick','bordercolor'); + } +} + +tinyMCEPopup.onInit.add(init); diff --git a/web/libs/tiny_mce/plugins/table/langs/en_dlg.js b/web/libs/tiny_mce/plugins/table/langs/en_dlg.js new file mode 100644 index 0000000..000332a --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/langs/en_dlg.js @@ -0,0 +1,74 @@ +tinyMCE.addI18n('en.table_dlg',{ +general_tab:"General", +advanced_tab:"Advanced", +general_props:"General properties", +advanced_props:"Advanced properties", +rowtype:"Row in table part", +title:"Insert/Modify table", +width:"Width", +height:"Height", +cols:"Cols", +rows:"Rows", +cellspacing:"Cellspacing", +cellpadding:"Cellpadding", +border:"Border", +align:"Alignment", +align_default:"Default", +align_left:"Left", +align_right:"Right", +align_middle:"Center", +row_title:"Table row properties", +cell_title:"Table cell properties", +cell_type:"Cell type", +valign:"Vertical alignment", +align_top:"Top", +align_bottom:"Bottom", +bordercolor:"Border color", +bgcolor:"Background color", +merge_cells_title:"Merge table cells", +id:"Id", +style:"Style", +langdir:"Language direction", +langcode:"Language code", +mime:"Target MIME type", +ltr:"Left to right", +rtl:"Right to left", +bgimage:"Background image", +summary:"Summary", +td:"Data", +th:"Header", +cell_cell:"Update current cell", +cell_row:"Update all cells in row", +cell_all:"Update all cells in table", +row_row:"Update current row", +row_odd:"Update odd rows in table", +row_even:"Update even rows in table", +row_all:"Update all rows in table", +thead:"Table Head", +tbody:"Table Body", +tfoot:"Table Foot", +scope:"Scope", +rowgroup:"Row Group", +colgroup:"Col Group", +col_limit:"You've exceeded the maximum number of columns of {$cols}.", +row_limit:"You've exceeded the maximum number of rows of {$rows}.", +cell_limit:"You've exceeded the maximum number of cells of {$cells}.", +missing_scope:"Are you sure you want to continue without specifying a scope for this table header cell. Without it, it may be difficult for some users with disabilities to understand the content or data displayed of the table.", +caption:"Table caption", +frame:"Frame", +frame_none:"none", +frame_groups:"groups", +frame_rows:"rows", +frame_cols:"cols", +frame_all:"all", +rules:"Rules", +rules_void:"void", +rules_above:"above", +rules_below:"below", +rules_hsides:"hsides", +rules_lhs:"lhs", +rules_rhs:"rhs", +rules_vsides:"vsides", +rules_box:"box", +rules_border:"border" +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/table/merge_cells.htm b/web/libs/tiny_mce/plugins/table/merge_cells.htm new file mode 100644 index 0000000..9736ed8 --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/merge_cells.htm @@ -0,0 +1,32 @@ + + + + {#table_dlg.merge_cells_title} + + + + + + +
+
+ {#table_dlg.merge_cells_title} + + + + + + + + + +
{#table_dlg.cols}:
{#table_dlg.rows}:
+
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/table/row.htm b/web/libs/tiny_mce/plugins/table/row.htm new file mode 100644 index 0000000..092e6c8 --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/row.htm @@ -0,0 +1,155 @@ + + + + {#table_dlg.row_title} + + + + + + + + +
+ + +
+
+
+ {#table_dlg.general_props} + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ +
+ +
+
+
+ +
+
+ {#table_dlg.advanced_props} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + + + + +
 
+
+ + + + + +
 
+
+
+
+
+ +
+
+ +
+ + + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/table/table.htm b/web/libs/tiny_mce/plugins/table/table.htm new file mode 100644 index 0000000..f269039 --- /dev/null +++ b/web/libs/tiny_mce/plugins/table/table.htm @@ -0,0 +1,187 @@ + + + + {#table_dlg.title} + + + + + + + + + +
+ + +
+
+
+ {#table_dlg.general_props} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+
+ +
+
+ {#table_dlg.advanced_props} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + +
 
+
+ +
+ +
+ +
+ + + + + +
 
+
+ + + + + +
 
+
+
+
+
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/template/blank.htm b/web/libs/tiny_mce/plugins/template/blank.htm new file mode 100644 index 0000000..ecde53f --- /dev/null +++ b/web/libs/tiny_mce/plugins/template/blank.htm @@ -0,0 +1,12 @@ + + + blank_page + + + + + + + diff --git a/web/libs/tiny_mce/plugins/template/css/template.css b/web/libs/tiny_mce/plugins/template/css/template.css new file mode 100644 index 0000000..2d23a49 --- /dev/null +++ b/web/libs/tiny_mce/plugins/template/css/template.css @@ -0,0 +1,23 @@ +#frmbody { + padding: 10px; + background-color: #FFF; + border: 1px solid #CCC; +} + +.frmRow { + margin-bottom: 10px; +} + +#templatesrc { + border: none; + width: 320px; + height: 240px; +} + +.title { + padding-bottom: 5px; +} + +.mceActionPanel { + padding-top: 5px; +} diff --git a/web/libs/tiny_mce/plugins/template/editor_plugin.js b/web/libs/tiny_mce/plugins/template/editor_plugin.js new file mode 100644 index 0000000..ebe3c27 --- /dev/null +++ b/web/libs/tiny_mce/plugins/template/editor_plugin.js @@ -0,0 +1 @@ +(function(){var a=tinymce.each;tinymce.create("tinymce.plugins.TemplatePlugin",{init:function(b,c){var d=this;d.editor=b;b.addCommand("mceTemplate",function(e){b.windowManager.open({file:c+"/template.htm",width:b.getParam("template_popup_width",750),height:b.getParam("template_popup_height",600),inline:1},{plugin_url:c})});b.addCommand("mceInsertTemplate",d._insertTemplate,d);b.addButton("template",{title:"template.desc",cmd:"mceTemplate"});b.onPreProcess.add(function(e,g){var f=e.dom;a(f.select("div",g.node),function(h){if(f.hasClass(h,"mceTmpl")){a(f.select("*",h),function(i){if(f.hasClass(i,e.getParam("template_mdate_classes","mdate").replace(/\s+/g,"|"))){i.innerHTML=d._getDateTime(new Date(),e.getParam("template_mdate_format",e.getLang("template.mdate_format")))}});d._replaceVals(h)}})})},getInfo:function(){return{longname:"Template plugin",author:"Moxiecode Systems AB",authorurl:"http://www.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/template",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_insertTemplate:function(i,j){var k=this,g=k.editor,f,c,d=g.dom,b=g.selection.getContent();f=j.content;a(k.editor.getParam("template_replace_values"),function(l,h){if(typeof(l)!="function"){f=f.replace(new RegExp("\\{\\$"+h+"\\}","g"),l)}});c=d.create("div",null,f);n=d.select(".mceTmpl",c);if(n&&n.length>0){c=d.create("div",null);c.appendChild(n[0].cloneNode(true))}function e(l,h){return new RegExp("\\b"+h+"\\b","g").test(l.className)}a(d.select("*",c),function(h){if(e(h,g.getParam("template_cdate_classes","cdate").replace(/\s+/g,"|"))){h.innerHTML=k._getDateTime(new Date(),g.getParam("template_cdate_format",g.getLang("template.cdate_format")))}if(e(h,g.getParam("template_mdate_classes","mdate").replace(/\s+/g,"|"))){h.innerHTML=k._getDateTime(new Date(),g.getParam("template_mdate_format",g.getLang("template.mdate_format")))}if(e(h,g.getParam("template_selected_content_classes","selcontent").replace(/\s+/g,"|"))){h.innerHTML=b}});k._replaceVals(c);g.execCommand("mceInsertContent",false,c.innerHTML);g.addVisual()},_replaceVals:function(c){var d=this.editor.dom,b=this.editor.getParam("template_replace_values");a(d.select("*",c),function(f){a(b,function(g,e){if(d.hasClass(f,e)){if(typeof(b[e])=="function"){b[e](f)}}})})},_getDateTime:function(e,b){if(!b){return""}function c(g,d){var f;g=""+g;if(g.length 0) { + el = dom.create('div', null); + el.appendChild(n[0].cloneNode(true)); + } + + function hasClass(n, c) { + return new RegExp('\\b' + c + '\\b', 'g').test(n.className); + }; + + each(dom.select('*', el), function(n) { + // Replace cdate + if (hasClass(n, ed.getParam('template_cdate_classes', 'cdate').replace(/\s+/g, '|'))) + n.innerHTML = t._getDateTime(new Date(), ed.getParam("template_cdate_format", ed.getLang("template.cdate_format"))); + + // Replace mdate + if (hasClass(n, ed.getParam('template_mdate_classes', 'mdate').replace(/\s+/g, '|'))) + n.innerHTML = t._getDateTime(new Date(), ed.getParam("template_mdate_format", ed.getLang("template.mdate_format"))); + + // Replace selection + if (hasClass(n, ed.getParam('template_selected_content_classes', 'selcontent').replace(/\s+/g, '|'))) + n.innerHTML = sel; + }); + + t._replaceVals(el); + + ed.execCommand('mceInsertContent', false, el.innerHTML); + ed.addVisual(); + }, + + _replaceVals : function(e) { + var dom = this.editor.dom, vl = this.editor.getParam('template_replace_values'); + + each(dom.select('*', e), function(e) { + each(vl, function(v, k) { + if (dom.hasClass(e, k)) { + if (typeof(vl[k]) == 'function') + vl[k](e); + } + }); + }); + }, + + _getDateTime : function(d, fmt) { + if (!fmt) + return ""; + + function addZeros(value, len) { + var i; + + value = "" + value; + + if (value.length < len) { + for (i=0; i<(len-value.length); i++) + value = "0" + value; + } + + return value; + } + + fmt = fmt.replace("%D", "%m/%d/%y"); + fmt = fmt.replace("%r", "%I:%M:%S %p"); + fmt = fmt.replace("%Y", "" + d.getFullYear()); + fmt = fmt.replace("%y", "" + d.getYear()); + fmt = fmt.replace("%m", addZeros(d.getMonth()+1, 2)); + fmt = fmt.replace("%d", addZeros(d.getDate(), 2)); + fmt = fmt.replace("%H", "" + addZeros(d.getHours(), 2)); + fmt = fmt.replace("%M", "" + addZeros(d.getMinutes(), 2)); + fmt = fmt.replace("%S", "" + addZeros(d.getSeconds(), 2)); + fmt = fmt.replace("%I", "" + ((d.getHours() + 11) % 12 + 1)); + fmt = fmt.replace("%p", "" + (d.getHours() < 12 ? "AM" : "PM")); + fmt = fmt.replace("%B", "" + this.editor.getLang("template_months_long").split(',')[d.getMonth()]); + fmt = fmt.replace("%b", "" + this.editor.getLang("template_months_short").split(',')[d.getMonth()]); + fmt = fmt.replace("%A", "" + this.editor.getLang("template_day_long").split(',')[d.getDay()]); + fmt = fmt.replace("%a", "" + this.editor.getLang("template_day_short").split(',')[d.getDay()]); + fmt = fmt.replace("%%", "%"); + + return fmt; + } + }); + + // Register plugin + tinymce.PluginManager.add('template', tinymce.plugins.TemplatePlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/template/js/template.js b/web/libs/tiny_mce/plugins/template/js/template.js new file mode 100644 index 0000000..24045d7 --- /dev/null +++ b/web/libs/tiny_mce/plugins/template/js/template.js @@ -0,0 +1,106 @@ +tinyMCEPopup.requireLangPack(); + +var TemplateDialog = { + preInit : function() { + var url = tinyMCEPopup.getParam("template_external_list_url"); + + if (url != null) + document.write(''); + }, + + init : function() { + var ed = tinyMCEPopup.editor, tsrc, sel, x, u; + + tsrc = ed.getParam("template_templates", false); + sel = document.getElementById('tpath'); + + // Setup external template list + if (!tsrc && typeof(tinyMCETemplateList) != 'undefined') { + for (x=0, tsrc = []; x'); + }); + }, + + selectTemplate : function(u, ti) { + var d = window.frames['templatesrc'].document, x, tsrc = this.tsrc; + + if (!u) + return; + + d.body.innerHTML = this.templateHTML = this.getFileContents(u); + + for (x=0; x + + {#template_dlg.title} + + + + + +
+
+
{#template_dlg.desc}
+
+ +
+
+
+
+ {#template_dlg.preview} + +
+
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/tinybrowser/config_tinybrowser.php b/web/libs/tiny_mce/plugins/tinybrowser/config_tinybrowser.php new file mode 100644 index 0000000..7a54e23 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/config_tinybrowser.php @@ -0,0 +1,126 @@ +. +*/ + +// switch off error handling, to use custom handler +error_reporting(0); + +// set script time out higher, to help with thumbnail generation +set_time_limit(240); + +$tinybrowser = array(); + +// Session control and security check - to enable please uncomment +if(isset($_GET['sessidpass'])) session_id($_GET['sessidpass']); // workaround for Flash session bug +session_start(); +$tinybrowser['sessioncheck'] = 'upload_dir'; //name of session variable to check + +// Random string used to secure Flash upload if session control not enabled - be sure to change! +$tinybrowser['obfuscate'] = 'yeah'; + +// Set default language (ISO 639-1 code) +$tinybrowser['language'] = 'fr'; + +// Set the integration type (TinyMCE is default) +$tinybrowser['integration'] = 'tinymce'; // Possible values: 'tinymce', 'fckeditor' + +// Default is rtrim($_SERVER['DOCUMENT_ROOT'],'/') (suitable when using absolute paths, but can be set to '' if using relative paths) +$tinybrowser['docroot'] = rtrim($_SERVER['DOCUMENT_ROOT'],'/'); +//$tinybrowser['docroot'] = ''; + +// Folder permissions for Unix servers only +$tinybrowser['unixpermissions'] = 0777; + +// File upload paths (set to absolute by default) + +$tinybrowser['path']['image'] = $_SESSION["upload_dir"].'/images/'; // Image files location - also creates a '_thumbs' subdirectory within this path to hold the image thumbnails +$tinybrowser['path']['media'] = $_SESSION["upload_dir"].'/media/'; // Media files location +$tinybrowser['path']['file'] = $_SESSION["upload_dir"].'/files/'; // Other files location + +/* +$tinybrowser['path']['image'] = $pz_user_dir."/images/"; $tinybrowser['path']['media'] = $pz_user_dir."/media"; $tinybrowser['path']['file'] = $pz_user_dir."/files"; +*/ + +// File link paths - these are the paths that get passed back to TinyMCE or your application (set to equal the upload path by default) +$tinybrowser['link']['image'] = $tinybrowser['path']['image']; // Image links +$tinybrowser['link']['media'] = $tinybrowser['path']['media']; // Media links +$tinybrowser['link']['file'] = $tinybrowser['path']['file']; // Other file links + +// File upload size limit (0 is unlimited) +$tinybrowser['maxsize']['image'] = 0; // Image file maximum size +$tinybrowser['maxsize']['media'] = 0; // Media file maximum size +$tinybrowser['maxsize']['file'] = 0; // Other file maximum size + +// Image automatic resize on upload (0 is no resize) +$tinybrowser['imageresize']['width'] = 0; +$tinybrowser['imageresize']['height'] = 0; + +// Image thumbnail source (set to 'path' by default - shouldn't need changing) +$tinybrowser['thumbsrc'] = 'path'; // Possible values: path, link + +// Image thumbnail size in pixels +$tinybrowser['thumbsize'] = 80; + +// Image and thumbnail quality, higher is better (1 to 99) +$tinybrowser['imagequality'] = 80; // only used when resizing or rotating +$tinybrowser['thumbquality'] = 80; + +// Date format, as per php date function +$tinybrowser['dateformat'] = 'd/m/Y H:i'; + +// Permitted file extensions +$tinybrowser['filetype']['image'] = '*.jpg, *.jpeg, *.gif, *.png'; // Image file types +$tinybrowser['filetype']['media'] = '*.swf, *.dcr, *.mov, *.qt, *.mpg, *.mp3, *.mp4, *.mpeg, *.avi, *.wmv, *.wm, *.asf, *.asx, *.wmx, *.wvx, *.rm, *.ra, *.ram'; // Media file types +$tinybrowser['filetype']['file'] = '*.*'; // Other file types + +// Prohibited file extensions +$tinybrowser['prohibited'] = array('php','php3','php4','php5','phtml','asp','aspx','ascx','jsp','cfm','cfc','pl','bat','exe','dll','reg','cgi', 'sh', 'py','asa','asax','config','com','inc'); + +// Default file sort +$tinybrowser['order']['by'] = 'name'; // Possible values: name, size, type, modified +$tinybrowser['order']['type'] = 'asc'; // Possible values: asc, desc + +// Default image view method +$tinybrowser['view']['image'] = 'thumb'; // Possible values: thumb, detail + +// File Pagination - split results into pages (0 is none) +$tinybrowser['pagination'] = 0; + +// TinyMCE dialog.css file location, relative to tinybrowser.php (can be set to absolute link) +$tinybrowser['tinymcecss'] = '../../themes/advanced/skins/default/dialog.css'; + +// TinyBrowser pop-up window size +$tinybrowser['window']['width'] = 770; +$tinybrowser['window']['height'] = 480; + +// Assign Permissions for Upload, Edit, Delete & Folders +$tinybrowser['allowupload'] = true; +$tinybrowser['allowedit'] = true; +$tinybrowser['allowdelete'] = true; +$tinybrowser['allowfolders'] = true; + +// Clean filenames on upload +$tinybrowser['cleanfilename'] = true; + +// Set default action for edit page +$tinybrowser['defaultaction'] = 'delete'; // Possible values: delete, rename, move + +// Set delay for file process script, only required if server response is slow +$tinybrowser['delayprocess'] = 0; // Value in seconds +?> diff --git a/web/libs/tiny_mce/plugins/tinybrowser/css/style_tinybrowser.css.php b/web/libs/tiny_mce/plugins/tinybrowser/css/style_tinybrowser.css.php new file mode 100644 index 0000000..9e7bb13 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/css/style_tinybrowser.css.php @@ -0,0 +1,226 @@ + +html { +overflow: -moz-scrollbars-vertical !important; +} +.panel_wrapper div.currentmod { +display:block; +width:100%; +overflow-x:hidden; +} +.tabs li.right { +float:right; +margin:0; +} +.tabs span { +font-size: 10px; +} +fieldset { +padding-bottom: 10px; +} +form { +margin: 0; +padding: 0; +font-size: 11px; +} +form.custom select, form.custom input { +margin: 0 7px 0 0; +padding: 0; +} +form.custom input { +height: 14px; +padding: 2px 0 0 2px; +} +form.custom select { +margin-top: 1px; +padding: 0; +} +form.custom label { +margin-right: 2px; +} +.del { +margin: 0; +padding: 0; +border: none; +width: 13px !important; /* for IE */ +height: 13px !important; /* for IE */ +vertical-align: middle; +} +.rad { +margin: 0; +padding: 0; +margin-left: 2px !important; +border: none; +background: none; +vertical-align: middle; +} +img { +vertical-align: middle !important; +} +button { +vertical-align: top; +font-size: 11px; +background-color: #d5d5d5; +border: 1px solid #666666; +padding: 1px 2px; +} +*+html button { padding: 0; } /*IE7+ */ +* html button { padding: 0; } /*IE6- */ +button:hover { +background-color:#8cca83; +cursor: hand; +} +button.edit:hover { +background-color:#ff9999; +} +.tabularwrapper { +margin: 5px; +} +table.browse { +clear: both; +width: 100%; +border: 1px solid #b7babc; +border-right: 0; +border-collapse: collapse; +overflow: hidden; +} +table.browse th, table.browse td { +font-size: 10px; +text-align: left; +padding: 0 7px; +color: #0b333c; +border-right: 1px solid #b7babc; +line-height: 22px; +} +table.browse th { +background-image: url(../img/back.png); +background-repeat: repeat-x; +background-position: bottom left; +border-bottom: 1px solid #b7babc; +} +table.browse th a { +color: #0b333c; +display: block; +width: 100%; +text-decoration: none; +background-repeat: no-repeat; +background-position: center right; +background-image: none; +} +table.browse th a.asc { +background-image: url(../img/asc.gif); +} +table.browse th a.desc { +background-image: url(../img/desc.gif); +} +table.browse tr.r0 td { + background-color: #FFFFFF; +} +table.browse tr.r1 td { + background-color: #f5f5f5; +} +table.browse tr.over td, table.browse th.over { +background-color: #b2e1ff; +background-image: none; +} +.img-browser { +margin: 5px; +border: 1px solid #e2e2e2; +float: left; +clear: none; +text-align: center; +height: px; +width: px; +font-size: px; +} +*+html .img-browser { width: px; } /*IE7+ */ +* html .img-browser { width: px; } /*IE6- */ +.img-browser img { +border: 0; +vertical-align: middle; +margin-top: -20px; +} +*+html .img-browser img { margin-top: 0; } /*IE7+ */ +* html .img-browser img { margin-top: 0; } /*IE6- */ +.img-browser a { +display: block; +width: 100%; +height: 100%; +text-decoration: none; +} +.img-browser a:hover { +background-color: #b2e1ff; +} +.filename { +font-family: Tahoma,Arial,Helvetica,sans-serif; +clear:both; +font-size: 11px; +line-height: 13px; +overflow: hidden; +width: px; +height: 28px; +margin-top: -6px; +padding-left: 3px; +} +a.imghover { +padding-left: 22px; +display: block; +position: relative; +z-index: 30; +background-image: url(../img/preview.gif); +background-repeat: no-repeat; +background-position: 0 4px; +} +a.imghover img { +position: absolute; +z-index: 31; +background-color: #fff; +padding: 4px; +border: 1px solid #888888; +display: none; +} +a.imghover:hover img { +top: -5px; +left: 140px; +display: block; +} +.pushleft { +padding: 4px 5px; +float: left; +text-align: left; +} +.pushright { +padding: 4px 5px; +float: right; +text-align: right; +} +a { +outline: none; +border: 0; +} +.alertsuccess, .alertfailure, .alertinfo { +position: relative; +clear: both; +margin: 0 auto; +padding: 4px 4px 4px 4px; +width: 98%; +text-align: center; +border-style: solid; +border-width: 1px; +} +.alertsuccess { +border-color: #00C000; +background-color: #BBFFBB; +} +.alertfailure { +border-color: #CC0000; +background-color: #FFBBBB; +} +.alertinfo { +border-color: #1133DD; +background-color: #AACCFF; +} + diff --git a/web/libs/tiny_mce/plugins/tinybrowser/css/stylefull_tinybrowser.css b/web/libs/tiny_mce/plugins/tinybrowser/css/stylefull_tinybrowser.css new file mode 100644 index 0000000..e66c8f5 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/css/stylefull_tinybrowser.css @@ -0,0 +1,34 @@ +/* Generic */ +body { +font-family:Verdana, Arial, Helvetica, sans-serif; font-size:11px; +background:#F0F0EE; +padding:0; +margin:8px 8px 0 8px; +} + +html {background:#F0F0EE;} +textarea {resize:none;outline:none;} +a:link, a:visited {color:black;} +a:hover {color:#2B6FB6;} + +/* Forms */ +fieldset {margin:0; padding:4px; border:1px solid #919B9C; font-family:Verdana, Arial; font-size:10px;} +legend {color:#2B6FB6; font-weight:bold;} +input {background:#FFF; border:1px solid #CCC;} +input, select, textarea {font-family:Verdana, Arial, Helvetica, sans-serif; font-size:10px;} +input, select, textarea {border:1px solid #808080;} + +/* Tabs classes */ +.tabs {width:100%; height:18px; line-height:normal; background:url(../img/tabs.gif) repeat-x 0 -72px;} +.tabs ul {margin:0; padding:0; list-style:none;} +.tabs li {float:left; background:url(../img/tabs.gif) no-repeat 0 0; margin:0 2px 0 0; padding:0 0 0 10px; line-height:17px; height:18px; display:block;} +.tabs li.current {background:url(../img/tabs.gif) no-repeat 0 -18px; margin-right:2px;} +.tabs span {float:left; display:block; background:url(../img/tabs.gif) no-repeat right -36px; padding:0px 10px 0 0;} +.tabs .current span {background:url(../img/tabs.gif) no-repeat right -54px;} +.tabs a {text-decoration:none; font-family:Verdana, Arial; font-size:10px;} +.tabs a:link, .tabs a:visited, .tabs a:hover {color:black;} + +/* Panels */ +.panel_wrapper div.panel {display:none;} +.panel_wrapper div.current {display:block; width:100%; height:300px; overflow:visible;} +.panel_wrapper {border:1px solid #919B9C; border-top:0px; padding:10px; padding-top:5px; clear:both; background:white;} diff --git a/web/libs/tiny_mce/plugins/tinybrowser/edit.php b/web/libs/tiny_mce/plugins/tinybrowser/edit.php new file mode 100644 index 0000000..d804eb2 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/edit.php @@ -0,0 +1,537 @@ + array(), + 'message' => array() +); +$deleteqty = 0; +$renameqty = 0; +$resizeqty = 0; +$rotateqty = 0; +$moveqty = 0; +$errorqty = 0; + +// Set when rotating images to force thumbnail refresh +$imagerefresh =''; + +// Delete any checked files +if(isset($_POST['deletefile'])) + { + foreach($_POST['deletefile'] as $delthis => $val) + { + $delthisfile = $tinybrowser['docroot'].$editpath.$_POST['actionfile'][$delthis]; + if (file_exists($delthisfile) && unlink($delthisfile)) $deleteqty++; else $errorqty++; + if($typenow=='image') + { + $delthisthumb = $tinybrowser['docroot'].$editpath.'_thumbs/_'.$_POST['actionfile'][$delthis]; + if (file_exists($delthisthumb)) unlink($delthisthumb); + } + } + } + +// Rename any files with changed name +if(isset($_POST['renamefile'])) + { + foreach($_POST['renamefile'] as $namethis => $newname) + { + if($_POST['actionfile'][$namethis] != $newname.$_POST['renameext'][$namethis]) + { + $namethisfilefrom = $tinybrowser['docroot'].$editpath.$_POST['actionfile'][$namethis]; + $namethisfileto = $tinybrowser['docroot'].$editpath.clean_filename($newname.$_POST['renameext'][$namethis]); + if (file_exists($namethisfilefrom) && rename($namethisfilefrom,$namethisfileto)) $renameqty++; else $errorqty++; + if($typenow=='image') + { + $namethisthumbfrom = $tinybrowser['docroot'].$editpath.'_thumbs/_'.$_POST['actionfile'][$namethis]; + $namethisthumbto = $tinybrowser['docroot'].$editpath.'_thumbs/_'.clean_filename($newname.$_POST['renameext'][$namethis]); + if (file_exists($namethisthumbfrom)) rename($namethisthumbfrom,$namethisthumbto); + } + } + } + } + +// Move any checked files +if(isset($_POST['movefile'])) + { + foreach($_POST['movefile'] as $movethis => $val) + { + $movethisfile = $tinybrowser['docroot'].$editpath.$_POST['actionfile'][$movethis]; + $movefiledest = $tinybrowser['docroot'].$destfolder.$_POST['actionfile'][$movethis]; + if (!file_exists($movefiledest) && file_exists($movethisfile) && copy($movethisfile,$movefiledest)) + { + $moveqty++; + unlink($movethisfile); + if($typenow=='image') + { + $movethisthumb = $tinybrowser['docroot'].$editpath.'_thumbs/_'.$_POST['actionfile'][$movethis]; + $movethumbdest = $tinybrowser['docroot'].$destfolder.'_thumbs/_'.$_POST['actionfile'][$movethis]; + if (file_exists($movethisthumb) && copy($movethisthumb,$movethumbdest)) unlink($movethisthumb); + } + } + else $errorqty++; + } + } + +// Resize any files with new size +if(isset($_POST['resizefile'])) + { + foreach($_POST['resizefile'] as $sizethis => $newsize) + { + $newsize = intval($newsize); + if($newsize) + { + // detect silly sizes + if($newsize > $tinybrowser['thumbsize']) + { + // do image resize + $targetimg = $tinybrowser['docroot'].$editpath.$_POST['actionfile'][$sizethis]; + if (file_exists($targetimg)) + { + $mime = getimagesize($targetimg); + if($_POST['resizetype'][$sizethis]=='width') + { + $rw = $newsize; + $rh = $mime[1]; + } + else + { + $rw = $mime[0]; + $rh = $newsize; + } + $im = convert_image($targetimg,$mime['mime']); + resizeimage($im,$rw,$rh,$targetimg,$tinybrowser['imagequality'],$mime['mime']); + imagedestroy($im); + $resizeqty++; + } + else $errorqty++; + } + else $errorqty++; + } + } + } + +// Rotate any selected files +if(isset($_POST['rotatefile'])) + { + $imagerefresh = '?refresh='.uniqid(''); + foreach($_POST['rotatefile'] as $rotatethis => $direction) + { + if($direction != 'none') + { + $targetimg = $tinybrowser['docroot'].$editpath.$_POST['actionfile'][$rotatethis]; + if (file_exists($targetimg)) + { + // rotate image + if($direction == 'clock') $degree=270; else $degree=90; + $mime = getimagesize($targetimg); + $im = convert_image($targetimg,$mime['mime']); + + // additional processing for png / gif transparencies (credit to Dirk Bohl) + if($mime['mime'] == 'image/x-png' || $mime['mime'] == 'image/png') + { + imagealphablending($newim, false); + imagesavealpha($newim, true); + } + elseif($mime['mime'] == 'image/gif') + { + $originaltransparentcolor = imagecolortransparent( $im ); + if($originaltransparentcolor >= 0 && $originaltransparentcolor < imagecolorstotal( $im )) + { + $transparentcolor = imagecolorsforindex( $im, $originaltransparentcolor ); + $newtransparentcolor = imagecolorallocate($newim,$transparentcolor['red'],$transparentcolor['green'],$transparentcolor['blue']); + imagefill( $newim, 0, 0, $newtransparentcolor ); + imagecolortransparent( $newim, $newtransparentcolor ); + } + } + $newim = imagerotate($im, $degree, 0); + imagedestroy($im); + + if($mime['mime'] == 'image/pjpeg' || $mime['mime'] == 'image/jpeg') + imagejpeg ($newim,$targetimg,$tinybrowser['imagequality']); + elseif($mime['mime'] == 'image/x-png' || $mime['mime'] == 'image/png') + imagepng ($newim,$targetimg,substr($tinybrowser['imagequality'],0,1)); + elseif($mime['mime'] == 'image/gif') + imagegif ($newim,$targetimg); + imagedestroy($newim); + $rotateqty++; + + // delete and recreate thumbnail image + $targetthumb = $tinybrowser['docroot'].$editpath.'_thumbs/_'.$_POST['actionfile'][$rotatethis]; + if (file_exists($targetthumb)) unlink($targetthumb); + $mime = getimagesize($targetimg); + $im = convert_image($targetimg,$mime['mime']); + resizeimage($im,$tinybrowser['thumbsize'],$tinybrowser['thumbsize'],$targetthumb,$tinybrowser['thumbquality'],$mime['mime']); + imagedestroy($im); + } + else $errorqty++; + } + } + } + +// Read directory contents and populate $file array +$dh = opendir($tinybrowser['docroot'].$editpath); +$file = array(); +while (($filename = readdir($dh)) !== false) + { + // get file extension + $nameparts = explode('.',$filename); + $ext = end($nameparts); + + // filter directories and prohibited file types + if($filename != '.' && $filename != '..' && !is_dir($tinybrowser['docroot'].$editpath.$filename) && !in_array($ext, $tinybrowser['prohibited']) && ($typenow == 'file' || strpos(strtolower($tinybrowser['filetype'][$typenow]),strtolower($ext)))) + { + // search file name if search term entered + if($findnow) $exists = strpos(strtolower($filename),strtolower($findnow)); + + // assign file details to array, for all files or those that match search + if(!$findnow || ($findnow && $exists !== false)) + { + $file['name'][] = $filename; + $file['sortname'][] = strtolower($filename); + $file['modified'][] = filemtime($tinybrowser['docroot'].$editpath.$filename); + $file['size'][] = filesize($tinybrowser['docroot'].$editpath.$filename); + + // image specific info or general + if($typenow=='image' && $imginfo = getimagesize($tinybrowser['docroot'].$editpath.$filename)) + { + $file['width'][] = $imginfo[0]; + $file['height'][] = $imginfo[1]; + $file['dimensions'][] = $imginfo[0] + $imginfo[1]; + $file['type'][] = $imginfo['mime']; + } + else + { + $file['width'][] = 'N/A'; + $file['height'][] = 'N/A'; + $file['dimensions'][] = 'N/A'; + $file['type'][] = returnMIMEType($filename); + } + } + } + } +closedir($dh); + +// Assign directory structure to array +$editdirs=array(); +dirtree($editdirs,$tinybrowser['filetype'][$typenow],$tinybrowser['docroot'],$tinybrowser['path'][$typenow]); + +// generate alert if files deleted +if($deleteqty>0) + { + $notify['type'][]='success'; + $notify['message'][]=sprintf(TB_MSGDELETE, $deleteqty); + } +// generate alert if files renamed +elseif($renameqty>0) + { + $notify['type'][]='success'; + $notify['message'][]=sprintf(TB_MSGRENAME, $renameqty); + } +// generate alert if files renamed +elseif($moveqty>0) + { + $notify['type'][]='success'; + $notify['message'][]=sprintf(TB_MSGMOVE, $moveqty); + } +// generate alert if images resized +elseif($resizeqty>0) + { + $notify['type'][]='success'; + $notify['message'][]=sprintf(TB_MSGRESIZE, $resizeqty); + } +// generate alert if images rotated +elseif($rotateqty>0) + { + $notify['type'][]='success'; + $notify['message'][]=sprintf(TB_MSGROTATE, $rotateqty); + } + +// generate alert if file errors encountered +if($errorqty>0) + { + $notify['type'][]='failure'; + $notify['message'][]=sprintf(TB_MSGEDITERR, $errorqty); + } + +// determine sort order +$sortorder = ($sorttypenow == 'asc' ? SORT_ASC : SORT_DESC); +$num_of_files = (isset($file['name']) ? count($file['name']) : 0); + +if($num_of_files>0) + { + // sort files by selected order + sortfileorder($sortbynow,$sortorder,$file); + } + +// determine pagination +if($tinybrowser['pagination']>0) + { + $showpagestart = ($showpagenow ? ($_REQUEST['showpage']*$tinybrowser['pagination'])-$tinybrowser['pagination'] : 0); + $showpageend = $showpagestart+$tinybrowser['pagination']; + if($showpageend>$num_of_files) $showpageend = $num_of_files; + } +else + { + $showpagestart = 0; + $showpageend = $num_of_files; + } +?> + + + +TinyBrowser :: <?php echo TB_EDIT; ?> + + + + + + + +0) alert($notify); +form_open('foldertab',false,'edit.php','?type='.$typenow.$passfeid); +?> +
+
    +
  • +
  • + +
  • +
  • 1) + { + ?>
  • +
+
+ +
+
+
+ + +
+0) + { + $pagelimit = ceil($num_of_files/$tinybrowser['pagination'])+1; + $page = array(); + for($i=1;$i<$pagelimit;$i++) + { + $page[] = array($i,TB_PAGE.' '.$i); + } + if($i>2) form_select($page,'showpage',SHOW,$showpagenow,true); + } +?>
+ + + + +'; + if($typenow=='image') echo ''; + else echo ''; + echo '' + .'\n"; + } + +echo "
>>>
' .truncate_text($file['name'][$i],30).''.truncate_text($file['name'][$i],30).''.bytestostring($file['size'][$i],1).''.$file['type'][$i].''; + form_hidden_input('actionfile['.$i.']',$file['name'][$i]); + switch($actionnow) + { + case 'delete': + echo ''; + break; + case 'rename': + // get file extension + $nameparts = explode('.',$file['name'][$i]); + $ext = end($nameparts); + form_hidden_input('renameext['.$i.']',$ext); + form_text_input('renamefile['.$i.']',false,basename($file['name'][$i],$ext),30,120); echo $ext; + break; + case 'resize': + form_text_input('resizefile['.$i.']',false,'',4,4); form_select($selectresize,'resizetype['.$i.']',false,'',false); + break; + case 'rotate': + echo ''.TB_ROTATECW.''.TB_ROTATECCW.''.TB_NONE.''; + break; + case 'move': + echo ''; + break; + default: + // do nothing + } + echo "
\n".'
'; +if($tinybrowser['allowdelete'] || $tinybrowser['allowedit']) + { + form_hidden_input('sortby',$sortbynow); + form_hidden_input('sorttype',$sorttypenow); + form_hidden_input('find',$findnow); + form_hidden_input('showpage',$showpagenow); + form_hidden_input('action',$actionnow); + form_submit_button('commit',$actionhead.' '.TB_FILES,'edit'); + } +?> +
+ + diff --git a/web/libs/tiny_mce/plugins/tinybrowser/flexupload.swf b/web/libs/tiny_mce/plugins/tinybrowser/flexupload.swf new file mode 100644 index 0000000..4ee5a2e Binary files /dev/null and b/web/libs/tiny_mce/plugins/tinybrowser/flexupload.swf differ diff --git a/web/libs/tiny_mce/plugins/tinybrowser/fns_tinybrowser.php b/web/libs/tiny_mce/plugins/tinybrowser/fns_tinybrowser.php new file mode 100644 index 0000000..c5ea26b --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/fns_tinybrowser.php @@ -0,0 +1,431 @@ +

$maxwidth) || ($maxheight && $height > $maxheight)) + { + if($maxwidth && $width > $maxwidth) + { + $widthratio = $maxwidth/$width; + $resizewidth=true; + } + else $resizewidth=false; + + if($maxheight && $height > $maxheight) + { + $heightratio = $maxheight/$height; + $resizeheight=true; + } + else $resizeheight=false; + + if($resizewidth && $resizeheight) + { + if($widthratio < $heightratio) $ratio = $widthratio; + else $ratio = $heightratio; + } + elseif($resizewidth) + { + $ratio = $widthratio; + } + elseif($resizeheight) + { + $ratio = $heightratio; + } + $newwidth = $width * $ratio; + $newheight = $height * $ratio; + if(function_exists('imagecopyresampled') && $imagetype !='image/gif') + { + $newim = imagecreatetruecolor($newwidth, $newheight); + } + else + { + $newim = imagecreate($newwidth, $newheight); + } + + // additional processing for png / gif transparencies (credit to Dirk Bohl) + if($imagetype == 'image/x-png' || $imagetype == 'image/png') + { + imagealphablending($newim, false); + imagesavealpha($newim, true); + } + elseif($imagetype == 'image/gif') + { + $originaltransparentcolor = imagecolortransparent( $im ); + if($originaltransparentcolor >= 0 && $originaltransparentcolor < imagecolorstotal( $im )) + { + $transparentcolor = imagecolorsforindex( $im, $originaltransparentcolor ); + $newtransparentcolor = imagecolorallocate($newim,$transparentcolor['red'],$transparentcolor['green'],$transparentcolor['blue']); + imagefill( $newim, 0, 0, $newtransparentcolor ); + imagecolortransparent( $newim, $newtransparentcolor ); + } + } + + imagecopyresampled($newim, $im, 0, 0, 0, 0, $newwidth, $newheight, $width, $height); + + if($imagetype == 'image/pjpeg' || $imagetype == 'image/jpeg') + { + imagejpeg ($newim,$urlandname,$comp); + } + elseif($imagetype == 'image/x-png' || $imagetype == 'image/png') + { + imagepng ($newim,$urlandname,substr($comp,0,1)); + } + elseif($imagetype == 'image/gif') + { + imagegif ($newim,$urlandname); + } + imagedestroy ($newim); + } +else + { + if($imagetype == 'image/pjpeg' || $imagetype == 'image/jpeg') + { + imagejpeg ($im,$urlandname,$comp); + } + elseif($imagetype == 'image/x-png' || $imagetype == 'image/png') + { + imagepng ($im,$urlandname,substr($comp,0,1)); + } + elseif($imagetype == 'image/gif') + { + imagegif ($im,$urlandname); + } + } +} + +// **************************CHECK IMAGE TYPE AND CONVERT TO TEMP TYPE***************************** +function convert_image($imagetemp,$imagetype){ + +if($imagetype == 'image/pjpeg' || $imagetype == 'image/jpeg') + { + $cim1 = imagecreatefromjpeg($imagetemp); + } +elseif($imagetype == 'image/x-png' || $imagetype == 'image/png') + { + $cim1 = imagecreatefrompng($imagetemp); + imagealphablending($cim1, false); + imagesavealpha($cim1, true); + } +elseif($imagetype == 'image/gif') + { + $cim1 = imagecreatefromgif($imagetemp); + } +return $cim1; +} + +// **************************GENERATE FORM OPEN***************************** +function form_open($name,$class,$url,$parameters){ +?>
+ + + +
+ $length) + { + $textstring = substr($textstring,0,$length).'...'; + } + return $textstring; +} + +/** + * Present a size (in bytes) as a human-readable value + * + * @param int $size size (in bytes) + * @param int $precision number of digits after the decimal point + * @return string + */ +function bytestostring($size, $precision = 0) { + $sizes = array('YB', 'ZB', 'EB', 'PB', 'TB', 'GB', 'MB', 'KB', 'B'); + $total = count($sizes); + + while($total-- && $size > 1024) $size /= 1024; + return round($size, $precision).' '.$sizes[$total]; +} + +//function to clean a filename string so it is a valid filename +function clean_filename($filename){ + $filename = preg_replace('/^\W+|\W+$/', '', $filename); // remove all non-alphanumeric chars at begin & end of string + $filename = preg_replace('/\s+/', '_', $filename); // compress internal whitespace and replace with _ + return strtolower(preg_replace('/\W-/', '', $filename)); // remove all non-alphanumeric chars except _ and - + +} + +//********************************Return File MIME Type*************************** +function returnMIMEType($filename) + { + preg_match("|\.([a-z0-9]{2,4})$|i", $filename, $fileSuffix); + + switch(strtolower($fileSuffix[1])) + { + case 'js' : + return 'application/x-javascript'; + + case 'json' : + return 'application/json'; + + case 'jpg' : + case 'jpeg' : + case 'jpe' : + return 'image/jpg'; + + case 'png' : + case 'gif' : + case 'bmp' : + case 'tiff' : + return 'image/'.strtolower($fileSuffix[1]); + + case 'css' : + return 'text/css'; + + case 'xml' : + return 'application/xml'; + + case 'doc' : + case 'docx' : + return 'application/msword'; + + case 'xls' : + case 'xlt' : + case 'xlm' : + case 'xld' : + case 'xla' : + case 'xlc' : + case 'xlw' : + case 'xll' : + return 'application/vnd.ms-excel'; + + case 'ppt' : + case 'pps' : + return 'application/vnd.ms-powerpoint'; + + case 'rtf' : + return 'application/rtf'; + + case 'pdf' : + return 'application/pdf'; + + case 'html' : + case 'htm' : + case 'php' : + return 'text/html'; + + case 'txt' : + return 'text/plain'; + + case 'mpeg' : + case 'mpg' : + case 'mpe' : + return 'video/mpeg'; + + case 'mp3' : + return 'audio/mpeg3'; + + case 'wav' : + return 'audio/wav'; + + case 'aiff' : + case 'aif' : + return 'audio/aiff'; + + case 'avi' : + return 'video/msvideo'; + + case 'wmv' : + return 'video/x-ms-wmv'; + + case 'mov' : + return 'video/quicktime'; + + case 'zip' : + return 'application/zip'; + + case 'tar' : + return 'application/x-tar'; + + case 'swf' : + return 'application/x-shockwave-flash'; + + default : + if(function_exists('mime_content_type')) + { + $fileSuffix = mime_content_type($filename); + } + + return 'unknown/' . trim($fileSuffix[0], '.'); + } + } + +//************************Return Array of Directory Structure*************************** +function dirtree(&$alldirs,$types='*.*',$root='',$tree='',$branch='',$level=0) { + +// filter file types according to type +$filetypes = explode(',',preg_replace('{[ \t]+}', '',$types)); + +if($level==0 && is_dir($root.$tree.$branch)) + { + $filenum=0; + foreach($filetypes as $filetype) + { + $filenum = $filenum + count(glob($root.$tree.$branch.sql_regcase($filetype),GLOB_NOSORT)); + } + $treeparts = explode('/',rtrim($tree,'/')); + $topname = end($treeparts); + $alldirs[] = array($branch,rtrim($topname,'/').' ('.$filenum.')',rtrim($topname,'/'),rtrim($topname,'/'),$filenum,filemtime($root.$tree.$branch)); + } +$level++; + +$dh = opendir($root.$tree.$branch); +while (($dirname = readdir($dh)) !== false) + { + if($dirname != '.' && $dirname != '..' && is_dir($root.$tree.$branch.$dirname) && $dirname != '_thumbs') + { + $filenum=0; + foreach($filetypes as $filetype) + { + $filenum = $filenum + count(glob($root.$tree.$branch.$dirname.'/'.sql_regcase($filetype),GLOB_NOSORT)); + } + $indent = ''; + for($i=0;$i<$level;$i++) { $indent .= '   '; } + if(strlen($indent)>0) $indent .= '→ '; + $alldirs[] = array(urlencode($branch.$dirname.'/'),$indent.$dirname.' ('.$filenum.')',$indent.$dirname,$dirname,$filenum,filemtime($root.$tree.$branch.$dirname)); + dirtree($alldirs,$types,$root,$tree,$branch.$dirname.'/',$level); + } + } +closedir($dh); +$level--; +} + +/* user defined error handling function. */ +function userErrorHandler($errno, $errmsg, $filename, $linenum, $vars) +{ + // timestamp for the error entry. + $dt = date('Y-m-d H:i:s (T)'); + + // define an assoc array of error string + // in reality the only entries we should + // consider are E_WARNING, E_NOTICE, E_USER_ERROR, + // E_USER_WARNING and E_USER_NOTICE. + $errortype = array ( + E_ERROR => 'Error', + E_WARNING => 'Warning', + E_PARSE => 'Parsing Error', + E_NOTICE => 'Notice', + E_CORE_ERROR => 'Core Error', + E_CORE_WARNING => 'Core Warning', + E_COMPILE_ERROR => 'Compile Error', + E_COMPILE_WARNING => 'Compile Warning', + E_USER_ERROR => 'User Error', + E_USER_WARNING => 'User Warning', + E_USER_NOTICE => 'User Notice', + E_STRICT => 'Runtime Notice' + ); + // set of errors for which a var trace will be saved. + $user_errors = array(E_USER_ERROR, E_USER_WARNING, E_USER_NOTICE); + + if($errno != E_STRICT) // exclude Runtime Notices + { + $err = $dt. "\t"; + $err .= $errno.' '.$errortype[$errno]. "\t"; + $err .= $errmsg. "\t"; + $err .= 'File: '.basename($filename). "\t"; + $err .= 'Line: '.$linenum. "\t"; + + if (in_array($errno, $user_errors)) + { + $err .= 'Trace: '.wddx_serialize_value($vars, 'Variables'). "\t"; + } + $err .= "\n"; + + // save to the error log file, and e-mail me if there is a critical user error. + error_log($err, 3, 'error.log'); + } +} +$old_error_handler = set_error_handler('userErrorHandler'); + +?> diff --git a/web/libs/tiny_mce/plugins/tinybrowser/folders.php b/web/libs/tiny_mce/plugins/tinybrowser/folders.php new file mode 100644 index 0000000..b9f52a6 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/folders.php @@ -0,0 +1,273 @@ + array(), + 'message' => array() +); +$createqty = 0; +$deleteqty = 0; +$renameqty = 0; +$errorqty = 0; + +// Create any child folders with entered name +if(isset($_POST['createfolder'])) + { + foreach($_POST['createfolder'] as $parent => $newfolder) + { + if($newfolder != '') + { + $createthisfolder = $tinybrowser['docroot'].$dirpath.urldecode($_POST['actionfolder'][$parent]).clean_filename($newfolder); + if (!file_exists($createthisfolder) && createfolder($createthisfolder,$tinybrowser['unixpermissions'])) $createqty++; else $errorqty++; + if($typenow=='image') + { + createfolder($createthisfolder.'/_thumbs/',$tinybrowser['unixpermissions']); + } + } + } + } + +// Delete any checked folders +if(isset($_POST['deletefolder'])) + { + foreach($_POST['deletefolder'] as $delthis => $val) + { + if($typenow=='image') + { + $delthisthumbdir = $tinybrowser['docroot'].$dirpath.urldecode($_POST['actionfolder'][$delthis]).'_thumbs/'; + if (is_dir($delthisthumbdir)) rmdir($delthisthumbdir); + } + $delthisdir = $tinybrowser['docroot'].$dirpath.urldecode($_POST['actionfolder'][$delthis]); + if (is_dir($delthisdir) && rmdir($delthisdir)) $deleteqty++; else $errorqty++; + if($foldernow==urldecode($_POST['actionfolder'][$delthis])) + { + $foldernow = ''; + $passfolder = ''; + } + } + + } + +// Rename any folders with changed name +if(isset($_POST['renamefolder'])) + { + foreach($_POST['renamefolder'] as $namethis => $newname) + { + $urlparts = explode('/',rtrim(urldecode($_POST['actionfolder'][$namethis]),'/')); + if(array_pop($urlparts) != $newname) + { + $namethisfolderfrom = $tinybrowser['docroot'].$dirpath.urldecode($_POST['actionfolder'][$namethis]); + $renameurl = implode('/',$urlparts).'/'.clean_filename($newname).'/'; + $namethisfolderto = $tinybrowser['docroot'].$dirpath.$renameurl; + if (is_dir($namethisfolderfrom) && rename($namethisfolderfrom,$namethisfolderto)) $renameqty++; else $errorqty++; + if($foldernow==urldecode($_POST['actionfolder'][$namethis])) + { + $foldernow = ltrim($renameurl,'/'); + $passfolder = '&folder='.urlencode(ltrim($renameurl,'/')); + } + } + } + } + +// Assign directory structure to array +$dirs=array(); +dirtree($dirs,$tinybrowser['filetype'][$typenow],$tinybrowser['docroot'],$tinybrowser['path'][$typenow]); + +// generate alert if folders deleted +if($createqty>0) + { + $notify['type'][]='success'; + $notify['message'][]=sprintf(TB_MSGCREATE, $createqty); + } +// generate alert if folders deleted +elseif($deleteqty>0) + { + $notify['type'][]='success'; + $notify['message'][]=sprintf(TB_MSGDELETE, $deleteqty); + } +// generate alert if folders renamed +elseif($renameqty>0) + { + $notify['type'][]='success'; + $notify['message'][]=sprintf(TB_MSGRENAME, $renameqty); + } + +// generate alert if file errors encountered +if($errorqty>0) + { + $notify['type'][]='failure'; + $notify['message'][]=sprintf(TB_MSGEDITERR, $errorqty); + } + +// count folders +$num_of_folders = (isset($dirs) ? count($dirs) : 0); + +?> + + + +TinyBrowser :: <?php echo TB_FOLDERS; ?> + + + + + + + +0) alert($notify); +form_open('foldertab',false,'folders.php','?type='.$typenow.$passfeid); +?> +
+
    +
  • +
  • +
  • +
  • +
+
+ +
+
+
+ + +
+
+ + + + +'; + echo ''; + echo '' + .'\n"; + } + +echo "
'.$dirs[$i][2].''.$dirs[$i][4].''.date($tinybrowser['dateformat'],$dirs[$i][5]).''; + form_hidden_input('actionfolder['.$i.']',$dirs[$i][0]); + switch($actionnow) + { + case 'create': + echo '→ '; + form_text_input('createfolder['.$i.']',false,'',30,120); + break; + case 'delete': + $disabledel = ($dirs[$i][4] > 0 ? ' DISABLED' : ''); + if(!$disable) echo ''; + break; + case 'rename': + if(!$disable) form_text_input('renamefolder['.$i.']',false,$dirs[$i][3],30,120); + break; + default: + // do nothing + } + echo "
\n".'
'; +if($tinybrowser['allowdelete'] && $tinybrowser['allowedit']) + { + form_hidden_input('editaction',$actionnow); + form_submit_button('commit',$actionhead.' '.TB_FOLDERS,'edit'); + } +?> +
+ + diff --git a/web/libs/tiny_mce/plugins/tinybrowser/img/asc.gif b/web/libs/tiny_mce/plugins/tinybrowser/img/asc.gif new file mode 100644 index 0000000..adf5013 Binary files /dev/null and b/web/libs/tiny_mce/plugins/tinybrowser/img/asc.gif differ diff --git a/web/libs/tiny_mce/plugins/tinybrowser/img/back.png b/web/libs/tiny_mce/plugins/tinybrowser/img/back.png new file mode 100644 index 0000000..567a182 Binary files /dev/null and b/web/libs/tiny_mce/plugins/tinybrowser/img/back.png differ diff --git a/web/libs/tiny_mce/plugins/tinybrowser/img/desc.gif b/web/libs/tiny_mce/plugins/tinybrowser/img/desc.gif new file mode 100644 index 0000000..09f89cb Binary files /dev/null and b/web/libs/tiny_mce/plugins/tinybrowser/img/desc.gif differ diff --git a/web/libs/tiny_mce/plugins/tinybrowser/img/preview.gif b/web/libs/tiny_mce/plugins/tinybrowser/img/preview.gif new file mode 100644 index 0000000..73dba77 Binary files /dev/null and b/web/libs/tiny_mce/plugins/tinybrowser/img/preview.gif differ diff --git a/web/libs/tiny_mce/plugins/tinybrowser/img/rotate_ac.gif b/web/libs/tiny_mce/plugins/tinybrowser/img/rotate_ac.gif new file mode 100644 index 0000000..ea25adc Binary files /dev/null and b/web/libs/tiny_mce/plugins/tinybrowser/img/rotate_ac.gif differ diff --git a/web/libs/tiny_mce/plugins/tinybrowser/img/rotate_c.gif b/web/libs/tiny_mce/plugins/tinybrowser/img/rotate_c.gif new file mode 100644 index 0000000..3a4bb7c Binary files /dev/null and b/web/libs/tiny_mce/plugins/tinybrowser/img/rotate_c.gif differ diff --git a/web/libs/tiny_mce/plugins/tinybrowser/img/tabs.gif b/web/libs/tiny_mce/plugins/tinybrowser/img/tabs.gif new file mode 100644 index 0000000..ce4be63 Binary files /dev/null and b/web/libs/tiny_mce/plugins/tinybrowser/img/tabs.gif differ diff --git a/web/libs/tiny_mce/plugins/tinybrowser/js/swfobject.js b/web/libs/tiny_mce/plugins/tinybrowser/js/swfobject.js new file mode 100644 index 0000000..e7edd42 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/js/swfobject.js @@ -0,0 +1,8 @@ +/** + * SWFObject v1.5: Flash Player detection and embed - http://blog.deconcept.com/swfobject/ + * + * SWFObject is (c) 2007 Geoff Stearns and is released under the MIT License: + * http://www.opensource.org/licenses/mit-license.php + * + */ +if(typeof deconcept=="undefined"){var deconcept=new Object();}if(typeof deconcept.util=="undefined"){deconcept.util=new Object();}if(typeof deconcept.SWFObjectUtil=="undefined"){deconcept.SWFObjectUtil=new Object();}deconcept.SWFObject=function(_1,id,w,h,_5,c,_7,_8,_9,_a){if(!document.getElementById){return;}this.DETECT_KEY=_a?_a:"detectflash";this.skipDetect=deconcept.util.getRequestParameter(this.DETECT_KEY);this.params=new Object();this.variables=new Object();this.attributes=new Array();if(_1){this.setAttribute("swf",_1);}if(id){this.setAttribute("id",id);}if(w){this.setAttribute("width",w);}if(h){this.setAttribute("height",h);}if(_5){this.setAttribute("version",new deconcept.PlayerVersion(_5.toString().split(".")));}this.installedVer=deconcept.SWFObjectUtil.getPlayerVersion();if(!window.opera&&document.all&&this.installedVer.major>7){deconcept.SWFObject.doPrepUnload=true;}if(c){this.addParam("bgcolor",c);}var q=_7?_7:"high";this.addParam("quality",q);this.setAttribute("useExpressInstall",false);this.setAttribute("doExpressInstall",false);var _c=(_8)?_8:window.location;this.setAttribute("xiRedirectUrl",_c);this.setAttribute("redirectUrl","");if(_9){this.setAttribute("redirectUrl",_9);}};deconcept.SWFObject.prototype={useExpressInstall:function(_d){this.xiSWFPath=!_d?"expressinstall.swf":_d;this.setAttribute("useExpressInstall",true);},setAttribute:function(_e,_f){this.attributes[_e]=_f;},getAttribute:function(_10){return this.attributes[_10];},addParam:function(_11,_12){this.params[_11]=_12;},getParams:function(){return this.params;},addVariable:function(_13,_14){this.variables[_13]=_14;},getVariable:function(_15){return this.variables[_15];},getVariables:function(){return this.variables;},getVariablePairs:function(){var _16=new Array();var key;var _18=this.getVariables();for(key in _18){_16[_16.length]=key+"="+_18[key];}return _16;},getSWFHTML:function(){var _19="";if(navigator.plugins&&navigator.mimeTypes&&navigator.mimeTypes.length){if(this.getAttribute("doExpressInstall")){this.addVariable("MMplayerType","PlugIn");this.setAttribute("swf",this.xiSWFPath);}_19="0){_19+="flashvars=\""+_1c+"\"";}_19+="/>";}else{if(this.getAttribute("doExpressInstall")){this.addVariable("MMplayerType","ActiveX");this.setAttribute("swf",this.xiSWFPath);}_19="";_19+="";var _1d=this.getParams();for(var key in _1d){_19+="";}var _1f=this.getVariablePairs().join("&");if(_1f.length>0){_19+="";}_19+="";}return _19;},write:function(_20){if(this.getAttribute("useExpressInstall")){var _21=new deconcept.PlayerVersion([6,0,65]);if(this.installedVer.versionIsValid(_21)&&!this.installedVer.versionIsValid(this.getAttribute("version"))){this.setAttribute("doExpressInstall",true);this.addVariable("MMredirectURL",escape(this.getAttribute("xiRedirectUrl")));document.title=document.title.slice(0,47)+" - Flash Player Installation";this.addVariable("MMdoctitle",document.title);}}if(this.skipDetect||this.getAttribute("doExpressInstall")||this.installedVer.versionIsValid(this.getAttribute("version"))){var n=(typeof _20=="string")?document.getElementById(_20):_20;n.innerHTML=this.getSWFHTML();return true;}else{if(this.getAttribute("redirectUrl")!=""){document.location.replace(this.getAttribute("redirectUrl"));}}return false;}};deconcept.SWFObjectUtil.getPlayerVersion=function(){var _23=new deconcept.PlayerVersion([0,0,0]);if(navigator.plugins&&navigator.mimeTypes.length){var x=navigator.plugins["Shockwave Flash"];if(x&&x.description){_23=new deconcept.PlayerVersion(x.description.replace(/([a-zA-Z]|\s)+/,"").replace(/(\s+r|\s+b[0-9]+)/,".").split("."));}}else{if(navigator.userAgent&&navigator.userAgent.indexOf("Windows CE")>=0){var axo=1;var _26=3;while(axo){try{_26++;axo=new ActiveXObject("ShockwaveFlash.ShockwaveFlash."+_26);_23=new deconcept.PlayerVersion([_26,0,0]);}catch(e){axo=null;}}}else{try{var axo=new ActiveXObject("ShockwaveFlash.ShockwaveFlash.7");}catch(e){try{var axo=new ActiveXObject("ShockwaveFlash.ShockwaveFlash.6");_23=new deconcept.PlayerVersion([6,0,21]);axo.AllowScriptAccess="always";}catch(e){if(_23.major==6){return _23;}}try{axo=new ActiveXObject("ShockwaveFlash.ShockwaveFlash");}catch(e){}}if(axo!=null){_23=new deconcept.PlayerVersion(axo.GetVariable("$version").split(" ")[1].split(","));}}}return _23;};deconcept.PlayerVersion=function(_29){this.major=_29[0]!=null?parseInt(_29[0]):0;this.minor=_29[1]!=null?parseInt(_29[1]):0;this.rev=_29[2]!=null?parseInt(_29[2]):0;};deconcept.PlayerVersion.prototype.versionIsValid=function(fv){if(this.majorfv.major){return true;}if(this.minorfv.minor){return true;}if(this.rev=0;i--){_2f[i].style.display="none";for(var x in _2f[i]){if(typeof _2f[i][x]=="function"){_2f[i][x]=function(){};}}}};if(deconcept.SWFObject.doPrepUnload){if(!deconcept.unloadSet){deconcept.SWFObjectUtil.prepUnload=function(){__flash_unloadHandler=function(){};__flash_savedUnloadHandler=function(){};window.attachEvent("onunload",deconcept.SWFObjectUtil.cleanupSWFs);};window.attachEvent("onbeforeunload",deconcept.SWFObjectUtil.prepUnload);deconcept.unloadSet=true;}}if(!document.getElementById&&document.all){document.getElementById=function(id){return document.all[id];};}var getQueryParamValue=deconcept.util.getRequestParameter;var FlashObject=deconcept.SWFObject;var SWFObject=deconcept.SWFObject; \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/js/tinybrowser.js.php b/web/libs/tiny_mce/plugins/tinybrowser/js/tinybrowser.js.php new file mode 100644 index 0000000..2b428ac --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/js/tinybrowser.js.php @@ -0,0 +1,79 @@ + + function selectURL(url) + { + document.passform.fileurl.value = url; + FileBrowserDialogue.mySubmit(); + } + var FileBrowserDialogue = { + init : function () { + // Here goes your code for setting your custom things onLoad. + rowHighlight(); + }, + mySubmit : function () { + var URL = document.passform.fileurl.value; + var win = tinyMCEPopup.getWindowArg("window"); + + // insert information now + win.document.getElementById(tinyMCEPopup.getWindowArg("input")).value = URL; + + // for image browsers: update image dimensions + if (typeof(win.ImageDialog) != "undefined" && document.URL.indexOf('type=image') != -1) + { + if (win.ImageDialog.getImageData) win.ImageDialog.getImageData(); + if (win.ImageDialog.showPreviewImage) win.ImageDialog.showPreviewImage(URL); + } + + // close popup window + tinyMCEPopup.close(); + } + } + tinyMCEPopup.onInit.add(FileBrowserDialogue.init, FileBrowserDialogue); + + function selectURL(url){ + // window.opener.SetUrl( url, width, height, alt); + window.opener.SetUrl( url ) ; + window.close() ; + } + + function selectURL(url) { + opener.document.getElementById("").value = url; + // Set img source of element id, if img id exists (format is elementid + "img") + if ( + typeof(opener.document.getElementById("img")) != "undefined" + && opener.document.getElementById("img") != null + && opener.document.getElementById("img").src.length != 0 + ) + { + opener.document.getElementById("img").src = url; + } + self.close(); + } + + +rowHighlight = function() { +var x = document.getElementsByTagName('tr'); +for (var i=0;i diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/da.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/da.php new file mode 100644 index 0000000..b266c15 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/da.php @@ -0,0 +1,69 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/de.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/de.php new file mode 100644 index 0000000..7ec803c --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/de.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/en.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/en.php new file mode 100644 index 0000000..95fba41 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/en.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/es.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/es.php new file mode 100644 index 0000000..51340df --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/es.php @@ -0,0 +1,59 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/fi.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/fi.php new file mode 100644 index 0000000..1322505 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/fi.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/fr.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/fr.php new file mode 100644 index 0000000..ab8bec1 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/fr.php @@ -0,0 +1,66 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/hr.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/hr.php new file mode 100644 index 0000000..d25d22e --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/hr.php @@ -0,0 +1,59 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/hu.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/hu.php new file mode 100644 index 0000000..d6e5366 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/hu.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/it.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/it.php new file mode 100644 index 0000000..f163b35 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/it.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/lv.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/lv.php new file mode 100644 index 0000000..b9fc933 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/lv.php @@ -0,0 +1,59 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/nl.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/nl.php new file mode 100644 index 0000000..124426d --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/nl.php @@ -0,0 +1,69 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/pl.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/pl.php new file mode 100644 index 0000000..bc59025 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/pl.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/pt.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/pt.php new file mode 100644 index 0000000..0c2c77b --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/pt.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/ru.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/ru.php new file mode 100644 index 0000000..cd9def6 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/ru.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/sk.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/sk.php new file mode 100644 index 0000000..de11eb8 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/sk.php @@ -0,0 +1,59 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/sv.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/sv.php new file mode 100644 index 0000000..23f776e --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/sv.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/zh-cn.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/zh-cn.php new file mode 100644 index 0000000..9bafd12 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/zh-cn.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/langs/zh-tw.php b/web/libs/tiny_mce/plugins/tinybrowser/langs/zh-tw.php new file mode 100644 index 0000000..11b0589 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/langs/zh-tw.php @@ -0,0 +1,68 @@ + \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/readme.txt b/web/libs/tiny_mce/plugins/tinybrowser/readme.txt new file mode 100644 index 0000000..c2a2fb6 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/readme.txt @@ -0,0 +1,430 @@ +TinyBrowser 1.41 - A TinyMCE file browser (C) 2008 Bryn Jones +(author website - http://www.lunarvis.com) + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program. If not, see . + + +TinyBrowser Features: +===================== + +- Integrates as a custom file browser within TinyMCE for image, media and 'all' + file types, or can work in stand-alone mode + +- Adobe Flash based file uploader, supporting multiple file selection and upload + with file type and size filtering (permission based) + +- Browse files with a list view or as thumbnails (images only), with optional + pagination + +- List view has image thumbnail on hover + +- File display order customisable e.g. by name, type, size, date + +- Find function to filter results by search string + +- Display detailed file information such as type, size and dimensions (images + only) + +- File deletion facility (permission based) + +- File edit facility (permission based) - rename, resize and rotate (last two + images only) + +- Folder browsing and creation + +- File storage location user definable for each file type + +- Optional session control + +- Multi-lingual support with language definition files + +- Many user definable settings, all from central configuration file + + +TinyBrowser Background +====================== + +I created TinyBrowser as I couldn't find the right TinyMCE file browser for my +needs, particularly the ability to select and upload multiple files in an easy +way. + + +Version Notes +============= + +TinyBrowser 1.41 - released 05/05/2009 +-------------------------------------- +New Features: +Added folder argument to tinyBrowserPopUp function, so that a sub-folder can be +selected when using TinyBrowser in standalone mode. +Added error logging - errors are output to error.log in tinybrowser directory. +Added Spanish, Croatian, Slovakian, Latvian, Czech, Italian, Hungarian, Swedish +and Russian language files (thanks to all who contributed). + +Changes: +Prohibited files are no longer browseable (if the paths defined contained files +of this type). +Only defined file extensions of a file type are browseable and editable. +Changed stripos function to strpos to ensure PHP4 compatability. +Updated createfolder function to work recursively with PHP4. +Remember current folder after upload. +Changed filename clean regex to be less strict. + +Bug Fixes: +Fixed transparency support for gif and png (thanks to Dirk Bohl). +Added 'no-cache' meta tag to ensure latest page is served by web browser. +Added another fix for no style issue with TinyMCE integration. +Security fix for browse type when set to non-existant value. +Security fix for malicious setting of folder get variable to relative values. + +TinyBrowser 1.40 - released N/A +-------------------------------------- +New Features: +Added multiple folder support with a separate Folders tab to allow folder +creation, renaming and deletion. +Added Move action to Edit tab, to allow moving of files between folders. +Added Danish language file. +Added 'delayprocess' to config file - this can be set if server response is +delayed, preventing uploaded files being processed correctly. +Added width and height config values for the TinyBrowser pop up window size. +Added 'cleanfilename' flag to config file, to remove disallowed characters +from filenames on upload (set to true by default). + +Changes: +Added recursive flag to createfolder function, to allow TinyBrowser to +create full upload path. +Changed default window size to 770px x 480px. +Minor code optimisation. +Prohibited files are now not browseable (if the paths defined contained files of +this type). +Now only defined file extensions of a file type are browseable and editable. +Changed stripos function call to strpos to ensure PHP4 compatability. +Updated createfolder function to work recursively with PHP4. +Remember current folder after upload. + +Bug Fixes: +Fixed minor bug causing elementid to be lost after file upload in +stand-alone mode. +Fixed stand-alone javascript selectURL function bug that prevented +TinyBrowser window close on selection. +Fixed bug in Flash upload that prevented folder permission error reporting. +Fixed bug in image resize and rotate functions that converted all types +to jpeg. + +TinyBrowser 1.33 - released 23/09/2008 +-------------------------------------- +New Features: +Added German, Finnish, Traditional and Simplified Chinese language files. +Added session control workaround for upload_file.php (called by Flash). + +Changes: +Flash uploader has been modified to display the file type and also to fix +strange progress bar behaviour when uploading multiple files. As the +upload process is not concurrent, I have removed the individual progress +bars and replaced them with one (progress is still per file however). +When the Upload button is pressed all the buttons now disappear. + +Bug Fixes: +Fixed minor bug that affected css layout after file upload. +Fixed bug introduced in 1.32 that prevented automatic image resize on +upload. +Added 'HTTP/1.1 200' response to upload_file.php script, to address +Flash bug in some Mac setups. +Added check for valid images in Browse and Edit tabs - non-image files +are still listed but error producing image properties code is bypassed. + + +TinyBrowser 1.32 - released 17/09/2008 +-------------------------------------- +New Features: +None. + +Changes: +The upload path is now passed to the Flash upload widget, for better +compatibility with Firefox and Opera when you set your paths using session +variables (this is due to a Flash bug that loses session data). +Files are no longer uploaded to a temporary directory, so there's now no +folder creation during the upload process. Instead, file name extensions +are suffixed with an underscore until processed. (This renders them +useless until verification). +The thumbs directory has been changed to '_thumbs'. + +Bug Fixes: +Fixed security hole - previously, it was possible to directly +submit files to the upload_file.php script. Due to the Flash session bug, +normal session control does not work. Instead, a hash string check has been +added to the upload_file.php script and the installation instructions +amended. + +TinyBrowser 1.31 - released 16/09/2008 +-------------------------------------- +New Features: +None. + +Changes: +Added prohibited files logic to the file_upload.php script (previously +located only in file_process.php script). +Changed duplicate file handling behaviour - TinyBrowser now discards +files with the same name. + +Bug Fixes: +None. + +TinyBrowser 1.30 - released 12/09/2008 +-------------------------------------- +New Features: +'Stand-alone' mode, for use without TinyMCE. +Optional and configurable pagination, to break results down into pages. +New configuration option, $tinybrowser['link'], allows the passback link to +be different to the upload path. +Added automatic creation of upload directories (with definable chmod for Unix +servers). +Added alert messages for errors and actions. +Multi-lingual support - credit to Francis Rebouças +(francisreboucas[at]gmail[dot]com) for idea, design, implementation and +Portugese language file. +Experimental support for FCKeditor. + +Changes: +Rationalised TinyBrowser file and folder names and structure (brought in line +with TinyMCE plugin specification). +Revised documentation. +After file upload user is now directed back to upload tab instead of the +browse tab. + +Bug Fixes: +Fixed security hole - prohibited file extensions not obeyed due to error in +inherited code. +Fixed small issue with edit / delete permissions (not consistently hiding +edit tab). + +TinyBrowser 1.20 - released 20/08/2008 +-------------------------------------- +New Features: +Added thumbnail on hover for detail view (images only). Note: not working in +IE6. +Added Edit tab - allows file rename, resize and rotate (last two for images +only). Also moved delete action to here. +Added configurable automatic image resize on upload. + +Changes: +Moved file thumbnail generation to upload process. +Changed table css to match Flash upload. +Improved thumbnail view layout. +Removed the form select elements for sort by and type, and made the table +column headers clickable. + +Bug Fixes: +Changed default $tinymce['docroot'] value to +rtrim($_SERVER['DOCUMENT_ROOT'],'/') - this fixes an issue with server setups +that return a value with a '/' suffix. +Removed .htaccess file after various bug reports - doesn't appear to be +required for majority of server setups. +Fixed silly bug with thumbnail urls that could prevent generation and viewing +under some server setups. +Fixed various other minor bugs and tidied code. + +TinyBrowser 1.10 +---------------- +Adjusted layout of file upload. +Added facility to limit permitted file upload size (separate values for each +file type). +Amended installation instructions for clarity. +Tested as working in Opera 9. + +TinyBrowser 1.00 +---------------- +Tested in Firefox 2 and 3, Internet Explorer 6 and 7 and Safari 3. +Requires Adobe Flash Player 9. + + +Requirements +============ + +Adobe Flash Player 8 + +PHP enabled server + +Supported browsers: +Internet Explorer 6 + +Firefox 2 + +Safari 3 + +Opera 9 + +Google Chrome + + +Language Definition Files +========================= + +English (en) +Chinese Simplified (zh-cn) +Chinese Traditional (zh-tw) +Croatian (hr) +Czech (cs) +Danish (da) +Dutch (nl) +Finnish (fi) +French (fr) +German (de) +Hungarian (hu) +Italian (it) +Latvian (lv) +Polish (pl) +Portuguese (pt) +Russian (ru) +Slovak (sk) +Spanish (es) +Swedish (sv) + + + +Known Issues +============ + +None. + + +Troubleshooting +=============== + +If you receive a 403, 406 or 412 status error on uploading files, please create +an .htaccess file in your tinybrowser directory with the following contents: + +SecFilterEngine Off +SecFilterScanPOST Off + +If you use Linux and the Squid proxy, you need to add a "ignore_expect_100 on" +flag to the squid config file to avoid a 417 status error. + + +TinyBrowser Installation Method 1 +================================= + +The standard TinyBrowser installation, this integrates TinyBrowser as a custom +file browseer with TinyMCE. + +1) Copy the tinybrowser folder and contents to your TinyMCE plugins directory. + +2) Place the following javascript link after the link to TinyMCE (tiny_mce.js): + + + + ***NOTE:*** The above link assumes TinyMCE is installed in your website root + directory, you will need to amend the link to your specific setup! + +3) Add this line to your TinyMCE init: + + file_browser_callback : "tinyBrowser" + +4) Edit the TinyBrowser configuration file (config_tinybrowser.php). The most + important settings are the file paths (these will be automatically created on + your server by TinyBrowser if they do not exist) and also the 'obfuscate' + property, which should be set to a random value. + + ***NOTE:*** If your server is Unix-based. you may wish to modify the + $tinybrowser['unixpermissions'] config value, which decides permissions. + +5) All done! Now you will see a browse button in the TinyMCE dialog windows for + plugins like image, media and link - just click this button and TinyBrowser + will appear. + + +TinyBrowser Installation Method 2 +================================= + +This installation allows TinyBrowser to be used in 'stand-alone' mode, for +integration with any web application. + +1) Copy the tinybrowser folder and contents to your server. + +2) Place the following javascript link within the tag on the page you + require TinyBrowser: + + + + ***NOTE:*** The above link assumes TinyBrowser is installed in your website + root directory, you will need to amend the link to your specific setup! + +3) Edit the TinyBrowser configuration file (config_tinybrowser.php). The most + important settings are the file paths (these will be automatically created on + your server by TinyBrowser if they do not exist) and also the 'obfuscate' + property, which should be set to a random value. + + ***NOTE:*** If your server is Unix-based. you may wish to modify the + $tinybrowser['unixpermissions'] config value, which decides permissions. + +4) To launch TinyBrowser use the following javascript function: + + tinyBrowserPopUp('type','elementid'); + + 'type' can contain 'image', 'media' or 'file' - corresponding to the type of + file you want TinyBrowser to manage. + + 'elementid' is the id of the page element you want populate with the file url + TinyBrowser returns - this is generally a form text input. If you want to + immediately display the image then create an tag with the same element + id, only suffixed with img - e.g. elementidimg. + + +TinyBrowser Installation Method 3 +================================= + +This installation method integrates TinyBrowser as a custom file browser with +FCKeditor. + +1) Copy the tinybrowser folder and contents to your server. + +2) Edit your fckconfig.js file as follows (replace existing lines). + + To enable TinyBrowser for files: + FCKConfig.LinkBrowserURL = '/yourtinybrowserurl/tinybrowser.php?type=file'; + + To enable TinyBrowser for images: + FCKConfig.ImageBrowserURL = '/yourtinybrowserurl/tinybrowser.php?type=image'; + + To enable TinyBrowser for Flash: + FCKConfig.FlashBrowserURL = '/yourtinybrowserurl/tinybrowser.php?type=media'; + + If you wish to disable the default FCKeditor file uploads (recommended), set + the following: + FCKConfig.LinkUpload = false; + FCKConfig.ImageUpload = false; + FCKConfig.FlashUpload = false; + +3) Edit the TinyBrowser configuration file (config_tinybrowser.php). + + Change the $tinybrowser['integration'] line: + $tinybrowser['integration'] = 'fckeditor'; + + The other most important settings are the file paths (these will be + automatically created on your server by TinyBrowser if they do not exist) and + the 'obfuscate' property, which should be set to a random value. + + ***NOTE:*** If your server is Unix-based. you may wish to modify the + $tinybrowser['unixpermissions'] config value, which decides permissions. + +4) All done! Now when you click the Browse Server button in the FCKeditor dialog + windows for image, Flash and link, TinyBrowser will appear instead of the + standard FCKeditor file browser. + + +Contact +======= + +Please notify me by email bryn[at]lunarvis[dot]com if you notice any bugs or +have ideas for new features. + +----------------------------- +File Last Modified 05/05/2009 \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/tb_standalone.js.php b/web/libs/tiny_mce/plugins/tinybrowser/tb_standalone.js.php new file mode 100644 index 0000000..5de1f82 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/tb_standalone.js.php @@ -0,0 +1,14 @@ + + +function tinyBrowserPopUp(type,formelementid,folder) { + tburl = "" + "?type=" + type + "&feid=" + formelementid; + if (folder !== undefined) tburl += "&folder="+folder+"%2F"; + newwindow=window.open(tburl,'tinybrowser','height=,width=,scrollbars=yes,resizable=yes'); + if (window.focus) {newwindow.focus()} + return false; +} diff --git a/web/libs/tiny_mce/plugins/tinybrowser/tb_tinymce.js.php b/web/libs/tiny_mce/plugins/tinybrowser/tb_tinymce.js.php new file mode 100644 index 0000000..b19dad7 --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/tb_tinymce.js.php @@ -0,0 +1,40 @@ + + + function tinyBrowser (field_name, url, type, win) { + + /* If you work with sessions in PHP and your client doesn't accept cookies you might need to carry + the session name and session ID in the request string (can look like this: "?PHPSESSID=88p0n70s9dsknra96qhuk6etm5"). + These lines of code extract the necessary parameters and add them back to the filebrowser URL again. */ + + var cmsURL = ""; // script URL - use an absolute path! + if (cmsURL.indexOf("?") < 0) { + //add the type as the only query parameter + cmsURL = cmsURL + "?type=" + type; + } + else { + //add the type as an additional query parameter + // (PHP session ID is now included if there is one at all) + cmsURL = cmsURL + "&type=" + type; + } + + tinyMCE.activeEditor.windowManager.open({ + file : cmsURL, + title : 'Tiny Browser', + width : , + height : , + resizable : "yes", + scrollbars : "yes", + inline : "yes", // This parameter only has an effect if you use the inlinepopups plugin! + close_previous : "no" + }, { + window : win, + input : field_name + }); + return false; + } \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/tinybrowser/tinybrowser.php b/web/libs/tiny_mce/plugins/tinybrowser/tinybrowser.php new file mode 100644 index 0000000..aa4ff4d --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/tinybrowser.php @@ -0,0 +1,337 @@ + array(), + 'message' => array() +); +$newthumbqty = 0; + +// read folder contents if folder exists +if(file_exists($tinybrowser['docroot'].$browsepath)) + { + // Read directory contents and populate $file array + $dh = opendir($tinybrowser['docroot'].$browsepath); + $file = array(); + while (($filename = readdir($dh)) !== false) + { + // get file extension + $nameparts = explode('.',$filename); + $ext = end($nameparts); + + // filter directories and prohibited file types + if($filename != '.' && $filename != '..' && !is_dir($tinybrowser['docroot'].$browsepath.$filename) && !in_array($ext, $tinybrowser['prohibited']) && ($typenow == 'file' || strpos(strtolower($tinybrowser['filetype'][$typenow]),strtolower($ext)))) + { + // search file name if search term entered + if($findnow) $exists = strpos(strtolower($filename),strtolower($findnow)); + + // assign file details to array, for all files or those that match search + if(!$findnow || ($findnow && $exists !== false)) + { + $file['name'][] = $filename; + $file['sortname'][] = strtolower($filename); + $file['modified'][] = filemtime($tinybrowser['docroot'].$browsepath.$filename); + $file['size'][] = filesize($tinybrowser['docroot'].$browsepath.$filename); + + // image specific info or general + if($typenow=='image' && $imginfo = getimagesize($tinybrowser['docroot'].$browsepath.$filename)) + { + $file['width'][] = $imginfo[0]; + $file['height'][] = $imginfo[1]; + $file['dimensions'][] = $imginfo[0] + $imginfo[1]; + $file['type'][] = $imginfo['mime']; + + // Check a thumbnail exists + if(!file_exists($tinybrowser['docroot'].$browsepath.'_thumbs/')) createfolder($tinybrowser['docroot'].$browsepath.'_thumbs/',$tinybrowser['unixpermissions']); + $thumbimg = $tinybrowser['docroot'].$browsepath.'_thumbs/_'.$filename; + if (!file_exists($thumbimg)) + { + $nothumbimg = $tinybrowser['docroot'].$browsepath.$filename; + $mime = getimagesize($nothumbimg); + $im = convert_image($nothumbimg,$mime['mime']); + resizeimage($im,$tinybrowser['thumbsize'],$tinybrowser['thumbsize'],$thumbimg,$tinybrowser['thumbquality'],$mime['mime']); + imagedestroy($im); + $newthumbqty++; + } + } + else + { + $file['width'][] = 'N/A'; + $file['height'][] = 'N/A'; + $file['dimensions'][] = 'N/A'; + $file['type'][] = returnMIMEType($filename); + } + } + } + } + closedir($dh); + } +// create file upload folder +else + { + $success = createfolder($tinybrowser['docroot'].$browsepath,$tinybrowser['unixpermissions']); + if($success) + { + if($typenow=='image') createfolder($tinybrowser['docroot'].$browsepath.'_thumbs/',$tinybrowser['unixpermissions']); + $notify['type'][]='success'; + $notify['message'][]=sprintf(TB_MSGMKDIR, $browsepath); + } + else + { + $notify['type'][]='error'; + $notify['message'][]=sprintf(TB_MSGMKDIRFAIL, $browsepath); + } + } + +// Assign directory structure to array +$browsedirs=array(); +dirtree($browsedirs,$tinybrowser['filetype'][$typenow],$tinybrowser['docroot'],$tinybrowser['path'][$typenow]); + +// generate alert if new thumbnails created +if($newthumbqty>0) + { + $notify['type'][]='info'; + $notify['message'][]=sprintf(TB_MSGNEWTHUMBS, $newthumbqty); + } + + +// determine sort order +$sortorder = ($sorttypenow == 'asc' ? SORT_ASC : SORT_DESC); +$num_of_files = (isset($file['name']) ? count($file['name']) : 0); + +if($num_of_files>0) + { + // sort files by selected order + sortfileorder($sortbynow,$sortorder,$file); + } + +// determine pagination +if($tinybrowser['pagination']>0) + { + $showpage_start = ($showpagenow ? ($_REQUEST['showpage']*$tinybrowser['pagination'])-$tinybrowser['pagination'] : 0); + $showpage_end = $showpage_start+$tinybrowser['pagination']; + if($showpage_end>$num_of_files) $showpage_end = $num_of_files; + } +else + { + $showpage_start = 0; + $showpage_end = $num_of_files; + } +?> + + + +TinyBrowser :: <?php echo TB_BROWSE; ?> + + + + + + + +> +0) alert($notify); +form_open('foldertab',false,'tinybrowser.php','?type='.$typenow.$passviewtype.$passsortby.$passfeid); +?> +
+
    +
  • 1) + { + ?>
  • +
+
+ +
+
+
+ + +
+0) + { + $pagelimit = ceil($num_of_files/$tinybrowser['pagination'])+1; + $page = array(); + for($i=1;$i<$pagelimit;$i++) + { + $page[] = array($i,TB_PAGE.' '.$i); + } + if($i>2) form_select($page,'showpage',TB_SHOW,$showpagenow,true); + } +?>
+'.TB_DIMENSIONS.''; + } +else $imagehead = ''; + +echo '
' + .'' + .'' + .$imagehead + .'' + .''; + +// show image thumbnails, unless detail view is selected +if($typenow=='image' && $viewtypenow != 'detail') + { + echo '
'.TB_FILENAME.''.TB_SIZE.''.TB_TYPE.''.TB_DATE.'
'; + + for($i=$showpage_start;$i<$showpage_end;$i++) + { + echo ''; + } + } +else + { + for($i=$showpage_start;$i<$showpage_end;$i++) + { + $alt = (IsOdd($i) ? 'r1' : 'r0'); + echo ''; + if($typenow=='image') echo ''.truncate_text($file['name'][$i],30).''; + else echo ''.truncate_text($file['name'][$i],30).''; + echo ''.bytestostring($file['size'][$i],1).''; + if($typenow=='image') echo ''.$file['width'][$i].' x '.$file['height'][$i].''; + echo ''.$file['type'][$i].'' + .''.date($tinybrowser['dateformat'],$file['modified'][$i]).''."\n"; + } + echo '
'; + } +?> +
+
+ + diff --git a/web/libs/tiny_mce/plugins/tinybrowser/upload.php b/web/libs/tiny_mce/plugins/tinybrowser/upload.php new file mode 100644 index 0000000..bc97e8d --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/upload.php @@ -0,0 +1,177 @@ + array(), + 'message' => array() +); +$goodqty = (isset($_GET['goodfiles']) ? $_GET['goodfiles'] : 0); +$badqty = (isset($_GET['badfiles']) ? $_GET['badfiles'] : 0); +$dupqty = (isset($_GET['dupfiles']) ? $_GET['dupfiles'] : 0); + +if($goodqty>0) + { + $notify['type'][]='success'; + $notify['message'][]=sprintf(TB_MSGUPGOOD, $goodqty); + } +if($badqty>0) + { + $notify['type'][]='failure'; + $notify['message'][]=sprintf(TB_MSGUPBAD, $badqty); + } +if($dupqty>0) + { + $notify['type'][]='failure'; + $notify['message'][]=sprintf(TB_MSGUPDUP, $dupqty); + } +if(isset($_GET['permerror'])) + { + $notify['type'][]='failure'; + $notify['message'][]=sprintf(TB_MSGUPFAIL, $tinybrowser['docroot'].$tinybrowser['path'][$typenow]); + } +?> + + + +TinyBrowser :: <?php echo TB_UPLOAD; ?> + + + + + + + +"); + so.addVariable("sessid", ""); + so.addVariable("obfus", ""); + so.addVariable("filenames", ""); + so.addVariable("extensions", ""); + so.addVariable("filenamelbl", ""); + so.addVariable("sizelbl", ""); + so.addVariable("typelbl", ""); + so.addVariable("progresslbl", ""); + so.addVariable("browselbl", ""); + so.addVariable("removelbl", ""); + so.addVariable("uploadlbl", ""); + so.addVariable("uplimitmsg", ""); + so.addVariable("uplimitlbl", ""); + so.addVariable("uplimitbyte", ""); + so.addParam("allowScriptAccess", "always"); + so.addParam("type", "application/x-shockwave-flash"); + so.write("flashcontent");'> +0) alert($notify); +form_open('foldertab',false,'upload.php','?type='.$typenow.$passfeid); +?> +
+
    +
  • +
  • +
  • +
  • 1) + { + ?>
  • +
+
+ +
+
+
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/tinybrowser/upload_file.php b/web/libs/tiny_mce/plugins/tinybrowser/upload_file.php new file mode 100644 index 0000000..f9c2a7f --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/upload_file.php @@ -0,0 +1,40 @@ +File Upload SuccessFile Upload Success diff --git a/web/libs/tiny_mce/plugins/tinybrowser/upload_process.php b/web/libs/tiny_mce/plugins/tinybrowser/upload_process.php new file mode 100644 index 0000000..971e37f --- /dev/null +++ b/web/libs/tiny_mce/plugins/tinybrowser/upload_process.php @@ -0,0 +1,99 @@ +0) sleep($tinybrowser['delayprocess']); + +// Initialise files array and error vars +$files = array(); +$good = 0; +$bad = 0; +$dup = 0; +$total = (isset($_GET['filetotal']) ? $_GET['filetotal'] : 0); + + +// Assign get variables +$folder = $tinybrowser['docroot'].urldecode($_GET['folder']); +$foldernow = urlencode(str_replace($tinybrowser['path'][$_GET['type']],'',urldecode($_GET['folder']))); +$passfeid = (isset($_GET['feid']) ? '&feid='.$_GET['feid'] : ''); + +if ($handle = opendir($folder)) + { + while (false !== ($file = readdir($handle))) + { + if ($file != "." && $file != ".." && substr($file,-1)=='_') + { + //-- File Naming + $tmp_filename = $folder.$file; + $dest_filename = $folder.rtrim($file,'_'); + + //-- Duplicate Files + if(file_exists($dest_filename)) { unlink($tmp_filename); $dup++; continue; } + + //-- Bad extensions + $nameparts = explode('.',$dest_filename); + $ext = end($nameparts); + + if(!validateExtension($ext, $tinybrowser['prohibited'])) { unlink($tmp_filename); continue; } + + //-- Rename temp file to dest file + rename($tmp_filename, $dest_filename); + $good++; + + //-- if image, perform additional processing + if($_GET['type']=='image') + { + //-- Good mime-types + $imginfo = getimagesize($dest_filename); + if($imginfo === false) { unlink($dest_filename); continue; } + $mime = $imginfo['mime']; + + // resize image to maximum height and width, if set + if($tinybrowser['imageresize']['width'] > 0 || $tinybrowser['imageresize']['height'] > 0) + { + // assign new width and height values, only if they are less than existing image size + $widthnew = ($tinybrowser['imageresize']['width'] > 0 && $tinybrowser['imageresize']['width'] < $imginfo[0] ? $tinybrowser['imageresize']['width'] : $imginfo[0]); + $heightnew = ($tinybrowser['imageresize']['height'] > 0 && $tinybrowser['imageresize']['height'] < $imginfo[1] ? $tinybrowser['imageresize']['height'] : $imginfo[1]); + + // only resize if width or height values are different + if($widthnew != $imginfo[0] || $heightnew != $imginfo[1]) + { + $im = convert_image($dest_filename,$mime); + resizeimage($im,$widthnew,$heightnew,$dest_filename,$tinybrowser['imagequality'],$mime); + imagedestroy($im); + } + } + + // generate thumbnail + $thumbimg = $folder.'_thumbs/_'.rtrim($file,'_'); + if (!file_exists($thumbimg)) + { + $im = convert_image($dest_filename,$mime); + resizeimage ($im,$tinybrowser['thumbsize'],$tinybrowser['thumbsize'],$thumbimg,$tinybrowser['thumbquality'],$mime); + imagedestroy ($im); + } + } + + } + } + closedir($handle); + } +$bad = $total-($good+$dup); + +// Check for problem during upload +if($total>0 && $bad==$total) Header('Location: ./upload.php?type='.$_GET['type'].$passfeid.'&permerror=1&total='.$total); +else Header('Location: ./upload.php?type='.$_GET['type'].$passfeid.'&folder='.$foldernow.'&badfiles='.$bad.'&goodfiles='.$good.'&dupfiles='.$dup); +?> + + + + + + + TinyBrowser :: Process Upload + + +

Sorry, there was an error processing file uploads.

+ + diff --git a/web/libs/tiny_mce/plugins/visualchars/editor_plugin.js b/web/libs/tiny_mce/plugins/visualchars/editor_plugin.js new file mode 100644 index 0000000..94719f9 --- /dev/null +++ b/web/libs/tiny_mce/plugins/visualchars/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.VisualChars",{init:function(a,b){var c=this;c.editor=a;a.addCommand("mceVisualChars",c._toggleVisualChars,c);a.addButton("visualchars",{title:"visualchars.desc",cmd:"mceVisualChars"});a.onBeforeGetContent.add(function(d,e){if(c.state&&e.format!="raw"&&!e.draft){c.state=true;c._toggleVisualChars(false)}})},getInfo:function(){return{longname:"Visual characters",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/visualchars",version:tinymce.majorVersion+"."+tinymce.minorVersion}},_toggleVisualChars:function(m){var p=this,k=p.editor,a,g,j,n=k.getDoc(),o=k.getBody(),l,q=k.selection,e,c,f;p.state=!p.state;k.controlManager.setActive("visualchars",p.state);if(m){f=q.getBookmark()}if(p.state){a=[];tinymce.walk(o,function(b){if(b.nodeType==3&&b.nodeValue&&b.nodeValue.indexOf("\u00a0")!=-1){a.push(b)}},"childNodes");for(g=0;g$1');c=k.dom.create("div",null,l);while(node=c.lastChild){k.dom.insertAfter(node,a[g])}k.dom.remove(a[g])}}else{a=k.dom.select("span.mceItemNbsp",o);for(g=a.length-1;g>=0;g--){k.dom.remove(a[g],1)}}q.moveToBookmark(f)}});tinymce.PluginManager.add("visualchars",tinymce.plugins.VisualChars)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/visualchars/editor_plugin_src.js b/web/libs/tiny_mce/plugins/visualchars/editor_plugin_src.js new file mode 100644 index 0000000..35856e2 --- /dev/null +++ b/web/libs/tiny_mce/plugins/visualchars/editor_plugin_src.js @@ -0,0 +1,83 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.VisualChars', { + init : function(ed, url) { + var t = this; + + t.editor = ed; + + // Register commands + ed.addCommand('mceVisualChars', t._toggleVisualChars, t); + + // Register buttons + ed.addButton('visualchars', {title : 'visualchars.desc', cmd : 'mceVisualChars'}); + + ed.onBeforeGetContent.add(function(ed, o) { + if (t.state && o.format != 'raw' && !o.draft) { + t.state = true; + t._toggleVisualChars(false); + } + }); + }, + + getInfo : function() { + return { + longname : 'Visual characters', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/visualchars', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + }, + + // Private methods + + _toggleVisualChars : function(bookmark) { + var t = this, ed = t.editor, nl, i, h, d = ed.getDoc(), b = ed.getBody(), nv, s = ed.selection, bo, div, bm; + + t.state = !t.state; + ed.controlManager.setActive('visualchars', t.state); + + if (bookmark) + bm = s.getBookmark(); + + if (t.state) { + nl = []; + tinymce.walk(b, function(n) { + if (n.nodeType == 3 && n.nodeValue && n.nodeValue.indexOf('\u00a0') != -1) + nl.push(n); + }, 'childNodes'); + + for (i = 0; i < nl.length; i++) { + nv = nl[i].nodeValue; + nv = nv.replace(/(\u00a0)/g, '$1'); + + div = ed.dom.create('div', null, nv); + while (node = div.lastChild) + ed.dom.insertAfter(node, nl[i]); + + ed.dom.remove(nl[i]); + } + } else { + nl = ed.dom.select('span.mceItemNbsp', b); + + for (i = nl.length - 1; i >= 0; i--) + ed.dom.remove(nl[i], 1); + } + + s.moveToBookmark(bm); + } + }); + + // Register plugin + tinymce.PluginManager.add('visualchars', tinymce.plugins.VisualChars); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/wordcount/editor_plugin.js b/web/libs/tiny_mce/plugins/wordcount/editor_plugin.js new file mode 100644 index 0000000..a099e6a --- /dev/null +++ b/web/libs/tiny_mce/plugins/wordcount/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.WordCount",{block:0,id:null,countre:null,cleanre:null,init:function(a,b){var c=this,d=0;c.countre=a.getParam("wordcount_countregex",/\S\s+/g);c.cleanre=a.getParam("wordcount_cleanregex",/[0-9.(),;:!?%#$¿'"_+=\\\/-]*/g);c.id=a.id+"-word-count";a.onPostRender.add(function(f,e){var g,h;h=f.getParam("wordcount_target_id");if(!h){g=tinymce.DOM.get(f.id+"_path_row");if(g){tinymce.DOM.add(g.parentNode,"div",{style:"float: right"},f.getLang("wordcount.words","Words: ")+'0')}}else{tinymce.DOM.add(h,"span",{},'0')}});a.onInit.add(function(e){e.selection.onSetContent.add(function(){c._count(e)});c._count(e)});a.onSetContent.add(function(e){c._count(e)});a.onKeyUp.add(function(f,g){if(g.keyCode==d){return}if(13==g.keyCode||8==d||46==d){c._count(f)}d=g.keyCode})},_count:function(b){var c=this,a=0;if(c.block){return}c.block=1;setTimeout(function(){var d=b.getContent({format:"raw"});if(d){d=d.replace(/<.[^<>]*?>/g," ").replace(/ | /gi," ");d=d.replace(c.cleanre,"");d.replace(c.countre,function(){a++})}tinymce.DOM.setHTML(c.id,a.toString());setTimeout(function(){c.block=0},2000)},1)},getInfo:function(){return{longname:"Word Count plugin",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/wordcount",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("wordcount",tinymce.plugins.WordCount)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/wordcount/editor_plugin_src.js b/web/libs/tiny_mce/plugins/wordcount/editor_plugin_src.js new file mode 100644 index 0000000..5cb92fa --- /dev/null +++ b/web/libs/tiny_mce/plugins/wordcount/editor_plugin_src.js @@ -0,0 +1,98 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.WordCount', { + block : 0, + id : null, + countre : null, + cleanre : null, + + init : function(ed, url) { + var t = this, last = 0; + + t.countre = ed.getParam('wordcount_countregex', /\S\s+/g); + t.cleanre = ed.getParam('wordcount_cleanregex', /[0-9.(),;:!?%#$¿'"_+=\\\/-]*/g); + t.id = ed.id + '-word-count'; + + ed.onPostRender.add(function(ed, cm) { + var row, id; + + // Add it to the specified id or the theme advanced path + id = ed.getParam('wordcount_target_id'); + if (!id) { + row = tinymce.DOM.get(ed.id + '_path_row'); + + if (row) + tinymce.DOM.add(row.parentNode, 'div', {'style': 'float: right'}, ed.getLang('wordcount.words', 'Words: ') + '0'); + } else + tinymce.DOM.add(id, 'span', {}, '0'); + }); + + ed.onInit.add(function(ed) { + ed.selection.onSetContent.add(function() { + t._count(ed); + }); + + t._count(ed); + }); + + ed.onSetContent.add(function(ed) { + t._count(ed); + }); + + ed.onKeyUp.add(function(ed, e) { + if (e.keyCode == last) + return; + + if (13 == e.keyCode || 8 == last || 46 == last) + t._count(ed); + + last = e.keyCode; + }); + }, + + _count : function(ed) { + var t = this, tc = 0; + + // Keep multiple calls from happening at the same time + if (t.block) + return; + + t.block = 1; + + setTimeout(function() { + var tx = ed.getContent({format : 'raw'}); + + if (tx) { + tx = tx.replace(/<.[^<>]*?>/g, ' ').replace(/ | /gi, ' '); // remove html tags and space chars + tx = tx.replace(t.cleanre, ''); // remove numbers and punctuation + tx.replace(t.countre, function() {tc++;}); // count the words + } + + tinymce.DOM.setHTML(t.id, tc.toString()); + + setTimeout(function() {t.block = 0;}, 2000); + }, 1); + }, + + getInfo: function() { + return { + longname : 'Word Count plugin', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/wordcount', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + tinymce.PluginManager.add('wordcount', tinymce.plugins.WordCount); +})(); diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/abbr.htm b/web/libs/tiny_mce/plugins/xhtmlxtras/abbr.htm new file mode 100644 index 0000000..3aeac0d --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/abbr.htm @@ -0,0 +1,141 @@ + + + + {#xhtmlxtras_dlg.title_abbr_element} + + + + + + + + + +
+ + +
+
+
+ {#xhtmlxtras_dlg.fieldset_attrib_tab} + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
: + +
:
: + +
: + +
+
+
+
+
+ {#xhtmlxtras_dlg.fieldset_events_tab} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
:
:
:
:
:
:
:
:
:
:
+
+
+
+
+ + + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/acronym.htm b/web/libs/tiny_mce/plugins/xhtmlxtras/acronym.htm new file mode 100644 index 0000000..31ee7b7 --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/acronym.htm @@ -0,0 +1,141 @@ + + + + {#xhtmlxtras_dlg.title_acronym_element} + + + + + + + + + +
+ + +
+
+
+ {#xhtmlxtras_dlg.fieldset_attrib_tab} + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
: + +
:
: + +
: + +
+
+
+
+
+ {#xhtmlxtras_dlg.fieldset_events_tab} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
:
:
:
:
:
:
:
:
:
:
+
+
+
+
+ + + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/attributes.htm b/web/libs/tiny_mce/plugins/xhtmlxtras/attributes.htm new file mode 100644 index 0000000..17054da --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/attributes.htm @@ -0,0 +1,148 @@ + + + + {#xhtmlxtras_dlg.attribs_title} + + + + + + + + +
+ + +
+
+
+ {#xhtmlxtras_dlg.attribute_attrib_tab} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
+ +
:
: + +
: + +
+
+
+
+
+ {#xhtmlxtras_dlg.attribute_events_tab} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
:
:
:
:
:
:
:
:
:
:
+
+
+
+
+ + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/cite.htm b/web/libs/tiny_mce/plugins/xhtmlxtras/cite.htm new file mode 100644 index 0000000..d0a3e3a --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/cite.htm @@ -0,0 +1,141 @@ + + + + {#xhtmlxtras_dlg.title_cite_element} + + + + + + + + + +
+ + +
+
+
+ {#xhtmlxtras_dlg.fieldset_attrib_tab} + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
: + +
:
: + +
: + +
+
+
+
+
+ {#xhtmlxtras_dlg.fieldset_events_tab} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
:
:
:
:
:
:
:
:
:
:
+
+
+
+
+ + + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/css/attributes.css b/web/libs/tiny_mce/plugins/xhtmlxtras/css/attributes.css new file mode 100644 index 0000000..9a6a235 --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/css/attributes.css @@ -0,0 +1,11 @@ +.panel_wrapper div.current { + height: 290px; +} + +#id, #style, #title, #dir, #hreflang, #lang, #classlist, #tabindex, #accesskey { + width: 200px; +} + +#events_panel input { + width: 200px; +} diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/css/popup.css b/web/libs/tiny_mce/plugins/xhtmlxtras/css/popup.css new file mode 100644 index 0000000..e67114d --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/css/popup.css @@ -0,0 +1,9 @@ +input.field, select.field {width:200px;} +input.picker {width:179px; margin-left: 5px;} +input.disabled {border-color:#F2F2F2;} +img.picker {vertical-align:text-bottom; cursor:pointer;} +h1 {padding: 0 0 5px 0;} +.panel_wrapper div.current {height:160px;} +#xhtmlxtrasdel .panel_wrapper div.current, #xhtmlxtrasins .panel_wrapper div.current {height: 230px;} +a.browse span {display:block; width:20px; height:20px; background:url('../../../themes/advanced/img/icons.gif') -140px -20px;} +#datetime {width:180px;} diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/del.htm b/web/libs/tiny_mce/plugins/xhtmlxtras/del.htm new file mode 100644 index 0000000..8b07fa8 --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/del.htm @@ -0,0 +1,161 @@ + + + + {#xhtmlxtras_dlg.title_del_element} + + + + + + + + + +
+ + +
+
+
+ {#xhtmlxtras_dlg.fieldset_general_tab} + + + + + + + + + +
: + + + + + +
+
:
+
+
+ {#xhtmlxtras_dlg.fieldset_attrib_tab} + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
: + +
:
: + +
: + +
+
+
+
+
+ {#xhtmlxtras_dlg.fieldset_events_tab} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
:
:
:
:
:
:
:
:
:
:
+
+
+
+
+ + + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/editor_plugin.js b/web/libs/tiny_mce/plugins/xhtmlxtras/editor_plugin.js new file mode 100644 index 0000000..a9393ad --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/editor_plugin.js @@ -0,0 +1 @@ +(function(){tinymce.create("tinymce.plugins.XHTMLXtrasPlugin",{init:function(a,b){a.addCommand("mceCite",function(){a.windowManager.open({file:b+"/cite.htm",width:350+parseInt(a.getLang("xhtmlxtras.cite_delta_width",0)),height:250+parseInt(a.getLang("xhtmlxtras.cite_delta_height",0)),inline:1},{plugin_url:b})});a.addCommand("mceAcronym",function(){a.windowManager.open({file:b+"/acronym.htm",width:350+parseInt(a.getLang("xhtmlxtras.acronym_delta_width",0)),height:250+parseInt(a.getLang("xhtmlxtras.acronym_delta_width",0)),inline:1},{plugin_url:b})});a.addCommand("mceAbbr",function(){a.windowManager.open({file:b+"/abbr.htm",width:350+parseInt(a.getLang("xhtmlxtras.abbr_delta_width",0)),height:250+parseInt(a.getLang("xhtmlxtras.abbr_delta_width",0)),inline:1},{plugin_url:b})});a.addCommand("mceDel",function(){a.windowManager.open({file:b+"/del.htm",width:340+parseInt(a.getLang("xhtmlxtras.del_delta_width",0)),height:310+parseInt(a.getLang("xhtmlxtras.del_delta_width",0)),inline:1},{plugin_url:b})});a.addCommand("mceIns",function(){a.windowManager.open({file:b+"/ins.htm",width:340+parseInt(a.getLang("xhtmlxtras.ins_delta_width",0)),height:310+parseInt(a.getLang("xhtmlxtras.ins_delta_width",0)),inline:1},{plugin_url:b})});a.addCommand("mceAttributes",function(){a.windowManager.open({file:b+"/attributes.htm",width:380,height:370,inline:1},{plugin_url:b})});a.addButton("cite",{title:"xhtmlxtras.cite_desc",cmd:"mceCite"});a.addButton("acronym",{title:"xhtmlxtras.acronym_desc",cmd:"mceAcronym"});a.addButton("abbr",{title:"xhtmlxtras.abbr_desc",cmd:"mceAbbr"});a.addButton("del",{title:"xhtmlxtras.del_desc",cmd:"mceDel"});a.addButton("ins",{title:"xhtmlxtras.ins_desc",cmd:"mceIns"});a.addButton("attribs",{title:"xhtmlxtras.attribs_desc",cmd:"mceAttributes"});a.onNodeChange.add(function(d,c,f,e){f=d.dom.getParent(f,"CITE,ACRONYM,ABBR,DEL,INS");c.setDisabled("cite",e);c.setDisabled("acronym",e);c.setDisabled("abbr",e);c.setDisabled("del",e);c.setDisabled("ins",e);c.setDisabled("attribs",f&&f.nodeName=="BODY");c.setActive("cite",0);c.setActive("acronym",0);c.setActive("abbr",0);c.setActive("del",0);c.setActive("ins",0);if(f){do{c.setDisabled(f.nodeName.toLowerCase(),0);c.setActive(f.nodeName.toLowerCase(),1)}while(f=f.parentNode)}});a.onPreInit.add(function(){a.dom.create("abbr")})},getInfo:function(){return{longname:"XHTML Xtras Plugin",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",infourl:"http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/xhtmlxtras",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.PluginManager.add("xhtmlxtras",tinymce.plugins.XHTMLXtrasPlugin)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/editor_plugin_src.js b/web/libs/tiny_mce/plugins/xhtmlxtras/editor_plugin_src.js new file mode 100644 index 0000000..5f9d9bd --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/editor_plugin_src.js @@ -0,0 +1,132 @@ +/** + * editor_plugin_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + tinymce.create('tinymce.plugins.XHTMLXtrasPlugin', { + init : function(ed, url) { + // Register commands + ed.addCommand('mceCite', function() { + ed.windowManager.open({ + file : url + '/cite.htm', + width : 350 + parseInt(ed.getLang('xhtmlxtras.cite_delta_width', 0)), + height : 250 + parseInt(ed.getLang('xhtmlxtras.cite_delta_height', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + ed.addCommand('mceAcronym', function() { + ed.windowManager.open({ + file : url + '/acronym.htm', + width : 350 + parseInt(ed.getLang('xhtmlxtras.acronym_delta_width', 0)), + height : 250 + parseInt(ed.getLang('xhtmlxtras.acronym_delta_width', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + ed.addCommand('mceAbbr', function() { + ed.windowManager.open({ + file : url + '/abbr.htm', + width : 350 + parseInt(ed.getLang('xhtmlxtras.abbr_delta_width', 0)), + height : 250 + parseInt(ed.getLang('xhtmlxtras.abbr_delta_width', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + ed.addCommand('mceDel', function() { + ed.windowManager.open({ + file : url + '/del.htm', + width : 340 + parseInt(ed.getLang('xhtmlxtras.del_delta_width', 0)), + height : 310 + parseInt(ed.getLang('xhtmlxtras.del_delta_width', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + ed.addCommand('mceIns', function() { + ed.windowManager.open({ + file : url + '/ins.htm', + width : 340 + parseInt(ed.getLang('xhtmlxtras.ins_delta_width', 0)), + height : 310 + parseInt(ed.getLang('xhtmlxtras.ins_delta_width', 0)), + inline : 1 + }, { + plugin_url : url + }); + }); + + ed.addCommand('mceAttributes', function() { + ed.windowManager.open({ + file : url + '/attributes.htm', + width : 380, + height : 370, + inline : 1 + }, { + plugin_url : url + }); + }); + + // Register buttons + ed.addButton('cite', {title : 'xhtmlxtras.cite_desc', cmd : 'mceCite'}); + ed.addButton('acronym', {title : 'xhtmlxtras.acronym_desc', cmd : 'mceAcronym'}); + ed.addButton('abbr', {title : 'xhtmlxtras.abbr_desc', cmd : 'mceAbbr'}); + ed.addButton('del', {title : 'xhtmlxtras.del_desc', cmd : 'mceDel'}); + ed.addButton('ins', {title : 'xhtmlxtras.ins_desc', cmd : 'mceIns'}); + ed.addButton('attribs', {title : 'xhtmlxtras.attribs_desc', cmd : 'mceAttributes'}); + + ed.onNodeChange.add(function(ed, cm, n, co) { + n = ed.dom.getParent(n, 'CITE,ACRONYM,ABBR,DEL,INS'); + + cm.setDisabled('cite', co); + cm.setDisabled('acronym', co); + cm.setDisabled('abbr', co); + cm.setDisabled('del', co); + cm.setDisabled('ins', co); + cm.setDisabled('attribs', n && n.nodeName == 'BODY'); + cm.setActive('cite', 0); + cm.setActive('acronym', 0); + cm.setActive('abbr', 0); + cm.setActive('del', 0); + cm.setActive('ins', 0); + + // Activate all + if (n) { + do { + cm.setDisabled(n.nodeName.toLowerCase(), 0); + cm.setActive(n.nodeName.toLowerCase(), 1); + } while (n = n.parentNode); + } + }); + + ed.onPreInit.add(function() { + // Fixed IE issue where it can't handle these elements correctly + ed.dom.create('abbr'); + }); + }, + + getInfo : function() { + return { + longname : 'XHTML Xtras Plugin', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + infourl : 'http://wiki.moxiecode.com/index.php/TinyMCE:Plugins/xhtmlxtras', + version : tinymce.majorVersion + "." + tinymce.minorVersion + }; + } + }); + + // Register plugin + tinymce.PluginManager.add('xhtmlxtras', tinymce.plugins.XHTMLXtrasPlugin); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/ins.htm b/web/libs/tiny_mce/plugins/xhtmlxtras/ins.htm new file mode 100644 index 0000000..6c5470c --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/ins.htm @@ -0,0 +1,161 @@ + + + + {#xhtmlxtras_dlg.title_ins_element} + + + + + + + + + +
+ + +
+
+
+ {#xhtmlxtras_dlg.fieldset_general_tab} + + + + + + + + + +
: + + + + + +
+
:
+
+
+ {#xhtmlxtras_dlg.fieldset_attrib_tab} + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
: + +
:
: + +
: + +
+
+
+
+
+ {#xhtmlxtras_dlg.fieldset_events_tab} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
:
:
:
:
:
:
:
:
:
:
:
:
+
+
+
+
+ + + +
+
+ + diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/js/abbr.js b/web/libs/tiny_mce/plugins/xhtmlxtras/js/abbr.js new file mode 100644 index 0000000..4b51a25 --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/js/abbr.js @@ -0,0 +1,28 @@ +/** + * abbr.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +function init() { + SXE.initElementDialog('abbr'); + if (SXE.currentAction == "update") { + SXE.showRemoveButton(); + } +} + +function insertAbbr() { + SXE.insertElement('abbr'); + tinyMCEPopup.close(); +} + +function removeAbbr() { + SXE.removeElement('abbr'); + tinyMCEPopup.close(); +} + +tinyMCEPopup.onInit.add(init); diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/js/acronym.js b/web/libs/tiny_mce/plugins/xhtmlxtras/js/acronym.js new file mode 100644 index 0000000..6ec2f88 --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/js/acronym.js @@ -0,0 +1,28 @@ +/** + * acronym.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +function init() { + SXE.initElementDialog('acronym'); + if (SXE.currentAction == "update") { + SXE.showRemoveButton(); + } +} + +function insertAcronym() { + SXE.insertElement('acronym'); + tinyMCEPopup.close(); +} + +function removeAcronym() { + SXE.removeElement('acronym'); + tinyMCEPopup.close(); +} + +tinyMCEPopup.onInit.add(init); diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/js/attributes.js b/web/libs/tiny_mce/plugins/xhtmlxtras/js/attributes.js new file mode 100644 index 0000000..d62a219 --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/js/attributes.js @@ -0,0 +1,126 @@ +/** + * attributes.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +function init() { + tinyMCEPopup.resizeToInnerSize(); + var inst = tinyMCEPopup.editor; + var dom = inst.dom; + var elm = inst.selection.getNode(); + var f = document.forms[0]; + var onclick = dom.getAttrib(elm, 'onclick'); + + setFormValue('title', dom.getAttrib(elm, 'title')); + setFormValue('id', dom.getAttrib(elm, 'id')); + setFormValue('style', dom.getAttrib(elm, "style")); + setFormValue('dir', dom.getAttrib(elm, 'dir')); + setFormValue('lang', dom.getAttrib(elm, 'lang')); + setFormValue('tabindex', dom.getAttrib(elm, 'tabindex', typeof(elm.tabindex) != "undefined" ? elm.tabindex : "")); + setFormValue('accesskey', dom.getAttrib(elm, 'accesskey', typeof(elm.accesskey) != "undefined" ? elm.accesskey : "")); + setFormValue('onfocus', dom.getAttrib(elm, 'onfocus')); + setFormValue('onblur', dom.getAttrib(elm, 'onblur')); + setFormValue('onclick', onclick); + setFormValue('ondblclick', dom.getAttrib(elm, 'ondblclick')); + setFormValue('onmousedown', dom.getAttrib(elm, 'onmousedown')); + setFormValue('onmouseup', dom.getAttrib(elm, 'onmouseup')); + setFormValue('onmouseover', dom.getAttrib(elm, 'onmouseover')); + setFormValue('onmousemove', dom.getAttrib(elm, 'onmousemove')); + setFormValue('onmouseout', dom.getAttrib(elm, 'onmouseout')); + setFormValue('onkeypress', dom.getAttrib(elm, 'onkeypress')); + setFormValue('onkeydown', dom.getAttrib(elm, 'onkeydown')); + setFormValue('onkeyup', dom.getAttrib(elm, 'onkeyup')); + className = dom.getAttrib(elm, 'class'); + + addClassesToList('classlist', 'advlink_styles'); + selectByValue(f, 'classlist', className, true); + + TinyMCE_EditableSelects.init(); +} + +function setFormValue(name, value) { + if(value && document.forms[0].elements[name]){ + document.forms[0].elements[name].value = value; + } +} + +function insertAction() { + var inst = tinyMCEPopup.editor; + var elm = inst.selection.getNode(); + + tinyMCEPopup.execCommand("mceBeginUndoLevel"); + setAllAttribs(elm); + tinyMCEPopup.execCommand("mceEndUndoLevel"); + tinyMCEPopup.close(); +} + +function setAttrib(elm, attrib, value) { + var formObj = document.forms[0]; + var valueElm = formObj.elements[attrib.toLowerCase()]; + var inst = tinyMCEPopup.editor; + var dom = inst.dom; + + if (typeof(value) == "undefined" || value == null) { + value = ""; + + if (valueElm) + value = valueElm.value; + } + + if (value != "") { + dom.setAttrib(elm, attrib.toLowerCase(), value); + + if (attrib == "style") + attrib = "style.cssText"; + + if (attrib.substring(0, 2) == 'on') + value = 'return true;' + value; + + if (attrib == "class") + attrib = "className"; + + elm[attrib]=value; + } else + elm.removeAttribute(attrib); +} + +function setAllAttribs(elm) { + var f = document.forms[0]; + + setAttrib(elm, 'title'); + setAttrib(elm, 'id'); + setAttrib(elm, 'style'); + setAttrib(elm, 'class', getSelectValue(f, 'classlist')); + setAttrib(elm, 'dir'); + setAttrib(elm, 'lang'); + setAttrib(elm, 'tabindex'); + setAttrib(elm, 'accesskey'); + setAttrib(elm, 'onfocus'); + setAttrib(elm, 'onblur'); + setAttrib(elm, 'onclick'); + setAttrib(elm, 'ondblclick'); + setAttrib(elm, 'onmousedown'); + setAttrib(elm, 'onmouseup'); + setAttrib(elm, 'onmouseover'); + setAttrib(elm, 'onmousemove'); + setAttrib(elm, 'onmouseout'); + setAttrib(elm, 'onkeypress'); + setAttrib(elm, 'onkeydown'); + setAttrib(elm, 'onkeyup'); + + // Refresh in old MSIE +// if (tinyMCE.isMSIE5) +// elm.outerHTML = elm.outerHTML; +} + +function insertAttribute() { + tinyMCEPopup.close(); +} + +tinyMCEPopup.onInit.add(init); +tinyMCEPopup.requireLangPack(); diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/js/cite.js b/web/libs/tiny_mce/plugins/xhtmlxtras/js/cite.js new file mode 100644 index 0000000..009b715 --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/js/cite.js @@ -0,0 +1,28 @@ +/** + * cite.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +function init() { + SXE.initElementDialog('cite'); + if (SXE.currentAction == "update") { + SXE.showRemoveButton(); + } +} + +function insertCite() { + SXE.insertElement('cite'); + tinyMCEPopup.close(); +} + +function removeCite() { + SXE.removeElement('cite'); + tinyMCEPopup.close(); +} + +tinyMCEPopup.onInit.add(init); diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/js/del.js b/web/libs/tiny_mce/plugins/xhtmlxtras/js/del.js new file mode 100644 index 0000000..9e5d8c5 --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/js/del.js @@ -0,0 +1,63 @@ +/** + * del.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +function init() { + SXE.initElementDialog('del'); + if (SXE.currentAction == "update") { + setFormValue('datetime', tinyMCEPopup.editor.dom.getAttrib(SXE.updateElement, 'datetime')); + setFormValue('cite', tinyMCEPopup.editor.dom.getAttrib(SXE.updateElement, 'cite')); + SXE.showRemoveButton(); + } +} + +function setElementAttribs(elm) { + setAllCommonAttribs(elm); + setAttrib(elm, 'datetime'); + setAttrib(elm, 'cite'); +} + +function insertDel() { + var elm = tinyMCEPopup.editor.dom.getParent(SXE.focusElement, 'DEL'); + + tinyMCEPopup.execCommand('mceBeginUndoLevel'); + if (elm == null) { + var s = SXE.inst.selection.getContent(); + if(s.length > 0) { + insertInlineElement('del'); + var elementArray = tinymce.grep(SXE.inst.dom.select('del'), function(n) {return n.id == '#sxe_temp_del#';}); + for (var i=0; i 0) { + tagName = element_name; + + insertInlineElement(element_name); + var elementArray = tinymce.grep(SXE.inst.dom.select(element_name)); + for (var i=0; i -1) ? true : false; +} + +SXE.removeClass = function(elm,cl) { + if(elm.className == null || elm.className == "" || !SXE.containsClass(elm,cl)) { + return true; + } + var classNames = elm.className.split(" "); + var newClassNames = ""; + for (var x = 0, cnl = classNames.length; x < cnl; x++) { + if (classNames[x] != cl) { + newClassNames += (classNames[x] + " "); + } + } + elm.className = newClassNames.substring(0,newClassNames.length-1); //removes extra space at the end +} + +SXE.addClass = function(elm,cl) { + if(!SXE.containsClass(elm,cl)) elm.className ? elm.className += " " + cl : elm.className = cl; + return true; +} + +function insertInlineElement(en) { + var ed = tinyMCEPopup.editor, dom = ed.dom; + + ed.getDoc().execCommand('FontName', false, 'mceinline'); + tinymce.each(dom.select('span,font'), function(n) { + if (n.style.fontFamily == 'mceinline' || n.face == 'mceinline') + dom.replace(dom.create(en, {_mce_new : 1}), n, 1); + }); +} diff --git a/web/libs/tiny_mce/plugins/xhtmlxtras/js/ins.js b/web/libs/tiny_mce/plugins/xhtmlxtras/js/ins.js new file mode 100644 index 0000000..3774f0a --- /dev/null +++ b/web/libs/tiny_mce/plugins/xhtmlxtras/js/ins.js @@ -0,0 +1,62 @@ +/** + * ins.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +function init() { + SXE.initElementDialog('ins'); + if (SXE.currentAction == "update") { + setFormValue('datetime', tinyMCEPopup.editor.dom.getAttrib(SXE.updateElement, 'datetime')); + setFormValue('cite', tinyMCEPopup.editor.dom.getAttrib(SXE.updateElement, 'cite')); + SXE.showRemoveButton(); + } +} + +function setElementAttribs(elm) { + setAllCommonAttribs(elm); + setAttrib(elm, 'datetime'); + setAttrib(elm, 'cite'); +} + +function insertIns() { + var elm = tinyMCEPopup.editor.dom.getParent(SXE.focusElement, 'INS'); + tinyMCEPopup.execCommand('mceBeginUndoLevel'); + if (elm == null) { + var s = SXE.inst.selection.getContent(); + if(s.length > 0) { + insertInlineElement('INS'); + var elementArray = tinymce.grep(SXE.inst.dom.select('ins'), function(n) {return n.id == '#sxe_temp_ins#';}); + for (var i=0; i + + + {#advanced_dlg.about_title} + + + + + + + +
+
+

{#advanced_dlg.about_title}

+

Version: ()

+

TinyMCE is a platform independent web based Javascript HTML WYSIWYG editor control released as Open Source under LGPL + by Moxiecode Systems AB. It has the ability to convert HTML TEXTAREA fields or other HTML elements to editor instances.

+

Copyright © 2003-2008, Moxiecode Systems AB, All rights reserved.

+

For more information about this software visit the TinyMCE website.

+ +
+ Got Moxie? + Hosted By Sourceforge + Also on freshmeat +
+
+ +
+
+

{#advanced_dlg.about_loaded}

+ +
+
+ +

 

+
+
+ +
+
+
+
+ +
+ +
+ + diff --git a/web/libs/tiny_mce/themes/advanced/anchor.htm b/web/libs/tiny_mce/themes/advanced/anchor.htm new file mode 100644 index 0000000..2bc63fc --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/anchor.htm @@ -0,0 +1,26 @@ + + + + {#advanced_dlg.anchor_title} + + + + +
+ + + + + + + + +
{#advanced_dlg.anchor_title}
{#advanced_dlg.anchor_name}:
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/themes/advanced/charmap.htm b/web/libs/tiny_mce/themes/advanced/charmap.htm new file mode 100644 index 0000000..3991b81 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/charmap.htm @@ -0,0 +1,52 @@ + + + + {#advanced_dlg.charmap_title} + + + + + + + + + + + + + + + +
{#advanced_dlg.charmap_title}
+ + + + + + + + + +
 
 
+
+ + + + + + + + + + + + + + + + +
HTML-Code
 
 
NUM-Code
 
+
+ + + diff --git a/web/libs/tiny_mce/themes/advanced/color_picker.htm b/web/libs/tiny_mce/themes/advanced/color_picker.htm new file mode 100644 index 0000000..096e755 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/color_picker.htm @@ -0,0 +1,73 @@ + + + + {#advanced_dlg.colorpicker_title} + + + + + +
+ + +
+
+
+ {#advanced_dlg.colorpicker_picker_title} +
+ + +
+ +
+ +
+
+
+
+ +
+
+ {#advanced_dlg.colorpicker_palette_title} +
+ +
+ +
+
+
+ +
+
+ {#advanced_dlg.colorpicker_named_title} +
+ +
+ +
+ +
+ {#advanced_dlg.colorpicker_name} +
+
+
+
+ +
+ + +
+ +
+ +
+
+
+ + diff --git a/web/libs/tiny_mce/themes/advanced/editor_template.js b/web/libs/tiny_mce/themes/advanced/editor_template.js new file mode 100644 index 0000000..4c43312 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/editor_template.js @@ -0,0 +1 @@ +(function(e){var d=e.DOM,b=e.dom.Event,h=e.extend,f=e.each,a=e.util.Cookie,g,c=e.explode;e.ThemeManager.requireLangPack("advanced");e.create("tinymce.themes.AdvancedTheme",{sizes:[8,10,12,14,18,24,36],controls:{bold:["bold_desc","Bold"],italic:["italic_desc","Italic"],underline:["underline_desc","Underline"],strikethrough:["striketrough_desc","Strikethrough"],justifyleft:["justifyleft_desc","JustifyLeft"],justifycenter:["justifycenter_desc","JustifyCenter"],justifyright:["justifyright_desc","JustifyRight"],justifyfull:["justifyfull_desc","JustifyFull"],bullist:["bullist_desc","InsertUnorderedList"],numlist:["numlist_desc","InsertOrderedList"],outdent:["outdent_desc","Outdent"],indent:["indent_desc","Indent"],cut:["cut_desc","Cut"],copy:["copy_desc","Copy"],paste:["paste_desc","Paste"],undo:["undo_desc","Undo"],redo:["redo_desc","Redo"],link:["link_desc","mceLink"],unlink:["unlink_desc","unlink"],image:["image_desc","mceImage"],cleanup:["cleanup_desc","mceCleanup"],help:["help_desc","mceHelp"],code:["code_desc","mceCodeEditor"],hr:["hr_desc","InsertHorizontalRule"],removeformat:["removeformat_desc","RemoveFormat"],sub:["sub_desc","subscript"],sup:["sup_desc","superscript"],forecolor:["forecolor_desc","ForeColor"],forecolorpicker:["forecolor_desc","mceForeColor"],backcolor:["backcolor_desc","HiliteColor"],backcolorpicker:["backcolor_desc","mceBackColor"],charmap:["charmap_desc","mceCharMap"],visualaid:["visualaid_desc","mceToggleVisualAid"],anchor:["anchor_desc","mceInsertAnchor"],newdocument:["newdocument_desc","mceNewDocument"],blockquote:["blockquote_desc","mceBlockQuote"]},stateControls:["bold","italic","underline","strikethrough","bullist","numlist","justifyleft","justifycenter","justifyright","justifyfull","sub","sup","blockquote"],init:function(j,k){var l=this,m,i,n;l.editor=j;l.url=k;l.onResolveName=new e.util.Dispatcher(this);l.settings=m=h({theme_advanced_path:true,theme_advanced_toolbar_location:"bottom",theme_advanced_buttons1:"bold,italic,underline,strikethrough,|,justifyleft,justifycenter,justifyright,justifyfull,|,styleselect,formatselect",theme_advanced_buttons2:"bullist,numlist,|,outdent,indent,|,undo,redo,|,link,unlink,anchor,image,cleanup,help,code",theme_advanced_buttons3:"hr,removeformat,visualaid,|,sub,sup,|,charmap",theme_advanced_blockformats:"p,address,pre,h1,h2,h3,h4,h5,h6",theme_advanced_toolbar_align:"center",theme_advanced_fonts:"Andale Mono=andale mono,times;Arial=arial,helvetica,sans-serif;Arial Black=arial black,avant garde;Book Antiqua=book antiqua,palatino;Comic Sans MS=comic sans ms,sans-serif;Courier New=courier new,courier;Georgia=georgia,palatino;Helvetica=helvetica;Impact=impact,chicago;Symbol=symbol;Tahoma=tahoma,arial,helvetica,sans-serif;Terminal=terminal,monaco;Times New Roman=times new roman,times;Trebuchet MS=trebuchet ms,geneva;Verdana=verdana,geneva;Webdings=webdings;Wingdings=wingdings,zapf dingbats",theme_advanced_more_colors:1,theme_advanced_row_height:23,theme_advanced_resize_horizontal:1,theme_advanced_resizing_use_cookie:1,theme_advanced_font_sizes:"1,2,3,4,5,6,7",readonly:j.settings.readonly},j.settings);if(!m.font_size_style_values){m.font_size_style_values="8pt,10pt,12pt,14pt,18pt,24pt,36pt"}if(e.is(m.theme_advanced_font_sizes,"string")){m.font_size_style_values=e.explode(m.font_size_style_values);m.font_size_classes=e.explode(m.font_size_classes||"");n={};j.settings.theme_advanced_font_sizes=m.theme_advanced_font_sizes;f(j.getParam("theme_advanced_font_sizes","","hash"),function(q,p){var o;if(p==q&&q>=1&&q<=7){p=q+" ("+l.sizes[q-1]+"pt)";o=m.font_size_classes[q-1];q=m.font_size_style_values[q-1]||(l.sizes[q-1]+"pt")}if(/^\s*\./.test(q)){o=q.replace(/\./g,"")}n[p]=o?{"class":o}:{fontSize:q}});m.theme_advanced_font_sizes=n}if((i=m.theme_advanced_path_location)&&i!="none"){m.theme_advanced_statusbar_location=m.theme_advanced_path_location}if(m.theme_advanced_statusbar_location=="none"){m.theme_advanced_statusbar_location=0}j.onInit.add(function(){if(!j.settings.readonly){j.onNodeChange.add(l._nodeChanged,l)}if(j.settings.content_css!==false){j.dom.loadCSS(j.baseURI.toAbsolute("themes/advanced/skins/"+j.settings.skin+"/content.css"))}});j.onSetProgressState.add(function(q,o,r){var s,t=q.id,p;if(o){l.progressTimer=setTimeout(function(){s=q.getContainer();s=s.insertBefore(d.create("DIV",{style:"position:relative"}),s.firstChild);p=d.get(q.id+"_tbl");d.add(s,"div",{id:t+"_blocker","class":"mceBlocker",style:{width:p.clientWidth+2,height:p.clientHeight+2}});d.add(s,"div",{id:t+"_progress","class":"mceProgress",style:{left:p.clientWidth/2,top:p.clientHeight/2}})},r||0)}else{d.remove(t+"_blocker");d.remove(t+"_progress");clearTimeout(l.progressTimer)}});d.loadCSS(m.editor_css?j.documentBaseURI.toAbsolute(m.editor_css):k+"/skins/"+j.settings.skin+"/ui.css");if(m.skin_variant){d.loadCSS(k+"/skins/"+j.settings.skin+"/ui_"+m.skin_variant+".css")}},createControl:function(l,i){var j,k;if(k=i.createControl(l)){return k}switch(l){case"styleselect":return this._createStyleSelect();case"formatselect":return this._createBlockFormats();case"fontselect":return this._createFontSelect();case"fontsizeselect":return this._createFontSizeSelect();case"forecolor":return this._createForeColorMenu();case"backcolor":return this._createBackColorMenu()}if((j=this.controls[l])){return i.createButton(l,{title:"advanced."+j[0],cmd:j[1],ui:j[2],value:j[3]})}},execCommand:function(k,j,l){var i=this["_"+k];if(i){i.call(this,j,l);return true}return false},_importClasses:function(k){var i=this.editor,j=i.controlManager.get("styleselect");if(j.getLength()==0){f(i.dom.getClasses(),function(n,l){var m="style_"+l;i.formatter.register(m,{inline:"span",attributes:{"class":n["class"]},selector:"*"});j.add(n["class"],m)})}},_createStyleSelect:function(m){var k=this,i=k.editor,j=i.controlManager,l;l=j.createListBox("styleselect",{title:"advanced.style_select",onselect:function(o){var p,n=[];f(l.items,function(q){n.push(q.value)});i.focus();i.undoManager.add();p=i.formatter.matchAll(n);if(!o||p[0]==o){i.formatter.remove(p[0])}else{i.formatter.apply(o)}i.undoManager.add();i.nodeChanged();return false}});i.onInit.add(function(){var o=0,n=i.getParam("style_formats");if(n){f(n,function(p){var q,r=0;f(p,function(){r++});if(r>1){q=p.name=p.name||"style_"+(o++);i.formatter.register(q,p);l.add(p.title,q)}else{l.add(p.title)}})}else{f(i.getParam("theme_advanced_styles","","hash"),function(r,q){var p;if(r){p="style_"+(o++);i.formatter.register(p,{inline:"span",classes:r,selector:"*"});l.add(k.editor.translate(q),p)}})}});if(l.getLength()==0){l.onPostRender.add(function(o,p){if(!l.NativeListBox){b.add(p.id+"_text","focus",k._importClasses,k);b.add(p.id+"_text","mousedown",k._importClasses,k);b.add(p.id+"_open","focus",k._importClasses,k);b.add(p.id+"_open","mousedown",k._importClasses,k)}else{b.add(p.id,"focus",k._importClasses,k)}})}return l},_createFontSelect:function(){var k,j=this,i=j.editor;k=i.controlManager.createListBox("fontselect",{title:"advanced.fontdefault",onselect:function(l){var m=k.items[k.selectedIndex];if(!l&&m){i.execCommand("FontName",false,m.value);return}i.execCommand("FontName",false,l);k.select(function(n){return l==n});return false}});if(k){f(i.getParam("theme_advanced_fonts",j.settings.theme_advanced_fonts,"hash"),function(m,l){k.add(i.translate(l),m,{style:m.indexOf("dings")==-1?"font-family:"+m:""})})}return k},_createFontSizeSelect:function(){var m=this,k=m.editor,n,l=0,j=[];n=k.controlManager.createListBox("fontsizeselect",{title:"advanced.font_size",onselect:function(i){var o=n.items[n.selectedIndex];if(!i&&o){o=o.value;if(o["class"]){k.formatter.toggle("fontsize_class",{value:o["class"]});k.undoManager.add();k.nodeChanged()}else{k.execCommand("FontSize",false,o.fontSize)}return}if(i["class"]){k.focus();k.undoManager.add();k.formatter.toggle("fontsize_class",{value:i["class"]});k.undoManager.add();k.nodeChanged()}else{k.execCommand("FontSize",false,i.fontSize)}n.select(function(p){return i==p});return false}});if(n){f(m.settings.theme_advanced_font_sizes,function(o,i){var p=o.fontSize;if(p>=1&&p<=7){p=m.sizes[parseInt(p)-1]+"pt"}n.add(i,o,{style:"font-size:"+p,"class":"mceFontSize"+(l++)+(" "+(o["class"]||""))})})}return n},_createBlockFormats:function(){var k,i={p:"advanced.paragraph",address:"advanced.address",pre:"advanced.pre",h1:"advanced.h1",h2:"advanced.h2",h3:"advanced.h3",h4:"advanced.h4",h5:"advanced.h5",h6:"advanced.h6",div:"advanced.div",blockquote:"advanced.blockquote",code:"advanced.code",dt:"advanced.dt",dd:"advanced.dd",samp:"advanced.samp"},j=this;k=j.editor.controlManager.createListBox("formatselect",{title:"advanced.block",cmd:"FormatBlock"});if(k){f(j.editor.getParam("theme_advanced_blockformats",j.settings.theme_advanced_blockformats,"hash"),function(m,l){k.add(j.editor.translate(l!=m?l:i[m]),m,{"class":"mce_formatPreview mce_"+m})})}return k},_createForeColorMenu:function(){var m,j=this,k=j.settings,l={},i;if(k.theme_advanced_more_colors){l.more_colors_func=function(){j._mceColorPicker(0,{color:m.value,func:function(n){m.setColor(n)}})}}if(i=k.theme_advanced_text_colors){l.colors=i}if(k.theme_advanced_default_foreground_color){l.default_color=k.theme_advanced_default_foreground_color}l.title="advanced.forecolor_desc";l.cmd="ForeColor";l.scope=this;m=j.editor.controlManager.createColorSplitButton("forecolor",l);return m},_createBackColorMenu:function(){var m,j=this,k=j.settings,l={},i;if(k.theme_advanced_more_colors){l.more_colors_func=function(){j._mceColorPicker(0,{color:m.value,func:function(n){m.setColor(n)}})}}if(i=k.theme_advanced_background_colors){l.colors=i}if(k.theme_advanced_default_background_color){l.default_color=k.theme_advanced_default_background_color}l.title="advanced.backcolor_desc";l.cmd="HiliteColor";l.scope=this;m=j.editor.controlManager.createColorSplitButton("backcolor",l);return m},renderUI:function(k){var m,l,q,v=this,r=v.editor,w=v.settings,u,j,i;m=j=d.create("span",{id:r.id+"_parent","class":"mceEditor "+r.settings.skin+"Skin"+(w.skin_variant?" "+r.settings.skin+"Skin"+v._ufirst(w.skin_variant):"")});if(!d.boxModel){m=d.add(m,"div",{"class":"mceOldBoxModel"})}m=u=d.add(m,"table",{id:r.id+"_tbl","class":"mceLayout",cellSpacing:0,cellPadding:0});m=q=d.add(m,"tbody");switch((w.theme_advanced_layout_manager||"").toLowerCase()){case"rowlayout":l=v._rowLayout(w,q,k);break;case"customlayout":l=r.execCallback("theme_advanced_custom_layout",w,q,k,j);break;default:l=v._simpleLayout(w,q,k,j)}m=k.targetNode;i=d.stdMode?u.getElementsByTagName("tr"):u.rows;d.addClass(i[0],"mceFirst");d.addClass(i[i.length-1],"mceLast");f(d.select("tr",q),function(o){d.addClass(o.firstChild,"mceFirst");d.addClass(o.childNodes[o.childNodes.length-1],"mceLast")});if(d.get(w.theme_advanced_toolbar_container)){d.get(w.theme_advanced_toolbar_container).appendChild(j)}else{d.insertAfter(j,m)}b.add(r.id+"_path_row","click",function(n){n=n.target;if(n.nodeName=="A"){v._sel(n.className.replace(/^.*mcePath_([0-9]+).*$/,"$1"));return b.cancel(n)}});if(!r.getParam("accessibility_focus")){b.add(d.add(j,"a",{href:"#"},""),"focus",function(){tinyMCE.get(r.id).focus()})}if(w.theme_advanced_toolbar_location=="external"){k.deltaHeight=0}v.deltaHeight=k.deltaHeight;k.targetNode=null;return{iframeContainer:l,editorContainer:r.id+"_parent",sizeContainer:u,deltaHeight:k.deltaHeight}},getInfo:function(){return{longname:"Advanced theme",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",version:e.majorVersion+"."+e.minorVersion}},resizeBy:function(i,j){var k=d.get(this.editor.id+"_tbl");this.resizeTo(k.clientWidth+i,k.clientHeight+j)},resizeTo:function(i,l){var j=this.editor,k=this.settings,m=d.get(j.id+"_tbl"),n=d.get(j.id+"_ifr");i=Math.max(k.theme_advanced_resizing_min_width||100,i);l=Math.max(k.theme_advanced_resizing_min_height||100,l);i=Math.min(k.theme_advanced_resizing_max_width||65535,i);l=Math.min(k.theme_advanced_resizing_max_height||65535,l);d.setStyle(m,"height","");d.setStyle(n,"height",l);if(k.theme_advanced_resize_horizontal){d.setStyle(m,"width","");d.setStyle(n,"width",i);if(i"))}q.push(d.createHTML("a",{href:"#",accesskey:"q",title:r.getLang("advanced.toolbar_focus")},""));for(p=1;(y=A["theme_advanced_buttons"+p]);p++){m=j.createToolbar("toolbar"+p,{"class":"mceToolbarRow"+p});if(A["theme_advanced_buttons"+p+"_add"]){y+=","+A["theme_advanced_buttons"+p+"_add"]}if(A["theme_advanced_buttons"+p+"_add_before"]){y=A["theme_advanced_buttons"+p+"_add_before"]+","+y}z._addControls(y,m);q.push(m.renderHTML());k.deltaHeight-=A.theme_advanced_row_height}q.push(d.createHTML("a",{href:"#",accesskey:"z",title:r.getLang("advanced.toolbar_focus"),onfocus:"tinyMCE.getInstanceById('"+r.id+"').focus();"},""));d.setHTML(l,q.join(""))},_addStatusBar:function(m,j){var k,v=this,p=v.editor,w=v.settings,i,q,u,l;k=d.add(m,"tr");k=l=d.add(k,"td",{"class":"mceStatusbar"});k=d.add(k,"div",{id:p.id+"_path_row"},w.theme_advanced_path?p.translate("advanced.path")+": ":" ");d.add(k,"a",{href:"#",accesskey:"x"});if(w.theme_advanced_resizing){d.add(l,"a",{id:p.id+"_resize",href:"javascript:;",onclick:"return false;","class":"mceResize"});if(w.theme_advanced_resizing_use_cookie){p.onPostRender.add(function(){var n=a.getHash("TinyMCE_"+p.id+"_size"),r=d.get(p.id+"_tbl");if(!n){return}v.resizeTo(n.cw,n.ch)})}p.onPostRender.add(function(){b.add(p.id+"_resize","mousedown",function(D){var t,r,s,o,C,z,A,F,n,E,x;function y(G){n=A+(G.screenX-C);E=F+(G.screenY-z);v.resizeTo(n,E)}function B(G){b.remove(d.doc,"mousemove",t);b.remove(p.getDoc(),"mousemove",r);b.remove(d.doc,"mouseup",s);b.remove(p.getDoc(),"mouseup",o);if(w.theme_advanced_resizing_use_cookie){a.setHash("TinyMCE_"+p.id+"_size",{cw:n,ch:E})}}D.preventDefault();C=D.screenX;z=D.screenY;x=d.get(v.editor.id+"_ifr");A=n=x.clientWidth;F=E=x.clientHeight;t=b.add(d.doc,"mousemove",y);r=b.add(p.getDoc(),"mousemove",y);s=b.add(d.doc,"mouseup",B);o=b.add(p.getDoc(),"mouseup",B)})})}j.deltaHeight-=21;k=m=null},_nodeChanged:function(r,z,l,x,j){var C=this,i,y=0,B,u,D=C.settings,A,k,w,m,q;e.each(C.stateControls,function(n){z.setActive(n,r.queryCommandState(C.controls[n][1]))});function o(p){var s,n=j.parents,t=p;if(typeof(p)=="string"){t=function(v){return v.nodeName==p}}for(s=0;s= 1 && v <= 7) { + k = v + ' (' + t.sizes[v - 1] + 'pt)'; + cl = s.font_size_classes[v - 1]; + v = s.font_size_style_values[v - 1] || (t.sizes[v - 1] + 'pt'); + } + + if (/^\s*\./.test(v)) + cl = v.replace(/\./g, ''); + + o[k] = cl ? {'class' : cl} : {fontSize : v}; + }); + + s.theme_advanced_font_sizes = o; + } + + if ((v = s.theme_advanced_path_location) && v != 'none') + s.theme_advanced_statusbar_location = s.theme_advanced_path_location; + + if (s.theme_advanced_statusbar_location == 'none') + s.theme_advanced_statusbar_location = 0; + + // Init editor + ed.onInit.add(function() { + if (!ed.settings.readonly) + ed.onNodeChange.add(t._nodeChanged, t); + + if (ed.settings.content_css !== false) + ed.dom.loadCSS(ed.baseURI.toAbsolute("themes/advanced/skins/" + ed.settings.skin + "/content.css")); + }); + + ed.onSetProgressState.add(function(ed, b, ti) { + var co, id = ed.id, tb; + + if (b) { + t.progressTimer = setTimeout(function() { + co = ed.getContainer(); + co = co.insertBefore(DOM.create('DIV', {style : 'position:relative'}), co.firstChild); + tb = DOM.get(ed.id + '_tbl'); + + DOM.add(co, 'div', {id : id + '_blocker', 'class' : 'mceBlocker', style : {width : tb.clientWidth + 2, height : tb.clientHeight + 2}}); + DOM.add(co, 'div', {id : id + '_progress', 'class' : 'mceProgress', style : {left : tb.clientWidth / 2, top : tb.clientHeight / 2}}); + }, ti || 0); + } else { + DOM.remove(id + '_blocker'); + DOM.remove(id + '_progress'); + clearTimeout(t.progressTimer); + } + }); + + DOM.loadCSS(s.editor_css ? ed.documentBaseURI.toAbsolute(s.editor_css) : url + "/skins/" + ed.settings.skin + "/ui.css"); + + if (s.skin_variant) + DOM.loadCSS(url + "/skins/" + ed.settings.skin + "/ui_" + s.skin_variant + ".css"); + }, + + createControl : function(n, cf) { + var cd, c; + + if (c = cf.createControl(n)) + return c; + + switch (n) { + case "styleselect": + return this._createStyleSelect(); + + case "formatselect": + return this._createBlockFormats(); + + case "fontselect": + return this._createFontSelect(); + + case "fontsizeselect": + return this._createFontSizeSelect(); + + case "forecolor": + return this._createForeColorMenu(); + + case "backcolor": + return this._createBackColorMenu(); + } + + if ((cd = this.controls[n])) + return cf.createButton(n, {title : "advanced." + cd[0], cmd : cd[1], ui : cd[2], value : cd[3]}); + }, + + execCommand : function(cmd, ui, val) { + var f = this['_' + cmd]; + + if (f) { + f.call(this, ui, val); + return true; + } + + return false; + }, + + _importClasses : function(e) { + var ed = this.editor, ctrl = ed.controlManager.get('styleselect'); + + if (ctrl.getLength() == 0) { + each(ed.dom.getClasses(), function(o, idx) { + var name = 'style_' + idx; + + ed.formatter.register(name, { + inline : 'span', + attributes : {'class' : o['class']}, + selector : '*' + }); + + ctrl.add(o['class'], name); + }); + } + }, + + _createStyleSelect : function(n) { + var t = this, ed = t.editor, ctrlMan = ed.controlManager, ctrl; + + // Setup style select box + ctrl = ctrlMan.createListBox('styleselect', { + title : 'advanced.style_select', + onselect : function(name) { + var matches, formatNames = []; + + each(ctrl.items, function(item) { + formatNames.push(item.value); + }); + + ed.focus(); + ed.undoManager.add(); + + // Toggle off the current format + matches = ed.formatter.matchAll(formatNames); + if (!name || matches[0] == name) + ed.formatter.remove(matches[0]); + else + ed.formatter.apply(name); + + ed.undoManager.add(); + ed.nodeChanged(); + + return false; // No auto select + } + }); + + // Handle specified format + ed.onInit.add(function() { + var counter = 0, formats = ed.getParam('style_formats'); + + if (formats) { + each(formats, function(fmt) { + var name, keys = 0; + + each(fmt, function() {keys++;}); + + if (keys > 1) { + name = fmt.name = fmt.name || 'style_' + (counter++); + ed.formatter.register(name, fmt); + ctrl.add(fmt.title, name); + } else + ctrl.add(fmt.title); + }); + } else { + each(ed.getParam('theme_advanced_styles', '', 'hash'), function(val, key) { + var name; + + if (val) { + name = 'style_' + (counter++); + + ed.formatter.register(name, { + inline : 'span', + classes : val, + selector : '*' + }); + + ctrl.add(t.editor.translate(key), name); + } + }); + } + }); + + // Auto import classes if the ctrl box is empty + if (ctrl.getLength() == 0) { + ctrl.onPostRender.add(function(ed, n) { + if (!ctrl.NativeListBox) { + Event.add(n.id + '_text', 'focus', t._importClasses, t); + Event.add(n.id + '_text', 'mousedown', t._importClasses, t); + Event.add(n.id + '_open', 'focus', t._importClasses, t); + Event.add(n.id + '_open', 'mousedown', t._importClasses, t); + } else + Event.add(n.id, 'focus', t._importClasses, t); + }); + } + + return ctrl; + }, + + _createFontSelect : function() { + var c, t = this, ed = t.editor; + + c = ed.controlManager.createListBox('fontselect', { + title : 'advanced.fontdefault', + onselect : function(v) { + var cur = c.items[c.selectedIndex]; + + if (!v && cur) { + ed.execCommand('FontName', false, cur.value); + return; + } + + ed.execCommand('FontName', false, v); + + // Fake selection, execCommand will fire a nodeChange and update the selection + c.select(function(sv) { + return v == sv; + }); + + return false; // No auto select + } + }); + + if (c) { + each(ed.getParam('theme_advanced_fonts', t.settings.theme_advanced_fonts, 'hash'), function(v, k) { + c.add(ed.translate(k), v, {style : v.indexOf('dings') == -1 ? 'font-family:' + v : ''}); + }); + } + + return c; + }, + + _createFontSizeSelect : function() { + var t = this, ed = t.editor, c, i = 0, cl = []; + + c = ed.controlManager.createListBox('fontsizeselect', {title : 'advanced.font_size', onselect : function(v) { + var cur = c.items[c.selectedIndex]; + + if (!v && cur) { + cur = cur.value; + + if (cur['class']) { + ed.formatter.toggle('fontsize_class', {value : cur['class']}); + ed.undoManager.add(); + ed.nodeChanged(); + } else { + ed.execCommand('FontSize', false, cur.fontSize); + } + + return; + } + + if (v['class']) { + ed.focus(); + ed.undoManager.add(); + ed.formatter.toggle('fontsize_class', {value : v['class']}); + ed.undoManager.add(); + ed.nodeChanged(); + } else + ed.execCommand('FontSize', false, v.fontSize); + + // Fake selection, execCommand will fire a nodeChange and update the selection + c.select(function(sv) { + return v == sv; + }); + + return false; // No auto select + }}); + + if (c) { + each(t.settings.theme_advanced_font_sizes, function(v, k) { + var fz = v.fontSize; + + if (fz >= 1 && fz <= 7) + fz = t.sizes[parseInt(fz) - 1] + 'pt'; + + c.add(k, v, {'style' : 'font-size:' + fz, 'class' : 'mceFontSize' + (i++) + (' ' + (v['class'] || ''))}); + }); + } + + return c; + }, + + _createBlockFormats : function() { + var c, fmts = { + p : 'advanced.paragraph', + address : 'advanced.address', + pre : 'advanced.pre', + h1 : 'advanced.h1', + h2 : 'advanced.h2', + h3 : 'advanced.h3', + h4 : 'advanced.h4', + h5 : 'advanced.h5', + h6 : 'advanced.h6', + div : 'advanced.div', + blockquote : 'advanced.blockquote', + code : 'advanced.code', + dt : 'advanced.dt', + dd : 'advanced.dd', + samp : 'advanced.samp' + }, t = this; + + c = t.editor.controlManager.createListBox('formatselect', {title : 'advanced.block', cmd : 'FormatBlock'}); + if (c) { + each(t.editor.getParam('theme_advanced_blockformats', t.settings.theme_advanced_blockformats, 'hash'), function(v, k) { + c.add(t.editor.translate(k != v ? k : fmts[v]), v, {'class' : 'mce_formatPreview mce_' + v}); + }); + } + + return c; + }, + + _createForeColorMenu : function() { + var c, t = this, s = t.settings, o = {}, v; + + if (s.theme_advanced_more_colors) { + o.more_colors_func = function() { + t._mceColorPicker(0, { + color : c.value, + func : function(co) { + c.setColor(co); + } + }); + }; + } + + if (v = s.theme_advanced_text_colors) + o.colors = v; + + if (s.theme_advanced_default_foreground_color) + o.default_color = s.theme_advanced_default_foreground_color; + + o.title = 'advanced.forecolor_desc'; + o.cmd = 'ForeColor'; + o.scope = this; + + c = t.editor.controlManager.createColorSplitButton('forecolor', o); + + return c; + }, + + _createBackColorMenu : function() { + var c, t = this, s = t.settings, o = {}, v; + + if (s.theme_advanced_more_colors) { + o.more_colors_func = function() { + t._mceColorPicker(0, { + color : c.value, + func : function(co) { + c.setColor(co); + } + }); + }; + } + + if (v = s.theme_advanced_background_colors) + o.colors = v; + + if (s.theme_advanced_default_background_color) + o.default_color = s.theme_advanced_default_background_color; + + o.title = 'advanced.backcolor_desc'; + o.cmd = 'HiliteColor'; + o.scope = this; + + c = t.editor.controlManager.createColorSplitButton('backcolor', o); + + return c; + }, + + renderUI : function(o) { + var n, ic, tb, t = this, ed = t.editor, s = t.settings, sc, p, nl; + + n = p = DOM.create('span', {id : ed.id + '_parent', 'class' : 'mceEditor ' + ed.settings.skin + 'Skin' + (s.skin_variant ? ' ' + ed.settings.skin + 'Skin' + t._ufirst(s.skin_variant) : '')}); + + if (!DOM.boxModel) + n = DOM.add(n, 'div', {'class' : 'mceOldBoxModel'}); + + n = sc = DOM.add(n, 'table', {id : ed.id + '_tbl', 'class' : 'mceLayout', cellSpacing : 0, cellPadding : 0}); + n = tb = DOM.add(n, 'tbody'); + + switch ((s.theme_advanced_layout_manager || '').toLowerCase()) { + case "rowlayout": + ic = t._rowLayout(s, tb, o); + break; + + case "customlayout": + ic = ed.execCallback("theme_advanced_custom_layout", s, tb, o, p); + break; + + default: + ic = t._simpleLayout(s, tb, o, p); + } + + n = o.targetNode; + + // Add classes to first and last TRs + nl = DOM.stdMode ? sc.getElementsByTagName('tr') : sc.rows; // Quick fix for IE 8 + DOM.addClass(nl[0], 'mceFirst'); + DOM.addClass(nl[nl.length - 1], 'mceLast'); + + // Add classes to first and last TDs + each(DOM.select('tr', tb), function(n) { + DOM.addClass(n.firstChild, 'mceFirst'); + DOM.addClass(n.childNodes[n.childNodes.length - 1], 'mceLast'); + }); + + if (DOM.get(s.theme_advanced_toolbar_container)) + DOM.get(s.theme_advanced_toolbar_container).appendChild(p); + else + DOM.insertAfter(p, n); + + Event.add(ed.id + '_path_row', 'click', function(e) { + e = e.target; + + if (e.nodeName == 'A') { + t._sel(e.className.replace(/^.*mcePath_([0-9]+).*$/, '$1')); + + return Event.cancel(e); + } + }); +/* + if (DOM.get(ed.id + '_path_row')) { + Event.add(ed.id + '_tbl', 'mouseover', function(e) { + var re; + + e = e.target; + + if (e.nodeName == 'SPAN' && DOM.hasClass(e.parentNode, 'mceButton')) { + re = DOM.get(ed.id + '_path_row'); + t.lastPath = re.innerHTML; + DOM.setHTML(re, e.parentNode.title); + } + }); + + Event.add(ed.id + '_tbl', 'mouseout', function(e) { + if (t.lastPath) { + DOM.setHTML(ed.id + '_path_row', t.lastPath); + t.lastPath = 0; + } + }); + } +*/ + + if (!ed.getParam('accessibility_focus')) + Event.add(DOM.add(p, 'a', {href : '#'}, ''), 'focus', function() {tinyMCE.get(ed.id).focus();}); + + if (s.theme_advanced_toolbar_location == 'external') + o.deltaHeight = 0; + + t.deltaHeight = o.deltaHeight; + o.targetNode = null; + + return { + iframeContainer : ic, + editorContainer : ed.id + '_parent', + sizeContainer : sc, + deltaHeight : o.deltaHeight + }; + }, + + getInfo : function() { + return { + longname : 'Advanced theme', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + version : tinymce.majorVersion + "." + tinymce.minorVersion + } + }, + + resizeBy : function(dw, dh) { + var e = DOM.get(this.editor.id + '_tbl'); + + this.resizeTo(e.clientWidth + dw, e.clientHeight + dh); + }, + + resizeTo : function(w, h) { + var ed = this.editor, s = this.settings, e = DOM.get(ed.id + '_tbl'), ifr = DOM.get(ed.id + '_ifr'); + + // Boundery fix box + w = Math.max(s.theme_advanced_resizing_min_width || 100, w); + h = Math.max(s.theme_advanced_resizing_min_height || 100, h); + w = Math.min(s.theme_advanced_resizing_max_width || 0xFFFF, w); + h = Math.min(s.theme_advanced_resizing_max_height || 0xFFFF, h); + + // Resize iframe and container + DOM.setStyle(e, 'height', ''); + DOM.setStyle(ifr, 'height', h); + + if (s.theme_advanced_resize_horizontal) { + DOM.setStyle(e, 'width', ''); + DOM.setStyle(ifr, 'width', w); + + // Make sure that the size is never smaller than the over all ui + if (w < e.clientWidth) + DOM.setStyle(ifr, 'width', e.clientWidth); + } + }, + + destroy : function() { + var id = this.editor.id; + + Event.clear(id + '_resize'); + Event.clear(id + '_path_row'); + Event.clear(id + '_external_close'); + }, + + // Internal functions + + _simpleLayout : function(s, tb, o, p) { + var t = this, ed = t.editor, lo = s.theme_advanced_toolbar_location, sl = s.theme_advanced_statusbar_location, n, ic, etb, c; + + if (s.readonly) { + n = DOM.add(tb, 'tr'); + n = ic = DOM.add(n, 'td', {'class' : 'mceIframeContainer'}); + return ic; + } + + // Create toolbar container at top + if (lo == 'top') + t._addToolbars(tb, o); + + // Create external toolbar + if (lo == 'external') { + n = c = DOM.create('div', {style : 'position:relative'}); + n = DOM.add(n, 'div', {id : ed.id + '_external', 'class' : 'mceExternalToolbar'}); + DOM.add(n, 'a', {id : ed.id + '_external_close', href : 'javascript:;', 'class' : 'mceExternalClose'}); + n = DOM.add(n, 'table', {id : ed.id + '_tblext', cellSpacing : 0, cellPadding : 0}); + etb = DOM.add(n, 'tbody'); + + if (p.firstChild.className == 'mceOldBoxModel') + p.firstChild.appendChild(c); + else + p.insertBefore(c, p.firstChild); + + t._addToolbars(etb, o); + + ed.onMouseUp.add(function() { + var e = DOM.get(ed.id + '_external'); + DOM.show(e); + + DOM.hide(lastExtID); + + var f = Event.add(ed.id + '_external_close', 'click', function() { + DOM.hide(ed.id + '_external'); + Event.remove(ed.id + '_external_close', 'click', f); + }); + + DOM.show(e); + DOM.setStyle(e, 'top', 0 - DOM.getRect(ed.id + '_tblext').h - 1); + + // Fixes IE rendering bug + DOM.hide(e); + DOM.show(e); + e.style.filter = ''; + + lastExtID = ed.id + '_external'; + + e = null; + }); + } + + if (sl == 'top') + t._addStatusBar(tb, o); + + // Create iframe container + if (!s.theme_advanced_toolbar_container) { + n = DOM.add(tb, 'tr'); + n = ic = DOM.add(n, 'td', {'class' : 'mceIframeContainer'}); + } + + // Create toolbar container at bottom + if (lo == 'bottom') + t._addToolbars(tb, o); + + if (sl == 'bottom') + t._addStatusBar(tb, o); + + return ic; + }, + + _rowLayout : function(s, tb, o) { + var t = this, ed = t.editor, dc, da, cf = ed.controlManager, n, ic, to, a; + + dc = s.theme_advanced_containers_default_class || ''; + da = s.theme_advanced_containers_default_align || 'center'; + + each(explode(s.theme_advanced_containers || ''), function(c, i) { + var v = s['theme_advanced_container_' + c] || ''; + + switch (v.toLowerCase()) { + case 'mceeditor': + n = DOM.add(tb, 'tr'); + n = ic = DOM.add(n, 'td', {'class' : 'mceIframeContainer'}); + break; + + case 'mceelementpath': + t._addStatusBar(tb, o); + break; + + default: + a = (s['theme_advanced_container_' + c + '_align'] || da).toLowerCase(); + a = 'mce' + t._ufirst(a); + + n = DOM.add(DOM.add(tb, 'tr'), 'td', { + 'class' : 'mceToolbar ' + (s['theme_advanced_container_' + c + '_class'] || dc) + ' ' + a || da + }); + + to = cf.createToolbar("toolbar" + i); + t._addControls(v, to); + DOM.setHTML(n, to.renderHTML()); + o.deltaHeight -= s.theme_advanced_row_height; + } + }); + + return ic; + }, + + _addControls : function(v, tb) { + var t = this, s = t.settings, di, cf = t.editor.controlManager; + + if (s.theme_advanced_disable && !t._disabled) { + di = {}; + + each(explode(s.theme_advanced_disable), function(v) { + di[v] = 1; + }); + + t._disabled = di; + } else + di = t._disabled; + + each(explode(v), function(n) { + var c; + + if (di && di[n]) + return; + + // Compatiblity with 2.x + if (n == 'tablecontrols') { + each(["table","|","row_props","cell_props","|","row_before","row_after","delete_row","|","col_before","col_after","delete_col","|","split_cells","merge_cells"], function(n) { + n = t.createControl(n, cf); + + if (n) + tb.add(n); + }); + + return; + } + + c = t.createControl(n, cf); + + if (c) + tb.add(c); + }); + }, + + _addToolbars : function(c, o) { + var t = this, i, tb, ed = t.editor, s = t.settings, v, cf = ed.controlManager, di, n, h = [], a; + + a = s.theme_advanced_toolbar_align.toLowerCase(); + a = 'mce' + t._ufirst(a); + + n = DOM.add(DOM.add(c, 'tr'), 'td', {'class' : 'mceToolbar ' + a}); + + if (!ed.getParam('accessibility_focus')) + h.push(DOM.createHTML('a', {href : '#', onfocus : 'tinyMCE.get(\'' + ed.id + '\').focus();'}, '')); + + h.push(DOM.createHTML('a', {href : '#', accesskey : 'q', title : ed.getLang("advanced.toolbar_focus")}, '')); + + // Create toolbar and add the controls + for (i=1; (v = s['theme_advanced_buttons' + i]); i++) { + tb = cf.createToolbar("toolbar" + i, {'class' : 'mceToolbarRow' + i}); + + if (s['theme_advanced_buttons' + i + '_add']) + v += ',' + s['theme_advanced_buttons' + i + '_add']; + + if (s['theme_advanced_buttons' + i + '_add_before']) + v = s['theme_advanced_buttons' + i + '_add_before'] + ',' + v; + + t._addControls(v, tb); + + //n.appendChild(n = tb.render()); + h.push(tb.renderHTML()); + + o.deltaHeight -= s.theme_advanced_row_height; + } + + h.push(DOM.createHTML('a', {href : '#', accesskey : 'z', title : ed.getLang("advanced.toolbar_focus"), onfocus : 'tinyMCE.getInstanceById(\'' + ed.id + '\').focus();'}, '')); + DOM.setHTML(n, h.join('')); + }, + + _addStatusBar : function(tb, o) { + var n, t = this, ed = t.editor, s = t.settings, r, mf, me, td; + + n = DOM.add(tb, 'tr'); + n = td = DOM.add(n, 'td', {'class' : 'mceStatusbar'}); + n = DOM.add(n, 'div', {id : ed.id + '_path_row'}, s.theme_advanced_path ? ed.translate('advanced.path') + ': ' : ' '); + DOM.add(n, 'a', {href : '#', accesskey : 'x'}); + + if (s.theme_advanced_resizing) { + DOM.add(td, 'a', {id : ed.id + '_resize', href : 'javascript:;', onclick : "return false;", 'class' : 'mceResize'}); + + if (s.theme_advanced_resizing_use_cookie) { + ed.onPostRender.add(function() { + var o = Cookie.getHash("TinyMCE_" + ed.id + "_size"), c = DOM.get(ed.id + '_tbl'); + + if (!o) + return; + + t.resizeTo(o.cw, o.ch); + }); + } + + ed.onPostRender.add(function() { + Event.add(ed.id + '_resize', 'mousedown', function(e) { + var mouseMoveHandler1, mouseMoveHandler2, + mouseUpHandler1, mouseUpHandler2, + startX, startY, startWidth, startHeight, width, height, ifrElm; + + function resizeOnMove(e) { + width = startWidth + (e.screenX - startX); + height = startHeight + (e.screenY - startY); + + t.resizeTo(width, height); + }; + + function endResize(e) { + // Stop listening + Event.remove(DOM.doc, 'mousemove', mouseMoveHandler1); + Event.remove(ed.getDoc(), 'mousemove', mouseMoveHandler2); + Event.remove(DOM.doc, 'mouseup', mouseUpHandler1); + Event.remove(ed.getDoc(), 'mouseup', mouseUpHandler2); + + // Store away the size + if (s.theme_advanced_resizing_use_cookie) { + Cookie.setHash("TinyMCE_" + ed.id + "_size", { + cw : width, + ch : height + }); + } + }; + + e.preventDefault(); + + // Get the current rect size + startX = e.screenX; + startY = e.screenY; + ifrElm = DOM.get(t.editor.id + '_ifr'); + startWidth = width = ifrElm.clientWidth; + startHeight = height = ifrElm.clientHeight; + + // Register envent handlers + mouseMoveHandler1 = Event.add(DOM.doc, 'mousemove', resizeOnMove); + mouseMoveHandler2 = Event.add(ed.getDoc(), 'mousemove', resizeOnMove); + mouseUpHandler1 = Event.add(DOM.doc, 'mouseup', endResize); + mouseUpHandler2 = Event.add(ed.getDoc(), 'mouseup', endResize); + }); + }); + } + + o.deltaHeight -= 21; + n = tb = null; + }, + + _nodeChanged : function(ed, cm, n, co, ob) { + var t = this, p, de = 0, v, c, s = t.settings, cl, fz, fn, formatNames, matches; + + tinymce.each(t.stateControls, function(c) { + cm.setActive(c, ed.queryCommandState(t.controls[c][1])); + }); + + function getParent(name) { + var i, parents = ob.parents, func = name; + + if (typeof(name) == 'string') { + func = function(node) { + return node.nodeName == name; + }; + } + + for (i = 0; i < parents.length; i++) { + if (func(parents[i])) + return parents[i]; + } + }; + + cm.setActive('visualaid', ed.hasVisual); + cm.setDisabled('undo', !ed.undoManager.hasUndo() && !ed.typing); + cm.setDisabled('redo', !ed.undoManager.hasRedo()); + cm.setDisabled('outdent', !ed.queryCommandState('Outdent')); + + p = getParent('A'); + if (c = cm.get('link')) { + if (!p || !p.name) { + c.setDisabled(!p && co); + c.setActive(!!p); + } + } + + if (c = cm.get('unlink')) { + c.setDisabled(!p && co); + c.setActive(!!p && !p.name); + } + + if (c = cm.get('anchor')) { + c.setActive(!!p && p.name); + } + + p = getParent('IMG'); + if (c = cm.get('image')) + c.setActive(!!p && n.className.indexOf('mceItem') == -1); + + if (c = cm.get('styleselect')) { + t._importClasses(); + + formatNames = []; + each(c.items, function(item) { + formatNames.push(item.value); + }); + + matches = ed.formatter.matchAll(formatNames); + c.select(matches[0]); + } + + if (c = cm.get('formatselect')) { + p = getParent(DOM.isBlock); + + if (p) + c.select(p.nodeName.toLowerCase()); + } + + // Find out current fontSize, fontFamily and fontClass + getParent(function(n) { + if (n.nodeName === 'SPAN') { + if (!cl && n.className) + cl = n.className; + + if (!fz && n.style.fontSize) + fz = n.style.fontSize; + + if (!fn && n.style.fontFamily) + fn = n.style.fontFamily.replace(/[\"\']+/g, '').replace(/^([^,]+).*/, '$1').toLowerCase(); + } + + return false; + }); + + if (c = cm.get('fontselect')) { + c.select(function(v) { + return v.replace(/^([^,]+).*/, '$1').toLowerCase() == fn; + }); + } + + // Select font size + if (c = cm.get('fontsizeselect')) { + // Use computed style + if (s.theme_advanced_runtime_fontsize && !fz && !cl) + fz = ed.dom.getStyle(n, 'fontSize', true); + + c.select(function(v) { + if (v.fontSize && v.fontSize === fz) + return true; + + if (v['class'] && v['class'] === cl) + return true; + }); + } + + if (s.theme_advanced_path && s.theme_advanced_statusbar_location) { + p = DOM.get(ed.id + '_path') || DOM.add(ed.id + '_path_row', 'span', {id : ed.id + '_path'}); + DOM.setHTML(p, ''); + + getParent(function(n) { + var na = n.nodeName.toLowerCase(), u, pi, ti = ''; + + /*if (n.getAttribute('_mce_bogus')) + return; +*/ + // Ignore non element and hidden elements + if (n.nodeType != 1 || n.nodeName === 'BR' || (DOM.hasClass(n, 'mceItemHidden') || DOM.hasClass(n, 'mceItemRemoved'))) + return; + + // Fake name + if (v = DOM.getAttrib(n, 'mce_name')) + na = v; + + // Handle prefix + if (tinymce.isIE && n.scopeName !== 'HTML') + na = n.scopeName + ':' + na; + + // Remove internal prefix + na = na.replace(/mce\:/g, ''); + + // Handle node name + switch (na) { + case 'b': + na = 'strong'; + break; + + case 'i': + na = 'em'; + break; + + case 'img': + if (v = DOM.getAttrib(n, 'src')) + ti += 'src: ' + v + ' '; + + break; + + case 'a': + if (v = DOM.getAttrib(n, 'name')) { + ti += 'name: ' + v + ' '; + na += '#' + v; + } + + if (v = DOM.getAttrib(n, 'href')) + ti += 'href: ' + v + ' '; + + break; + + case 'font': + if (v = DOM.getAttrib(n, 'face')) + ti += 'font: ' + v + ' '; + + if (v = DOM.getAttrib(n, 'size')) + ti += 'size: ' + v + ' '; + + if (v = DOM.getAttrib(n, 'color')) + ti += 'color: ' + v + ' '; + + break; + + case 'span': + if (v = DOM.getAttrib(n, 'style')) + ti += 'style: ' + v + ' '; + + break; + } + + if (v = DOM.getAttrib(n, 'id')) + ti += 'id: ' + v + ' '; + + if (v = n.className) { + v = v.replace(/\b\s*(webkit|mce|Apple-)\w+\s*\b/g, '') + + if (v) { + ti += 'class: ' + v + ' '; + + if (DOM.isBlock(n) || na == 'img' || na == 'span') + na += '.' + v; + } + } + + na = na.replace(/(html:)/g, ''); + na = {name : na, node : n, title : ti}; + t.onResolveName.dispatch(t, na); + ti = na.title; + na = na.name; + + //u = "javascript:tinymce.EditorManager.get('" + ed.id + "').theme._sel('" + (de++) + "');"; + pi = DOM.create('a', {'href' : "javascript:;", onmousedown : "return false;", title : ti, 'class' : 'mcePath_' + (de++)}, na); + + if (p.hasChildNodes()) { + p.insertBefore(DOM.doc.createTextNode(' \u00bb '), p.firstChild); + p.insertBefore(pi, p.firstChild); + } else + p.appendChild(pi); + }, ed.getBody()); + } + }, + + // Commands gets called by execCommand + + _sel : function(v) { + this.editor.execCommand('mceSelectNodeDepth', false, v); + }, + + _mceInsertAnchor : function(ui, v) { + var ed = this.editor; + + ed.windowManager.open({ + url : tinymce.baseURL + '/themes/advanced/anchor.htm', + width : 320 + parseInt(ed.getLang('advanced.anchor_delta_width', 0)), + height : 90 + parseInt(ed.getLang('advanced.anchor_delta_height', 0)), + inline : true + }, { + theme_url : this.url + }); + }, + + _mceCharMap : function() { + var ed = this.editor; + + ed.windowManager.open({ + url : tinymce.baseURL + '/themes/advanced/charmap.htm', + width : 550 + parseInt(ed.getLang('advanced.charmap_delta_width', 0)), + height : 250 + parseInt(ed.getLang('advanced.charmap_delta_height', 0)), + inline : true + }, { + theme_url : this.url + }); + }, + + _mceHelp : function() { + var ed = this.editor; + + ed.windowManager.open({ + url : tinymce.baseURL + '/themes/advanced/about.htm', + width : 480, + height : 380, + inline : true + }, { + theme_url : this.url + }); + }, + + _mceColorPicker : function(u, v) { + var ed = this.editor; + + v = v || {}; + + ed.windowManager.open({ + url : tinymce.baseURL + '/themes/advanced/color_picker.htm', + width : 375 + parseInt(ed.getLang('advanced.colorpicker_delta_width', 0)), + height : 250 + parseInt(ed.getLang('advanced.colorpicker_delta_height', 0)), + close_previous : false, + inline : true + }, { + input_color : v.color, + func : v.func, + theme_url : this.url + }); + }, + + _mceCodeEditor : function(ui, val) { + var ed = this.editor; + + ed.windowManager.open({ + url : tinymce.baseURL + '/themes/advanced/source_editor.htm', + width : parseInt(ed.getParam("theme_advanced_source_editor_width", 720)), + height : parseInt(ed.getParam("theme_advanced_source_editor_height", 580)), + inline : true, + resizable : true, + maximizable : true + }, { + theme_url : this.url + }); + }, + + _mceImage : function(ui, val) { + var ed = this.editor; + + // Internal image object like a flash placeholder + if (ed.dom.getAttrib(ed.selection.getNode(), 'class').indexOf('mceItem') != -1) + return; + + ed.windowManager.open({ + url : tinymce.baseURL + '/themes/advanced/image.htm', + width : 355 + parseInt(ed.getLang('advanced.image_delta_width', 0)), + height : 275 + parseInt(ed.getLang('advanced.image_delta_height', 0)), + inline : true + }, { + theme_url : this.url + }); + }, + + _mceLink : function(ui, val) { + var ed = this.editor; + + ed.windowManager.open({ + url : tinymce.baseURL + '/themes/advanced/link.htm', + width : 310 + parseInt(ed.getLang('advanced.link_delta_width', 0)), + height : 200 + parseInt(ed.getLang('advanced.link_delta_height', 0)), + inline : true + }, { + theme_url : this.url + }); + }, + + _mceNewDocument : function() { + var ed = this.editor; + + ed.windowManager.confirm('advanced.newdocument', function(s) { + if (s) + ed.execCommand('mceSetContent', false, ''); + }); + }, + + _mceForeColor : function() { + var t = this; + + this._mceColorPicker(0, { + color: t.fgColor, + func : function(co) { + t.fgColor = co; + t.editor.execCommand('ForeColor', false, co); + } + }); + }, + + _mceBackColor : function() { + var t = this; + + this._mceColorPicker(0, { + color: t.bgColor, + func : function(co) { + t.bgColor = co; + t.editor.execCommand('HiliteColor', false, co); + } + }); + }, + + _ufirst : function(s) { + return s.substring(0, 1).toUpperCase() + s.substring(1); + } + }); + + tinymce.ThemeManager.add('advanced', tinymce.themes.AdvancedTheme); +}(tinymce)); \ No newline at end of file diff --git a/web/libs/tiny_mce/themes/advanced/image.htm b/web/libs/tiny_mce/themes/advanced/image.htm new file mode 100644 index 0000000..f30d670 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/image.htm @@ -0,0 +1,80 @@ + + + + {#advanced_dlg.image_title} + + + + + + +
+ + +
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + +
 
+ x +
+
+
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/themes/advanced/img/colorpicker.jpg b/web/libs/tiny_mce/themes/advanced/img/colorpicker.jpg new file mode 100644 index 0000000..b4c542d Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/img/colorpicker.jpg differ diff --git a/web/libs/tiny_mce/themes/advanced/img/icons.gif b/web/libs/tiny_mce/themes/advanced/img/icons.gif new file mode 100644 index 0000000..e46de53 Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/img/icons.gif differ diff --git a/web/libs/tiny_mce/themes/advanced/js/about.js b/web/libs/tiny_mce/themes/advanced/js/about.js new file mode 100644 index 0000000..5cee9ed --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/js/about.js @@ -0,0 +1,72 @@ +tinyMCEPopup.requireLangPack(); + +function init() { + var ed, tcont; + + tinyMCEPopup.resizeToInnerSize(); + ed = tinyMCEPopup.editor; + + // Give FF some time + window.setTimeout(insertHelpIFrame, 10); + + tcont = document.getElementById('plugintablecontainer'); + document.getElementById('plugins_tab').style.display = 'none'; + + var html = ""; + html += ''; + html += ''; + html += ''; + html += ''; + html += ''; + html += ''; + html += ''; + html += ''; + html += ''; + + tinymce.each(ed.plugins, function(p, n) { + var info; + + if (!p.getInfo) + return; + + html += ''; + + info = p.getInfo(); + + if (info.infourl != null && info.infourl != '') + html += ''; + else + html += ''; + + if (info.authorurl != null && info.authorurl != '') + html += ''; + else + html += ''; + + html += ''; + html += ''; + + document.getElementById('plugins_tab').style.display = ''; + + }); + + html += ''; + html += '
' + ed.getLang('advanced_dlg.about_plugin') + '' + ed.getLang('advanced_dlg.about_author') + '' + ed.getLang('advanced_dlg.about_version') + '
' + info.longname + '' + info.longname + '' + info.author + '' + info.author + '' + info.version + '
'; + + tcont.innerHTML = html; + + tinyMCEPopup.dom.get('version').innerHTML = tinymce.majorVersion + "." + tinymce.minorVersion; + tinyMCEPopup.dom.get('date').innerHTML = tinymce.releaseDate; +} + +function insertHelpIFrame() { + var html; + + if (tinyMCEPopup.getParam('docs_url')) { + html = ''; + document.getElementById('iframecontainer').innerHTML = html; + document.getElementById('help_tab').style.display = 'block'; + } +} + +tinyMCEPopup.onInit.add(init); diff --git a/web/libs/tiny_mce/themes/advanced/js/anchor.js b/web/libs/tiny_mce/themes/advanced/js/anchor.js new file mode 100644 index 0000000..7fe7810 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/js/anchor.js @@ -0,0 +1,37 @@ +tinyMCEPopup.requireLangPack(); + +var AnchorDialog = { + init : function(ed) { + var action, elm, f = document.forms[0]; + + this.editor = ed; + elm = ed.dom.getParent(ed.selection.getNode(), 'A'); + v = ed.dom.getAttrib(elm, 'name'); + + if (v) { + this.action = 'update'; + f.anchorName.value = v; + } + + f.insert.value = ed.getLang(elm ? 'update' : 'insert'); + }, + + update : function() { + var ed = this.editor, elm, name = document.forms[0].anchorName.value; + + tinyMCEPopup.restoreSelection(); + + if (this.action != 'update') + ed.selection.collapse(1); + + elm = ed.dom.getParent(ed.selection.getNode(), 'A'); + if (elm) + elm.name = name; + else + ed.execCommand('mceInsertContent', 0, ed.dom.createHTML('a', {name : name, 'class' : 'mceItemAnchor'}, '')); + + tinyMCEPopup.close(); + } +}; + +tinyMCEPopup.onInit.add(AnchorDialog.init, AnchorDialog); diff --git a/web/libs/tiny_mce/themes/advanced/js/charmap.js b/web/libs/tiny_mce/themes/advanced/js/charmap.js new file mode 100644 index 0000000..8c5aea1 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/js/charmap.js @@ -0,0 +1,335 @@ +/** + * charmap.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +tinyMCEPopup.requireLangPack(); + +var charmap = [ + [' ', ' ', true, 'no-break space'], + ['&', '&', true, 'ampersand'], + ['"', '"', true, 'quotation mark'], +// finance + ['¢', '¢', true, 'cent sign'], + ['€', '€', true, 'euro sign'], + ['£', '£', true, 'pound sign'], + ['¥', '¥', true, 'yen sign'], +// signs + ['©', '©', true, 'copyright sign'], + ['®', '®', true, 'registered sign'], + ['™', '™', true, 'trade mark sign'], + ['‰', '‰', true, 'per mille sign'], + ['µ', 'µ', true, 'micro sign'], + ['·', '·', true, 'middle dot'], + ['•', '•', true, 'bullet'], + ['…', '…', true, 'three dot leader'], + ['′', '′', true, 'minutes / feet'], + ['″', '″', true, 'seconds / inches'], + ['§', '§', true, 'section sign'], + ['¶', '¶', true, 'paragraph sign'], + ['ß', 'ß', true, 'sharp s / ess-zed'], +// quotations + ['‹', '‹', true, 'single left-pointing angle quotation mark'], + ['›', '›', true, 'single right-pointing angle quotation mark'], + ['«', '«', true, 'left pointing guillemet'], + ['»', '»', true, 'right pointing guillemet'], + ['‘', '‘', true, 'left single quotation mark'], + ['’', '’', true, 'right single quotation mark'], + ['“', '“', true, 'left double quotation mark'], + ['”', '”', true, 'right double quotation mark'], + ['‚', '‚', true, 'single low-9 quotation mark'], + ['„', '„', true, 'double low-9 quotation mark'], + ['<', '<', true, 'less-than sign'], + ['>', '>', true, 'greater-than sign'], + ['≤', '≤', true, 'less-than or equal to'], + ['≥', '≥', true, 'greater-than or equal to'], + ['–', '–', true, 'en dash'], + ['—', '—', true, 'em dash'], + ['¯', '¯', true, 'macron'], + ['‾', '‾', true, 'overline'], + ['¤', '¤', true, 'currency sign'], + ['¦', '¦', true, 'broken bar'], + ['¨', '¨', true, 'diaeresis'], + ['¡', '¡', true, 'inverted exclamation mark'], + ['¿', '¿', true, 'turned question mark'], + ['ˆ', 'ˆ', true, 'circumflex accent'], + ['˜', '˜', true, 'small tilde'], + ['°', '°', true, 'degree sign'], + ['−', '−', true, 'minus sign'], + ['±', '±', true, 'plus-minus sign'], + ['÷', '÷', true, 'division sign'], + ['⁄', '⁄', true, 'fraction slash'], + ['×', '×', true, 'multiplication sign'], + ['¹', '¹', true, 'superscript one'], + ['²', '²', true, 'superscript two'], + ['³', '³', true, 'superscript three'], + ['¼', '¼', true, 'fraction one quarter'], + ['½', '½', true, 'fraction one half'], + ['¾', '¾', true, 'fraction three quarters'], +// math / logical + ['ƒ', 'ƒ', true, 'function / florin'], + ['∫', '∫', true, 'integral'], + ['∑', '∑', true, 'n-ary sumation'], + ['∞', '∞', true, 'infinity'], + ['√', '√', true, 'square root'], + ['∼', '∼', false,'similar to'], + ['≅', '≅', false,'approximately equal to'], + ['≈', '≈', true, 'almost equal to'], + ['≠', '≠', true, 'not equal to'], + ['≡', '≡', true, 'identical to'], + ['∈', '∈', false,'element of'], + ['∉', '∉', false,'not an element of'], + ['∋', '∋', false,'contains as member'], + ['∏', '∏', true, 'n-ary product'], + ['∧', '∧', false,'logical and'], + ['∨', '∨', false,'logical or'], + ['¬', '¬', true, 'not sign'], + ['∩', '∩', true, 'intersection'], + ['∪', '∪', false,'union'], + ['∂', '∂', true, 'partial differential'], + ['∀', '∀', false,'for all'], + ['∃', '∃', false,'there exists'], + ['∅', '∅', false,'diameter'], + ['∇', '∇', false,'backward difference'], + ['∗', '∗', false,'asterisk operator'], + ['∝', '∝', false,'proportional to'], + ['∠', '∠', false,'angle'], +// undefined + ['´', '´', true, 'acute accent'], + ['¸', '¸', true, 'cedilla'], + ['ª', 'ª', true, 'feminine ordinal indicator'], + ['º', 'º', true, 'masculine ordinal indicator'], + ['†', '†', true, 'dagger'], + ['‡', '‡', true, 'double dagger'], +// alphabetical special chars + ['À', 'À', true, 'A - grave'], + ['Á', 'Á', true, 'A - acute'], + ['Â', 'Â', true, 'A - circumflex'], + ['Ã', 'Ã', true, 'A - tilde'], + ['Ä', 'Ä', true, 'A - diaeresis'], + ['Å', 'Å', true, 'A - ring above'], + ['Æ', 'Æ', true, 'ligature AE'], + ['Ç', 'Ç', true, 'C - cedilla'], + ['È', 'È', true, 'E - grave'], + ['É', 'É', true, 'E - acute'], + ['Ê', 'Ê', true, 'E - circumflex'], + ['Ë', 'Ë', true, 'E - diaeresis'], + ['Ì', 'Ì', true, 'I - grave'], + ['Í', 'Í', true, 'I - acute'], + ['Î', 'Î', true, 'I - circumflex'], + ['Ï', 'Ï', true, 'I - diaeresis'], + ['Ð', 'Ð', true, 'ETH'], + ['Ñ', 'Ñ', true, 'N - tilde'], + ['Ò', 'Ò', true, 'O - grave'], + ['Ó', 'Ó', true, 'O - acute'], + ['Ô', 'Ô', true, 'O - circumflex'], + ['Õ', 'Õ', true, 'O - tilde'], + ['Ö', 'Ö', true, 'O - diaeresis'], + ['Ø', 'Ø', true, 'O - slash'], + ['Œ', 'Œ', true, 'ligature OE'], + ['Š', 'Š', true, 'S - caron'], + ['Ù', 'Ù', true, 'U - grave'], + ['Ú', 'Ú', true, 'U - acute'], + ['Û', 'Û', true, 'U - circumflex'], + ['Ü', 'Ü', true, 'U - diaeresis'], + ['Ý', 'Ý', true, 'Y - acute'], + ['Ÿ', 'Ÿ', true, 'Y - diaeresis'], + ['Þ', 'Þ', true, 'THORN'], + ['à', 'à', true, 'a - grave'], + ['á', 'á', true, 'a - acute'], + ['â', 'â', true, 'a - circumflex'], + ['ã', 'ã', true, 'a - tilde'], + ['ä', 'ä', true, 'a - diaeresis'], + ['å', 'å', true, 'a - ring above'], + ['æ', 'æ', true, 'ligature ae'], + ['ç', 'ç', true, 'c - cedilla'], + ['è', 'è', true, 'e - grave'], + ['é', 'é', true, 'e - acute'], + ['ê', 'ê', true, 'e - circumflex'], + ['ë', 'ë', true, 'e - diaeresis'], + ['ì', 'ì', true, 'i - grave'], + ['í', 'í', true, 'i - acute'], + ['î', 'î', true, 'i - circumflex'], + ['ï', 'ï', true, 'i - diaeresis'], + ['ð', 'ð', true, 'eth'], + ['ñ', 'ñ', true, 'n - tilde'], + ['ò', 'ò', true, 'o - grave'], + ['ó', 'ó', true, 'o - acute'], + ['ô', 'ô', true, 'o - circumflex'], + ['õ', 'õ', true, 'o - tilde'], + ['ö', 'ö', true, 'o - diaeresis'], + ['ø', 'ø', true, 'o slash'], + ['œ', 'œ', true, 'ligature oe'], + ['š', 'š', true, 's - caron'], + ['ù', 'ù', true, 'u - grave'], + ['ú', 'ú', true, 'u - acute'], + ['û', 'û', true, 'u - circumflex'], + ['ü', 'ü', true, 'u - diaeresis'], + ['ý', 'ý', true, 'y - acute'], + ['þ', 'þ', true, 'thorn'], + ['ÿ', 'ÿ', true, 'y - diaeresis'], + ['Α', 'Α', true, 'Alpha'], + ['Β', 'Β', true, 'Beta'], + ['Γ', 'Γ', true, 'Gamma'], + ['Δ', 'Δ', true, 'Delta'], + ['Ε', 'Ε', true, 'Epsilon'], + ['Ζ', 'Ζ', true, 'Zeta'], + ['Η', 'Η', true, 'Eta'], + ['Θ', 'Θ', true, 'Theta'], + ['Ι', 'Ι', true, 'Iota'], + ['Κ', 'Κ', true, 'Kappa'], + ['Λ', 'Λ', true, 'Lambda'], + ['Μ', 'Μ', true, 'Mu'], + ['Ν', 'Ν', true, 'Nu'], + ['Ξ', 'Ξ', true, 'Xi'], + ['Ο', 'Ο', true, 'Omicron'], + ['Π', 'Π', true, 'Pi'], + ['Ρ', 'Ρ', true, 'Rho'], + ['Σ', 'Σ', true, 'Sigma'], + ['Τ', 'Τ', true, 'Tau'], + ['Υ', 'Υ', true, 'Upsilon'], + ['Φ', 'Φ', true, 'Phi'], + ['Χ', 'Χ', true, 'Chi'], + ['Ψ', 'Ψ', true, 'Psi'], + ['Ω', 'Ω', true, 'Omega'], + ['α', 'α', true, 'alpha'], + ['β', 'β', true, 'beta'], + ['γ', 'γ', true, 'gamma'], + ['δ', 'δ', true, 'delta'], + ['ε', 'ε', true, 'epsilon'], + ['ζ', 'ζ', true, 'zeta'], + ['η', 'η', true, 'eta'], + ['θ', 'θ', true, 'theta'], + ['ι', 'ι', true, 'iota'], + ['κ', 'κ', true, 'kappa'], + ['λ', 'λ', true, 'lambda'], + ['μ', 'μ', true, 'mu'], + ['ν', 'ν', true, 'nu'], + ['ξ', 'ξ', true, 'xi'], + ['ο', 'ο', true, 'omicron'], + ['π', 'π', true, 'pi'], + ['ρ', 'ρ', true, 'rho'], + ['ς', 'ς', true, 'final sigma'], + ['σ', 'σ', true, 'sigma'], + ['τ', 'τ', true, 'tau'], + ['υ', 'υ', true, 'upsilon'], + ['φ', 'φ', true, 'phi'], + ['χ', 'χ', true, 'chi'], + ['ψ', 'ψ', true, 'psi'], + ['ω', 'ω', true, 'omega'], +// symbols + ['ℵ', 'ℵ', false,'alef symbol'], + ['ϖ', 'ϖ', false,'pi symbol'], + ['ℜ', 'ℜ', false,'real part symbol'], + ['ϑ','ϑ', false,'theta symbol'], + ['ϒ', 'ϒ', false,'upsilon - hook symbol'], + ['℘', '℘', false,'Weierstrass p'], + ['ℑ', 'ℑ', false,'imaginary part'], +// arrows + ['←', '←', true, 'leftwards arrow'], + ['↑', '↑', true, 'upwards arrow'], + ['→', '→', true, 'rightwards arrow'], + ['↓', '↓', true, 'downwards arrow'], + ['↔', '↔', true, 'left right arrow'], + ['↵', '↵', false,'carriage return'], + ['⇐', '⇐', false,'leftwards double arrow'], + ['⇑', '⇑', false,'upwards double arrow'], + ['⇒', '⇒', false,'rightwards double arrow'], + ['⇓', '⇓', false,'downwards double arrow'], + ['⇔', '⇔', false,'left right double arrow'], + ['∴', '∴', false,'therefore'], + ['⊂', '⊂', false,'subset of'], + ['⊃', '⊃', false,'superset of'], + ['⊄', '⊄', false,'not a subset of'], + ['⊆', '⊆', false,'subset of or equal to'], + ['⊇', '⊇', false,'superset of or equal to'], + ['⊕', '⊕', false,'circled plus'], + ['⊗', '⊗', false,'circled times'], + ['⊥', '⊥', false,'perpendicular'], + ['⋅', '⋅', false,'dot operator'], + ['⌈', '⌈', false,'left ceiling'], + ['⌉', '⌉', false,'right ceiling'], + ['⌊', '⌊', false,'left floor'], + ['⌋', '⌋', false,'right floor'], + ['⟨', '〈', false,'left-pointing angle bracket'], + ['⟩', '〉', false,'right-pointing angle bracket'], + ['◊', '◊', true,'lozenge'], + ['♠', '♠', false,'black spade suit'], + ['♣', '♣', true, 'black club suit'], + ['♥', '♥', true, 'black heart suit'], + ['♦', '♦', true, 'black diamond suit'], + [' ', ' ', false,'en space'], + [' ', ' ', false,'em space'], + [' ', ' ', false,'thin space'], + ['‌', '‌', false,'zero width non-joiner'], + ['‍', '‍', false,'zero width joiner'], + ['‎', '‎', false,'left-to-right mark'], + ['‏', '‏', false,'right-to-left mark'], + ['­', '­', false,'soft hyphen'] +]; + +tinyMCEPopup.onInit.add(function() { + tinyMCEPopup.dom.setHTML('charmapView', renderCharMapHTML()); +}); + +function renderCharMapHTML() { + var charsPerRow = 20, tdWidth=20, tdHeight=20, i; + var html = ''; + var cols=-1; + + for (i=0; i' + + '' + + charmap[i][1] + + ''; + if ((cols+1) % charsPerRow == 0) + html += ''; + } + } + + if (cols % charsPerRow > 0) { + var padd = charsPerRow - (cols % charsPerRow); + for (var i=0; i '; + } + + html += '
'; + + return html; +} + +function insertChar(chr) { + tinyMCEPopup.execCommand('mceInsertContent', false, '&#' + chr + ';'); + + // Refocus in window + if (tinyMCEPopup.isWindow) + window.focus(); + + tinyMCEPopup.editor.focus(); + tinyMCEPopup.close(); +} + +function previewChar(codeA, codeB, codeN) { + var elmA = document.getElementById('codeA'); + var elmB = document.getElementById('codeB'); + var elmV = document.getElementById('codeV'); + var elmN = document.getElementById('codeN'); + + if (codeA=='#160;') { + elmV.innerHTML = '__'; + } else { + elmV.innerHTML = '&' + codeA; + } + + elmB.innerHTML = '&' + codeA; + elmA.innerHTML = '&' + codeB; + elmN.innerHTML = codeN; +} diff --git a/web/libs/tiny_mce/themes/advanced/js/color_picker.js b/web/libs/tiny_mce/themes/advanced/js/color_picker.js new file mode 100644 index 0000000..fd9700f --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/js/color_picker.js @@ -0,0 +1,253 @@ +tinyMCEPopup.requireLangPack(); + +var detail = 50, strhex = "0123456789abcdef", i, isMouseDown = false, isMouseOver = false; + +var colors = [ + "#000000","#000033","#000066","#000099","#0000cc","#0000ff","#330000","#330033", + "#330066","#330099","#3300cc","#3300ff","#660000","#660033","#660066","#660099", + "#6600cc","#6600ff","#990000","#990033","#990066","#990099","#9900cc","#9900ff", + "#cc0000","#cc0033","#cc0066","#cc0099","#cc00cc","#cc00ff","#ff0000","#ff0033", + "#ff0066","#ff0099","#ff00cc","#ff00ff","#003300","#003333","#003366","#003399", + "#0033cc","#0033ff","#333300","#333333","#333366","#333399","#3333cc","#3333ff", + "#663300","#663333","#663366","#663399","#6633cc","#6633ff","#993300","#993333", + "#993366","#993399","#9933cc","#9933ff","#cc3300","#cc3333","#cc3366","#cc3399", + "#cc33cc","#cc33ff","#ff3300","#ff3333","#ff3366","#ff3399","#ff33cc","#ff33ff", + "#006600","#006633","#006666","#006699","#0066cc","#0066ff","#336600","#336633", + "#336666","#336699","#3366cc","#3366ff","#666600","#666633","#666666","#666699", + "#6666cc","#6666ff","#996600","#996633","#996666","#996699","#9966cc","#9966ff", + "#cc6600","#cc6633","#cc6666","#cc6699","#cc66cc","#cc66ff","#ff6600","#ff6633", + "#ff6666","#ff6699","#ff66cc","#ff66ff","#009900","#009933","#009966","#009999", + "#0099cc","#0099ff","#339900","#339933","#339966","#339999","#3399cc","#3399ff", + "#669900","#669933","#669966","#669999","#6699cc","#6699ff","#999900","#999933", + "#999966","#999999","#9999cc","#9999ff","#cc9900","#cc9933","#cc9966","#cc9999", + "#cc99cc","#cc99ff","#ff9900","#ff9933","#ff9966","#ff9999","#ff99cc","#ff99ff", + "#00cc00","#00cc33","#00cc66","#00cc99","#00cccc","#00ccff","#33cc00","#33cc33", + "#33cc66","#33cc99","#33cccc","#33ccff","#66cc00","#66cc33","#66cc66","#66cc99", + "#66cccc","#66ccff","#99cc00","#99cc33","#99cc66","#99cc99","#99cccc","#99ccff", + "#cccc00","#cccc33","#cccc66","#cccc99","#cccccc","#ccccff","#ffcc00","#ffcc33", + "#ffcc66","#ffcc99","#ffcccc","#ffccff","#00ff00","#00ff33","#00ff66","#00ff99", + "#00ffcc","#00ffff","#33ff00","#33ff33","#33ff66","#33ff99","#33ffcc","#33ffff", + "#66ff00","#66ff33","#66ff66","#66ff99","#66ffcc","#66ffff","#99ff00","#99ff33", + "#99ff66","#99ff99","#99ffcc","#99ffff","#ccff00","#ccff33","#ccff66","#ccff99", + "#ccffcc","#ccffff","#ffff00","#ffff33","#ffff66","#ffff99","#ffffcc","#ffffff" +]; + +var named = { + '#F0F8FF':'AliceBlue','#FAEBD7':'AntiqueWhite','#00FFFF':'Aqua','#7FFFD4':'Aquamarine','#F0FFFF':'Azure','#F5F5DC':'Beige', + '#FFE4C4':'Bisque','#000000':'Black','#FFEBCD':'BlanchedAlmond','#0000FF':'Blue','#8A2BE2':'BlueViolet','#A52A2A':'Brown', + '#DEB887':'BurlyWood','#5F9EA0':'CadetBlue','#7FFF00':'Chartreuse','#D2691E':'Chocolate','#FF7F50':'Coral','#6495ED':'CornflowerBlue', + '#FFF8DC':'Cornsilk','#DC143C':'Crimson','#00FFFF':'Cyan','#00008B':'DarkBlue','#008B8B':'DarkCyan','#B8860B':'DarkGoldenRod', + '#A9A9A9':'DarkGray','#A9A9A9':'DarkGrey','#006400':'DarkGreen','#BDB76B':'DarkKhaki','#8B008B':'DarkMagenta','#556B2F':'DarkOliveGreen', + '#FF8C00':'Darkorange','#9932CC':'DarkOrchid','#8B0000':'DarkRed','#E9967A':'DarkSalmon','#8FBC8F':'DarkSeaGreen','#483D8B':'DarkSlateBlue', + '#2F4F4F':'DarkSlateGray','#2F4F4F':'DarkSlateGrey','#00CED1':'DarkTurquoise','#9400D3':'DarkViolet','#FF1493':'DeepPink','#00BFFF':'DeepSkyBlue', + '#696969':'DimGray','#696969':'DimGrey','#1E90FF':'DodgerBlue','#B22222':'FireBrick','#FFFAF0':'FloralWhite','#228B22':'ForestGreen', + '#FF00FF':'Fuchsia','#DCDCDC':'Gainsboro','#F8F8FF':'GhostWhite','#FFD700':'Gold','#DAA520':'GoldenRod','#808080':'Gray','#808080':'Grey', + '#008000':'Green','#ADFF2F':'GreenYellow','#F0FFF0':'HoneyDew','#FF69B4':'HotPink','#CD5C5C':'IndianRed','#4B0082':'Indigo','#FFFFF0':'Ivory', + '#F0E68C':'Khaki','#E6E6FA':'Lavender','#FFF0F5':'LavenderBlush','#7CFC00':'LawnGreen','#FFFACD':'LemonChiffon','#ADD8E6':'LightBlue', + '#F08080':'LightCoral','#E0FFFF':'LightCyan','#FAFAD2':'LightGoldenRodYellow','#D3D3D3':'LightGray','#D3D3D3':'LightGrey','#90EE90':'LightGreen', + '#FFB6C1':'LightPink','#FFA07A':'LightSalmon','#20B2AA':'LightSeaGreen','#87CEFA':'LightSkyBlue','#778899':'LightSlateGray','#778899':'LightSlateGrey', + '#B0C4DE':'LightSteelBlue','#FFFFE0':'LightYellow','#00FF00':'Lime','#32CD32':'LimeGreen','#FAF0E6':'Linen','#FF00FF':'Magenta','#800000':'Maroon', + '#66CDAA':'MediumAquaMarine','#0000CD':'MediumBlue','#BA55D3':'MediumOrchid','#9370D8':'MediumPurple','#3CB371':'MediumSeaGreen','#7B68EE':'MediumSlateBlue', + '#00FA9A':'MediumSpringGreen','#48D1CC':'MediumTurquoise','#C71585':'MediumVioletRed','#191970':'MidnightBlue','#F5FFFA':'MintCream','#FFE4E1':'MistyRose','#FFE4B5':'Moccasin', + '#FFDEAD':'NavajoWhite','#000080':'Navy','#FDF5E6':'OldLace','#808000':'Olive','#6B8E23':'OliveDrab','#FFA500':'Orange','#FF4500':'OrangeRed','#DA70D6':'Orchid', + '#EEE8AA':'PaleGoldenRod','#98FB98':'PaleGreen','#AFEEEE':'PaleTurquoise','#D87093':'PaleVioletRed','#FFEFD5':'PapayaWhip','#FFDAB9':'PeachPuff', + '#CD853F':'Peru','#FFC0CB':'Pink','#DDA0DD':'Plum','#B0E0E6':'PowderBlue','#800080':'Purple','#FF0000':'Red','#BC8F8F':'RosyBrown','#4169E1':'RoyalBlue', + '#8B4513':'SaddleBrown','#FA8072':'Salmon','#F4A460':'SandyBrown','#2E8B57':'SeaGreen','#FFF5EE':'SeaShell','#A0522D':'Sienna','#C0C0C0':'Silver', + '#87CEEB':'SkyBlue','#6A5ACD':'SlateBlue','#708090':'SlateGray','#708090':'SlateGrey','#FFFAFA':'Snow','#00FF7F':'SpringGreen', + '#4682B4':'SteelBlue','#D2B48C':'Tan','#008080':'Teal','#D8BFD8':'Thistle','#FF6347':'Tomato','#40E0D0':'Turquoise','#EE82EE':'Violet', + '#F5DEB3':'Wheat','#FFFFFF':'White','#F5F5F5':'WhiteSmoke','#FFFF00':'Yellow','#9ACD32':'YellowGreen' +}; + +function init() { + var inputColor = convertRGBToHex(tinyMCEPopup.getWindowArg('input_color')); + + tinyMCEPopup.resizeToInnerSize(); + + generatePicker(); + + if (inputColor) { + changeFinalColor(inputColor); + + col = convertHexToRGB(inputColor); + + if (col) + updateLight(col.r, col.g, col.b); + } +} + +function insertAction() { + var color = document.getElementById("color").value, f = tinyMCEPopup.getWindowArg('func'); + + tinyMCEPopup.restoreSelection(); + + if (f) + f(color); + + tinyMCEPopup.close(); +} + +function showColor(color, name) { + if (name) + document.getElementById("colorname").innerHTML = name; + + document.getElementById("preview").style.backgroundColor = color; + document.getElementById("color").value = color.toLowerCase(); +} + +function convertRGBToHex(col) { + var re = new RegExp("rgb\\s*\\(\\s*([0-9]+).*,\\s*([0-9]+).*,\\s*([0-9]+).*\\)", "gi"); + + if (!col) + return col; + + var rgb = col.replace(re, "$1,$2,$3").split(','); + if (rgb.length == 3) { + r = parseInt(rgb[0]).toString(16); + g = parseInt(rgb[1]).toString(16); + b = parseInt(rgb[2]).toString(16); + + r = r.length == 1 ? '0' + r : r; + g = g.length == 1 ? '0' + g : g; + b = b.length == 1 ? '0' + b : b; + + return "#" + r + g + b; + } + + return col; +} + +function convertHexToRGB(col) { + if (col.indexOf('#') != -1) { + col = col.replace(new RegExp('[^0-9A-F]', 'gi'), ''); + + r = parseInt(col.substring(0, 2), 16); + g = parseInt(col.substring(2, 4), 16); + b = parseInt(col.substring(4, 6), 16); + + return {r : r, g : g, b : b}; + } + + return null; +} + +function generatePicker() { + var el = document.getElementById('light'), h = '', i; + + for (i = 0; i < detail; i++){ + h += '
'; + } + + el.innerHTML = h; +} + +function generateWebColors() { + var el = document.getElementById('webcolors'), h = '', i; + + if (el.className == 'generated') + return; + + h += '' + + ''; + + for (i=0; i' + + '' + + ''; + if ((i+1) % 18 == 0) + h += ''; + } + + h += '
'; + + el.innerHTML = h; + el.className = 'generated'; +} + +function generateNamedColors() { + var el = document.getElementById('namedcolors'), h = '', n, v, i = 0; + + if (el.className == 'generated') + return; + + for (n in named) { + v = named[n]; + h += '' + } + + el.innerHTML = h; + el.className = 'generated'; +} + +function dechex(n) { + return strhex.charAt(Math.floor(n / 16)) + strhex.charAt(n % 16); +} + +function computeColor(e) { + var x, y, partWidth, partDetail, imHeight, r, g, b, coef, i, finalCoef, finalR, finalG, finalB; + + x = e.offsetX ? e.offsetX : (e.target ? e.clientX - e.target.x : 0); + y = e.offsetY ? e.offsetY : (e.target ? e.clientY - e.target.y : 0); + + partWidth = document.getElementById('colors').width / 6; + partDetail = detail / 2; + imHeight = document.getElementById('colors').height; + + r = (x >= 0)*(x < partWidth)*255 + (x >= partWidth)*(x < 2*partWidth)*(2*255 - x * 255 / partWidth) + (x >= 4*partWidth)*(x < 5*partWidth)*(-4*255 + x * 255 / partWidth) + (x >= 5*partWidth)*(x < 6*partWidth)*255; + g = (x >= 0)*(x < partWidth)*(x * 255 / partWidth) + (x >= partWidth)*(x < 3*partWidth)*255 + (x >= 3*partWidth)*(x < 4*partWidth)*(4*255 - x * 255 / partWidth); + b = (x >= 2*partWidth)*(x < 3*partWidth)*(-2*255 + x * 255 / partWidth) + (x >= 3*partWidth)*(x < 5*partWidth)*255 + (x >= 5*partWidth)*(x < 6*partWidth)*(6*255 - x * 255 / partWidth); + + coef = (imHeight - y) / imHeight; + r = 128 + (r - 128) * coef; + g = 128 + (g - 128) * coef; + b = 128 + (b - 128) * coef; + + changeFinalColor('#' + dechex(r) + dechex(g) + dechex(b)); + updateLight(r, g, b); +} + +function updateLight(r, g, b) { + var i, partDetail = detail / 2, finalCoef, finalR, finalG, finalB, color; + + for (i=0; i=0) && (i'); + }, + + init : function() { + var f = document.forms[0], ed = tinyMCEPopup.editor; + + // Setup browse button + document.getElementById('srcbrowsercontainer').innerHTML = getBrowserHTML('srcbrowser','src','image','theme_advanced_image'); + if (isVisible('srcbrowser')) + document.getElementById('src').style.width = '180px'; + + e = ed.selection.getNode(); + + this.fillFileList('image_list', 'tinyMCEImageList'); + + if (e.nodeName == 'IMG') { + f.src.value = ed.dom.getAttrib(e, 'src'); + f.alt.value = ed.dom.getAttrib(e, 'alt'); + f.border.value = this.getAttrib(e, 'border'); + f.vspace.value = this.getAttrib(e, 'vspace'); + f.hspace.value = this.getAttrib(e, 'hspace'); + f.width.value = ed.dom.getAttrib(e, 'width'); + f.height.value = ed.dom.getAttrib(e, 'height'); + f.insert.value = ed.getLang('update'); + this.styleVal = ed.dom.getAttrib(e, 'style'); + selectByValue(f, 'image_list', f.src.value); + selectByValue(f, 'align', this.getAttrib(e, 'align')); + this.updateStyle(); + } + }, + + fillFileList : function(id, l) { + var dom = tinyMCEPopup.dom, lst = dom.get(id), v, cl; + + l = window[l]; + + if (l && l.length > 0) { + lst.options[lst.options.length] = new Option('', ''); + + tinymce.each(l, function(o) { + lst.options[lst.options.length] = new Option(o[0], o[1]); + }); + } else + dom.remove(dom.getParent(id, 'tr')); + }, + + update : function() { + var f = document.forms[0], nl = f.elements, ed = tinyMCEPopup.editor, args = {}, el; + + tinyMCEPopup.restoreSelection(); + + if (f.src.value === '') { + if (ed.selection.getNode().nodeName == 'IMG') { + ed.dom.remove(ed.selection.getNode()); + ed.execCommand('mceRepaint'); + } + + tinyMCEPopup.close(); + return; + } + + if (!ed.settings.inline_styles) { + args = tinymce.extend(args, { + vspace : nl.vspace.value, + hspace : nl.hspace.value, + border : nl.border.value, + align : getSelectValue(f, 'align') + }); + } else + args.style = this.styleVal; + + tinymce.extend(args, { + src : f.src.value, + alt : f.alt.value, + width : f.width.value, + height : f.height.value + }); + + el = ed.selection.getNode(); + + if (el && el.nodeName == 'IMG') { + ed.dom.setAttribs(el, args); + } else { + ed.execCommand('mceInsertContent', false, '', {skip_undo : 1}); + ed.dom.setAttribs('__mce_tmp', args); + ed.dom.setAttrib('__mce_tmp', 'id', ''); + ed.undoManager.add(); + } + + tinyMCEPopup.close(); + }, + + updateStyle : function() { + var dom = tinyMCEPopup.dom, st, v, f = document.forms[0]; + + if (tinyMCEPopup.editor.settings.inline_styles) { + st = tinyMCEPopup.dom.parseStyle(this.styleVal); + + // Handle align + v = getSelectValue(f, 'align'); + if (v) { + if (v == 'left' || v == 'right') { + st['float'] = v; + delete st['vertical-align']; + } else { + st['vertical-align'] = v; + delete st['float']; + } + } else { + delete st['float']; + delete st['vertical-align']; + } + + // Handle border + v = f.border.value; + if (v || v == '0') { + if (v == '0') + st['border'] = '0'; + else + st['border'] = v + 'px solid black'; + } else + delete st['border']; + + // Handle hspace + v = f.hspace.value; + if (v) { + delete st['margin']; + st['margin-left'] = v + 'px'; + st['margin-right'] = v + 'px'; + } else { + delete st['margin-left']; + delete st['margin-right']; + } + + // Handle vspace + v = f.vspace.value; + if (v) { + delete st['margin']; + st['margin-top'] = v + 'px'; + st['margin-bottom'] = v + 'px'; + } else { + delete st['margin-top']; + delete st['margin-bottom']; + } + + // Merge + st = tinyMCEPopup.dom.parseStyle(dom.serializeStyle(st), 'img'); + this.styleVal = dom.serializeStyle(st, 'img'); + } + }, + + getAttrib : function(e, at) { + var ed = tinyMCEPopup.editor, dom = ed.dom, v, v2; + + if (ed.settings.inline_styles) { + switch (at) { + case 'align': + if (v = dom.getStyle(e, 'float')) + return v; + + if (v = dom.getStyle(e, 'vertical-align')) + return v; + + break; + + case 'hspace': + v = dom.getStyle(e, 'margin-left') + v2 = dom.getStyle(e, 'margin-right'); + if (v && v == v2) + return parseInt(v.replace(/[^0-9]/g, '')); + + break; + + case 'vspace': + v = dom.getStyle(e, 'margin-top') + v2 = dom.getStyle(e, 'margin-bottom'); + if (v && v == v2) + return parseInt(v.replace(/[^0-9]/g, '')); + + break; + + case 'border': + v = 0; + + tinymce.each(['top', 'right', 'bottom', 'left'], function(sv) { + sv = dom.getStyle(e, 'border-' + sv + '-width'); + + // False or not the same as prev + if (!sv || (sv != v && v !== 0)) { + v = 0; + return false; + } + + if (sv) + v = sv; + }); + + if (v) + return parseInt(v.replace(/[^0-9]/g, '')); + + break; + } + } + + if (v = dom.getAttrib(e, at)) + return v; + + return ''; + }, + + resetImageData : function() { + var f = document.forms[0]; + + f.width.value = f.height.value = ""; + }, + + updateImageData : function() { + var f = document.forms[0], t = ImageDialog; + + if (f.width.value == "") + f.width.value = t.preloadImg.width; + + if (f.height.value == "") + f.height.value = t.preloadImg.height; + }, + + getImageData : function() { + var f = document.forms[0]; + + this.preloadImg = new Image(); + this.preloadImg.onload = this.updateImageData; + this.preloadImg.onerror = this.resetImageData; + this.preloadImg.src = tinyMCEPopup.editor.documentBaseURI.toAbsolute(f.src.value); + } +}; + +ImageDialog.preInit(); +tinyMCEPopup.onInit.add(ImageDialog.init, ImageDialog); diff --git a/web/libs/tiny_mce/themes/advanced/js/link.js b/web/libs/tiny_mce/themes/advanced/js/link.js new file mode 100644 index 0000000..f67a5bc --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/js/link.js @@ -0,0 +1,156 @@ +tinyMCEPopup.requireLangPack(); + +var LinkDialog = { + preInit : function() { + var url; + + if (url = tinyMCEPopup.getParam("external_link_list_url")) + document.write(''); + }, + + init : function() { + var f = document.forms[0], ed = tinyMCEPopup.editor; + + // Setup browse button + document.getElementById('hrefbrowsercontainer').innerHTML = getBrowserHTML('hrefbrowser', 'href', 'file', 'theme_advanced_link'); + if (isVisible('hrefbrowser')) + document.getElementById('href').style.width = '180px'; + + this.fillClassList('class_list'); + this.fillFileList('link_list', 'tinyMCELinkList'); + this.fillTargetList('target_list'); + + if (e = ed.dom.getParent(ed.selection.getNode(), 'A')) { + f.href.value = ed.dom.getAttrib(e, 'href'); + f.linktitle.value = ed.dom.getAttrib(e, 'title'); + f.insert.value = ed.getLang('update'); + selectByValue(f, 'link_list', f.href.value); + selectByValue(f, 'target_list', ed.dom.getAttrib(e, 'target')); + selectByValue(f, 'class_list', ed.dom.getAttrib(e, 'class')); + } + }, + + update : function() { + var f = document.forms[0], ed = tinyMCEPopup.editor, e, b; + + tinyMCEPopup.restoreSelection(); + e = ed.dom.getParent(ed.selection.getNode(), 'A'); + + // Remove element if there is no href + if (!f.href.value) { + if (e) { + tinyMCEPopup.execCommand("mceBeginUndoLevel"); + b = ed.selection.getBookmark(); + ed.dom.remove(e, 1); + ed.selection.moveToBookmark(b); + tinyMCEPopup.execCommand("mceEndUndoLevel"); + tinyMCEPopup.close(); + return; + } + } + + tinyMCEPopup.execCommand("mceBeginUndoLevel"); + + // Create new anchor elements + if (e == null) { + ed.getDoc().execCommand("unlink", false, null); + tinyMCEPopup.execCommand("CreateLink", false, "#mce_temp_url#", {skip_undo : 1}); + + tinymce.each(ed.dom.select("a"), function(n) { + if (ed.dom.getAttrib(n, 'href') == '#mce_temp_url#') { + e = n; + + ed.dom.setAttribs(e, { + href : f.href.value, + title : f.linktitle.value, + target : f.target_list ? getSelectValue(f, "target_list") : null, + 'class' : f.class_list ? getSelectValue(f, "class_list") : null + }); + } + }); + } else { + ed.dom.setAttribs(e, { + href : f.href.value, + title : f.linktitle.value, + target : f.target_list ? getSelectValue(f, "target_list") : null, + 'class' : f.class_list ? getSelectValue(f, "class_list") : null + }); + } + + // Don't move caret if selection was image + if (e.childNodes.length != 1 || e.firstChild.nodeName != 'IMG') { + ed.focus(); + ed.selection.select(e); + ed.selection.collapse(0); + tinyMCEPopup.storeSelection(); + } + + tinyMCEPopup.execCommand("mceEndUndoLevel"); + tinyMCEPopup.close(); + }, + + checkPrefix : function(n) { + if (n.value && Validator.isEmail(n) && !/^\s*mailto:/i.test(n.value) && confirm(tinyMCEPopup.getLang('advanced_dlg.link_is_email'))) + n.value = 'mailto:' + n.value; + + if (/^\s*www\./i.test(n.value) && confirm(tinyMCEPopup.getLang('advanced_dlg.link_is_external'))) + n.value = 'http://' + n.value; + }, + + fillFileList : function(id, l) { + var dom = tinyMCEPopup.dom, lst = dom.get(id), v, cl; + + l = window[l]; + + if (l && l.length > 0) { + lst.options[lst.options.length] = new Option('', ''); + + tinymce.each(l, function(o) { + lst.options[lst.options.length] = new Option(o[0], o[1]); + }); + } else + dom.remove(dom.getParent(id, 'tr')); + }, + + fillClassList : function(id) { + var dom = tinyMCEPopup.dom, lst = dom.get(id), v, cl; + + if (v = tinyMCEPopup.getParam('theme_advanced_styles')) { + cl = []; + + tinymce.each(v.split(';'), function(v) { + var p = v.split('='); + + cl.push({'title' : p[0], 'class' : p[1]}); + }); + } else + cl = tinyMCEPopup.editor.dom.getClasses(); + + if (cl.length > 0) { + lst.options[lst.options.length] = new Option(tinyMCEPopup.getLang('not_set'), ''); + + tinymce.each(cl, function(o) { + lst.options[lst.options.length] = new Option(o.title || o['class'], o['class']); + }); + } else + dom.remove(dom.getParent(id, 'tr')); + }, + + fillTargetList : function(id) { + var dom = tinyMCEPopup.dom, lst = dom.get(id), v; + + lst.options[lst.options.length] = new Option(tinyMCEPopup.getLang('not_set'), ''); + lst.options[lst.options.length] = new Option(tinyMCEPopup.getLang('advanced_dlg.link_target_same'), '_self'); + lst.options[lst.options.length] = new Option(tinyMCEPopup.getLang('advanced_dlg.link_target_blank'), '_blank'); + + if (v = tinyMCEPopup.getParam('theme_advanced_link_targets')) { + tinymce.each(v.split(','), function(v) { + v = v.split('='); + lst.options[lst.options.length] = new Option(v[0], v[1]); + }); + } + } +}; + +LinkDialog.preInit(); +tinyMCEPopup.onInit.add(LinkDialog.init, LinkDialog); diff --git a/web/libs/tiny_mce/themes/advanced/js/source_editor.js b/web/libs/tiny_mce/themes/advanced/js/source_editor.js new file mode 100644 index 0000000..2793286 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/js/source_editor.js @@ -0,0 +1,62 @@ +tinyMCEPopup.requireLangPack(); +tinyMCEPopup.onInit.add(onLoadInit); + +function saveContent() { + tinyMCEPopup.editor.setContent(document.getElementById('htmlSource').value, {source_view : true}); + tinyMCEPopup.close(); +} + +function onLoadInit() { + tinyMCEPopup.resizeToInnerSize(); + + // Remove Gecko spellchecking + if (tinymce.isGecko) + document.body.spellcheck = tinyMCEPopup.editor.getParam("gecko_spellcheck"); + + document.getElementById('htmlSource').value = tinyMCEPopup.editor.getContent({source_view : true}); + + if (tinyMCEPopup.editor.getParam("theme_advanced_source_editor_wrap", true)) { + setWrap('soft'); + document.getElementById('wraped').checked = true; + } + + resizeInputs(); +} + +function setWrap(val) { + var v, n, s = document.getElementById('htmlSource'); + + s.wrap = val; + + if (!tinymce.isIE) { + v = s.value; + n = s.cloneNode(false); + n.setAttribute("wrap", val); + s.parentNode.replaceChild(n, s); + n.value = v; + } +} + +function toggleWordWrap(elm) { + if (elm.checked) + setWrap('soft'); + else + setWrap('off'); +} + +var wHeight=0, wWidth=0, owHeight=0, owWidth=0; + +function resizeInputs() { + var el = document.getElementById('htmlSource'); + + if (!tinymce.isIE) { + wHeight = self.innerHeight - 65; + wWidth = self.innerWidth - 16; + } else { + wHeight = document.body.clientHeight - 70; + wWidth = document.body.clientWidth - 16; + } + + el.style.height = Math.abs(wHeight) + 'px'; + el.style.width = Math.abs(wWidth) + 'px'; +} diff --git a/web/libs/tiny_mce/themes/advanced/langs/en.js b/web/libs/tiny_mce/themes/advanced/langs/en.js new file mode 100644 index 0000000..69694b1 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/langs/en.js @@ -0,0 +1,62 @@ +tinyMCE.addI18n('en.advanced',{ +style_select:"Styles", +font_size:"Font size", +fontdefault:"Font family", +block:"Format", +paragraph:"Paragraph", +div:"Div", +address:"Address", +pre:"Preformatted", +h1:"Heading 1", +h2:"Heading 2", +h3:"Heading 3", +h4:"Heading 4", +h5:"Heading 5", +h6:"Heading 6", +blockquote:"Blockquote", +code:"Code", +samp:"Code sample", +dt:"Definition term ", +dd:"Definition description", +bold_desc:"Bold (Ctrl+B)", +italic_desc:"Italic (Ctrl+I)", +underline_desc:"Underline (Ctrl+U)", +striketrough_desc:"Strikethrough", +justifyleft_desc:"Align left", +justifycenter_desc:"Align center", +justifyright_desc:"Align right", +justifyfull_desc:"Align full", +bullist_desc:"Unordered list", +numlist_desc:"Ordered list", +outdent_desc:"Outdent", +indent_desc:"Indent", +undo_desc:"Undo (Ctrl+Z)", +redo_desc:"Redo (Ctrl+Y)", +link_desc:"Insert/edit link", +unlink_desc:"Unlink", +image_desc:"Insert/edit image", +cleanup_desc:"Cleanup messy code", +code_desc:"Edit HTML Source", +sub_desc:"Subscript", +sup_desc:"Superscript", +hr_desc:"Insert horizontal ruler", +removeformat_desc:"Remove formatting", +custom1_desc:"Your custom description here", +forecolor_desc:"Select text color", +backcolor_desc:"Select background color", +charmap_desc:"Insert custom character", +visualaid_desc:"Toggle guidelines/invisible elements", +anchor_desc:"Insert/edit anchor", +cut_desc:"Cut", +copy_desc:"Copy", +paste_desc:"Paste", +image_props_desc:"Image properties", +newdocument_desc:"New document", +help_desc:"Help", +blockquote_desc:"Blockquote", +clipboard_msg:"Copy/Cut/Paste is not available in Mozilla and Firefox.\r\nDo you want more information about this issue?", +path:"Path", +newdocument:"Are you sure you want clear all contents?", +toolbar_focus:"Jump to tool buttons - Alt+Q, Jump to editor - Alt-Z, Jump to element path - Alt-X", +more_colors:"More colors" +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/themes/advanced/langs/en_dlg.js b/web/libs/tiny_mce/themes/advanced/langs/en_dlg.js new file mode 100644 index 0000000..9d124d7 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/langs/en_dlg.js @@ -0,0 +1,51 @@ +tinyMCE.addI18n('en.advanced_dlg',{ +about_title:"About TinyMCE", +about_general:"About", +about_help:"Help", +about_license:"License", +about_plugins:"Plugins", +about_plugin:"Plugin", +about_author:"Author", +about_version:"Version", +about_loaded:"Loaded plugins", +anchor_title:"Insert/edit anchor", +anchor_name:"Anchor name", +code_title:"HTML Source Editor", +code_wordwrap:"Word wrap", +colorpicker_title:"Select a color", +colorpicker_picker_tab:"Picker", +colorpicker_picker_title:"Color picker", +colorpicker_palette_tab:"Palette", +colorpicker_palette_title:"Palette colors", +colorpicker_named_tab:"Named", +colorpicker_named_title:"Named colors", +colorpicker_color:"Color:", +colorpicker_name:"Name:", +charmap_title:"Select custom character", +image_title:"Insert/edit image", +image_src:"Image URL", +image_alt:"Image description", +image_list:"Image list", +image_border:"Border", +image_dimensions:"Dimensions", +image_vspace:"Vertical space", +image_hspace:"Horizontal space", +image_align:"Alignment", +image_align_baseline:"Baseline", +image_align_top:"Top", +image_align_middle:"Middle", +image_align_bottom:"Bottom", +image_align_texttop:"Text top", +image_align_textbottom:"Text bottom", +image_align_left:"Left", +image_align_right:"Right", +link_title:"Insert/edit link", +link_url:"Link URL", +link_target:"Target", +link_target_same:"Open link in the same window", +link_target_blank:"Open link in a new window", +link_titlefield:"Title", +link_is_email:"The URL you entered seems to be an email address, do you want to add the required mailto: prefix?", +link_is_external:"The URL you entered seems to external link, do you want to add the required http:// prefix?", +link_list:"Link list" +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/themes/advanced/link.htm b/web/libs/tiny_mce/themes/advanced/link.htm new file mode 100644 index 0000000..7565b9a --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/link.htm @@ -0,0 +1,58 @@ + + + + {#advanced_dlg.link_title} + + + + + + + +
+ + +
+
+ + + + + + + + + + + + + + + + + + + + + + +
+ + + + +
 
+
+
+ +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/themes/advanced/skins/default/content.css b/web/libs/tiny_mce/themes/advanced/skins/default/content.css new file mode 100644 index 0000000..9fba043 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/skins/default/content.css @@ -0,0 +1,36 @@ +body, td, pre {color:#000; font-family:Verdana, Arial, Helvetica, sans-serif; font-size:10px; margin:8px;} +body {background:#FFF;} +body.mceForceColors {background:#FFF; color:#000;} +h1 {font-size: 2em} +h2 {font-size: 1.5em} +h3 {font-size: 1.17em} +h4 {font-size: 1em} +h5 {font-size: .83em} +h6 {font-size: .75em} +.mceItemTable, .mceItemTable td, .mceItemTable th, .mceItemTable caption, .mceItemVisualAid {border: 1px dashed #BBB;} +a.mceItemAnchor {display:inline-block; width:11px !important; height:11px !important; background:url(img/items.gif) no-repeat 0 0;} +span.mceItemNbsp {background: #DDD} +td.mceSelected, th.mceSelected {background-color:#3399ff !important} +img {border:0;} +table {cursor:default} +table td, table th {cursor:text} +ins {border-bottom:1px solid green; text-decoration: none; color:green} +del {color:red; text-decoration:line-through} +cite {border-bottom:1px dashed blue} +acronym {border-bottom:1px dotted #CCC; cursor:help} +abbr {border-bottom:1px dashed #CCC; cursor:help} + +/* IE */ +* html body { +scrollbar-3dlight-color:#F0F0EE; +scrollbar-arrow-color:#676662; +scrollbar-base-color:#F0F0EE; +scrollbar-darkshadow-color:#DDD; +scrollbar-face-color:#E0E0DD; +scrollbar-highlight-color:#F0F0EE; +scrollbar-shadow-color:#F0F0EE; +scrollbar-track-color:#F5F5F5; +} + +img:-moz-broken {-moz-force-broken-image-icon:1; width:24px; height:24px} +font[face=mceinline] {font-family:inherit !important} diff --git a/web/libs/tiny_mce/themes/advanced/skins/default/dialog.css b/web/libs/tiny_mce/themes/advanced/skins/default/dialog.css new file mode 100644 index 0000000..f012226 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/skins/default/dialog.css @@ -0,0 +1,117 @@ +/* Generic */ +body { +font-family:Verdana, Arial, Helvetica, sans-serif; font-size:11px; +scrollbar-3dlight-color:#F0F0EE; +scrollbar-arrow-color:#676662; +scrollbar-base-color:#F0F0EE; +scrollbar-darkshadow-color:#DDDDDD; +scrollbar-face-color:#E0E0DD; +scrollbar-highlight-color:#F0F0EE; +scrollbar-shadow-color:#F0F0EE; +scrollbar-track-color:#F5F5F5; +background:#F0F0EE; +padding:0; +margin:8px 8px 0 8px; +} + +html {background:#F0F0EE;} +td {font-family:Verdana, Arial, Helvetica, sans-serif; font-size:10px;} +textarea {resize:none;outline:none;} +a:link, a:visited {color:black;} +a:hover {color:#2B6FB6;} +.nowrap {white-space: nowrap} + +/* Forms */ +fieldset {margin:0; padding:4px; border:1px solid #919B9C; font-family:Verdana, Arial; font-size:10px;} +legend {color:#2B6FB6; font-weight:bold;} +label.msg {display:none;} +label.invalid {color:#EE0000; display:inline;} +input.invalid {border:1px solid #EE0000;} +input {background:#FFF; border:1px solid #CCC;} +input, select, textarea {font-family:Verdana, Arial, Helvetica, sans-serif; font-size:10px;} +input, select, textarea {border:1px solid #808080;} +input.radio {border:1px none #000000; background:transparent; vertical-align:middle;} +input.checkbox {border:1px none #000000; background:transparent; vertical-align:middle;} +.input_noborder {border:0;} + +/* Buttons */ +#insert, #cancel, input.button, .updateButton { +border:0; margin:0; padding:0; +font-weight:bold; +width:94px; height:26px; +background:url(img/buttons.png) 0 -26px; +cursor:pointer; +padding-bottom:2px; +float:left; +} + +#insert {background:url(img/buttons.png) 0 -52px} +#cancel {background:url(img/buttons.png) 0 0; float:right} + +/* Browse */ +a.pickcolor, a.browse {text-decoration:none} +a.browse span {display:block; width:20px; height:18px; background:url(../../img/icons.gif) -860px 0; border:1px solid #FFF; margin-left:1px;} +.mceOldBoxModel a.browse span {width:22px; height:20px;} +a.browse:hover span {border:1px solid #0A246A; background-color:#B2BBD0;} +a.browse span.disabled {border:1px solid white; opacity:0.3; -ms-filter:'alpha(opacity=30)'; filter:alpha(opacity=30)} +a.browse:hover span.disabled {border:1px solid white; background-color:transparent;} +a.pickcolor span {display:block; width:20px; height:16px; background:url(../../img/icons.gif) -840px 0; margin-left:2px;} +.mceOldBoxModel a.pickcolor span {width:21px; height:17px;} +a.pickcolor:hover span {background-color:#B2BBD0;} +a.pickcolor:hover span.disabled {} + +/* Charmap */ +table.charmap {border:1px solid #AAA; text-align:center} +td.charmap, #charmap a {width:18px; height:18px; color:#000; border:1px solid #AAA; text-align:center; font-size:12px; vertical-align:middle; line-height: 18px;} +#charmap a {display:block; color:#000; text-decoration:none; border:0} +#charmap a:hover {background:#CCC;color:#2B6FB6} +#charmap #codeN {font-size:10px; font-family:Arial,Helvetica,sans-serif; text-align:center} +#charmap #codeV {font-size:40px; height:80px; border:1px solid #AAA; text-align:center} + +/* Source */ +.wordWrapCode {vertical-align:middle; border:1px none #000000; background:transparent;} +.mceActionPanel {margin-top:5px;} + +/* Tabs classes */ +.tabs {width:100%; height:18px; line-height:normal; background:url(img/tabs.gif) repeat-x 0 -72px;} +.tabs ul {margin:0; padding:0; list-style:none;} +.tabs li {float:left; background:url(img/tabs.gif) no-repeat 0 0; margin:0 2px 0 0; padding:0 0 0 10px; line-height:17px; height:18px; display:block;} +.tabs li.current {background:url(img/tabs.gif) no-repeat 0 -18px; margin-right:2px;} +.tabs span {float:left; display:block; background:url(img/tabs.gif) no-repeat right -36px; padding:0px 10px 0 0;} +.tabs .current span {background:url(img/tabs.gif) no-repeat right -54px;} +.tabs a {text-decoration:none; font-family:Verdana, Arial; font-size:10px;} +.tabs a:link, .tabs a:visited, .tabs a:hover {color:black;} + +/* Panels */ +.panel_wrapper div.panel {display:none;} +.panel_wrapper div.current {display:block; width:100%; height:300px; overflow:visible;} +.panel_wrapper {border:1px solid #919B9C; border-top:0px; padding:10px; padding-top:5px; clear:both; background:white;} + +/* Columns */ +.column {float:left;} +.properties {width:100%;} +.properties .column1 {} +.properties .column2 {text-align:left;} + +/* Titles */ +h1, h2, h3, h4 {color:#2B6FB6; margin:0; padding:0; padding-top:5px;} +h3 {font-size:14px;} +.title {font-size:12px; font-weight:bold; color:#2B6FB6;} + +/* Dialog specific */ +#link .panel_wrapper, #link div.current {height:125px;} +#image .panel_wrapper, #image div.current {height:200px;} +#plugintable thead {font-weight:bold; background:#DDD;} +#plugintable, #about #plugintable td {border:1px solid #919B9C;} +#plugintable {width:96%; margin-top:10px;} +#pluginscontainer {height:290px; overflow:auto;} +#colorpicker #preview {float:right; width:50px; height:14px;line-height:1px; border:1px solid black; margin-left:5px;} +#colorpicker #colors {float:left; border:1px solid gray; cursor:crosshair;} +#colorpicker #light {border:1px solid gray; margin-left:5px; float:left;width:15px; height:150px; cursor:crosshair;} +#colorpicker #light div {overflow:hidden;} +#colorpicker #previewblock {float:right; padding-left:10px; height:20px;} +#colorpicker .panel_wrapper div.current {height:175px;} +#colorpicker #namedcolors {width:150px;} +#colorpicker #namedcolors a {display:block; float:left; width:10px; height:10px; margin:1px 1px 0 0; overflow:hidden;} +#colorpicker #colornamecontainer {margin-top:5px;} +#colorpicker #picker_panel fieldset {margin:auto;width:325px;} diff --git a/web/libs/tiny_mce/themes/advanced/skins/default/img/buttons.png b/web/libs/tiny_mce/themes/advanced/skins/default/img/buttons.png new file mode 100644 index 0000000..7dd5841 Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/skins/default/img/buttons.png differ diff --git a/web/libs/tiny_mce/themes/advanced/skins/default/img/items.gif b/web/libs/tiny_mce/themes/advanced/skins/default/img/items.gif new file mode 100644 index 0000000..2eafd79 Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/skins/default/img/items.gif differ diff --git a/web/libs/tiny_mce/themes/advanced/skins/default/img/menu_arrow.gif b/web/libs/tiny_mce/themes/advanced/skins/default/img/menu_arrow.gif new file mode 100644 index 0000000..85e31df Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/skins/default/img/menu_arrow.gif differ diff --git a/web/libs/tiny_mce/themes/advanced/skins/default/img/menu_check.gif b/web/libs/tiny_mce/themes/advanced/skins/default/img/menu_check.gif new file mode 100644 index 0000000..adfdddc Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/skins/default/img/menu_check.gif differ diff --git a/web/libs/tiny_mce/themes/advanced/skins/default/img/progress.gif b/web/libs/tiny_mce/themes/advanced/skins/default/img/progress.gif new file mode 100644 index 0000000..5bb90fd Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/skins/default/img/progress.gif differ diff --git a/web/libs/tiny_mce/themes/advanced/skins/default/img/tabs.gif b/web/libs/tiny_mce/themes/advanced/skins/default/img/tabs.gif new file mode 100644 index 0000000..ce4be63 Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/skins/default/img/tabs.gif differ diff --git a/web/libs/tiny_mce/themes/advanced/skins/default/ui.css b/web/libs/tiny_mce/themes/advanced/skins/default/ui.css new file mode 100644 index 0000000..0049c7b --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/skins/default/ui.css @@ -0,0 +1,213 @@ +/* Reset */ +.defaultSkin table, .defaultSkin tbody, .defaultSkin a, .defaultSkin img, .defaultSkin tr, .defaultSkin div, .defaultSkin td, .defaultSkin iframe, .defaultSkin span, .defaultSkin *, .defaultSkin .mceText {border:0; margin:0; padding:0; background:transparent; white-space:nowrap; text-decoration:none; font-weight:normal; cursor:default; color:#000; vertical-align:baseline; width:auto; border-collapse:separate; text-align:left} +.defaultSkin a:hover, .defaultSkin a:link, .defaultSkin a:visited, .defaultSkin a:active {text-decoration:none; font-weight:normal; cursor:default; color:#000} +.defaultSkin table td {vertical-align:middle} + +/* Containers */ +.defaultSkin table {direction:ltr; background:#F0F0EE} +.defaultSkin iframe {display:block; background:#FFF} +.defaultSkin .mceToolbar {height:26px} +.defaultSkin .mceLeft {text-align:left} +.defaultSkin .mceRight {text-align:right} + +/* External */ +.defaultSkin .mceExternalToolbar {position:absolute; border:1px solid #CCC; border-bottom:0; display:none;} +.defaultSkin .mceExternalToolbar td.mceToolbar {padding-right:13px;} +.defaultSkin .mceExternalClose {position:absolute; top:3px; right:3px; width:7px; height:7px; background:url(../../img/icons.gif) -820px 0} + +/* Layout */ +.defaultSkin table.mceLayout {border:0; border-left:1px solid #CCC; border-right:1px solid #CCC} +.defaultSkin table.mceLayout tr.mceFirst td {border-top:1px solid #CCC} +.defaultSkin table.mceLayout tr.mceLast td {border-bottom:1px solid #CCC} +.defaultSkin table.mceToolbar, .defaultSkin tr.mceFirst .mceToolbar tr td, .defaultSkin tr.mceLast .mceToolbar tr td {border:0; margin:0; padding:0;} +.defaultSkin td.mceToolbar {padding-top:1px; vertical-align:top} +.defaultSkin .mceIframeContainer {border-top:1px solid #CCC; border-bottom:1px solid #CCC} +.defaultSkin .mceStatusbar {font-family:'MS Sans Serif',sans-serif,Verdana,Arial; font-size:9pt; line-height:16px; overflow:visible; color:#000; display:block; height:20px} +.defaultSkin .mceStatusbar div {float:left; margin:2px} +.defaultSkin .mceStatusbar a.mceResize {display:block; float:right; background:url(../../img/icons.gif) -800px 0; width:20px; height:20px; cursor:se-resize; outline:0} +.defaultSkin .mceStatusbar a:hover {text-decoration:underline} +.defaultSkin table.mceToolbar {margin-left:3px} +.defaultSkin span.mceIcon, .defaultSkin img.mceIcon {display:block; width:20px; height:20px} +.defaultSkin .mceIcon {background:url(../../img/icons.gif) no-repeat 20px 20px} +.defaultSkin td.mceCenter {text-align:center;} +.defaultSkin td.mceCenter table {margin:0 auto; text-align:left;} +.defaultSkin td.mceRight table {margin:0 0 0 auto;} + +/* Button */ +.defaultSkin .mceButton {display:block; border:1px solid #F0F0EE; width:20px; height:20px; margin-right:1px} +.defaultSkin a.mceButtonEnabled:hover {border:1px solid #0A246A; background-color:#B2BBD0} +.defaultSkin a.mceButtonActive, .defaultSkin a.mceButtonSelected {border:1px solid #0A246A; background-color:#C2CBE0} +.defaultSkin .mceButtonDisabled .mceIcon {opacity:0.3; -ms-filter:'alpha(opacity=30)'; filter:alpha(opacity=30)} +.defaultSkin .mceButtonLabeled {width:auto} +.defaultSkin .mceButtonLabeled span.mceIcon {float:left} +.defaultSkin span.mceButtonLabel {display:block; font-size:10px; padding:4px 6px 0 22px; font-family:Tahoma,Verdana,Arial,Helvetica} +.defaultSkin .mceButtonDisabled .mceButtonLabel {color:#888} + +/* Separator */ +.defaultSkin .mceSeparator {display:block; background:url(../../img/icons.gif) -180px 0; width:2px; height:20px; margin:2px 2px 0 4px} + +/* ListBox */ +.defaultSkin .mceListBox, .defaultSkin .mceListBox a {display:block} +.defaultSkin .mceListBox .mceText {padding-left:4px; width:70px; text-align:left; border:1px solid #CCC; border-right:0; background:#FFF; font-family:Tahoma,Verdana,Arial,Helvetica; font-size:11px; height:20px; line-height:20px; overflow:hidden} +.defaultSkin .mceListBox .mceOpen {width:9px; height:20px; background:url(../../img/icons.gif) -741px 0; margin-right:2px; border:1px solid #CCC;} +.defaultSkin table.mceListBoxEnabled:hover .mceText, .defaultSkin .mceListBoxHover .mceText, .defaultSkin .mceListBoxSelected .mceText {border:1px solid #A2ABC0; border-right:0; background:#FFF} +.defaultSkin table.mceListBoxEnabled:hover .mceOpen, .defaultSkin .mceListBoxHover .mceOpen, .defaultSkin .mceListBoxSelected .mceOpen {background-color:#FFF; border:1px solid #A2ABC0} +.defaultSkin .mceListBoxDisabled a.mceText {color:gray; background-color:transparent;} +.defaultSkin .mceListBoxMenu {overflow:auto; overflow-x:hidden} +.defaultSkin .mceOldBoxModel .mceListBox .mceText {height:22px} +.defaultSkin .mceOldBoxModel .mceListBox .mceOpen {width:11px; height:22px;} +.defaultSkin select.mceNativeListBox {font-family:'MS Sans Serif',sans-serif,Verdana,Arial; font-size:7pt; background:#F0F0EE; border:1px solid gray; margin-right:2px;} + +/* SplitButton */ +.defaultSkin .mceSplitButton {width:32px; height:20px; direction:ltr} +.defaultSkin .mceSplitButton a, .defaultSkin .mceSplitButton span {height:20px; display:block} +.defaultSkin .mceSplitButton a.mceAction {width:20px; border:1px solid #F0F0EE; border-right:0;} +.defaultSkin .mceSplitButton span.mceAction {width:20px; background-image:url(../../img/icons.gif);} +.defaultSkin .mceSplitButton a.mceOpen {width:9px; background:url(../../img/icons.gif) -741px 0; border:1px solid #F0F0EE;} +.defaultSkin .mceSplitButton span.mceOpen {display:none} +.defaultSkin table.mceSplitButtonEnabled:hover a.mceAction, .defaultSkin .mceSplitButtonHover a.mceAction, .defaultSkin .mceSplitButtonSelected a.mceAction {border:1px solid #0A246A; border-right:0; background-color:#B2BBD0} +.defaultSkin table.mceSplitButtonEnabled:hover a.mceOpen, .defaultSkin .mceSplitButtonHover a.mceOpen, .defaultSkin .mceSplitButtonSelected a.mceOpen {background-color:#B2BBD0; border:1px solid #0A246A;} +.defaultSkin .mceSplitButtonDisabled .mceAction, .defaultSkin .mceSplitButtonDisabled a.mceOpen {opacity:0.3; -ms-filter:'alpha(opacity=30)'; filter:alpha(opacity=30)} +.defaultSkin .mceSplitButtonActive a.mceAction {border:1px solid #0A246A; background-color:#C2CBE0} +.defaultSkin .mceSplitButtonActive a.mceOpen {border-left:0;} + +/* ColorSplitButton */ +.defaultSkin div.mceColorSplitMenu table {background:#FFF; border:1px solid gray} +.defaultSkin .mceColorSplitMenu td {padding:2px} +.defaultSkin .mceColorSplitMenu a {display:block; width:9px; height:9px; overflow:hidden; border:1px solid #808080} +.defaultSkin .mceColorSplitMenu td.mceMoreColors {padding:1px 3px 1px 1px} +.defaultSkin .mceColorSplitMenu a.mceMoreColors {width:100%; height:auto; text-align:center; font-family:Tahoma,Verdana,Arial,Helvetica; font-size:11px; line-height:20px; border:1px solid #FFF} +.defaultSkin .mceColorSplitMenu a.mceMoreColors:hover {border:1px solid #0A246A; background-color:#B6BDD2} +.defaultSkin a.mceMoreColors:hover {border:1px solid #0A246A} +.defaultSkin .mceColorPreview {margin-left:2px; width:16px; height:4px; overflow:hidden; background:#9a9b9a} +.defaultSkin .mce_forecolor span.mceAction, .defaultSkin .mce_backcolor span.mceAction {overflow:hidden; height:16px} + +/* Menu */ +.defaultSkin .mceMenu {position:absolute; left:0; top:0; z-index:1000; border:1px solid #D4D0C8} +.defaultSkin .mceNoIcons span.mceIcon {width:0;} +.defaultSkin .mceNoIcons a .mceText {padding-left:10px} +.defaultSkin .mceMenu table {background:#FFF} +.defaultSkin .mceMenu a, .defaultSkin .mceMenu span, .defaultSkin .mceMenu {display:block} +.defaultSkin .mceMenu td {height:20px} +.defaultSkin .mceMenu a {position:relative;padding:3px 0 4px 0} +.defaultSkin .mceMenu .mceText {position:relative; display:block; font-family:Tahoma,Verdana,Arial,Helvetica; color:#000; cursor:default; margin:0; padding:0 25px 0 25px; display:block} +.defaultSkin .mceMenu span.mceText, .defaultSkin .mceMenu .mcePreview {font-size:11px} +.defaultSkin .mceMenu pre.mceText {font-family:Monospace} +.defaultSkin .mceMenu .mceIcon {position:absolute; top:0; left:0; width:22px;} +.defaultSkin .mceMenu .mceMenuItemEnabled a:hover, .defaultSkin .mceMenu .mceMenuItemActive {background-color:#dbecf3} +.defaultSkin td.mceMenuItemSeparator {background:#DDD; height:1px} +.defaultSkin .mceMenuItemTitle a {border:0; background:#EEE; border-bottom:1px solid #DDD} +.defaultSkin .mceMenuItemTitle span.mceText {color:#000; font-weight:bold; padding-left:4px} +.defaultSkin .mceMenuItemDisabled .mceText {color:#888} +.defaultSkin .mceMenuItemSelected .mceIcon {background:url(img/menu_check.gif)} +.defaultSkin .mceNoIcons .mceMenuItemSelected a {background:url(img/menu_arrow.gif) no-repeat -6px center} +.defaultSkin .mceMenu span.mceMenuLine {display:none} +.defaultSkin .mceMenuItemSub a {background:url(img/menu_arrow.gif) no-repeat top right;} + +/* Progress,Resize */ +.defaultSkin .mceBlocker {position:absolute; left:0; top:0; z-index:1000; opacity:0.5; -ms-filter:'alpha(opacity=50)'; filter:alpha(opacity=50); background:#FFF} +.defaultSkin .mceProgress {position:absolute; left:0; top:0; z-index:1001; background:url(img/progress.gif) no-repeat; width:32px; height:32px; margin:-16px 0 0 -16px} + +/* Formats */ +.defaultSkin .mce_formatPreview a {font-size:10px} +.defaultSkin .mce_p span.mceText {} +.defaultSkin .mce_address span.mceText {font-style:italic} +.defaultSkin .mce_pre span.mceText {font-family:monospace} +.defaultSkin .mce_h1 span.mceText {font-weight:bolder; font-size: 2em} +.defaultSkin .mce_h2 span.mceText {font-weight:bolder; font-size: 1.5em} +.defaultSkin .mce_h3 span.mceText {font-weight:bolder; font-size: 1.17em} +.defaultSkin .mce_h4 span.mceText {font-weight:bolder; font-size: 1em} +.defaultSkin .mce_h5 span.mceText {font-weight:bolder; font-size: .83em} +.defaultSkin .mce_h6 span.mceText {font-weight:bolder; font-size: .75em} + +/* Theme */ +.defaultSkin span.mce_bold {background-position:0 0} +.defaultSkin span.mce_italic {background-position:-60px 0} +.defaultSkin span.mce_underline {background-position:-140px 0} +.defaultSkin span.mce_strikethrough {background-position:-120px 0} +.defaultSkin span.mce_undo {background-position:-160px 0} +.defaultSkin span.mce_redo {background-position:-100px 0} +.defaultSkin span.mce_cleanup {background-position:-40px 0} +.defaultSkin span.mce_bullist {background-position:-20px 0} +.defaultSkin span.mce_numlist {background-position:-80px 0} +.defaultSkin span.mce_justifyleft {background-position:-460px 0} +.defaultSkin span.mce_justifyright {background-position:-480px 0} +.defaultSkin span.mce_justifycenter {background-position:-420px 0} +.defaultSkin span.mce_justifyfull {background-position:-440px 0} +.defaultSkin span.mce_anchor {background-position:-200px 0} +.defaultSkin span.mce_indent {background-position:-400px 0} +.defaultSkin span.mce_outdent {background-position:-540px 0} +.defaultSkin span.mce_link {background-position:-500px 0} +.defaultSkin span.mce_unlink {background-position:-640px 0} +.defaultSkin span.mce_sub {background-position:-600px 0} +.defaultSkin span.mce_sup {background-position:-620px 0} +.defaultSkin span.mce_removeformat {background-position:-580px 0} +.defaultSkin span.mce_newdocument {background-position:-520px 0} +.defaultSkin span.mce_image {background-position:-380px 0} +.defaultSkin span.mce_help {background-position:-340px 0} +.defaultSkin span.mce_code {background-position:-260px 0} +.defaultSkin span.mce_hr {background-position:-360px 0} +.defaultSkin span.mce_visualaid {background-position:-660px 0} +.defaultSkin span.mce_charmap {background-position:-240px 0} +.defaultSkin span.mce_paste {background-position:-560px 0} +.defaultSkin span.mce_copy {background-position:-700px 0} +.defaultSkin span.mce_cut {background-position:-680px 0} +.defaultSkin span.mce_blockquote {background-position:-220px 0} +.defaultSkin .mce_forecolor span.mceAction {background-position:-720px 0} +.defaultSkin .mce_backcolor span.mceAction {background-position:-760px 0} +.defaultSkin span.mce_forecolorpicker {background-position:-720px 0} +.defaultSkin span.mce_backcolorpicker {background-position:-760px 0} + +/* Plugins */ +.defaultSkin span.mce_advhr {background-position:-0px -20px} +.defaultSkin span.mce_ltr {background-position:-20px -20px} +.defaultSkin span.mce_rtl {background-position:-40px -20px} +.defaultSkin span.mce_emotions {background-position:-60px -20px} +.defaultSkin span.mce_fullpage {background-position:-80px -20px} +.defaultSkin span.mce_fullscreen {background-position:-100px -20px} +.defaultSkin span.mce_iespell {background-position:-120px -20px} +.defaultSkin span.mce_insertdate {background-position:-140px -20px} +.defaultSkin span.mce_inserttime {background-position:-160px -20px} +.defaultSkin span.mce_absolute {background-position:-180px -20px} +.defaultSkin span.mce_backward {background-position:-200px -20px} +.defaultSkin span.mce_forward {background-position:-220px -20px} +.defaultSkin span.mce_insert_layer {background-position:-240px -20px} +.defaultSkin span.mce_insertlayer {background-position:-260px -20px} +.defaultSkin span.mce_movebackward {background-position:-280px -20px} +.defaultSkin span.mce_moveforward {background-position:-300px -20px} +.defaultSkin span.mce_media {background-position:-320px -20px} +.defaultSkin span.mce_nonbreaking {background-position:-340px -20px} +.defaultSkin span.mce_pastetext {background-position:-360px -20px} +.defaultSkin span.mce_pasteword {background-position:-380px -20px} +.defaultSkin span.mce_selectall {background-position:-400px -20px} +.defaultSkin span.mce_preview {background-position:-420px -20px} +.defaultSkin span.mce_print {background-position:-440px -20px} +.defaultSkin span.mce_cancel {background-position:-460px -20px} +.defaultSkin span.mce_save {background-position:-480px -20px} +.defaultSkin span.mce_replace {background-position:-500px -20px} +.defaultSkin span.mce_search {background-position:-520px -20px} +.defaultSkin span.mce_styleprops {background-position:-560px -20px} +.defaultSkin span.mce_table {background-position:-580px -20px} +.defaultSkin span.mce_cell_props {background-position:-600px -20px} +.defaultSkin span.mce_delete_table {background-position:-620px -20px} +.defaultSkin span.mce_delete_col {background-position:-640px -20px} +.defaultSkin span.mce_delete_row {background-position:-660px -20px} +.defaultSkin span.mce_col_after {background-position:-680px -20px} +.defaultSkin span.mce_col_before {background-position:-700px -20px} +.defaultSkin span.mce_row_after {background-position:-720px -20px} +.defaultSkin span.mce_row_before {background-position:-740px -20px} +.defaultSkin span.mce_merge_cells {background-position:-760px -20px} +.defaultSkin span.mce_table_props {background-position:-980px -20px} +.defaultSkin span.mce_row_props {background-position:-780px -20px} +.defaultSkin span.mce_split_cells {background-position:-800px -20px} +.defaultSkin span.mce_template {background-position:-820px -20px} +.defaultSkin span.mce_visualchars {background-position:-840px -20px} +.defaultSkin span.mce_abbr {background-position:-860px -20px} +.defaultSkin span.mce_acronym {background-position:-880px -20px} +.defaultSkin span.mce_attribs {background-position:-900px -20px} +.defaultSkin span.mce_cite {background-position:-920px -20px} +.defaultSkin span.mce_del {background-position:-940px -20px} +.defaultSkin span.mce_ins {background-position:-960px -20px} +.defaultSkin span.mce_pagebreak {background-position:0 -40px} +.defaultSkin span.mce_restoredraft {background-position:-20px -40px} +.defaultSkin span.mce_spellchecker {background-position:-540px -20px} diff --git a/web/libs/tiny_mce/themes/advanced/skins/o2k7/content.css b/web/libs/tiny_mce/themes/advanced/skins/o2k7/content.css new file mode 100644 index 0000000..3b833d9 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/skins/o2k7/content.css @@ -0,0 +1,36 @@ +body, td, pre {color:#000; font-family:Verdana, Arial, Helvetica, sans-serif; font-size:10px; margin:8px;} +body {background:#FFF;} +body.mceForceColors {background:#FFF; color:#000;} +h1 {font-size: 2em} +h2 {font-size: 1.5em} +h3 {font-size: 1.17em} +h4 {font-size: 1em} +h5 {font-size: .83em} +h6 {font-size: .75em} +.mceItemTable, .mceItemTable td, .mceItemTable th, .mceItemTable caption, .mceItemVisualAid {border: 1px dashed #BBB;} +a.mceItemAnchor {display:inline-block; width:11px !important; height:11px !important; background:url(../default/img/items.gif) no-repeat 0 0;} +span.mceItemNbsp {background: #DDD} +td.mceSelected, th.mceSelected {background-color:#3399ff !important} +img {border:0;} +table {cursor:default} +table td, table th {cursor:text} +ins {border-bottom:1px solid green; text-decoration: none; color:green} +del {color:red; text-decoration:line-through} +cite {border-bottom:1px dashed blue} +acronym {border-bottom:1px dotted #CCC; cursor:help} +abbr {border-bottom:1px dashed #CCC; cursor:help} + +/* IE */ +* html body { +scrollbar-3dlight-color:#F0F0EE; +scrollbar-arrow-color:#676662; +scrollbar-base-color:#F0F0EE; +scrollbar-darkshadow-color:#DDD; +scrollbar-face-color:#E0E0DD; +scrollbar-highlight-color:#F0F0EE; +scrollbar-shadow-color:#F0F0EE; +scrollbar-track-color:#F5F5F5; +} + +img:-moz-broken {-moz-force-broken-image-icon:1; width:24px; height:24px} +font[face=mceinline] {font-family:inherit !important} diff --git a/web/libs/tiny_mce/themes/advanced/skins/o2k7/dialog.css b/web/libs/tiny_mce/themes/advanced/skins/o2k7/dialog.css new file mode 100644 index 0000000..e3af139 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/skins/o2k7/dialog.css @@ -0,0 +1,116 @@ +/* Generic */ +body { +font-family:Verdana, Arial, Helvetica, sans-serif; font-size:11px; +scrollbar-3dlight-color:#F0F0EE; +scrollbar-arrow-color:#676662; +scrollbar-base-color:#F0F0EE; +scrollbar-darkshadow-color:#DDDDDD; +scrollbar-face-color:#E0E0DD; +scrollbar-highlight-color:#F0F0EE; +scrollbar-shadow-color:#F0F0EE; +scrollbar-track-color:#F5F5F5; +background:#F0F0EE; +padding:0; +margin:8px 8px 0 8px; +} + +html {background:#F0F0EE;} +td {font-family:Verdana, Arial, Helvetica, sans-serif; font-size:10px;} +textarea {resize:none;outline:none;} +a:link, a:visited {color:black;} +a:hover {color:#2B6FB6;} +.nowrap {white-space: nowrap} + +/* Forms */ +fieldset {margin:0; padding:4px; border:1px solid #919B9C; font-family:Verdana, Arial; font-size:10px;} +legend {color:#2B6FB6; font-weight:bold;} +label.msg {display:none;} +label.invalid {color:#EE0000; display:inline;} +input.invalid {border:1px solid #EE0000;} +input {background:#FFF; border:1px solid #CCC;} +input, select, textarea {font-family:Verdana, Arial, Helvetica, sans-serif; font-size:10px;} +input, select, textarea {border:1px solid #808080;} +input.radio {border:1px none #000000; background:transparent; vertical-align:middle;} +input.checkbox {border:1px none #000000; background:transparent; vertical-align:middle;} +.input_noborder {border:0;} + +/* Buttons */ +#insert, #cancel, input.button, .updateButton { +border:0; margin:0; padding:0; +font-weight:bold; +width:94px; height:26px; +background:url(../default/img/buttons.png) 0 -26px; +cursor:pointer; +padding-bottom:2px; +float:left; +} + +#insert {background:url(../default/img/buttons.png) 0 -52px} +#cancel {background:url(../default/img/buttons.png) 0 0; float:right} + +/* Browse */ +a.pickcolor, a.browse {text-decoration:none} +a.browse span {display:block; width:20px; height:18px; background:url(../../img/icons.gif) -860px 0; border:1px solid #FFF; margin-left:1px;} +.mceOldBoxModel a.browse span {width:22px; height:20px;} +a.browse:hover span {border:1px solid #0A246A; background-color:#B2BBD0;} +a.browse span.disabled {border:1px solid white; opacity:0.3; -ms-filter:'alpha(opacity=30)'; filter:alpha(opacity=30)} +a.browse:hover span.disabled {border:1px solid white; background-color:transparent;} +a.pickcolor span {display:block; width:20px; height:16px; background:url(../../img/icons.gif) -840px 0; margin-left:2px;} +.mceOldBoxModel a.pickcolor span {width:21px; height:17px;} +a.pickcolor:hover span {background-color:#B2BBD0;} +a.pickcolor:hover span.disabled {} + +/* Charmap */ +table.charmap {border:1px solid #AAA; text-align:center} +td.charmap, #charmap a {width:18px; height:18px; color:#000; border:1px solid #AAA; text-align:center; font-size:12px; vertical-align:middle; line-height: 18px;} +#charmap a {display:block; color:#000; text-decoration:none; border:0} +#charmap a:hover {background:#CCC;color:#2B6FB6} +#charmap #codeN {font-size:10px; font-family:Arial,Helvetica,sans-serif; text-align:center} +#charmap #codeV {font-size:40px; height:80px; border:1px solid #AAA; text-align:center} + +/* Source */ +.wordWrapCode {vertical-align:middle; border:1px none #000000; background:transparent;} +.mceActionPanel {margin-top:5px;} + +/* Tabs classes */ +.tabs {width:100%; height:18px; line-height:normal; background:url(../default/img/tabs.gif) repeat-x 0 -72px;} +.tabs ul {margin:0; padding:0; list-style:none;} +.tabs li {float:left; background:url(../default/img/tabs.gif) no-repeat 0 0; margin:0 2px 0 0; padding:0 0 0 10px; line-height:17px; height:18px; display:block;} +.tabs li.current {background:url(../default/img/tabs.gif) no-repeat 0 -18px; margin-right:2px;} +.tabs span {float:left; display:block; background:url(../default/img/tabs.gif) no-repeat right -36px; padding:0px 10px 0 0;} +.tabs .current span {background:url(../default/img/tabs.gif) no-repeat right -54px;} +.tabs a {text-decoration:none; font-family:Verdana, Arial; font-size:10px;} +.tabs a:link, .tabs a:visited, .tabs a:hover {color:black;} + +/* Panels */ +.panel_wrapper div.panel {display:none;} +.panel_wrapper div.current {display:block; width:100%; height:300px; overflow:visible;} +.panel_wrapper {border:1px solid #919B9C; border-top:0px; padding:10px; padding-top:5px; clear:both; background:white;} + +/* Columns */ +.column {float:left;} +.properties {width:100%;} +.properties .column1 {} +.properties .column2 {text-align:left;} + +/* Titles */ +h1, h2, h3, h4 {color:#2B6FB6; margin:0; padding:0; padding-top:5px;} +h3 {font-size:14px;} +.title {font-size:12px; font-weight:bold; color:#2B6FB6;} + +/* Dialog specific */ +#link .panel_wrapper, #link div.current {height:125px;} +#image .panel_wrapper, #image div.current {height:200px;} +#plugintable thead {font-weight:bold; background:#DDD;} +#plugintable, #about #plugintable td {border:1px solid #919B9C;} +#plugintable {width:96%; margin-top:10px;} +#pluginscontainer {height:290px; overflow:auto;} +#colorpicker #preview {float:right; width:50px; height:14px;line-height:1px; border:1px solid black; margin-left:5px;} +#colorpicker #colors {float:left; border:1px solid gray; cursor:crosshair;} +#colorpicker #light {border:1px solid gray; margin-left:5px; float:left;width:15px; height:150px; cursor:crosshair;} +#colorpicker #light div {overflow:hidden;} +#colorpicker #previewblock {float:right; padding-left:10px; height:20px;} +#colorpicker .panel_wrapper div.current {height:175px;} +#colorpicker #namedcolors {width:150px;} +#colorpicker #namedcolors a {display:block; float:left; width:10px; height:10px; margin:1px 1px 0 0; overflow:hidden;} +#colorpicker #colornamecontainer {margin-top:5px;} diff --git a/web/libs/tiny_mce/themes/advanced/skins/o2k7/img/button_bg.png b/web/libs/tiny_mce/themes/advanced/skins/o2k7/img/button_bg.png new file mode 100644 index 0000000..12cfb41 Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/skins/o2k7/img/button_bg.png differ diff --git a/web/libs/tiny_mce/themes/advanced/skins/o2k7/img/button_bg_black.png b/web/libs/tiny_mce/themes/advanced/skins/o2k7/img/button_bg_black.png new file mode 100644 index 0000000..8996c74 Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/skins/o2k7/img/button_bg_black.png differ diff --git a/web/libs/tiny_mce/themes/advanced/skins/o2k7/img/button_bg_silver.png b/web/libs/tiny_mce/themes/advanced/skins/o2k7/img/button_bg_silver.png new file mode 100644 index 0000000..bd5d255 Binary files /dev/null and b/web/libs/tiny_mce/themes/advanced/skins/o2k7/img/button_bg_silver.png differ diff --git a/web/libs/tiny_mce/themes/advanced/skins/o2k7/ui.css b/web/libs/tiny_mce/themes/advanced/skins/o2k7/ui.css new file mode 100644 index 0000000..a625397 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/skins/o2k7/ui.css @@ -0,0 +1,215 @@ +/* Reset */ +.o2k7Skin table, .o2k7Skin tbody, .o2k7Skin a, .o2k7Skin img, .o2k7Skin tr, .o2k7Skin div, .o2k7Skin td, .o2k7Skin iframe, .o2k7Skin span, .o2k7Skin *, .o2k7Skin .mceText {border:0; margin:0; padding:0; background:transparent; white-space:nowrap; text-decoration:none; font-weight:normal; cursor:default; color:#000; vertical-align:baseline; width:auto; border-collapse:separate; text-align:left} +.o2k7Skin a:hover, .o2k7Skin a:link, .o2k7Skin a:visited, .o2k7Skin a:active {text-decoration:none; font-weight:normal; cursor:default; color:#000} +.o2k7Skin table td {vertical-align:middle} + +/* Containers */ +.o2k7Skin table {background:#E5EFFD} +.o2k7Skin iframe {display:block; background:#FFF} +.o2k7Skin .mceToolbar {height:26px} + +/* External */ +.o2k7Skin .mceExternalToolbar {position:absolute; border:1px solid #ABC6DD; border-bottom:0; display:none} +.o2k7Skin .mceExternalToolbar td.mceToolbar {padding-right:13px;} +.o2k7Skin .mceExternalClose {position:absolute; top:3px; right:3px; width:7px; height:7px; background:url(../../img/icons.gif) -820px 0} + +/* Layout */ +.o2k7Skin table.mceLayout {border:0; border-left:1px solid #ABC6DD; border-right:1px solid #ABC6DD} +.o2k7Skin table.mceLayout tr.mceFirst td {border-top:1px solid #ABC6DD} +.o2k7Skin table.mceLayout tr.mceLast td {border-bottom:1px solid #ABC6DD} +.o2k7Skin table.mceToolbar, .o2k7Skin tr.mceFirst .mceToolbar tr td, .o2k7Skin tr.mceLast .mceToolbar tr td {border:0; margin:0; padding:0} +.o2k7Skin .mceIframeContainer {border-top:1px solid #ABC6DD; border-bottom:1px solid #ABC6DD} +.o2k7Skin .mceStatusbar {display:block; font-family:'MS Sans Serif',sans-serif,Verdana,Arial; font-size:9pt; line-height:16px; overflow:visible; color:#000; height:20px} +.o2k7Skin .mceStatusbar div {float:left; padding:2px} +.o2k7Skin .mceStatusbar a.mceResize {display:block; float:right; background:url(../../img/icons.gif) -800px 0; width:20px; height:20px; cursor:se-resize; outline:0} +.o2k7Skin .mceStatusbar a:hover {text-decoration:underline} +.o2k7Skin table.mceToolbar {margin-left:3px} +.o2k7Skin .mceToolbar .mceToolbarStart span {display:block; background:url(img/button_bg.png) -22px 0; width:1px; height:22px; margin-left:3px;} +.o2k7Skin .mceToolbar td.mceFirst span {margin:0} +.o2k7Skin .mceToolbar .mceToolbarEnd span {display:block; background:url(img/button_bg.png) -22px 0; width:1px; height:22px} +.o2k7Skin .mceToolbar .mceToolbarEndListBox span, .o2k7Skin .mceToolbar .mceToolbarStartListBox span {display:none} +.o2k7Skin span.mceIcon, .o2k7Skin img.mceIcon {display:block; width:20px; height:20px} +.o2k7Skin .mceIcon {background:url(../../img/icons.gif) no-repeat 20px 20px} +.o2k7Skin td.mceCenter {text-align:center;} +.o2k7Skin td.mceCenter table {margin:0 auto; text-align:left;} +.o2k7Skin td.mceRight table {margin:0 0 0 auto;} + +/* Button */ +.o2k7Skin .mceButton {display:block; background:url(img/button_bg.png); width:22px; height:22px} +.o2k7Skin a.mceButton span, .o2k7Skin a.mceButton img {margin-left:1px} +.o2k7Skin .mceOldBoxModel a.mceButton span, .o2k7Skin .mceOldBoxModel a.mceButton img {margin:0 0 0 1px} +.o2k7Skin a.mceButtonEnabled:hover {background-color:#B2BBD0; background-position:0 -22px} +.o2k7Skin a.mceButtonActive, .o2k7Skin a.mceButtonSelected {background-position:0 -44px} +.o2k7Skin .mceButtonDisabled .mceIcon {opacity:0.3; -ms-filter:'alpha(opacity=30)'; filter:alpha(opacity=30)} +.o2k7Skin .mceButtonLabeled {width:auto} +.o2k7Skin .mceButtonLabeled span.mceIcon {float:left} +.o2k7Skin span.mceButtonLabel {display:block; font-size:10px; padding:4px 6px 0 22px; font-family:Tahoma,Verdana,Arial,Helvetica} +.o2k7Skin .mceButtonDisabled .mceButtonLabel {color:#888} + +/* Separator */ +.o2k7Skin .mceSeparator {display:block; background:url(img/button_bg.png) -22px 0; width:5px; height:22px} + +/* ListBox */ +.o2k7Skin .mceListBox {margin-left:3px} +.o2k7Skin .mceListBox, .o2k7Skin .mceListBox a {display:block} +.o2k7Skin .mceListBox .mceText {padding-left:4px; text-align:left; width:70px; border:1px solid #b3c7e1; border-right:0; background:#eaf2fb; font-family:Tahoma,Verdana,Arial,Helvetica; font-size:11px; height:20px; line-height:20px; overflow:hidden} +.o2k7Skin .mceListBox .mceOpen {width:14px; height:22px; background:url(img/button_bg.png) -66px 0} +.o2k7Skin table.mceListBoxEnabled:hover .mceText, .o2k7Skin .mceListBoxHover .mceText, .o2k7Skin .mceListBoxSelected .mceText {background:#FFF} +.o2k7Skin table.mceListBoxEnabled:hover .mceOpen, .o2k7Skin .mceListBoxHover .mceOpen, .o2k7Skin .mceListBoxSelected .mceOpen {background-position:-66px -22px} +.o2k7Skin .mceListBoxDisabled .mceText {color:gray} +.o2k7Skin .mceListBoxMenu {overflow:auto; overflow-x:hidden} +.o2k7Skin .mceOldBoxModel .mceListBox .mceText {height:22px} +.o2k7Skin select.mceListBox {font-family:Tahoma,Verdana,Arial,Helvetica; font-size:12px; border:1px solid #b3c7e1; background:#FFF;} + +/* SplitButton */ +.o2k7Skin .mceSplitButton, .o2k7Skin .mceSplitButton a, .o2k7Skin .mceSplitButton span {display:block; height:22px} +.o2k7Skin .mceSplitButton {background:url(img/button_bg.png)} +.o2k7Skin .mceSplitButton a.mceAction {width:22px} +.o2k7Skin .mceSplitButton span.mceAction {width:22px; background-image:url(../../img/icons.gif)} +.o2k7Skin .mceSplitButton a.mceOpen {width:10px; background:url(img/button_bg.png) -44px 0} +.o2k7Skin .mceSplitButton span.mceOpen {display:none} +.o2k7Skin table.mceSplitButtonEnabled:hover a.mceAction, .o2k7Skin .mceSplitButtonHover a.mceAction, .o2k7Skin .mceSplitButtonSelected {background:url(img/button_bg.png) 0 -22px} +.o2k7Skin table.mceSplitButtonEnabled:hover a.mceOpen, .o2k7Skin .mceSplitButtonHover a.mceOpen, .o2k7Skin .mceSplitButtonSelected a.mceOpen {background-position:-44px -44px} +.o2k7Skin .mceSplitButtonDisabled .mceAction {opacity:0.3; -ms-filter:'alpha(opacity=30)'; filter:alpha(opacity=30)} +.o2k7Skin .mceSplitButtonActive {background-position:0 -44px} + +/* ColorSplitButton */ +.o2k7Skin div.mceColorSplitMenu table {background:#FFF; border:1px solid gray} +.o2k7Skin .mceColorSplitMenu td {padding:2px} +.o2k7Skin .mceColorSplitMenu a {display:block; width:9px; height:9px; overflow:hidden; border:1px solid #808080} +.o2k7Skin .mceColorSplitMenu td.mceMoreColors {padding:1px 3px 1px 1px} +.o2k7Skin .mceColorSplitMenu a.mceMoreColors {width:100%; height:auto; text-align:center; font-family:Tahoma,Verdana,Arial,Helvetica; font-size:11px; line-height:20px; border:1px solid #FFF} +.o2k7Skin .mceColorSplitMenu a.mceMoreColors:hover {border:1px solid #0A246A; background-color:#B6BDD2} +.o2k7Skin a.mceMoreColors:hover {border:1px solid #0A246A} +.o2k7Skin .mceColorPreview {margin-left:2px; width:16px; height:4px; overflow:hidden; background:#9a9b9a;overflow:hidden} +.o2k7Skin .mce_forecolor span.mceAction, .o2k7Skin .mce_backcolor span.mceAction {height:15px;overflow:hidden} + +/* Menu */ +.o2k7Skin .mceMenu {position:absolute; left:0; top:0; z-index:1000; border:1px solid #ABC6DD} +.o2k7Skin .mceNoIcons span.mceIcon {width:0;} +.o2k7Skin .mceNoIcons a .mceText {padding-left:10px} +.o2k7Skin .mceMenu table {background:#FFF} +.o2k7Skin .mceMenu a, .o2k7Skin .mceMenu span, .o2k7Skin .mceMenu {display:block} +.o2k7Skin .mceMenu td {height:20px} +.o2k7Skin .mceMenu a {position:relative;padding:3px 0 4px 0} +.o2k7Skin .mceMenu .mceText {position:relative; display:block; font-family:Tahoma,Verdana,Arial,Helvetica; color:#000; cursor:default; margin:0; padding:0 25px 0 25px; display:block} +.o2k7Skin .mceMenu span.mceText, .o2k7Skin .mceMenu .mcePreview {font-size:11px} +.o2k7Skin .mceMenu pre.mceText {font-family:Monospace} +.o2k7Skin .mceMenu .mceIcon {position:absolute; top:0; left:0; width:22px;} +.o2k7Skin .mceMenu .mceMenuItemEnabled a:hover, .o2k7Skin .mceMenu .mceMenuItemActive {background-color:#dbecf3} +.o2k7Skin td.mceMenuItemSeparator {background:#DDD; height:1px} +.o2k7Skin .mceMenuItemTitle a {border:0; background:#E5EFFD; border-bottom:1px solid #ABC6DD} +.o2k7Skin .mceMenuItemTitle span.mceText {color:#000; font-weight:bold; padding-left:4px} +.o2k7Skin .mceMenuItemDisabled .mceText {color:#888} +.o2k7Skin .mceMenuItemSelected .mceIcon {background:url(../default/img/menu_check.gif)} +.o2k7Skin .mceNoIcons .mceMenuItemSelected a {background:url(../default/img/menu_arrow.gif) no-repeat -6px center} +.o2k7Skin .mceMenu span.mceMenuLine {display:none} +.o2k7Skin .mceMenuItemSub a {background:url(../default/img/menu_arrow.gif) no-repeat top right;} + +/* Progress,Resize */ +.o2k7Skin .mceBlocker {position:absolute; left:0; top:0; z-index:1000; opacity:0.5; -ms-filter:'alpha(opacity=30)'; filter:alpha(opacity=50); background:#FFF} +.o2k7Skin .mceProgress {position:absolute; left:0; top:0; z-index:1001; background:url(../default/img/progress.gif) no-repeat; width:32px; height:32px; margin:-16px 0 0 -16px} + +/* Formats */ +.o2k7Skin .mce_formatPreview a {font-size:10px} +.o2k7Skin .mce_p span.mceText {} +.o2k7Skin .mce_address span.mceText {font-style:italic} +.o2k7Skin .mce_pre span.mceText {font-family:monospace} +.o2k7Skin .mce_h1 span.mceText {font-weight:bolder; font-size: 2em} +.o2k7Skin .mce_h2 span.mceText {font-weight:bolder; font-size: 1.5em} +.o2k7Skin .mce_h3 span.mceText {font-weight:bolder; font-size: 1.17em} +.o2k7Skin .mce_h4 span.mceText {font-weight:bolder; font-size: 1em} +.o2k7Skin .mce_h5 span.mceText {font-weight:bolder; font-size: .83em} +.o2k7Skin .mce_h6 span.mceText {font-weight:bolder; font-size: .75em} + +/* Theme */ +.o2k7Skin span.mce_bold {background-position:0 0} +.o2k7Skin span.mce_italic {background-position:-60px 0} +.o2k7Skin span.mce_underline {background-position:-140px 0} +.o2k7Skin span.mce_strikethrough {background-position:-120px 0} +.o2k7Skin span.mce_undo {background-position:-160px 0} +.o2k7Skin span.mce_redo {background-position:-100px 0} +.o2k7Skin span.mce_cleanup {background-position:-40px 0} +.o2k7Skin span.mce_bullist {background-position:-20px 0} +.o2k7Skin span.mce_numlist {background-position:-80px 0} +.o2k7Skin span.mce_justifyleft {background-position:-460px 0} +.o2k7Skin span.mce_justifyright {background-position:-480px 0} +.o2k7Skin span.mce_justifycenter {background-position:-420px 0} +.o2k7Skin span.mce_justifyfull {background-position:-440px 0} +.o2k7Skin span.mce_anchor {background-position:-200px 0} +.o2k7Skin span.mce_indent {background-position:-400px 0} +.o2k7Skin span.mce_outdent {background-position:-540px 0} +.o2k7Skin span.mce_link {background-position:-500px 0} +.o2k7Skin span.mce_unlink {background-position:-640px 0} +.o2k7Skin span.mce_sub {background-position:-600px 0} +.o2k7Skin span.mce_sup {background-position:-620px 0} +.o2k7Skin span.mce_removeformat {background-position:-580px 0} +.o2k7Skin span.mce_newdocument {background-position:-520px 0} +.o2k7Skin span.mce_image {background-position:-380px 0} +.o2k7Skin span.mce_help {background-position:-340px 0} +.o2k7Skin span.mce_code {background-position:-260px 0} +.o2k7Skin span.mce_hr {background-position:-360px 0} +.o2k7Skin span.mce_visualaid {background-position:-660px 0} +.o2k7Skin span.mce_charmap {background-position:-240px 0} +.o2k7Skin span.mce_paste {background-position:-560px 0} +.o2k7Skin span.mce_copy {background-position:-700px 0} +.o2k7Skin span.mce_cut {background-position:-680px 0} +.o2k7Skin span.mce_blockquote {background-position:-220px 0} +.o2k7Skin .mce_forecolor span.mceAction {background-position:-720px 0} +.o2k7Skin .mce_backcolor span.mceAction {background-position:-760px 0} +.o2k7Skin span.mce_forecolorpicker {background-position:-720px 0} +.o2k7Skin span.mce_backcolorpicker {background-position:-760px 0} + +/* Plugins */ +.o2k7Skin span.mce_advhr {background-position:-0px -20px} +.o2k7Skin span.mce_ltr {background-position:-20px -20px} +.o2k7Skin span.mce_rtl {background-position:-40px -20px} +.o2k7Skin span.mce_emotions {background-position:-60px -20px} +.o2k7Skin span.mce_fullpage {background-position:-80px -20px} +.o2k7Skin span.mce_fullscreen {background-position:-100px -20px} +.o2k7Skin span.mce_iespell {background-position:-120px -20px} +.o2k7Skin span.mce_insertdate {background-position:-140px -20px} +.o2k7Skin span.mce_inserttime {background-position:-160px -20px} +.o2k7Skin span.mce_absolute {background-position:-180px -20px} +.o2k7Skin span.mce_backward {background-position:-200px -20px} +.o2k7Skin span.mce_forward {background-position:-220px -20px} +.o2k7Skin span.mce_insert_layer {background-position:-240px -20px} +.o2k7Skin span.mce_insertlayer {background-position:-260px -20px} +.o2k7Skin span.mce_movebackward {background-position:-280px -20px} +.o2k7Skin span.mce_moveforward {background-position:-300px -20px} +.o2k7Skin span.mce_media {background-position:-320px -20px} +.o2k7Skin span.mce_nonbreaking {background-position:-340px -20px} +.o2k7Skin span.mce_pastetext {background-position:-360px -20px} +.o2k7Skin span.mce_pasteword {background-position:-380px -20px} +.o2k7Skin span.mce_selectall {background-position:-400px -20px} +.o2k7Skin span.mce_preview {background-position:-420px -20px} +.o2k7Skin span.mce_print {background-position:-440px -20px} +.o2k7Skin span.mce_cancel {background-position:-460px -20px} +.o2k7Skin span.mce_save {background-position:-480px -20px} +.o2k7Skin span.mce_replace {background-position:-500px -20px} +.o2k7Skin span.mce_search {background-position:-520px -20px} +.o2k7Skin span.mce_styleprops {background-position:-560px -20px} +.o2k7Skin span.mce_table {background-position:-580px -20px} +.o2k7Skin span.mce_cell_props {background-position:-600px -20px} +.o2k7Skin span.mce_delete_table {background-position:-620px -20px} +.o2k7Skin span.mce_delete_col {background-position:-640px -20px} +.o2k7Skin span.mce_delete_row {background-position:-660px -20px} +.o2k7Skin span.mce_col_after {background-position:-680px -20px} +.o2k7Skin span.mce_col_before {background-position:-700px -20px} +.o2k7Skin span.mce_row_after {background-position:-720px -20px} +.o2k7Skin span.mce_row_before {background-position:-740px -20px} +.o2k7Skin span.mce_merge_cells {background-position:-760px -20px} +.o2k7Skin span.mce_table_props {background-position:-980px -20px} +.o2k7Skin span.mce_row_props {background-position:-780px -20px} +.o2k7Skin span.mce_split_cells {background-position:-800px -20px} +.o2k7Skin span.mce_template {background-position:-820px -20px} +.o2k7Skin span.mce_visualchars {background-position:-840px -20px} +.o2k7Skin span.mce_abbr {background-position:-860px -20px} +.o2k7Skin span.mce_acronym {background-position:-880px -20px} +.o2k7Skin span.mce_attribs {background-position:-900px -20px} +.o2k7Skin span.mce_cite {background-position:-920px -20px} +.o2k7Skin span.mce_del {background-position:-940px -20px} +.o2k7Skin span.mce_ins {background-position:-960px -20px} +.o2k7Skin span.mce_pagebreak {background-position:0 -40px} +.o2k7Skin span.mce_restoredraft {background-position:-20px -40px} +.o2k7Skin span.mce_spellchecker {background-position:-540px -20px} diff --git a/web/libs/tiny_mce/themes/advanced/skins/o2k7/ui_black.css b/web/libs/tiny_mce/themes/advanced/skins/o2k7/ui_black.css new file mode 100644 index 0000000..153f0c3 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/skins/o2k7/ui_black.css @@ -0,0 +1,8 @@ +/* Black */ +.o2k7SkinBlack .mceToolbar .mceToolbarStart span, .o2k7SkinBlack .mceToolbar .mceToolbarEnd span, .o2k7SkinBlack .mceButton, .o2k7SkinBlack .mceSplitButton, .o2k7SkinBlack .mceSeparator, .o2k7SkinBlack .mceSplitButton a.mceOpen, .o2k7SkinBlack .mceListBox a.mceOpen {background-image:url(img/button_bg_black.png)} +.o2k7SkinBlack table, .o2k7SkinBlack .mceMenuItemTitle a, .o2k7SkinBlack .mceMenuItemTitle span.mceText, .o2k7SkinBlack .mceStatusbar div, .o2k7SkinBlack .mceStatusbar span, .o2k7SkinBlack .mceStatusbar a {background:#535353; color:#FFF} +.o2k7SkinBlack table.mceListBoxEnabled .mceText, o2k7SkinBlack .mceListBox .mceText {background:#FFF; border:1px solid #CBCFD4; border-bottom-color:#989FA9; border-right:0} +.o2k7SkinBlack table.mceListBoxEnabled:hover .mceText, .o2k7SkinBlack .mceListBoxHover .mceText, .o2k7SkinBlack .mceListBoxSelected .mceText {background:#FFF; border:1px solid #FFBD69; border-right:0} +.o2k7SkinBlack .mceExternalToolbar, .o2k7SkinBlack .mceListBox .mceText, .o2k7SkinBlack div.mceMenu, .o2k7SkinBlack table.mceLayout, .o2k7SkinBlack .mceMenuItemTitle a, .o2k7SkinBlack table.mceLayout tr.mceFirst td, .o2k7SkinBlack table.mceLayout, .o2k7SkinBlack .mceMenuItemTitle a, .o2k7SkinBlack table.mceLayout tr.mceLast td, .o2k7SkinBlack .mceIframeContainer {border-color: #535353;} +.o2k7SkinBlack table.mceSplitButtonEnabled:hover a.mceAction, .o2k7SkinBlack .mceSplitButtonHover a.mceAction, .o2k7SkinBlack .mceSplitButtonSelected {background-image:url(img/button_bg_black.png)} +.o2k7SkinBlack .mceMenu .mceMenuItemEnabled a:hover, .o2k7SkinBlack .mceMenu .mceMenuItemActive {background-color:#FFE7A1} \ No newline at end of file diff --git a/web/libs/tiny_mce/themes/advanced/skins/o2k7/ui_silver.css b/web/libs/tiny_mce/themes/advanced/skins/o2k7/ui_silver.css new file mode 100644 index 0000000..7fe3b45 --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/skins/o2k7/ui_silver.css @@ -0,0 +1,5 @@ +/* Silver */ +.o2k7SkinSilver .mceToolbar .mceToolbarStart span, .o2k7SkinSilver .mceButton, .o2k7SkinSilver .mceSplitButton, .o2k7SkinSilver .mceSeparator, .o2k7SkinSilver .mceSplitButton a.mceOpen, .o2k7SkinSilver .mceListBox a.mceOpen {background-image:url(img/button_bg_silver.png)} +.o2k7SkinSilver table, .o2k7SkinSilver .mceMenuItemTitle a {background:#eee} +.o2k7SkinSilver .mceListBox .mceText {background:#FFF} +.o2k7SkinSilver .mceExternalToolbar, .o2k7SkinSilver .mceListBox .mceText, .o2k7SkinSilver div.mceMenu, .o2k7SkinSilver table.mceLayout, .o2k7SkinSilver .mceMenuItemTitle a, .o2k7SkinSilver table.mceLayout tr.mceFirst td, .o2k7SkinSilver table.mceLayout, .o2k7SkinSilver .mceMenuItemTitle a, .o2k7SkinSilver table.mceLayout tr.mceLast td, .o2k7SkinSilver .mceIframeContainer {border-color: #bbb} diff --git a/web/libs/tiny_mce/themes/advanced/source_editor.htm b/web/libs/tiny_mce/themes/advanced/source_editor.htm new file mode 100644 index 0000000..5957bbd --- /dev/null +++ b/web/libs/tiny_mce/themes/advanced/source_editor.htm @@ -0,0 +1,25 @@ + + + {#advanced_dlg.code_title} + + + + +
+
{#advanced_dlg.code_title}
+ +
+ +
+ +
+ + + +
+ + +
+
+ + diff --git a/web/libs/tiny_mce/themes/simple/editor_template.js b/web/libs/tiny_mce/themes/simple/editor_template.js new file mode 100644 index 0000000..ed89abc --- /dev/null +++ b/web/libs/tiny_mce/themes/simple/editor_template.js @@ -0,0 +1 @@ +(function(){var a=tinymce.DOM;tinymce.ThemeManager.requireLangPack("simple");tinymce.create("tinymce.themes.SimpleTheme",{init:function(c,d){var e=this,b=["Bold","Italic","Underline","Strikethrough","InsertUnorderedList","InsertOrderedList"],f=c.settings;e.editor=c;c.onInit.add(function(){c.onNodeChange.add(function(h,g){tinymce.each(b,function(i){g.get(i.toLowerCase()).setActive(h.queryCommandState(i))})});c.dom.loadCSS(d+"/skins/"+f.skin+"/content.css")});a.loadCSS((f.editor_css?c.documentBaseURI.toAbsolute(f.editor_css):"")||d+"/skins/"+f.skin+"/ui.css")},renderUI:function(h){var e=this,i=h.targetNode,b,c,d=e.editor,f=d.controlManager,g;i=a.insertAfter(a.create("span",{id:d.id+"_container","class":"mceEditor "+d.settings.skin+"SimpleSkin"}),i);i=g=a.add(i,"table",{cellPadding:0,cellSpacing:0,"class":"mceLayout"});i=c=a.add(i,"tbody");i=a.add(c,"tr");i=b=a.add(a.add(i,"td"),"div",{"class":"mceIframeContainer"});i=a.add(a.add(c,"tr",{"class":"last"}),"td",{"class":"mceToolbar mceLast",align:"center"});c=e.toolbar=f.createToolbar("tools1");c.add(f.createButton("bold",{title:"simple.bold_desc",cmd:"Bold"}));c.add(f.createButton("italic",{title:"simple.italic_desc",cmd:"Italic"}));c.add(f.createButton("underline",{title:"simple.underline_desc",cmd:"Underline"}));c.add(f.createButton("strikethrough",{title:"simple.striketrough_desc",cmd:"Strikethrough"}));c.add(f.createSeparator());c.add(f.createButton("undo",{title:"simple.undo_desc",cmd:"Undo"}));c.add(f.createButton("redo",{title:"simple.redo_desc",cmd:"Redo"}));c.add(f.createSeparator());c.add(f.createButton("cleanup",{title:"simple.cleanup_desc",cmd:"mceCleanup"}));c.add(f.createSeparator());c.add(f.createButton("insertunorderedlist",{title:"simple.bullist_desc",cmd:"InsertUnorderedList"}));c.add(f.createButton("insertorderedlist",{title:"simple.numlist_desc",cmd:"InsertOrderedList"}));c.renderTo(i);return{iframeContainer:b,editorContainer:d.id+"_container",sizeContainer:g,deltaHeight:-20}},getInfo:function(){return{longname:"Simple theme",author:"Moxiecode Systems AB",authorurl:"http://tinymce.moxiecode.com",version:tinymce.majorVersion+"."+tinymce.minorVersion}}});tinymce.ThemeManager.add("simple",tinymce.themes.SimpleTheme)})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/themes/simple/editor_template_src.js b/web/libs/tiny_mce/themes/simple/editor_template_src.js new file mode 100644 index 0000000..4b862d4 --- /dev/null +++ b/web/libs/tiny_mce/themes/simple/editor_template_src.js @@ -0,0 +1,85 @@ +/** + * editor_template_src.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +(function() { + var DOM = tinymce.DOM; + + // Tell it to load theme specific language pack(s) + tinymce.ThemeManager.requireLangPack('simple'); + + tinymce.create('tinymce.themes.SimpleTheme', { + init : function(ed, url) { + var t = this, states = ['Bold', 'Italic', 'Underline', 'Strikethrough', 'InsertUnorderedList', 'InsertOrderedList'], s = ed.settings; + + t.editor = ed; + + ed.onInit.add(function() { + ed.onNodeChange.add(function(ed, cm) { + tinymce.each(states, function(c) { + cm.get(c.toLowerCase()).setActive(ed.queryCommandState(c)); + }); + }); + + ed.dom.loadCSS(url + "/skins/" + s.skin + "/content.css"); + }); + + DOM.loadCSS((s.editor_css ? ed.documentBaseURI.toAbsolute(s.editor_css) : '') || url + "/skins/" + s.skin + "/ui.css"); + }, + + renderUI : function(o) { + var t = this, n = o.targetNode, ic, tb, ed = t.editor, cf = ed.controlManager, sc; + + n = DOM.insertAfter(DOM.create('span', {id : ed.id + '_container', 'class' : 'mceEditor ' + ed.settings.skin + 'SimpleSkin'}), n); + n = sc = DOM.add(n, 'table', {cellPadding : 0, cellSpacing : 0, 'class' : 'mceLayout'}); + n = tb = DOM.add(n, 'tbody'); + + // Create iframe container + n = DOM.add(tb, 'tr'); + n = ic = DOM.add(DOM.add(n, 'td'), 'div', {'class' : 'mceIframeContainer'}); + + // Create toolbar container + n = DOM.add(DOM.add(tb, 'tr', {'class' : 'last'}), 'td', {'class' : 'mceToolbar mceLast', align : 'center'}); + + // Create toolbar + tb = t.toolbar = cf.createToolbar("tools1"); + tb.add(cf.createButton('bold', {title : 'simple.bold_desc', cmd : 'Bold'})); + tb.add(cf.createButton('italic', {title : 'simple.italic_desc', cmd : 'Italic'})); + tb.add(cf.createButton('underline', {title : 'simple.underline_desc', cmd : 'Underline'})); + tb.add(cf.createButton('strikethrough', {title : 'simple.striketrough_desc', cmd : 'Strikethrough'})); + tb.add(cf.createSeparator()); + tb.add(cf.createButton('undo', {title : 'simple.undo_desc', cmd : 'Undo'})); + tb.add(cf.createButton('redo', {title : 'simple.redo_desc', cmd : 'Redo'})); + tb.add(cf.createSeparator()); + tb.add(cf.createButton('cleanup', {title : 'simple.cleanup_desc', cmd : 'mceCleanup'})); + tb.add(cf.createSeparator()); + tb.add(cf.createButton('insertunorderedlist', {title : 'simple.bullist_desc', cmd : 'InsertUnorderedList'})); + tb.add(cf.createButton('insertorderedlist', {title : 'simple.numlist_desc', cmd : 'InsertOrderedList'})); + tb.renderTo(n); + + return { + iframeContainer : ic, + editorContainer : ed.id + '_container', + sizeContainer : sc, + deltaHeight : -20 + }; + }, + + getInfo : function() { + return { + longname : 'Simple theme', + author : 'Moxiecode Systems AB', + authorurl : 'http://tinymce.moxiecode.com', + version : tinymce.majorVersion + "." + tinymce.minorVersion + } + } + }); + + tinymce.ThemeManager.add('simple', tinymce.themes.SimpleTheme); +})(); \ No newline at end of file diff --git a/web/libs/tiny_mce/themes/simple/img/icons.gif b/web/libs/tiny_mce/themes/simple/img/icons.gif new file mode 100644 index 0000000..16af141 Binary files /dev/null and b/web/libs/tiny_mce/themes/simple/img/icons.gif differ diff --git a/web/libs/tiny_mce/themes/simple/langs/en.js b/web/libs/tiny_mce/themes/simple/langs/en.js new file mode 100644 index 0000000..9f08f10 --- /dev/null +++ b/web/libs/tiny_mce/themes/simple/langs/en.js @@ -0,0 +1,11 @@ +tinyMCE.addI18n('en.simple',{ +bold_desc:"Bold (Ctrl+B)", +italic_desc:"Italic (Ctrl+I)", +underline_desc:"Underline (Ctrl+U)", +striketrough_desc:"Strikethrough", +bullist_desc:"Unordered list", +numlist_desc:"Ordered list", +undo_desc:"Undo (Ctrl+Z)", +redo_desc:"Redo (Ctrl+Y)", +cleanup_desc:"Cleanup messy code" +}); \ No newline at end of file diff --git a/web/libs/tiny_mce/themes/simple/skins/default/content.css b/web/libs/tiny_mce/themes/simple/skins/default/content.css new file mode 100644 index 0000000..2506c80 --- /dev/null +++ b/web/libs/tiny_mce/themes/simple/skins/default/content.css @@ -0,0 +1,25 @@ +body, td, pre { + font-family: Verdana, Arial, Helvetica, sans-serif; + font-size: 10px; +} + +body { + background-color: #FFFFFF; +} + +.mceVisualAid { + border: 1px dashed #BBBBBB; +} + +/* MSIE specific */ + +* html body { + scrollbar-3dlight-color: #F0F0EE; + scrollbar-arrow-color: #676662; + scrollbar-base-color: #F0F0EE; + scrollbar-darkshadow-color: #DDDDDD; + scrollbar-face-color: #E0E0DD; + scrollbar-highlight-color: #F0F0EE; + scrollbar-shadow-color: #F0F0EE; + scrollbar-track-color: #F5F5F5; +} diff --git a/web/libs/tiny_mce/themes/simple/skins/default/ui.css b/web/libs/tiny_mce/themes/simple/skins/default/ui.css new file mode 100644 index 0000000..076fe84 --- /dev/null +++ b/web/libs/tiny_mce/themes/simple/skins/default/ui.css @@ -0,0 +1,32 @@ +/* Reset */ +.defaultSimpleSkin table, .defaultSimpleSkin tbody, .defaultSimpleSkin a, .defaultSimpleSkin img, .defaultSimpleSkin tr, .defaultSimpleSkin div, .defaultSimpleSkin td, .defaultSimpleSkin iframe, .defaultSimpleSkin span, .defaultSimpleSkin * {border:0; margin:0; padding:0; background:transparent; white-space:nowrap; text-decoration:none; font-weight:normal; cursor:default; color:#000} + +/* Containers */ +.defaultSimpleSkin {position:relative} +.defaultSimpleSkin table.mceLayout {background:#F0F0EE; border:1px solid #CCC;} +.defaultSimpleSkin iframe {display:block; background:#FFF; border-bottom:1px solid #CCC;} +.defaultSimpleSkin .mceToolbar {height:24px;} + +/* Layout */ +.defaultSimpleSkin span.mceIcon, .defaultSimpleSkin img.mceIcon {display:block; width:20px; height:20px} +.defaultSimpleSkin .mceIcon {background:url(../../img/icons.gif) no-repeat 20px 20px} + +/* Button */ +.defaultSimpleSkin .mceButton {display:block; border:1px solid #F0F0EE; width:20px; height:20px} +.defaultSimpleSkin a.mceButtonEnabled:hover {border:1px solid #0A246A; background-color:#B2BBD0} +.defaultSimpleSkin a.mceButtonActive {border:1px solid #0A246A; background-color:#C2CBE0} +.defaultSimpleSkin .mceButtonDisabled span {opacity:0.3; -ms-filter:'alpha(opacity=30)'; filter:alpha(opacity=30)} + +/* Separator */ +.defaultSimpleSkin .mceSeparator {display:block; background:url(../../img/icons.gif) -180px 0; width:2px; height:20px; margin:0 2px 0 4px} + +/* Theme */ +.defaultSimpleSkin span.mce_bold {background-position:0 0} +.defaultSimpleSkin span.mce_italic {background-position:-60px 0} +.defaultSimpleSkin span.mce_underline {background-position:-140px 0} +.defaultSimpleSkin span.mce_strikethrough {background-position:-120px 0} +.defaultSimpleSkin span.mce_undo {background-position:-160px 0} +.defaultSimpleSkin span.mce_redo {background-position:-100px 0} +.defaultSimpleSkin span.mce_cleanup {background-position:-40px 0} +.defaultSimpleSkin span.mce_insertunorderedlist {background-position:-20px 0} +.defaultSimpleSkin span.mce_insertorderedlist {background-position:-80px 0} diff --git a/web/libs/tiny_mce/themes/simple/skins/o2k7/content.css b/web/libs/tiny_mce/themes/simple/skins/o2k7/content.css new file mode 100644 index 0000000..595809f --- /dev/null +++ b/web/libs/tiny_mce/themes/simple/skins/o2k7/content.css @@ -0,0 +1,17 @@ +body, td, pre {font-family:Verdana, Arial, Helvetica, sans-serif; font-size:10px;} + +body {background: #FFF;} +.mceVisualAid {border: 1px dashed #BBB;} + +/* IE */ + +* html body { +scrollbar-3dlight-color: #F0F0EE; +scrollbar-arrow-color: #676662; +scrollbar-base-color: #F0F0EE; +scrollbar-darkshadow-color: #DDDDDD; +scrollbar-face-color: #E0E0DD; +scrollbar-highlight-color: #F0F0EE; +scrollbar-shadow-color: #F0F0EE; +scrollbar-track-color: #F5F5F5; +} diff --git a/web/libs/tiny_mce/themes/simple/skins/o2k7/img/button_bg.png b/web/libs/tiny_mce/themes/simple/skins/o2k7/img/button_bg.png new file mode 100644 index 0000000..527e349 Binary files /dev/null and b/web/libs/tiny_mce/themes/simple/skins/o2k7/img/button_bg.png differ diff --git a/web/libs/tiny_mce/themes/simple/skins/o2k7/ui.css b/web/libs/tiny_mce/themes/simple/skins/o2k7/ui.css new file mode 100644 index 0000000..cf6c35d --- /dev/null +++ b/web/libs/tiny_mce/themes/simple/skins/o2k7/ui.css @@ -0,0 +1,35 @@ +/* Reset */ +.o2k7SimpleSkin table, .o2k7SimpleSkin tbody, .o2k7SimpleSkin a, .o2k7SimpleSkin img, .o2k7SimpleSkin tr, .o2k7SimpleSkin div, .o2k7SimpleSkin td, .o2k7SimpleSkin iframe, .o2k7SimpleSkin span, .o2k7SimpleSkin * {border:0; margin:0; padding:0; background:transparent; white-space:nowrap; text-decoration:none; font-weight:normal; cursor:default; color:#000} + +/* Containers */ +.o2k7SimpleSkin {position:relative} +.o2k7SimpleSkin table.mceLayout {background:#E5EFFD; border:1px solid #ABC6DD;} +.o2k7SimpleSkin iframe {display:block; background:#FFF; border-bottom:1px solid #ABC6DD;} +.o2k7SimpleSkin .mceToolbar {height:26px;} + +/* Layout */ +.o2k7SimpleSkin .mceToolbar .mceToolbarStart span {display:block; background:url(img/button_bg.png) -22px 0; width:1px; height:22px; } +.o2k7SimpleSkin .mceToolbar .mceToolbarEnd span {display:block; background:url(img/button_bg.png) -22px 0; width:1px; height:22px} +.o2k7SimpleSkin span.mceIcon, .o2k7SimpleSkin img.mceIcon {display:block; width:20px; height:20px} +.o2k7SimpleSkin .mceIcon {background:url(../../img/icons.gif) no-repeat 20px 20px} + +/* Button */ +.o2k7SimpleSkin .mceButton {display:block; background:url(img/button_bg.png); width:22px; height:22px} +.o2k7SimpleSkin a.mceButton span, .o2k7SimpleSkin a.mceButton img {margin:1px 0 0 1px} +.o2k7SimpleSkin a.mceButtonEnabled:hover {background-color:#B2BBD0; background-position:0 -22px} +.o2k7SimpleSkin a.mceButtonActive {background-position:0 -44px} +.o2k7SimpleSkin .mceButtonDisabled span {opacity:0.3; -ms-filter:'alpha(opacity=30)'; filter:alpha(opacity=30)} + +/* Separator */ +.o2k7SimpleSkin .mceSeparator {display:block; background:url(img/button_bg.png) -22px 0; width:5px; height:22px} + +/* Theme */ +.o2k7SimpleSkin span.mce_bold {background-position:0 0} +.o2k7SimpleSkin span.mce_italic {background-position:-60px 0} +.o2k7SimpleSkin span.mce_underline {background-position:-140px 0} +.o2k7SimpleSkin span.mce_strikethrough {background-position:-120px 0} +.o2k7SimpleSkin span.mce_undo {background-position:-160px 0} +.o2k7SimpleSkin span.mce_redo {background-position:-100px 0} +.o2k7SimpleSkin span.mce_cleanup {background-position:-40px 0} +.o2k7SimpleSkin span.mce_insertunorderedlist {background-position:-20px 0} +.o2k7SimpleSkin span.mce_insertorderedlist {background-position:-80px 0} diff --git a/web/libs/tiny_mce/tiny_mce.js b/web/libs/tiny_mce/tiny_mce.js new file mode 100644 index 0000000..14d3570 --- /dev/null +++ b/web/libs/tiny_mce/tiny_mce.js @@ -0,0 +1 @@ +(function(c){var a=/^\s*|\s*$/g,d;var b={majorVersion:"3",minorVersion:"3.8",releaseDate:"2010-06-30",_init:function(){var r=this,o=document,m=navigator,f=m.userAgent,l,e,k,j,h,q;r.isOpera=c.opera&&opera.buildNumber;r.isWebKit=/WebKit/.test(f);r.isIE=!r.isWebKit&&!r.isOpera&&(/MSIE/gi).test(f)&&(/Explorer/gi).test(m.appName);r.isIE6=r.isIE&&/MSIE [56]/.test(f);r.isGecko=!r.isWebKit&&/Gecko/.test(f);r.isMac=f.indexOf("Mac")!=-1;r.isAir=/adobeair/i.test(f);r.isIDevice=/(iPad|iPhone)/.test(f);if(c.tinyMCEPreInit){r.suffix=tinyMCEPreInit.suffix;r.baseURL=tinyMCEPreInit.base;r.query=tinyMCEPreInit.query;return}r.suffix="";e=o.getElementsByTagName("base");for(l=0;l=c.length){for(e=0,b=g.length;e=c.length||g[e]!=c[e]){f=e+1;break}}}if(g.length=g.length||g[e]!=c[e]){f=e+1;break}}}if(f==1){return h}for(e=0,b=g.length-(f-1);e=0;c--){if(f[c].length==0||f[c]=="."){continue}if(f[c]==".."){b++;continue}if(b>0){b--;continue}h.push(f[c])}c=e.length-b;if(c<=0){g=h.reverse().join("/")}else{g=e.slice(0,c).join("/")+"/"+h.reverse().join("/")}if(g.indexOf("/")!==0){g="/"+g}if(d&&g.lastIndexOf("/")!==g.length-1){g+=d}return g},getURI:function(d){var c,b=this;if(!b.source||d){c="";if(!d){if(b.protocol){c+=b.protocol+"://"}if(b.userInfo){c+=b.userInfo+"@"}if(b.host){c+=b.host}if(b.port){c+=":"+b.port}}if(b.path){c+=b.path}if(b.query){c+="?"+b.query}if(b.anchor){c+="#"+b.anchor}b.source=c}return b.source}})})();(function(){var a=tinymce.each;tinymce.create("static tinymce.util.Cookie",{getHash:function(d){var b=this.get(d),c;if(b){a(b.split("&"),function(e){e=e.split("=");c=c||{};c[unescape(e[0])]=unescape(e[1])})}return c},setHash:function(j,b,g,f,i,c){var h="";a(b,function(e,d){h+=(!h?"":"&")+escape(d)+"="+escape(e)});this.set(j,h,g,f,i,c)},get:function(i){var h=document.cookie,g,f=i+"=",d;if(!h){return}d=h.indexOf("; "+f);if(d==-1){d=h.indexOf(f);if(d!=0){return null}}else{d+=2}g=h.indexOf(";",d);if(g==-1){g=h.length}return unescape(h.substring(d+f.length,g))},set:function(i,b,g,f,h,c){document.cookie=i+"="+escape(b)+((g)?"; expires="+g.toGMTString():"")+((f)?"; path="+escape(f):"")+((h)?"; domain="+h:"")+((c)?"; secure":"")},remove:function(e,b){var c=new Date();c.setTime(c.getTime()-1000);this.set(e,"",c,b,c)}})})();tinymce.create("static tinymce.util.JSON",{serialize:function(e){var c,a,d=tinymce.util.JSON.serialize,b;if(e==null){return"null"}b=typeof e;if(b=="string"){a="\bb\tt\nn\ff\rr\"\"''\\\\";return'"'+e.replace(/([\u0080-\uFFFF\x00-\x1f\"])/g,function(g,f){c=a.indexOf(f);if(c+1){return"\\"+a.charAt(c+1)}g=f.charCodeAt().toString(16);return"\\u"+"0000".substring(g.length)+g})+'"'}if(b=="object"){if(e.hasOwnProperty&&e instanceof Array){for(c=0,a="[";c0?",":"")+d(e[c])}return a+"]"}a="{";for(c in e){a+=typeof e[c]!="function"?(a.length>1?',"':'"')+c+'":'+d(e[c]):""}return a+"}"}return""+e},parse:function(s){try{return eval("("+s+")")}catch(ex){}}});tinymce.create("static tinymce.util.XHR",{send:function(g){var a,e,b=window,h=0;g.scope=g.scope||this;g.success_scope=g.success_scope||g.scope;g.error_scope=g.error_scope||g.scope;g.async=g.async===false?false:true;g.data=g.data||"";function d(i){a=0;try{a=new ActiveXObject(i)}catch(c){}return a}a=b.XMLHttpRequest?new XMLHttpRequest():d("Microsoft.XMLHTTP")||d("Msxml2.XMLHTTP");if(a){if(a.overrideMimeType){a.overrideMimeType(g.content_type)}a.open(g.type||(g.data?"POST":"GET"),g.url,g.async);if(g.content_type){a.setRequestHeader("Content-Type",g.content_type)}a.setRequestHeader("X-Requested-With","XMLHttpRequest");a.send(g.data);function f(){if(!g.async||a.readyState==4||h++>10000){if(g.success&&h<10000&&a.status==200){g.success.call(g.success_scope,""+a.responseText,a,g)}else{if(g.error){g.error.call(g.error_scope,h>10000?"TIMED_OUT":"GENERAL",a,g)}}a=null}else{b.setTimeout(f,10)}}if(!g.async){return f()}e=b.setTimeout(f,10)}}});(function(){var c=tinymce.extend,b=tinymce.util.JSON,a=tinymce.util.XHR;tinymce.create("tinymce.util.JSONRequest",{JSONRequest:function(d){this.settings=c({},d);this.count=0},send:function(f){var e=f.error,d=f.success;f=c(this.settings,f);f.success=function(h,g){h=b.parse(h);if(typeof(h)=="undefined"){h={error:"JSON Parse error."}}if(h.error){e.call(f.error_scope||f.scope,h.error,g)}else{d.call(f.success_scope||f.scope,h.result)}};f.error=function(h,g){e.call(f.error_scope||f.scope,h,g)};f.data=b.serialize({id:f.id||"c"+(this.count++),method:f.method,params:f.params});f.content_type="application/json";a.send(f)},"static":{sendRPC:function(d){return new tinymce.util.JSONRequest().send(d)}}})}());(function(m){var k=m.each,j=m.is,i=m.isWebKit,d=m.isIE,a=/^(H[1-6R]|P|DIV|ADDRESS|PRE|FORM|T(ABLE|BODY|HEAD|FOOT|H|R|D)|LI|OL|UL|CAPTION|BLOCKQUOTE|CENTER|DL|DT|DD|DIR|FIELDSET|NOSCRIPT|MENU|ISINDEX|SAMP)$/,e=g("checked,compact,declare,defer,disabled,ismap,multiple,nohref,noresize,noshade,nowrap,readonly,selected"),f=g("src,href,style,coords,shape"),c={"&":"&",'"':""","<":"<",">":">"},n=/[<>&\"]/g,b=/^([a-z0-9],?)+$/i,h=/<(\w+)((?:\s+\w+(?:\s*=\s*(?:(?:"[^"]*")|(?:'[^']*')|[^>\s]+))?)*)(\s*\/?)>/g,l=/(\w+)(?:\s*=\s*(?:(?:"((?:\\.|[^"])*)")|(?:'((?:\\.|[^'])*)')|([^>\s]+)))?/g;function g(q){var p={},o;q=q.split(",");for(o=q.length;o>=0;o--){p[q[o]]=1}return p}m.create("tinymce.dom.DOMUtils",{doc:null,root:null,files:null,pixelStyles:/^(top|left|bottom|right|width|height|borderWidth)$/,props:{"for":"htmlFor","class":"className",className:"className",checked:"checked",disabled:"disabled",maxlength:"maxLength",readonly:"readOnly",selected:"selected",value:"value",id:"id",name:"name",type:"type"},DOMUtils:function(u,q){var p=this,o;p.doc=u;p.win=window;p.files={};p.cssFlicker=false;p.counter=0;p.boxModel=!m.isIE||u.compatMode=="CSS1Compat";p.stdMode=u.documentMode===8;p.settings=q=m.extend({keep_values:false,hex_colors:1,process_html:1},q);if(m.isIE6){try{u.execCommand("BackgroundImageCache",false,true)}catch(r){p.cssFlicker=true}}if(q.valid_styles){p._styles={};k(q.valid_styles,function(t,s){p._styles[s]=m.explode(t)})}m.addUnload(p.destroy,p)},getRoot:function(){var o=this,p=o.settings;return(p&&o.get(p.root_element))||o.doc.body},getViewPort:function(p){var q,o;p=!p?this.win:p;q=p.document;o=this.boxModel?q.documentElement:q.body;return{x:p.pageXOffset||o.scrollLeft,y:p.pageYOffset||o.scrollTop,w:p.innerWidth||o.clientWidth,h:p.innerHeight||o.clientHeight}},getRect:function(s){var r,o=this,q;s=o.get(s);r=o.getPos(s);q=o.getSize(s);return{x:r.x,y:r.y,w:q.w,h:q.h}},getSize:function(r){var p=this,o,q;r=p.get(r);o=p.getStyle(r,"width");q=p.getStyle(r,"height");if(o.indexOf("px")===-1){o=0}if(q.indexOf("px")===-1){q=0}return{w:parseInt(o)||r.offsetWidth||r.clientWidth,h:parseInt(q)||r.offsetHeight||r.clientHeight}},getParent:function(q,p,o){return this.getParents(q,p,o,false)},getParents:function(z,v,s,y){var q=this,p,u=q.settings,x=[];z=q.get(z);y=y===undefined;if(u.strict_root){s=s||q.getRoot()}if(j(v,"string")){p=v;if(v==="*"){v=function(o){return o.nodeType==1}}else{v=function(o){return q.is(o,p)}}}while(z){if(z==s||!z.nodeType||z.nodeType===9){break}if(!v||v(z)){if(y){x.push(z)}else{return z}}z=z.parentNode}return y?x:null},get:function(o){var p;if(o&&this.doc&&typeof(o)=="string"){p=o;o=this.doc.getElementById(o);if(o&&o.id!==p){return this.doc.getElementsByName(p)[1]}}return o},getNext:function(p,o){return this._findSib(p,o,"nextSibling")},getPrev:function(p,o){return this._findSib(p,o,"previousSibling")},select:function(q,p){var o=this;return m.dom.Sizzle(q,o.get(p)||o.get(o.settings.root_element)||o.doc,[])},is:function(q,o){var p;if(q.length===undefined){if(o==="*"){return q.nodeType==1}if(b.test(o)){o=o.toLowerCase().split(/,/);q=q.nodeName.toLowerCase();for(p=o.length-1;p>=0;p--){if(o[p]==q){return true}}return false}}return m.dom.Sizzle.matches(o,q.nodeType?[q]:q).length>0},add:function(s,v,o,r,u){var q=this;return this.run(s,function(y){var x,t;x=j(v,"string")?q.doc.createElement(v):v;q.setAttribs(x,o);if(r){if(r.nodeType){x.appendChild(r)}else{q.setHTML(x,r)}}return !u?y.appendChild(x):x})},create:function(q,o,p){return this.add(this.doc.createElement(q),q,o,p,1)},createHTML:function(v,p,s){var u="",r=this,q;u+="<"+v;for(q in p){if(p.hasOwnProperty(q)){u+=" "+q+'="'+r.encode(p[q])+'"'}}if(m.is(s)){return u+">"+s+""}return u+" />"},remove:function(o,p){return this.run(o,function(r){var q,s;q=r.parentNode;if(!q){return null}if(p){while(s=r.firstChild){if(!m.isIE||s.nodeType!==3||s.nodeValue){q.insertBefore(s,r)}else{r.removeChild(s)}}}return q.removeChild(r)})},setStyle:function(r,o,p){var q=this;return q.run(r,function(v){var u,t;u=v.style;o=o.replace(/-(\D)/g,function(x,s){return s.toUpperCase()});if(q.pixelStyles.test(o)&&(m.is(p,"number")||/^[\-0-9\.]+$/.test(p))){p+="px"}switch(o){case"opacity":if(d){u.filter=p===""?"":"alpha(opacity="+(p*100)+")";if(!r.currentStyle||!r.currentStyle.hasLayout){u.display="inline-block"}}u[o]=u["-moz-opacity"]=u["-khtml-opacity"]=p||"";break;case"float":d?u.styleFloat=p:u.cssFloat=p;break;default:u[o]=p||""}if(q.settings.update_styles){q.setAttrib(v,"_mce_style")}})},getStyle:function(r,o,q){r=this.get(r);if(!r){return false}if(this.doc.defaultView&&q){o=o.replace(/[A-Z]/g,function(s){return"-"+s});try{return this.doc.defaultView.getComputedStyle(r,null).getPropertyValue(o)}catch(p){return null}}o=o.replace(/-(\D)/g,function(t,s){return s.toUpperCase()});if(o=="float"){o=d?"styleFloat":"cssFloat"}if(r.currentStyle&&q){return r.currentStyle[o]}return r.style[o]},setStyles:function(u,v){var q=this,r=q.settings,p;p=r.update_styles;r.update_styles=0;k(v,function(o,s){q.setStyle(u,s,o)});r.update_styles=p;if(r.update_styles){q.setAttrib(u,r.cssText)}},setAttrib:function(q,r,o){var p=this;if(!q||!r){return}if(p.settings.strict){r=r.toLowerCase()}return this.run(q,function(u){var t=p.settings;switch(r){case"style":if(!j(o,"string")){k(o,function(s,x){p.setStyle(u,x,s)});return}if(t.keep_values){if(o&&!p._isRes(o)){u.setAttribute("_mce_style",o,2)}else{u.removeAttribute("_mce_style",2)}}u.style.cssText=o;break;case"class":u.className=o||"";break;case"src":case"href":if(t.keep_values){if(t.url_converter){o=t.url_converter.call(t.url_converter_scope||p,o,r,u)}p.setAttrib(u,"_mce_"+r,o,2)}break;case"shape":u.setAttribute("_mce_style",o);break}if(j(o)&&o!==null&&o.length!==0){u.setAttribute(r,""+o,2)}else{u.removeAttribute(r,2)}})},setAttribs:function(q,r){var p=this;return this.run(q,function(o){k(r,function(s,t){p.setAttrib(o,t,s)})})},getAttrib:function(r,s,q){var o,p=this;r=p.get(r);if(!r||r.nodeType!==1){return false}if(!j(q)){q=""}if(/^(src|href|style|coords|shape)$/.test(s)){o=r.getAttribute("_mce_"+s);if(o){return o}}if(d&&p.props[s]){o=r[p.props[s]];o=o&&o.nodeValue?o.nodeValue:o}if(!o){o=r.getAttribute(s,2)}if(/^(checked|compact|declare|defer|disabled|ismap|multiple|nohref|noshade|nowrap|readonly|selected)$/.test(s)){if(r[p.props[s]]===true&&o===""){return s}return o?s:""}if(r.nodeName==="FORM"&&r.getAttributeNode(s)){return r.getAttributeNode(s).nodeValue}if(s==="style"){o=o||r.style.cssText;if(o){o=p.serializeStyle(p.parseStyle(o),r.nodeName);if(p.settings.keep_values&&!p._isRes(o)){r.setAttribute("_mce_style",o)}}}if(i&&s==="class"&&o){o=o.replace(/(apple|webkit)\-[a-z\-]+/gi,"")}if(d){switch(s){case"rowspan":case"colspan":if(o===1){o=""}break;case"size":if(o==="+0"||o===20||o===0){o=""}break;case"width":case"height":case"vspace":case"checked":case"disabled":case"readonly":if(o===0){o=""}break;case"hspace":if(o===-1){o=""}break;case"maxlength":case"tabindex":if(o===32768||o===2147483647||o==="32768"){o=""}break;case"multiple":case"compact":case"noshade":case"nowrap":if(o===65535){return s}return q;case"shape":o=o.toLowerCase();break;default:if(s.indexOf("on")===0&&o){o=(""+o).replace(/^function\s+\w+\(\)\s+\{\s+(.*)\s+\}$/,"$1")}}}return(o!==undefined&&o!==null&&o!=="")?""+o:q},getPos:function(A,s){var p=this,o=0,z=0,u,v=p.doc,q;A=p.get(A);s=s||v.body;if(A){if(d&&!p.stdMode){A=A.getBoundingClientRect();u=p.boxModel?v.documentElement:v.body;o=p.getStyle(p.select("html")[0],"borderWidth");o=(o=="medium"||p.boxModel&&!p.isIE6)&&2||o;return{x:A.left+u.scrollLeft-o,y:A.top+u.scrollTop-o}}q=A;while(q&&q!=s&&q.nodeType){o+=q.offsetLeft||0;z+=q.offsetTop||0;q=q.offsetParent}q=A.parentNode;while(q&&q!=s&&q.nodeType){o-=q.scrollLeft||0;z-=q.scrollTop||0;q=q.parentNode}}return{x:o,y:z}},parseStyle:function(r){var u=this,v=u.settings,x={};if(!r){return x}function p(D,A,C){var z,B,o,y;z=x[D+"-top"+A];if(!z){return}B=x[D+"-right"+A];if(z!=B){return}o=x[D+"-bottom"+A];if(B!=o){return}y=x[D+"-left"+A];if(o!=y){return}x[C]=y;delete x[D+"-top"+A];delete x[D+"-right"+A];delete x[D+"-bottom"+A];delete x[D+"-left"+A]}function q(y,s,o,A){var z;z=x[s];if(!z){return}z=x[o];if(!z){return}z=x[A];if(!z){return}x[y]=x[s]+" "+x[o]+" "+x[A];delete x[s];delete x[o];delete x[A]}r=r.replace(/&(#?[a-z0-9]+);/g,"&$1_MCE_SEMI_");k(r.split(";"),function(s){var o,t=[];if(s){s=s.replace(/_MCE_SEMI_/g,";");s=s.replace(/url\([^\)]+\)/g,function(y){t.push(y);return"url("+t.length+")"});s=s.split(":");o=m.trim(s[1]);o=o.replace(/url\(([^\)]+)\)/g,function(z,y){return t[parseInt(y)-1]});o=o.replace(/rgb\([^\)]+\)/g,function(y){return u.toHex(y)});if(v.url_converter){o=o.replace(/url\([\'\"]?([^\)\'\"]+)[\'\"]?\)/g,function(y,z){return"url("+v.url_converter.call(v.url_converter_scope||u,u.decode(z),"style",null)+")"})}x[m.trim(s[0]).toLowerCase()]=o}});p("border","","border");p("border","-width","border-width");p("border","-color","border-color");p("border","-style","border-style");p("padding","","padding");p("margin","","margin");q("border","border-width","border-style","border-color");if(d){if(x.border=="medium none"){x.border=""}}return x},serializeStyle:function(v,p){var q=this,r="";function u(s,o){if(o&&s){if(o.indexOf("-")===0){return}switch(o){case"font-weight":if(s==700){s="bold"}break;case"color":case"background-color":s=s.toLowerCase();break}r+=(r?" ":"")+o+": "+s+";"}}if(p&&q._styles){k(q._styles["*"],function(o){u(v[o],o)});k(q._styles[p.toLowerCase()],function(o){u(v[o],o)})}else{k(v,u)}return r},loadCSS:function(o){var q=this,r=q.doc,p;if(!o){o=""}p=q.select("head")[0];k(o.split(","),function(s){var t;if(q.files[s]){return}q.files[s]=true;t=q.create("link",{rel:"stylesheet",href:m._addVer(s)});if(d&&r.documentMode){t.onload=function(){r.recalc();t.onload=null}}p.appendChild(t)})},addClass:function(o,p){return this.run(o,function(q){var r;if(!p){return 0}if(this.hasClass(q,p)){return q.className}r=this.removeClass(q,p);return q.className=(r!=""?(r+" "):"")+p})},removeClass:function(q,r){var o=this,p;return o.run(q,function(t){var s;if(o.hasClass(t,r)){if(!p){p=new RegExp("(^|\\s+)"+r+"(\\s+|$)","g")}s=t.className.replace(p," ");s=m.trim(s!=" "?s:"");t.className=s;if(!s){t.removeAttribute("class");t.removeAttribute("className")}return s}return t.className})},hasClass:function(p,o){p=this.get(p);if(!p||!o){return false}return(" "+p.className+" ").indexOf(" "+o+" ")!==-1},show:function(o){return this.setStyle(o,"display","block")},hide:function(o){return this.setStyle(o,"display","none")},isHidden:function(o){o=this.get(o);return !o||o.style.display=="none"||this.getStyle(o,"display")=="none"},uniqueId:function(o){return(!o?"mce_":o)+(this.counter++)},setHTML:function(q,p){var o=this;return this.run(q,function(v){var r,t,s,z,u,r;p=o.processHTML(p);if(d){function y(){while(v.firstChild){v.firstChild.removeNode()}try{v.innerHTML="
"+p;v.removeChild(v.firstChild)}catch(x){r=o.create("div");r.innerHTML="
"+p;k(r.childNodes,function(B,A){if(A){v.appendChild(B)}})}}if(o.settings.fix_ie_paragraphs){p=p.replace(/

<\/p>|]+)><\/p>|/gi,' 

')}y();if(o.settings.fix_ie_paragraphs){s=v.getElementsByTagName("p");for(t=s.length-1,r=0;t>=0;t--){z=s[t];if(!z.hasChildNodes()){if(!z._mce_keep){r=1;break}z.removeAttribute("_mce_keep")}}}if(r){p=p.replace(/

]+)>|

/ig,'

');p=p.replace(/<\/p>/gi,"
");y();if(o.settings.fix_ie_paragraphs){s=v.getElementsByTagName("DIV");for(t=s.length-1;t>=0;t--){z=s[t];if(z._mce_tmp){u=o.doc.createElement("p");z.cloneNode(false).outerHTML.replace(/([a-z0-9\-_]+)=/gi,function(A,x){var B;if(x!=="_mce_tmp"){B=z.getAttribute(x);if(!B&&x==="class"){B=z.className}u.setAttribute(x,B)}});for(r=0;r]+)\/>|/gi,"");if(q.keep_values){if(/)/g,"\n");t=t.replace(/^[\r\n]*|[\r\n]*$/g,"");t=t.replace(/^\s*(\/\/\s*|\]\]>|-->|\]\]-->)\s*$/g,"");return t}r=r.replace(/]+|)>([\s\S]*?)<\/script>/gi,function(s,x,t){if(!x){x=' type="text/javascript"'}x=x.replace(/src=\"([^\"]+)\"?/i,function(y,z){if(q.url_converter){z=p.encode(q.url_converter.call(q.url_converter_scope||p,p.decode(z),"src","script"))}return'_mce_src="'+z+'"'});if(m.trim(t)){v.push(o(t));t=""}return""+t+""});r=r.replace(/]+|)>([\s\S]*?)<\/style>/gi,function(s,x,t){if(t){v.push(o(t));t=""}return""+t+""});r=r.replace(/]+|)>([\s\S]*?)<\/noscript>/g,function(s,x,t){return""})}r=r.replace(//g,"");function u(s){return s.replace(h,function(y,z,x,t){return"<"+z+x.replace(l,function(B,A,E,D,C){var F;A=A.toLowerCase();E=E||D||C||"";if(e[A]){if(E==="false"||E==="0"){return}return A+'="'+A+'"'}if(f[A]&&x.indexOf("_mce_"+A)==-1){F=p.decode(E);if(q.url_converter&&(A=="src"||A=="href")){F=q.url_converter.call(q.url_converter_scope||p,F,A,z)}if(A=="style"){F=p.serializeStyle(p.parseStyle(F),A)}return A+'="'+E+'" _mce_'+A+'="'+p.encode(F)+'"'}return B})+t+">"})}r=u(r);r=r.replace(/MCE_SCRIPT:([0-9]+)/g,function(t,s){return v[s]})}return r},getOuterHTML:function(o){var p;o=this.get(o);if(!o){return null}if(o.outerHTML!==undefined){return o.outerHTML}p=(o.ownerDocument||this.doc).createElement("body");p.appendChild(o.cloneNode(true));return p.innerHTML},setOuterHTML:function(r,p,s){var o=this;function q(u,t,x){var y,v;v=x.createElement("body");v.innerHTML=t;y=v.lastChild;while(y){o.insertAfter(y.cloneNode(true),u);y=y.previousSibling}o.remove(u)}return this.run(r,function(u){u=o.get(u);if(u.nodeType==1){s=s||u.ownerDocument||o.doc;if(d){try{if(d&&u.nodeType==1){u.outerHTML=p}else{q(u,p,s)}}catch(t){q(u,p,s)}}else{q(u,p,s)}}})},decode:function(p){var q,r,o;if(/&[\w#]+;/.test(p)){q=this.doc.createElement("div");q.innerHTML=p;r=q.firstChild;o="";if(r){do{o+=r.nodeValue}while(r=r.nextSibling)}return o||p}return p},encode:function(o){return(""+o).replace(n,function(p){return c[p]})},insertAfter:function(o,p){p=this.get(p);return this.run(o,function(r){var q,s;q=p.parentNode;s=p.nextSibling;if(s){q.insertBefore(r,s)}else{q.appendChild(r)}return r})},isBlock:function(o){if(o.nodeType&&o.nodeType!==1){return false}o=o.nodeName||o;return a.test(o)},replace:function(s,r,p){var q=this;if(j(r,"array")){s=s.cloneNode(true)}return q.run(r,function(t){if(p){k(m.grep(t.childNodes),function(o){s.appendChild(o)})}return t.parentNode.replaceChild(s,t)})},rename:function(r,o){var q=this,p;if(r.nodeName!=o.toUpperCase()){p=q.create(o);k(q.getAttribs(r),function(s){q.setAttrib(p,s.nodeName,q.getAttrib(r,s.nodeName))});q.replace(p,r,1)}return p||r},findCommonAncestor:function(q,o){var r=q,p;while(r){p=o;while(p&&r!=p){p=p.parentNode}if(r==p){break}r=r.parentNode}if(!r&&q.ownerDocument){return q.ownerDocument.documentElement}return r},toHex:function(o){var q=/^\s*rgb\s*?\(\s*?([0-9]+)\s*?,\s*?([0-9]+)\s*?,\s*?([0-9]+)\s*?\)\s*$/i.exec(o);function p(r){r=parseInt(r).toString(16);return r.length>1?r:"0"+r}if(q){o="#"+p(q[1])+p(q[2])+p(q[3]);return o}return o},getClasses:function(){var s=this,o=[],r,u={},v=s.settings.class_filter,q;if(s.classes){return s.classes}function x(t){k(t.imports,function(y){x(y)});k(t.cssRules||t.rules,function(y){switch(y.type||1){case 1:if(y.selectorText){k(y.selectorText.split(","),function(z){z=z.replace(/^\s*|\s*$|^\s\./g,"");if(/\.mce/.test(z)||!/\.[\w\-]+$/.test(z)){return}q=z;z=z.replace(/.*\.([a-z0-9_\-]+).*/i,"$1");if(v&&!(z=v(z,q))){return}if(!u[z]){o.push({"class":z});u[z]=1}})}break;case 3:x(y.styleSheet);break}})}try{k(s.doc.styleSheets,x)}catch(p){}if(o.length>0){s.classes=o}return o},run:function(u,r,q){var p=this,v;if(p.doc&&typeof(u)==="string"){u=p.get(u)}if(!u){return false}q=q||this;if(!u.nodeType&&(u.length||u.length===0)){v=[];k(u,function(s,o){if(s){if(typeof(s)=="string"){s=p.doc.getElementById(s)}v.push(r.call(q,s,o))}});return v}return r.call(q,u)},getAttribs:function(q){var p;q=this.get(q);if(!q){return[]}if(d){p=[];if(q.nodeName=="OBJECT"){return q.attributes}if(q.nodeName==="OPTION"&&this.getAttrib(q,"selected")){p.push({specified:1,nodeName:"selected"})}q.cloneNode(false).outerHTML.replace(/<\/?[\w:\-]+ ?|=[\"][^\"]+\"|=\'[^\']+\'|=[\w\-]+|>/gi,"").replace(/[\w:\-]+/gi,function(o){p.push({specified:1,nodeName:o})});return p}return q.attributes},destroy:function(p){var o=this;if(o.events){o.events.destroy()}o.win=o.doc=o.root=o.events=null;if(!p){m.removeUnload(o.destroy)}},createRng:function(){var o=this.doc;return o.createRange?o.createRange():new m.dom.Range(this)},nodeIndex:function(s,t){var o=0,q,r,p;if(s){for(q=s.nodeType,s=s.previousSibling,r=s;s;s=s.previousSibling){p=s.nodeType;if(t&&p==3){if(p==q||!s.nodeValue.length){continue}}o++;q=p}}return o},split:function(u,s,y){var z=this,o=z.createRng(),v,q,x;function p(A){var t,r=A.childNodes;if(A.nodeType==1&&A.getAttribute("_mce_type")=="bookmark"){return}for(t=r.length-1;t>=0;t--){p(r[t])}if(A.nodeType!=9){if(A.nodeType==3&&A.nodeValue.length>0){return}if(A.nodeType==1){r=A.childNodes;if(r.length==1&&r[0]&&r[0].nodeType==1&&r[0].getAttribute("_mce_type")=="bookmark"){A.parentNode.insertBefore(r[0],A)}if(r.length||/^(br|hr|input|img)$/i.test(A.nodeName)){return}}z.remove(A)}return A}if(u&&s){o.setStart(u.parentNode,z.nodeIndex(u));o.setEnd(s.parentNode,z.nodeIndex(s));v=o.extractContents();o=z.createRng();o.setStart(s.parentNode,z.nodeIndex(s)+1);o.setEnd(u.parentNode,z.nodeIndex(u)+1);q=o.extractContents();x=u.parentNode;x.insertBefore(p(v),u);if(y){x.replaceChild(y,s)}else{x.insertBefore(s,u)}x.insertBefore(p(q),u);z.remove(u);return y||s}},bind:function(s,o,r,q){var p=this;if(!p.events){p.events=new m.dom.EventUtils()}return p.events.add(s,o,r,q||this)},unbind:function(r,o,q){var p=this;if(!p.events){p.events=new m.dom.EventUtils()}return p.events.remove(r,o,q)},_findSib:function(r,o,p){var q=this,s=o;if(r){if(j(s,"string")){s=function(t){return q.is(t,o)}}for(r=r[p];r;r=r[p]){if(s(r)){return r}}}return null},_isRes:function(o){return/^(top|left|bottom|right|width|height)/i.test(o)||/;\s*(top|left|bottom|right|width|height)/i.test(o)}});m.DOM=new m.dom.DOMUtils(document,{process_html:0})})(tinymce);(function(a){function b(c){var N=this,e=c.doc,S=0,E=1,j=2,D=true,R=false,U="startOffset",h="startContainer",P="endContainer",z="endOffset",k=tinymce.extend,n=c.nodeIndex;k(N,{startContainer:e,startOffset:0,endContainer:e,endOffset:0,collapsed:D,commonAncestorContainer:e,START_TO_START:0,START_TO_END:1,END_TO_END:2,END_TO_START:3,setStart:q,setEnd:s,setStartBefore:g,setStartAfter:I,setEndBefore:J,setEndAfter:u,collapse:A,selectNode:x,selectNodeContents:F,compareBoundaryPoints:v,deleteContents:p,extractContents:H,cloneContents:d,insertNode:C,surroundContents:M,cloneRange:K});function q(V,t){B(D,V,t)}function s(V,t){B(R,V,t)}function g(t){q(t.parentNode,n(t))}function I(t){q(t.parentNode,n(t)+1)}function J(t){s(t.parentNode,n(t))}function u(t){s(t.parentNode,n(t)+1)}function A(t){if(t){N[P]=N[h];N[z]=N[U]}else{N[h]=N[P];N[U]=N[z]}N.collapsed=D}function x(t){g(t);u(t)}function F(t){q(t,0);s(t,t.nodeType===1?t.childNodes.length:t.nodeValue.length)}function v(W,X){var Z=N[h],Y=N[U],V=N[P],t=N[z];if(W===0){return G(Z,Y,Z,Y)}if(W===1){return G(Z,Y,V,t)}if(W===2){return G(V,t,V,t)}if(W===3){return G(V,t,Z,Y)}}function p(){m(j)}function H(){return m(S)}function d(){return m(E)}function C(Y){var V=this[h],t=this[U],X,W;if((V.nodeType===3||V.nodeType===4)&&V.nodeValue){if(!t){V.parentNode.insertBefore(Y,V)}else{if(t>=V.nodeValue.length){c.insertAfter(Y,V)}else{X=V.splitText(t);V.parentNode.insertBefore(Y,X)}}}else{if(V.childNodes.length>0){W=V.childNodes[t]}if(W){V.insertBefore(Y,W)}else{V.appendChild(Y)}}}function M(V){var t=N.extractContents();N.insertNode(V);V.appendChild(t);N.selectNode(V)}function K(){return k(new b(c),{startContainer:N[h],startOffset:N[U],endContainer:N[P],endOffset:N[z],collapsed:N.collapsed,commonAncestorContainer:N.commonAncestorContainer})}function O(t,V){var W;if(t.nodeType==3){return t}if(V<0){return t}W=t.firstChild;while(W&&V>0){--V;W=W.nextSibling}if(W){return W}return t}function l(){return(N[h]==N[P]&&N[U]==N[z])}function G(X,Z,V,Y){var aa,W,t,ab,ad,ac;if(X==V){if(Z==Y){return 0}if(Z0){N.collapse(V)}}else{N.collapse(V)}N.collapsed=l();N.commonAncestorContainer=c.findCommonAncestor(N[h],N[P])}function m(ab){var aa,X=0,ad=0,V,Z,W,Y,t,ac;if(N[h]==N[P]){return f(ab)}for(aa=N[P],V=aa.parentNode;V;aa=V,V=V.parentNode){if(V==N[h]){return r(aa,ab)}++X}for(aa=N[h],V=aa.parentNode;V;aa=V,V=V.parentNode){if(V==N[P]){return T(aa,ab)}++ad}Z=ad-X;W=N[h];while(Z>0){W=W.parentNode;Z--}Y=N[P];while(Z<0){Y=Y.parentNode;Z++}for(t=W.parentNode,ac=Y.parentNode;t!=ac;t=t.parentNode,ac=ac.parentNode){W=t;Y=ac}return o(W,Y,ab)}function f(Z){var ab,Y,X,aa,t,W,V;if(Z!=j){ab=e.createDocumentFragment()}if(N[U]==N[z]){return ab}if(N[h].nodeType==3){Y=N[h].nodeValue;X=Y.substring(N[U],N[z]);if(Z!=E){N[h].deleteData(N[U],N[z]-N[U]);N.collapse(D)}if(Z==j){return}ab.appendChild(e.createTextNode(X));return ab}aa=O(N[h],N[U]);t=N[z]-N[U];while(t>0){W=aa.nextSibling;V=y(aa,Z);if(ab){ab.appendChild(V)}--t;aa=W}if(Z!=E){N.collapse(D)}return ab}function r(ab,Y){var aa,Z,V,t,X,W;if(Y!=j){aa=e.createDocumentFragment()}Z=i(ab,Y);if(aa){aa.appendChild(Z)}V=n(ab);t=V-N[U];if(t<=0){if(Y!=E){N.setEndBefore(ab);N.collapse(R)}return aa}Z=ab.previousSibling;while(t>0){X=Z.previousSibling;W=y(Z,Y);if(aa){aa.insertBefore(W,aa.firstChild)}--t;Z=X}if(Y!=E){N.setEndBefore(ab);N.collapse(R)}return aa}function T(Z,Y){var ab,V,aa,t,X,W;if(Y!=j){ab=e.createDocumentFragment()}aa=Q(Z,Y);if(ab){ab.appendChild(aa)}V=n(Z);++V;t=N[z]-V;aa=Z.nextSibling;while(t>0){X=aa.nextSibling;W=y(aa,Y);if(ab){ab.appendChild(W)}--t;aa=X}if(Y!=E){N.setStartAfter(Z);N.collapse(D)}return ab}function o(Z,t,ac){var W,ae,Y,aa,ab,V,ad,X;if(ac!=j){ae=e.createDocumentFragment()}W=Q(Z,ac);if(ae){ae.appendChild(W)}Y=Z.parentNode;aa=n(Z);ab=n(t);++aa;V=ab-aa;ad=Z.nextSibling;while(V>0){X=ad.nextSibling;W=y(ad,ac);if(ae){ae.appendChild(W)}ad=X;--V}W=i(t,ac);if(ae){ae.appendChild(W)}if(ac!=E){N.setStartAfter(Z);N.collapse(D)}return ae}function i(aa,ab){var W=O(N[P],N[z]-1),ac,Z,Y,t,V,X=W!=N[P];if(W==aa){return L(W,X,R,ab)}ac=W.parentNode;Z=L(ac,R,R,ab);while(ac){while(W){Y=W.previousSibling;t=L(W,X,R,ab);if(ab!=j){Z.insertBefore(t,Z.firstChild)}X=D;W=Y}if(ac==aa){return Z}W=ac.previousSibling;ac=ac.parentNode;V=L(ac,R,R,ab);if(ab!=j){V.appendChild(Z)}Z=V}}function Q(aa,ab){var X=O(N[h],N[U]),Y=X!=N[h],ac,Z,W,t,V;if(X==aa){return L(X,Y,D,ab)}ac=X.parentNode;Z=L(ac,R,D,ab);while(ac){while(X){W=X.nextSibling;t=L(X,Y,D,ab);if(ab!=j){Z.appendChild(t)}Y=D;X=W}if(ac==aa){return Z}X=ac.nextSibling;ac=ac.parentNode;V=L(ac,R,D,ab);if(ab!=j){V.appendChild(Z)}Z=V}}function L(t,Y,ab,ac){var X,W,Z,V,aa;if(Y){return y(t,ac)}if(t.nodeType==3){X=t.nodeValue;if(ab){V=N[U];W=X.substring(V);Z=X.substring(0,V)}else{V=N[z];W=X.substring(0,V);Z=X.substring(V)}if(ac!=E){t.nodeValue=Z}if(ac==j){return}aa=t.cloneNode(R);aa.nodeValue=W;return aa}if(ac==j){return}return t.cloneNode(R)}function y(V,t){if(t!=j){return t==E?V.cloneNode(D):V}V.parentNode.removeChild(V)}}a.Range=b})(tinymce.dom);(function(){function a(g){var i=this,j="\uFEFF",e,h,d=g.dom,c=true,f=false;function b(){var n=g.getRng(),k=d.createRng(),m,o;m=n.item?n.item(0):n.parentElement();if(m.ownerDocument!=d.doc){return k}if(n.item||!m.hasChildNodes()){k.setStart(m.parentNode,d.nodeIndex(m));k.setEnd(k.startContainer,k.startOffset+1);return k}o=g.isCollapsed();function l(s){var u,q,t,p,A=0,x,y,z,r,v;r=n.duplicate();r.collapse(s);u=d.create("a");z=r.parentElement();if(!z.hasChildNodes()){k[s?"setStart":"setEnd"](z,0);return}z.appendChild(u);r.moveToElementText(u);v=n.compareEndPoints(s?"StartToStart":"EndToEnd",r);if(v>0){k[s?"setStartAfter":"setEndAfter"](z);d.remove(u);return}p=tinymce.grep(z.childNodes);x=p.length-1;while(A<=x){y=Math.floor((A+x)/2);z.insertBefore(u,p[y]);r.moveToElementText(u);v=n.compareEndPoints(s?"StartToStart":"EndToEnd",r);if(v>0){A=y+1}else{if(v<0){x=y-1}else{found=true;break}}}q=v>0||y==0?u.nextSibling:u.previousSibling;if(q.nodeType==1){d.remove(u);t=d.nodeIndex(q);q=q.parentNode;if(!s||y>0){t++}}else{if(v>0||y==0){r.setEndPoint(s?"StartToStart":"EndToEnd",n);t=r.text.length}else{r.setEndPoint(s?"StartToStart":"EndToEnd",n);t=q.nodeValue.length-r.text.length}d.remove(u)}k[s?"setStart":"setEnd"](q,t)}l(true);if(!o){l()}return k}this.addRange=function(k){var p,n,m,r,u,s,t=g.dom.doc,o=t.body;function l(B){var x,A,v,z,y;v=d.create("a");x=B?m:u;A=B?r:s;z=p.duplicate();if(x==t){x=o;A=0}if(x.nodeType==3){x.parentNode.insertBefore(v,x);z.moveToElementText(v);z.moveStart("character",A);d.remove(v);p.setEndPoint(B?"StartToStart":"EndToEnd",z)}else{y=x.childNodes;if(y.length){if(A>=y.length){d.insertAfter(v,y[y.length-1])}else{x.insertBefore(v,y[A])}z.moveToElementText(v)}else{v=t.createTextNode(j);x.appendChild(v);z.moveToElementText(v.parentNode);z.collapse(c)}p.setEndPoint(B?"StartToStart":"EndToEnd",z);d.remove(v)}}this.destroy();m=k.startContainer;r=k.startOffset;u=k.endContainer;s=k.endOffset;p=o.createTextRange();if(m==u&&m.nodeType==1&&r==s-1){if(r==s-1){try{n=o.createControlRange();n.addElement(m.childNodes[r]);n.select();n.scrollIntoView();return}catch(q){}}}l(true);l();p.select();p.scrollIntoView()};this.getRangeAt=function(){if(!e||!tinymce.dom.RangeUtils.compareRanges(h,g.getRng())){e=b();h=g.getRng()}try{e.startContainer.nextSibling}catch(k){e=b();h=null}return e};this.destroy=function(){h=e=null};if(g.dom.boxModel){(function(){var q=d.doc,l=q.body,n,o;q.documentElement.unselectable=c;function p(r,u){var s=l.createTextRange();try{s.moveToPoint(r,u)}catch(t){s=null}return s}function m(s){var r;if(s.button){r=p(s.x,s.y);if(r){if(r.compareEndPoints("StartToStart",o)>0){r.setEndPoint("StartToStart",o)}else{r.setEndPoint("EndToEnd",o)}r.select()}}else{k()}}function k(){d.unbind(q,"mouseup",k);d.unbind(q,"mousemove",m);n=0}d.bind(q,"mousedown",function(r){if(r.target.nodeName==="HTML"){if(n){k()}n=1;o=p(r.x,r.y);if(o){d.bind(q,"mouseup",k);d.bind(q,"mousemove",m);o.select()}}})})()}}tinymce.dom.TridentSelection=a})();(function(){var p=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,j=0,d=Object.prototype.toString,o=false,i=true;[0,0].sort(function(){i=false;return 0});var b=function(v,e,z,A){z=z||[];e=e||document;var C=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!v||typeof v!=="string"){return z}var x=[],s,E,H,r,u=true,t=b.isXML(e),B=v,D,G,F,y;do{p.exec("");s=p.exec(B);if(s){B=s[3];x.push(s[1]);if(s[2]){r=s[3];break}}}while(s);if(x.length>1&&k.exec(v)){if(x.length===2&&f.relative[x[0]]){E=h(x[0]+x[1],e)}else{E=f.relative[x[0]]?[e]:b(x.shift(),e);while(x.length){v=x.shift();if(f.relative[v]){v+=x.shift()}E=h(v,E)}}}else{if(!A&&x.length>1&&e.nodeType===9&&!t&&f.match.ID.test(x[0])&&!f.match.ID.test(x[x.length-1])){D=b.find(x.shift(),e,t);e=D.expr?b.filter(D.expr,D.set)[0]:D.set[0]}if(e){D=A?{expr:x.pop(),set:a(A)}:b.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&e.parentNode?e.parentNode:e,t);E=D.expr?b.filter(D.expr,D.set):D.set;if(x.length>0){H=a(E)}else{u=false}while(x.length){G=x.pop();F=G;if(!f.relative[G]){G=""}else{F=x.pop()}if(F==null){F=e}f.relative[G](H,F,t)}}else{H=x=[]}}if(!H){H=E}if(!H){b.error(G||v)}if(d.call(H)==="[object Array]"){if(!u){z.push.apply(z,H)}else{if(e&&e.nodeType===1){for(y=0;H[y]!=null;y++){if(H[y]&&(H[y]===true||H[y].nodeType===1&&b.contains(e,H[y]))){z.push(E[y])}}}else{for(y=0;H[y]!=null;y++){if(H[y]&&H[y].nodeType===1){z.push(E[y])}}}}}else{a(H,z)}if(r){b(r,C,z,A);b.uniqueSort(z)}return z};b.uniqueSort=function(r){if(c){o=i;r.sort(c);if(o){for(var e=1;e":function(x,r){var u=typeof r==="string",v,s=0,e=x.length;if(u&&!/\W/.test(r)){r=r.toLowerCase();for(;s=0)){if(!s){e.push(v)}}else{if(s){r[u]=false}}}}return false},ID:function(e){return e[1].replace(/\\/g,"")},TAG:function(r,e){return r[1].toLowerCase()},CHILD:function(e){if(e[1]==="nth"){var r=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(r[1]+(r[2]||1))-0;e[3]=r[3]-0}e[0]=j++;return e},ATTR:function(u,r,s,e,v,x){var t=u[1].replace(/\\/g,"");if(!x&&f.attrMap[t]){u[1]=f.attrMap[t]}if(u[2]==="~="){u[4]=" "+u[4]+" "}return u},PSEUDO:function(u,r,s,e,v){if(u[1]==="not"){if((p.exec(u[3])||"").length>1||/^\w/.test(u[3])){u[3]=b(u[3],null,null,r)}else{var t=b.filter(u[3],r,s,true^v);if(!s){e.push.apply(e,t)}return false}}else{if(f.match.POS.test(u[0])||f.match.CHILD.test(u[0])){return true}}return u},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){e.parentNode.selectedIndex;return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(s,r,e){return !!b(e[3],s).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(e){return"text"===e.type},radio:function(e){return"radio"===e.type},checkbox:function(e){return"checkbox"===e.type},file:function(e){return"file"===e.type},password:function(e){return"password"===e.type},submit:function(e){return"submit"===e.type},image:function(e){return"image"===e.type},reset:function(e){return"reset"===e.type},button:function(e){return"button"===e.type||e.nodeName.toLowerCase()==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)}},setFilters:{first:function(r,e){return e===0},last:function(s,r,e,t){return r===t.length-1},even:function(r,e){return e%2===0},odd:function(r,e){return e%2===1},lt:function(s,r,e){return re[3]-0},nth:function(s,r,e){return e[3]-0===r},eq:function(s,r,e){return e[3]-0===r}},filter:{PSEUDO:function(s,y,x,z){var e=y[1],r=f.filters[e];if(r){return r(s,x,y,z)}else{if(e==="contains"){return(s.textContent||s.innerText||b.getText([s])||"").indexOf(y[3])>=0}else{if(e==="not"){var t=y[3];for(var v=0,u=t.length;v=0)}}},ID:function(r,e){return r.nodeType===1&&r.getAttribute("id")===e},TAG:function(r,e){return(e==="*"&&r.nodeType===1)||r.nodeName.toLowerCase()===e},CLASS:function(r,e){return(" "+(r.className||r.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(v,t){var s=t[1],e=f.attrHandle[s]?f.attrHandle[s](v):v[s]!=null?v[s]:v.getAttribute(s),x=e+"",u=t[2],r=t[4];return e==null?u==="!=":u==="="?x===r:u==="*="?x.indexOf(r)>=0:u==="~="?(" "+x+" ").indexOf(r)>=0:!r?x&&e!==false:u==="!="?x!==r:u==="^="?x.indexOf(r)===0:u==="$="?x.substr(x.length-r.length)===r:u==="|="?x===r||x.substr(0,r.length+1)===r+"-":false},POS:function(u,r,s,v){var e=r[2],t=f.setFilters[e];if(t){return t(u,s,r,v)}}}};var k=f.match.POS,g=function(r,e){return"\\"+(e-0+1)};for(var m in f.match){f.match[m]=new RegExp(f.match[m].source+(/(?![^\[]*\])(?![^\(]*\))/.source));f.leftMatch[m]=new RegExp(/(^(?:.|\r|\n)*?)/.source+f.match[m].source.replace(/\\(\d+)/g,g))}var a=function(r,e){r=Array.prototype.slice.call(r,0);if(e){e.push.apply(e,r);return e}return r};try{Array.prototype.slice.call(document.documentElement.childNodes,0)[0].nodeType}catch(l){a=function(u,t){var r=t||[],s=0;if(d.call(u)==="[object Array]"){Array.prototype.push.apply(r,u)}else{if(typeof u.length==="number"){for(var e=u.length;s";var e=document.documentElement;e.insertBefore(r,e.firstChild);if(document.getElementById(s)){f.find.ID=function(u,v,x){if(typeof v.getElementById!=="undefined"&&!x){var t=v.getElementById(u[1]);return t?t.id===u[1]||typeof t.getAttributeNode!=="undefined"&&t.getAttributeNode("id").nodeValue===u[1]?[t]:undefined:[]}};f.filter.ID=function(v,t){var u=typeof v.getAttributeNode!=="undefined"&&v.getAttributeNode("id");return v.nodeType===1&&u&&u.nodeValue===t}}e.removeChild(r);e=r=null})();(function(){var e=document.createElement("div");e.appendChild(document.createComment(""));if(e.getElementsByTagName("*").length>0){f.find.TAG=function(r,v){var u=v.getElementsByTagName(r[1]);if(r[1]==="*"){var t=[];for(var s=0;u[s];s++){if(u[s].nodeType===1){t.push(u[s])}}u=t}return u}}e.innerHTML="";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){f.attrHandle.href=function(r){return r.getAttribute("href",2)}}e=null})();if(document.querySelectorAll){(function(){var e=b,s=document.createElement("div");s.innerHTML="

";if(s.querySelectorAll&&s.querySelectorAll(".TEST").length===0){return}b=function(x,v,t,u){v=v||document;if(!u&&v.nodeType===9&&!b.isXML(v)){try{return a(v.querySelectorAll(x),t)}catch(y){}}return e(x,v,t,u)};for(var r in e){b[r]=e[r]}s=null})()}(function(){var e=document.createElement("div");e.innerHTML="
";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}f.order.splice(1,0,"CLASS");f.find.CLASS=function(r,s,t){if(typeof s.getElementsByClassName!=="undefined"&&!t){return s.getElementsByClassName(r[1])}};e=null})();function n(r,x,v,A,y,z){for(var t=0,s=A.length;t0){u=e;break}}}e=e[r]}A[t]=u}}}b.contains=document.compareDocumentPosition?function(r,e){return !!(r.compareDocumentPosition(e)&16)}:function(r,e){return r!==e&&(r.contains?r.contains(e):true)};b.isXML=function(e){var r=(e?e.ownerDocument||e:0).documentElement;return r?r.nodeName!=="HTML":false};var h=function(e,y){var t=[],u="",v,s=y.nodeType?[y]:y;while((v=f.match.PSEUDO.exec(e))){u+=v[0];e=e.replace(f.match.PSEUDO,"")}e=f.relative[e]?e+"*":e;for(var x=0,r=s.length;x=0;h--){k=g[h];if(k.obj===l){j._remove(k.obj,k.name,k.cfunc);k.obj=k.cfunc=null;g.splice(h,1)}}}},cancel:function(g){if(!g){return false}this.stop(g);return this.prevent(g)},stop:function(g){if(g.stopPropagation){g.stopPropagation()}else{g.cancelBubble=true}return false},prevent:function(g){if(g.preventDefault){g.preventDefault()}else{g.returnValue=false}return false},destroy:function(){var g=this;f(g.events,function(j,h){g._remove(j.obj,j.name,j.cfunc);j.obj=j.cfunc=null});g.events=[];g=null},_add:function(h,i,g){if(h.attachEvent){h.attachEvent("on"+i,g)}else{if(h.addEventListener){h.addEventListener(i,g,false)}else{h["on"+i]=g}}},_remove:function(i,j,h){if(i){try{if(i.detachEvent){i.detachEvent("on"+j,h)}else{if(i.removeEventListener){i.removeEventListener(j,h,false)}else{i["on"+j]=null}}}catch(g){}}},_pageInit:function(h){var g=this;if(g.domLoaded){return}g.domLoaded=true;f(g.inits,function(i){i()});g.inits=[]},_wait:function(i){var g=this,h=i.document;if(i.tinyMCE_GZ&&tinyMCE_GZ.loaded){g.domLoaded=1;return}if(h.attachEvent){h.attachEvent("onreadystatechange",function(){if(h.readyState==="complete"){h.detachEvent("onreadystatechange",arguments.callee);g._pageInit(i)}});if(h.documentElement.doScroll&&i==i.top){(function(){if(g.domLoaded){return}try{h.documentElement.doScroll("left")}catch(j){setTimeout(arguments.callee,0);return}g._pageInit(i)})()}}else{if(h.addEventListener){g._add(i,"DOMContentLoaded",function(){g._pageInit(i)})}}g._add(i,"load",function(){g._pageInit(i)})},_stoppers:{preventDefault:function(){this.returnValue=false},stopPropagation:function(){this.cancelBubble=true}}});a=d.dom.Event=new d.dom.EventUtils();a._wait(window);d.addUnload(function(){a.destroy()})})(tinymce);(function(a){a.dom.Element=function(f,d){var b=this,e,c;b.settings=d=d||{};b.id=f;b.dom=e=d.dom||a.DOM;if(!a.isIE){c=e.get(b.id)}a.each(("getPos,getRect,getParent,add,setStyle,getStyle,setStyles,setAttrib,setAttribs,getAttrib,addClass,removeClass,hasClass,getOuterHTML,setOuterHTML,remove,show,hide,isHidden,setHTML,get").split(/,/),function(g){b[g]=function(){var h=[f],j;for(j=0;j_';if(j.startContainer==k&&j.endContainer==k){k.body.innerHTML=i}else{j.deleteContents();if(k.body.childNodes.length==0){k.body.innerHTML=i}else{j.insertNode(j.createContextualFragment(i))}}l=f.dom.get("__caret");j=k.createRange();j.setStartBefore(l);j.setEndBefore(l);f.setRng(j);f.dom.remove("__caret")}else{if(j.item){k.execCommand("Delete",false,null);j=f.getRng()}j.pasteHTML(i)}f.onSetContent.dispatch(f,g)},getStart:function(){var g=this.getRng(),h,f,j,i;if(g.duplicate||g.item){if(g.item){return g.item(0)}j=g.duplicate();j.collapse(1);h=j.parentElement();f=i=g.parentElement();while(i=i.parentNode){if(i==h){h=f;break}}if(h&&h.nodeName=="BODY"){return h.firstChild||h}return h}else{h=g.startContainer;if(h.nodeType==1&&h.hasChildNodes()){h=h.childNodes[Math.min(h.childNodes.length-1,g.startOffset)]}if(h&&h.nodeType==3){return h.parentNode}return h}},getEnd:function(){var g=this,h=g.getRng(),i,f;if(h.duplicate||h.item){if(h.item){return h.item(0)}h=h.duplicate();h.collapse(0);i=h.parentElement();if(i&&i.nodeName=="BODY"){return i.lastChild||i}return i}else{i=h.endContainer;f=h.endOffset;if(i.nodeType==1&&i.hasChildNodes()){i=i.childNodes[f>0?f-1:f]}if(i&&i.nodeType==3){return i.parentNode}return i}},getBookmark:function(q,r){var u=this,m=u.dom,g,j,i,n,h,o,p,l="\uFEFF",s;function f(v,x){var t=0;d(m.select(v),function(z,y){if(z==x){t=y}});return t}if(q==2){function k(){var v=u.getRng(true),t=m.getRoot(),x={};function y(B,G){var A=B[G?"startContainer":"endContainer"],F=B[G?"startOffset":"endOffset"],z=[],C,E,D=0;if(A.nodeType==3){if(r){for(C=A.previousSibling;C&&C.nodeType==3;C=C.previousSibling){F+=C.nodeValue.length}}z.push(F)}else{E=A.childNodes;if(F>=E.length&&E.length){D=1;F=Math.max(0,E.length-1)}z.push(u.dom.nodeIndex(E[F],r)+D)}for(;A&&A!=t;A=A.parentNode){z.push(u.dom.nodeIndex(A,r))}return z}x.start=y(v,true);if(!u.isCollapsed()){x.end=y(v)}return x}return k()}if(q){return{rng:u.getRng()}}g=u.getRng();i=m.uniqueId();n=tinyMCE.activeEditor.selection.isCollapsed();s="overflow:hidden;line-height:0px";if(g.duplicate||g.item){if(!g.item){j=g.duplicate();g.collapse();g.pasteHTML(''+l+"");if(!n){j.collapse(false);j.pasteHTML(''+l+"")}}else{o=g.item(0);h=o.nodeName;return{name:h,index:f(h,o)}}}else{o=u.getNode();h=o.nodeName;if(h=="IMG"){return{name:h,index:f(h,o)}}j=g.cloneRange();if(!n){j.collapse(false);j.insertNode(m.create("span",{_mce_type:"bookmark",id:i+"_end",style:s},l))}g.collapse(true);g.insertNode(m.create("span",{_mce_type:"bookmark",id:i+"_start",style:s},l))}u.moveToBookmark({id:i,keep:1});return{id:i}},moveToBookmark:function(n){var r=this,l=r.dom,i,h,f,q,j,s,o,p;if(r.tridentSel){r.tridentSel.destroy()}if(n){if(n.start){f=l.createRng();q=l.getRoot();function g(z){var t=n[z?"start":"end"],v,x,y,u;if(t){for(x=q,v=t.length-1;v>=1;v--){u=x.childNodes;if(u.length){x=u[t[v]]}}if(z){f.setStart(x,t[0])}else{f.setEnd(x,t[0])}}}g(true);g();r.setRng(f)}else{if(n.id){function k(A){var u=l.get(n.id+"_"+A),z,t,x,y,v=n.keep;if(u){z=u.parentNode;if(A=="start"){if(!v){t=l.nodeIndex(u)}else{z=u.firstChild;t=1}j=s=z;o=p=t}else{if(!v){t=l.nodeIndex(u)}else{z=u.firstChild;t=1}s=z;p=t}if(!v){y=u.previousSibling;x=u.nextSibling;d(c.grep(u.childNodes),function(B){if(B.nodeType==3){B.nodeValue=B.nodeValue.replace(/\uFEFF/g,"")}});while(u=l.get(n.id+"_"+A)){l.remove(u,1)}if(y&&x&&y.nodeType==x.nodeType&&y.nodeType==3){t=y.nodeValue.length;y.appendData(x.nodeValue);l.remove(x);if(A=="start"){j=s=y;o=p=t}else{s=y;p=t}}}}}function m(t){if(!a&&l.isBlock(t)&&!t.innerHTML){t.innerHTML='
'}return t}k("start");k("end");f=l.createRng();f.setStart(m(j),o);f.setEnd(m(s),p);r.setRng(f)}else{if(n.name){r.select(l.select(n.name)[n.index])}else{if(n.rng){r.setRng(n.rng)}}}}}},select:function(k,j){var i=this,l=i.dom,g=l.createRng(),f;f=l.nodeIndex(k);g.setStart(k.parentNode,f);g.setEnd(k.parentNode,f+1);if(j){function h(m,o){var n=new c.dom.TreeWalker(m,m);do{if(m.nodeType==3&&c.trim(m.nodeValue).length!=0){if(o){g.setStart(m,0)}else{g.setEnd(m,m.nodeValue.length)}return}if(m.nodeName=="BR"){if(o){g.setStartBefore(m)}else{g.setEndBefore(m)}return}}while(m=(o?n.next():n.prev()))}h(k,1);h(k)}i.setRng(g);return k},isCollapsed:function(){var f=this,h=f.getRng(),g=f.getSel();if(!h||h.item){return false}if(h.compareEndPoints){return h.compareEndPoints("StartToEnd",h)===0}return !g||h.collapsed},collapse:function(f){var g=this,h=g.getRng(),i;if(h.item){i=h.item(0);h=this.win.document.body.createTextRange();h.moveToElementText(i)}h.collapse(!!f);g.setRng(h)},getSel:function(){var g=this,f=this.win;return f.getSelection?f.getSelection():f.document.selection},getRng:function(j){var g=this,h,i;if(j&&g.tridentSel){return g.tridentSel.getRangeAt(0)}try{if(h=g.getSel()){i=h.rangeCount>0?h.getRangeAt(0):(h.createRange?h.createRange():g.win.document.createRange())}}catch(f){}if(!i){i=g.win.document.createRange?g.win.document.createRange():g.win.document.body.createTextRange()}if(g.selectedRange&&g.explicitRange){if(i.compareBoundaryPoints(i.START_TO_START,g.selectedRange)===0&&i.compareBoundaryPoints(i.END_TO_END,g.selectedRange)===0){i=g.explicitRange}else{g.selectedRange=null;g.explicitRange=null}}return i},setRng:function(i){var h,g=this;if(!g.tridentSel){h=g.getSel();if(h){g.explicitRange=i;h.removeAllRanges();h.addRange(i);g.selectedRange=h.getRangeAt(0)}}else{if(i.cloneRange){g.tridentSel.addRange(i);return}try{i.select()}catch(f){}}},setNode:function(g){var f=this;f.setContent(f.dom.getOuterHTML(g));return g},getNode:function(){var g=this,f=g.getRng(),h=g.getSel(),i;if(f.setStart){if(!f){return g.dom.getRoot()}i=f.commonAncestorContainer;if(!f.collapsed){if(f.startContainer==f.endContainer){if(f.startOffset-f.endOffset<2){if(f.startContainer.hasChildNodes()){i=f.startContainer.childNodes[f.startOffset]}}}if(c.isWebKit&&h.anchorNode&&h.anchorNode.nodeType==1){return h.anchorNode.childNodes[h.anchorOffset]}}if(i&&i.nodeType==3){return i.parentNode}return i}return f.item?f.item(0):f.parentElement()},getSelectedBlocks:function(g,f){var i=this,j=i.dom,m,h,l,k=[];m=j.getParent(g||i.getStart(),j.isBlock);h=j.getParent(f||i.getEnd(),j.isBlock);if(m){k.push(m)}if(m&&h&&m!=h){l=m;while((l=l.nextSibling)&&l!=h){if(j.isBlock(l)){k.push(l)}}}if(h&&m!=h){k.push(h)}return k},destroy:function(g){var f=this;f.win=null;if(f.tridentSel){f.tridentSel.destroy()}if(!g){c.removeUnload(f.destroy)}}})})(tinymce);(function(a){a.create("tinymce.dom.XMLWriter",{node:null,XMLWriter:function(c){function b(){var e=document.implementation;if(!e||!e.createDocument){try{return new ActiveXObject("MSXML2.DOMDocument")}catch(d){}try{return new ActiveXObject("Microsoft.XmlDom")}catch(d){}}else{return e.createDocument("","",null)}}this.doc=b();this.valid=a.isOpera||a.isWebKit;this.reset()},reset:function(){var b=this,c=b.doc;if(c.firstChild){c.removeChild(c.firstChild)}b.node=c.appendChild(c.createElement("html"))},writeStartElement:function(c){var b=this;b.node=b.node.appendChild(b.doc.createElement(c))},writeAttribute:function(c,b){if(this.valid){b=b.replace(/>/g,"%MCGT%")}this.node.setAttribute(c,b)},writeEndElement:function(){this.node=this.node.parentNode},writeFullEndElement:function(){var b=this,c=b.node;c.appendChild(b.doc.createTextNode(""));b.node=c.parentNode},writeText:function(b){if(this.valid){b=b.replace(/>/g,"%MCGT%")}this.node.appendChild(this.doc.createTextNode(b))},writeCDATA:function(b){this.node.appendChild(this.doc.createCDATASection(b))},writeComment:function(b){if(a.isIE){b=b.replace(/^\-|\-$/g," ")}this.node.appendChild(this.doc.createComment(b.replace(/\-\-/g," ")))},getContent:function(){var b;b=this.doc.xml||new XMLSerializer().serializeToString(this.doc);b=b.replace(/<\?[^?]+\?>||<\/html>||]+>/g,"");b=b.replace(/ ?\/>/g," />");if(this.valid){b=b.replace(/\%MCGT%/g,">")}return b}})})(tinymce);(function(a){a.create("tinymce.dom.StringWriter",{str:null,tags:null,count:0,settings:null,indent:null,StringWriter:function(b){this.settings=a.extend({indent_char:" ",indentation:0},b);this.reset()},reset:function(){this.indent="";this.str="";this.tags=[];this.count=0},writeStartElement:function(b){this._writeAttributesEnd();this.writeRaw("<"+b);this.tags.push(b);this.inAttr=true;this.count++;this.elementCount=this.count},writeAttribute:function(d,b){var c=this;c.writeRaw(" "+c.encode(d)+'="'+c.encode(b)+'"')},writeEndElement:function(){var b;if(this.tags.length>0){b=this.tags.pop();if(this._writeAttributesEnd(1)){this.writeRaw("")}if(this.settings.indentation>0){this.writeRaw("\n")}}},writeFullEndElement:function(){if(this.tags.length>0){this._writeAttributesEnd();this.writeRaw("");if(this.settings.indentation>0){this.writeRaw("\n")}}},writeText:function(b){this._writeAttributesEnd();this.writeRaw(this.encode(b));this.count++},writeCDATA:function(b){this._writeAttributesEnd();this.writeRaw("");this.count++},writeComment:function(b){this._writeAttributesEnd();this.writeRaw("");this.count++},writeRaw:function(b){this.str+=b},encode:function(b){return b.replace(/[<>&"]/g,function(c){switch(c){case"<":return"<";case">":return">";case"&":return"&";case'"':return"""}return c})},getContent:function(){return this.str},_writeAttributesEnd:function(b){if(!this.inAttr){return}this.inAttr=false;if(b&&this.elementCount==this.count){this.writeRaw(" />");return false}this.writeRaw(">");return true}})})(tinymce);(function(e){var g=e.extend,f=e.each,b=e.util.Dispatcher,d=e.isIE,a=e.isGecko;function c(h){return h.replace(/([?+*])/g,".$1")}e.create("tinymce.dom.Serializer",{Serializer:function(j){var i=this;i.key=0;i.onPreProcess=new b(i);i.onPostProcess=new b(i);try{i.writer=new e.dom.XMLWriter()}catch(h){i.writer=new e.dom.StringWriter()}i.settings=j=g({dom:e.DOM,valid_nodes:0,node_filter:0,attr_filter:0,invalid_attrs:/^(_mce_|_moz_|sizset|sizcache)/,closed:/^(br|hr|input|meta|img|link|param|area)$/,entity_encoding:"named",entities:"160,nbsp,161,iexcl,162,cent,163,pound,164,curren,165,yen,166,brvbar,167,sect,168,uml,169,copy,170,ordf,171,laquo,172,not,173,shy,174,reg,175,macr,176,deg,177,plusmn,178,sup2,179,sup3,180,acute,181,micro,182,para,183,middot,184,cedil,185,sup1,186,ordm,187,raquo,188,frac14,189,frac12,190,frac34,191,iquest,192,Agrave,193,Aacute,194,Acirc,195,Atilde,196,Auml,197,Aring,198,AElig,199,Ccedil,200,Egrave,201,Eacute,202,Ecirc,203,Euml,204,Igrave,205,Iacute,206,Icirc,207,Iuml,208,ETH,209,Ntilde,210,Ograve,211,Oacute,212,Ocirc,213,Otilde,214,Ouml,215,times,216,Oslash,217,Ugrave,218,Uacute,219,Ucirc,220,Uuml,221,Yacute,222,THORN,223,szlig,224,agrave,225,aacute,226,acirc,227,atilde,228,auml,229,aring,230,aelig,231,ccedil,232,egrave,233,eacute,234,ecirc,235,euml,236,igrave,237,iacute,238,icirc,239,iuml,240,eth,241,ntilde,242,ograve,243,oacute,244,ocirc,245,otilde,246,ouml,247,divide,248,oslash,249,ugrave,250,uacute,251,ucirc,252,uuml,253,yacute,254,thorn,255,yuml,402,fnof,913,Alpha,914,Beta,915,Gamma,916,Delta,917,Epsilon,918,Zeta,919,Eta,920,Theta,921,Iota,922,Kappa,923,Lambda,924,Mu,925,Nu,926,Xi,927,Omicron,928,Pi,929,Rho,931,Sigma,932,Tau,933,Upsilon,934,Phi,935,Chi,936,Psi,937,Omega,945,alpha,946,beta,947,gamma,948,delta,949,epsilon,950,zeta,951,eta,952,theta,953,iota,954,kappa,955,lambda,956,mu,957,nu,958,xi,959,omicron,960,pi,961,rho,962,sigmaf,963,sigma,964,tau,965,upsilon,966,phi,967,chi,968,psi,969,omega,977,thetasym,978,upsih,982,piv,8226,bull,8230,hellip,8242,prime,8243,Prime,8254,oline,8260,frasl,8472,weierp,8465,image,8476,real,8482,trade,8501,alefsym,8592,larr,8593,uarr,8594,rarr,8595,darr,8596,harr,8629,crarr,8656,lArr,8657,uArr,8658,rArr,8659,dArr,8660,hArr,8704,forall,8706,part,8707,exist,8709,empty,8711,nabla,8712,isin,8713,notin,8715,ni,8719,prod,8721,sum,8722,minus,8727,lowast,8730,radic,8733,prop,8734,infin,8736,ang,8743,and,8744,or,8745,cap,8746,cup,8747,int,8756,there4,8764,sim,8773,cong,8776,asymp,8800,ne,8801,equiv,8804,le,8805,ge,8834,sub,8835,sup,8836,nsub,8838,sube,8839,supe,8853,oplus,8855,otimes,8869,perp,8901,sdot,8968,lceil,8969,rceil,8970,lfloor,8971,rfloor,9001,lang,9002,rang,9674,loz,9824,spades,9827,clubs,9829,hearts,9830,diams,338,OElig,339,oelig,352,Scaron,353,scaron,376,Yuml,710,circ,732,tilde,8194,ensp,8195,emsp,8201,thinsp,8204,zwnj,8205,zwj,8206,lrm,8207,rlm,8211,ndash,8212,mdash,8216,lsquo,8217,rsquo,8218,sbquo,8220,ldquo,8221,rdquo,8222,bdquo,8224,dagger,8225,Dagger,8240,permil,8249,lsaquo,8250,rsaquo,8364,euro",valid_elements:"*[*]",extended_valid_elements:0,invalid_elements:0,fix_table_elements:1,fix_list_elements:true,fix_content_duplication:true,convert_fonts_to_spans:false,font_size_classes:0,apply_source_formatting:0,indent_mode:"simple",indent_char:"\t",indent_levels:1,remove_linebreaks:1,remove_redundant_brs:1,element_format:"xhtml"},j);i.dom=j.dom;i.schema=j.schema;if(j.entity_encoding=="named"&&!j.entities){j.entity_encoding="raw"}if(j.remove_redundant_brs){i.onPostProcess.add(function(k,l){l.content=l.content.replace(/(
\s*)+<\/(p|h[1-6]|div|li)>/gi,function(n,m,o){if(/^
\s*<\//.test(n)){return""}return n})})}if(j.element_format=="html"){i.onPostProcess.add(function(k,l){l.content=l.content.replace(/<([^>]+) \/>/g,"<$1>")})}if(j.fix_list_elements){i.onPreProcess.add(function(v,s){var l,z,y=["ol","ul"],u,t,q,k=/^(OL|UL)$/,A;function m(r,x){var o=x.split(","),p;while((r=r.previousSibling)!=null){for(p=0;p=1767){f(i.dom.select("p table",l.node).reverse(),function(p){var o=i.dom.getParent(p.parentNode,"table,p");if(o.nodeName!="TABLE"){try{i.dom.split(o,p)}catch(m){}}})}})}},setEntities:function(o){var n=this,j,m,h={},k;if(n.entityLookup){return}j=o.split(",");for(m=0;m1){f(q[1].split("|"),function(u){var p={},t;k=k||[];u=u.replace(/::/g,"~");u=/^([!\-])?([\w*.?~_\-]+|)([=:<])?(.+)?$/.exec(u);u[2]=u[2].replace(/~/g,":");if(u[1]=="!"){r=r||[];r.push(u[2])}if(u[1]=="-"){for(t=0;t=1767)){p=j.createHTMLDocument("");f(r.nodeName=="BODY"?r.childNodes:[r],function(h){p.body.appendChild(p.importNode(h,true))});if(r.nodeName!="BODY"){r=p.body.firstChild}else{r=p.body}i=k.dom.doc;k.dom.doc=p}k.key=""+(parseInt(k.key)+1);if(!q.no_events){q.node=r;k.onPreProcess.dispatch(k,q)}k.writer.reset();k._info=q;k._serializeNode(r,q.getInner);q.content=k.writer.getContent();if(i){k.dom.doc=i}if(!q.no_events){k.onPostProcess.dispatch(k,q)}k._postProcess(q);q.node=null;return e.trim(q.content)},_postProcess:function(n){var i=this,k=i.settings,j=n.content,m=[],l;if(n.format=="html"){l=i._protect({content:j,patterns:[{pattern:/(]*>)(.*?)(<\/script>)/g},{pattern:/(]*>)(.*?)(<\/noscript>)/g},{pattern:/(]*>)(.*?)(<\/style>)/g},{pattern:/(]*>)(.*?)(<\/pre>)/g,encode:1},{pattern:/()/g}]});j=l.content;if(k.entity_encoding!=="raw"){j=i._encode(j)}if(!n.set){j=j.replace(/

\s+<\/p>|]+)>\s+<\/p>/g,k.entity_encoding=="numeric"?" 

":" 

");if(k.remove_linebreaks){j=j.replace(/\r?\n|\r/g," ");j=j.replace(/(<[^>]+>)\s+/g,"$1 ");j=j.replace(/\s+(<\/[^>]+>)/g," $1");j=j.replace(/<(p|h[1-6]|blockquote|hr|div|table|tbody|tr|td|body|head|html|title|meta|style|pre|script|link|object) ([^>]+)>\s+/g,"<$1 $2>");j=j.replace(/<(p|h[1-6]|blockquote|hr|div|table|tbody|tr|td|body|head|html|title|meta|style|pre|script|link|object)>\s+/g,"<$1>");j=j.replace(/\s+<\/(p|h[1-6]|blockquote|hr|div|table|tbody|tr|td|body|head|html|title|meta|style|pre|script|link|object)>/g,"")}if(k.apply_source_formatting&&k.indent_mode=="simple"){j=j.replace(/<(\/?)(ul|hr|table|meta|link|tbody|tr|object|body|head|html|map)(|[^>]+)>\s*/g,"\n<$1$2$3>\n");j=j.replace(/\s*<(p|h[1-6]|blockquote|div|title|style|pre|script|td|li|area)(|[^>]+)>/g,"\n<$1$2>");j=j.replace(/<\/(p|h[1-6]|blockquote|div|title|style|pre|script|td|li)>\s*/g,"\n");j=j.replace(/\n\n/g,"\n")}}j=i._unprotect(j,l);j=j.replace(//g,"");if(k.entity_encoding=="raw"){j=j.replace(/

 <\/p>|]+)> <\/p>/g,"\u00a0

")}j=j.replace(/]+|)>([\s\S]*?)<\/noscript>/g,function(h,p,o){return""+i.dom.decode(o.replace(//g,""))+""})}n.content=j},_serializeNode:function(E,J){var A=this,B=A.settings,y=A.writer,q,j,u,G,F,I,C,h,z,k,r,D,p,m,H,o,x;if(!B.node_filter||B.node_filter(E)){switch(E.nodeType){case 1:if(E.hasAttribute?E.hasAttribute("_mce_bogus"):E.getAttribute("_mce_bogus")){return}p=H=false;q=E.hasChildNodes();k=E.getAttribute("_mce_name")||E.nodeName.toLowerCase();o=E.getAttribute("_mce_type");if(o){if(!A._info.cleanup){p=true;return}else{H=1}}if(d){x=E.scopeName;if(x&&x!=="HTML"&&x!=="html"){k=x+":"+k}}if(k.indexOf("mce:")===0){k=k.substring(4)}if(!H){if(!A.validElementsRE||!A.validElementsRE.test(k)||(A.invalidElementsRE&&A.invalidElementsRE.test(k))||J){p=true;break}}if(d){if(B.fix_content_duplication){if(E._mce_serialized==A.key){return}E._mce_serialized=A.key}if(k.charAt(0)=="/"){k=k.substring(1)}}else{if(a){if(E.nodeName==="BR"&&E.getAttribute("type")=="_moz"){return}}}if(B.validate_children){if(A.elementName&&!A.schema.isValid(A.elementName,k)){p=true;break}A.elementName=k}r=A.findRule(k);if(!r){p=true;break}k=r.name||k;m=B.closed.test(k);if((!q&&r.noEmpty)||(d&&!k)){p=true;break}if(r.requiredAttribs){I=r.requiredAttribs;for(G=I.length-1;G>=0;G--){if(this.dom.getAttrib(E,I[G])!==""){break}}if(G==-1){p=true;break}}y.writeStartElement(k);if(r.attribs){for(G=0,C=r.attribs,F=C.length;G-1;G--){h=C[G];if(h.specified){I=h.nodeName.toLowerCase();if(B.invalid_attrs.test(I)||!r.validAttribsRE.test(I)){continue}D=A.findAttribRule(r,I);z=A._getAttrib(E,D,I);if(z!==null){y.writeAttribute(I,z)}}}}if(o&&H){y.writeAttribute("_mce_type",o)}if(k==="script"&&e.trim(E.innerHTML)){y.writeText("// ");y.writeCDATA(E.innerHTML.replace(/|<\[CDATA\[|\]\]>/g,""));q=false;break}if(r.padd){if(q&&(u=E.firstChild)&&u.nodeType===1&&E.childNodes.length===1){if(u.hasAttribute?u.hasAttribute("_mce_bogus"):u.getAttribute("_mce_bogus")){y.writeText("\u00a0")}}else{if(!q){y.writeText("\u00a0")}}}break;case 3:if(B.validate_children&&A.elementName&&!A.schema.isValid(A.elementName,"#text")){return}return y.writeText(E.nodeValue);case 4:return y.writeCDATA(E.nodeValue);case 8:return y.writeComment(E.nodeValue)}}else{if(E.nodeType==1){q=E.hasChildNodes()}}if(q&&!m){u=E.firstChild;while(u){A._serializeNode(u);A.elementName=k;u=u.nextSibling}}if(!p){if(!m){y.writeFullEndElement()}else{y.writeEndElement()}}},_protect:function(j){var i=this;j.items=j.items||[];function h(l){return l.replace(/[\r\n\\]/g,function(m){if(m==="\n"){return"\\n"}else{if(m==="\\"){return"\\\\"}}return"\\r"})}function k(l){return l.replace(/\\[\\rn]/g,function(m){if(m==="\\n"){return"\n"}else{if(m==="\\\\"){return"\\"}}return"\r"})}f(j.patterns,function(l){j.content=k(h(j.content).replace(l.pattern,function(n,o,m,p){m=k(m);if(l.encode){m=i._encode(m)}j.items.push(m);return o+""+p}))});return j},_unprotect:function(i,j){i=i.replace(/\"))}if(a&&j.ListBox){if(a.Button||a.SplitButton){e+=b.createHTML("td",{"class":"mceToolbarEnd"},b.createHTML("span",null,""))}}if(b.stdMode){e+=''+j.renderHTML()+""}else{e+=""+j.renderHTML()+""}if(f&&j.ListBox){if(f.Button||f.SplitButton){e+=b.createHTML("td",{"class":"mceToolbarStart"},b.createHTML("span",null,""))}}}g="mceToolbarEnd";if(j.Button){g+=" mceToolbarEndButton"}else{if(j.SplitButton){g+=" mceToolbarEndSplitButton"}else{if(j.ListBox){g+=" mceToolbarEndListBox"}}}e+=b.createHTML("td",{"class":g},b.createHTML("span",null,""));return b.createHTML("table",{id:l.id,"class":"mceToolbar"+(m["class"]?" "+m["class"]:""),cellpadding:"0",cellspacing:"0",align:l.settings.align||""},""+e+"")}});(function(b){var a=b.util.Dispatcher,c=b.each;b.create("tinymce.AddOnManager",{items:[],urls:{},lookup:{},onAdd:new a(this),get:function(d){return this.lookup[d]},requireLangPack:function(e){var d=b.settings;if(d&&d.language){b.ScriptLoader.add(this.urls[e]+"/langs/"+d.language+".js")}},add:function(e,d){this.items.push(d);this.lookup[e]=d;this.onAdd.dispatch(this,e,d);return d},load:function(h,e,d,g){var f=this;if(f.urls[h]){return}if(e.indexOf("/")!=0&&e.indexOf("://")==-1){e=b.baseURL+"/"+e}f.urls[h]=e.substring(0,e.lastIndexOf("/"));b.ScriptLoader.add(e,d,g)}});b.PluginManager=new b.AddOnManager();b.ThemeManager=new b.AddOnManager()}(tinymce));(function(j){var g=j.each,d=j.extend,k=j.DOM,i=j.dom.Event,f=j.ThemeManager,b=j.PluginManager,e=j.explode,h=j.util.Dispatcher,a,c=0;j.documentBaseURL=window.location.href.replace(/[\?#].*$/,"").replace(/[\/\\][^\/]+$/,"");if(!/[\/\\]$/.test(j.documentBaseURL)){j.documentBaseURL+="/"}j.baseURL=new j.util.URI(j.documentBaseURL).toAbsolute(j.baseURL);j.baseURI=new j.util.URI(j.baseURL);j.onBeforeUnload=new h(j);i.add(window,"beforeunload",function(l){j.onBeforeUnload.dispatch(j,l)});j.onAddEditor=new h(j);j.onRemoveEditor=new h(j);j.EditorManager=d(j,{editors:[],i18n:{},activeEditor:null,init:function(q){var n=this,p,l=j.ScriptLoader,u,o=[],m;function r(x,y,t){var v=x[y];if(!v){return}if(j.is(v,"string")){t=v.replace(/\.\w+$/,"");t=t?j.resolve(t):0;v=j.resolve(v)}return v.apply(t||this,Array.prototype.slice.call(arguments,2))}q=d({theme:"simple",language:"en"},q);n.settings=q;i.add(document,"init",function(){var s,v;r(q,"onpageload");switch(q.mode){case"exact":s=q.elements||"";if(s.length>0){g(e(s),function(x){if(k.get(x)){m=new j.Editor(x,q);o.push(m);m.render(1)}else{g(document.forms,function(y){g(y.elements,function(z){if(z.name===x){x="mce_editor_"+c++;k.setAttrib(z,"id",x);m=new j.Editor(x,q);o.push(m);m.render(1)}})})}})}break;case"textareas":case"specific_textareas":function t(y,x){return x.constructor===RegExp?x.test(y.className):k.hasClass(y,x)}g(k.select("textarea"),function(x){if(q.editor_deselector&&t(x,q.editor_deselector)){return}if(!q.editor_selector||t(x,q.editor_selector)){u=k.get(x.name);if(!x.id&&!u){x.id=x.name}if(!x.id||n.get(x.id)){x.id=k.uniqueId()}m=new j.Editor(x.id,q);o.push(m);m.render(1)}});break}if(q.oninit){s=v=0;g(o,function(x){v++;if(!x.initialized){x.onInit.add(function(){s++;if(s==v){r(q,"oninit")}})}else{s++}if(s==v){r(q,"oninit")}})}})},get:function(l){if(l===a){return this.editors}return this.editors[l]},getInstanceById:function(l){return this.get(l)},add:function(m){var l=this,n=l.editors;n[m.id]=m;n.push(m);l._setActive(m);l.onAddEditor.dispatch(l,m);return m},remove:function(n){var m=this,l,o=m.editors;if(!o[n.id]){return null}delete o[n.id];for(l=0;l':"",visual_table_class:"mceItemTable",visual:1,font_size_style_values:"xx-small,x-small,small,medium,large,x-large,xx-large",apply_source_formatting:1,directionality:"ltr",forced_root_block:"p",valid_elements:"@[id|class|style|title|dir';if(F.document_base_url!=m.documentBaseURL){E.iframeHTML+=''}E.iframeHTML+='';if(m.relaxedDomain){E.iframeHTML+=''; + + bi = s.body_id || 'tinymce'; + if (bi.indexOf('=') != -1) { + bi = t.getParam('body_id', '', 'hash'); + bi = bi[t.id] || bi; + } + + bc = s.body_class || ''; + if (bc.indexOf('=') != -1) { + bc = t.getParam('body_class', '', 'hash'); + bc = bc[t.id] || ''; + } + + t.iframeHTML += ''; + + // Domain relaxing enabled, then set document domain + if (tinymce.relaxedDomain) { + // We need to write the contents here in IE since multiple writes messes up refresh button and back button + if (isIE || (tinymce.isOpera && parseFloat(opera.version()) >= 9.5)) + u = 'javascript:(function(){document.open();document.domain="' + document.domain + '";var ed = window.parent.tinyMCE.get("' + t.id + '");document.write(ed.iframeHTML);document.close();ed.setupIframe();})()'; + else if (tinymce.isOpera) + u = 'javascript:(function(){document.open();document.domain="' + document.domain + '";document.close();ed.setupIframe();})()'; + } + + // Create iframe + n = DOM.add(o.iframeContainer, 'iframe', { + id : t.id + "_ifr", + src : u || 'javascript:""', // Workaround for HTTPS warning in IE6/7 + frameBorder : '0', + style : { + width : '100%', + height : h + } + }); + + t.contentAreaContainer = o.iframeContainer; + DOM.get(o.editorContainer).style.display = t.orgDisplay; + DOM.get(t.id).style.display = 'none'; + + if (!isIE || !tinymce.relaxedDomain) + t.setupIframe(); + + e = n = o = null; // Cleanup + }, + + setupIframe : function() { + var t = this, s = t.settings, e = DOM.get(t.id), d = t.getDoc(), h, b; + + // Setup iframe body + if (!isIE || !tinymce.relaxedDomain) { + d.open(); + d.write(t.iframeHTML); + d.close(); + } + + // Design mode needs to be added here Ctrl+A will fail otherwise + if (!isIE) { + try { + if (!s.readonly) + d.designMode = 'On'; + } catch (ex) { + // Will fail on Gecko if the editor is placed in an hidden container element + // The design mode will be set ones the editor is focused + } + } + + // IE needs to use contentEditable or it will display non secure items for HTTPS + if (isIE) { + // It will not steal focus if we hide it while setting contentEditable + b = t.getBody(); + DOM.hide(b); + + if (!s.readonly) + b.contentEditable = true; + + DOM.show(b); + } + + t.dom = new tinymce.dom.DOMUtils(t.getDoc(), { + keep_values : true, + url_converter : t.convertURL, + url_converter_scope : t, + hex_colors : s.force_hex_style_colors, + class_filter : s.class_filter, + update_styles : 1, + fix_ie_paragraphs : 1, + valid_styles : s.valid_styles + }); + + t.schema = new tinymce.dom.Schema(); + + t.serializer = new tinymce.dom.Serializer(extend(s, { + valid_elements : s.verify_html === false ? '*[*]' : s.valid_elements, + dom : t.dom, + schema : t.schema + })); + + t.selection = new tinymce.dom.Selection(t.dom, t.getWin(), t.serializer); + + t.formatter = new tinymce.Formatter(this); + + // Register default formats + t.formatter.register({ + alignleft : [ + {selector : 'p,h1,h2,h3,h4,h5,h6,td,th,div,ul,ol,li', styles : {textAlign : 'left'}}, + {selector : 'img,table', styles : {'float' : 'left'}} + ], + + aligncenter : [ + {selector : 'p,h1,h2,h3,h4,h5,h6,td,th,div,ul,ol,li', styles : {textAlign : 'center'}}, + {selector : 'img', styles : {display : 'block', marginLeft : 'auto', marginRight : 'auto'}}, + {selector : 'table', styles : {marginLeft : 'auto', marginRight : 'auto'}} + ], + + alignright : [ + {selector : 'p,h1,h2,h3,h4,h5,h6,td,th,div,ul,ol,li', styles : {textAlign : 'right'}}, + {selector : 'img,table', styles : {'float' : 'right'}} + ], + + alignfull : [ + {selector : 'p,h1,h2,h3,h4,h5,h6,td,th,div,ul,ol,li', styles : {textAlign : 'justify'}} + ], + + bold : [ + {inline : 'strong'}, + {inline : 'span', styles : {fontWeight : 'bold'}}, + {inline : 'b'} + ], + + italic : [ + {inline : 'em'}, + {inline : 'span', styles : {fontStyle : 'italic'}}, + {inline : 'i'} + ], + + underline : [ + {inline : 'span', styles : {textDecoration : 'underline'}, exact : true}, + {inline : 'u'} + ], + + strikethrough : [ + {inline : 'span', styles : {textDecoration : 'line-through'}, exact : true}, + {inline : 'u'} + ], + + forecolor : {inline : 'span', styles : {color : '%value'}}, + hilitecolor : {inline : 'span', styles : {backgroundColor : '%value'}}, + fontname : {inline : 'span', styles : {fontFamily : '%value'}}, + fontsize : {inline : 'span', styles : {fontSize : '%value'}}, + fontsize_class : {inline : 'span', attributes : {'class' : '%value'}}, + blockquote : {block : 'blockquote', wrapper : 1, remove : 'all'}, + + removeformat : [ + {selector : 'b,strong,em,i,font,u,strike', remove : 'all', split : true, expand : false, block_expand : true, deep : true}, + {selector : 'span', attributes : ['style', 'class'], remove : 'empty', split : true, expand : false, deep : true}, + {selector : '*', attributes : ['style', 'class'], split : false, expand : false, deep : true} + ] + }); + + // Register default block formats + each('p h1 h2 h3 h4 h5 h6 div address pre div code dt dd samp'.split(/\s/), function(name) { + t.formatter.register(name, {block : name, remove : 'all'}); + }); + + // Register user defined formats + t.formatter.register(t.settings.formats); + + t.undoManager = new tinymce.UndoManager(t); + + // Pass through + t.undoManager.onAdd.add(function(um, l) { + if (!l.initial) + return t.onChange.dispatch(t, l, um); + }); + + t.undoManager.onUndo.add(function(um, l) { + return t.onUndo.dispatch(t, l, um); + }); + + t.undoManager.onRedo.add(function(um, l) { + return t.onRedo.dispatch(t, l, um); + }); + + t.forceBlocks = new tinymce.ForceBlocks(t, { + forced_root_block : s.forced_root_block + }); + + t.editorCommands = new tinymce.EditorCommands(t); + + // Pass through + t.serializer.onPreProcess.add(function(se, o) { + return t.onPreProcess.dispatch(t, o, se); + }); + + t.serializer.onPostProcess.add(function(se, o) { + return t.onPostProcess.dispatch(t, o, se); + }); + + t.onPreInit.dispatch(t); + + if (!s.gecko_spellcheck) + t.getBody().spellcheck = 0; + + if (!s.readonly) + t._addEvents(); + + t.controlManager.onPostRender.dispatch(t, t.controlManager); + t.onPostRender.dispatch(t); + + if (s.directionality) + t.getBody().dir = s.directionality; + + if (s.nowrap) + t.getBody().style.whiteSpace = "nowrap"; + + if (s.custom_elements) { + function handleCustom(ed, o) { + each(explode(s.custom_elements), function(v) { + var n; + + if (v.indexOf('~') === 0) { + v = v.substring(1); + n = 'span'; + } else + n = 'div'; + + o.content = o.content.replace(new RegExp('<(' + v + ')([^>]*)>', 'g'), '<' + n + ' _mce_name="$1"$2>'); + o.content = o.content.replace(new RegExp('', 'g'), ''); + }); + }; + + t.onBeforeSetContent.add(handleCustom); + t.onPostProcess.add(function(ed, o) { + if (o.set) + handleCustom(ed, o); + }); + } + + if (s.handle_node_change_callback) { + t.onNodeChange.add(function(ed, cm, n) { + t.execCallback('handle_node_change_callback', t.id, n, -1, -1, true, t.selection.isCollapsed()); + }); + } + + if (s.save_callback) { + t.onSaveContent.add(function(ed, o) { + var h = t.execCallback('save_callback', t.id, o.content, t.getBody()); + + if (h) + o.content = h; + }); + } + + if (s.onchange_callback) { + t.onChange.add(function(ed, l) { + t.execCallback('onchange_callback', t, l); + }); + } + + if (s.convert_newlines_to_brs) { + t.onBeforeSetContent.add(function(ed, o) { + if (o.initial) + o.content = o.content.replace(/\r?\n/g, '
'); + }); + } + + if (s.fix_nesting && isIE) { + t.onBeforeSetContent.add(function(ed, o) { + o.content = t._fixNesting(o.content); + }); + } + + if (s.preformatted) { + t.onPostProcess.add(function(ed, o) { + o.content = o.content.replace(/^\s*/, ''); + o.content = o.content.replace(/<\/pre>\s*$/, ''); + + if (o.set) + o.content = '
' + o.content + '
'; + }); + } + + if (s.verify_css_classes) { + t.serializer.attribValueFilter = function(n, v) { + var s, cl; + + if (n == 'class') { + // Build regexp for classes + if (!t.classesRE) { + cl = t.dom.getClasses(); + + if (cl.length > 0) { + s = ''; + + each (cl, function(o) { + s += (s ? '|' : '') + o['class']; + }); + + t.classesRE = new RegExp('(' + s + ')', 'gi'); + } + } + + return !t.classesRE || /(\bmceItem\w+\b|\bmceTemp\w+\b)/g.test(v) || t.classesRE.test(v) ? v : ''; + } + + return v; + }; + } + + if (s.cleanup_callback) { + t.onBeforeSetContent.add(function(ed, o) { + o.content = t.execCallback('cleanup_callback', 'insert_to_editor', o.content, o); + }); + + t.onPreProcess.add(function(ed, o) { + if (o.set) + t.execCallback('cleanup_callback', 'insert_to_editor_dom', o.node, o); + + if (o.get) + t.execCallback('cleanup_callback', 'get_from_editor_dom', o.node, o); + }); + + t.onPostProcess.add(function(ed, o) { + if (o.set) + o.content = t.execCallback('cleanup_callback', 'insert_to_editor', o.content, o); + + if (o.get) + o.content = t.execCallback('cleanup_callback', 'get_from_editor', o.content, o); + }); + } + + if (s.save_callback) { + t.onGetContent.add(function(ed, o) { + if (o.save) + o.content = t.execCallback('save_callback', t.id, o.content, t.getBody()); + }); + } + + if (s.handle_event_callback) { + t.onEvent.add(function(ed, e, o) { + if (t.execCallback('handle_event_callback', e, ed, o) === false) + Event.cancel(e); + }); + } + + // Add visual aids when new contents is added + t.onSetContent.add(function() { + t.addVisual(t.getBody()); + }); + + // Remove empty contents + if (s.padd_empty_editor) { + t.onPostProcess.add(function(ed, o) { + o.content = o.content.replace(/^(]*>( | |\s|\u00a0|)<\/p>[\r\n]*|
[\r\n]*)$/, ''); + }); + } + + if (isGecko) { + // Fix gecko link bug, when a link is placed at the end of block elements there is + // no way to move the caret behind the link. This fix adds a bogus br element after the link + function fixLinks(ed, o) { + each(ed.dom.select('a'), function(n) { + var pn = n.parentNode; + + if (ed.dom.isBlock(pn) && pn.lastChild === n) + ed.dom.add(pn, 'br', {'_mce_bogus' : 1}); + }); + }; + + t.onExecCommand.add(function(ed, cmd) { + if (cmd === 'CreateLink') + fixLinks(ed); + }); + + t.onSetContent.add(t.selection.onSetContent.add(fixLinks)); + + if (!s.readonly) { + try { + // Design mode must be set here once again to fix a bug where + // Ctrl+A/Delete/Backspace didn't work if the editor was added using mceAddControl then removed then added again + d.designMode = 'Off'; + d.designMode = 'On'; + } catch (ex) { + // Will fail on Gecko if the editor is placed in an hidden container element + // The design mode will be set ones the editor is focused + } + } + } + + // A small timeout was needed since firefox will remove. Bug: #1838304 + setTimeout(function () { + if (t.removed) + return; + + t.load({initial : true, format : (s.cleanup_on_startup ? 'html' : 'raw')}); + t.startContent = t.getContent({format : 'raw'}); + t.initialized = true; + + t.onInit.dispatch(t); + t.execCallback('setupcontent_callback', t.id, t.getBody(), t.getDoc()); + t.execCallback('init_instance_callback', t); + t.focus(true); + t.nodeChanged({initial : 1}); + + // Load specified content CSS last + if (s.content_css) { + tinymce.each(explode(s.content_css), function(u) { + t.dom.loadCSS(t.documentBaseURI.toAbsolute(u)); + }); + } + + // Handle auto focus + if (s.auto_focus) { + setTimeout(function () { + var ed = tinymce.get(s.auto_focus); + + ed.selection.select(ed.getBody(), 1); + ed.selection.collapse(1); + ed.getWin().focus(); + }, 100); + } + }, 1); + + e = null; + }, + + + focus : function(sf) { + var oed, t = this, ce = t.settings.content_editable, ieRng, controlElm, doc = t.getDoc(); + + if (!sf) { + // Get selected control element + ieRng = t.selection.getRng(); + if (ieRng.item) { + controlElm = ieRng.item(0); + } + + // Is not content editable + if (!ce) + t.getWin().focus(); + + // Restore selected control element + // This is needed when for example an image is selected within a + // layer a call to focus will then remove the control selection + if (controlElm && controlElm.ownerDocument == doc) { + ieRng = doc.body.createControlRange(); + ieRng.addElement(controlElm); + ieRng.select(); + } + + } + + if (tinymce.activeEditor != t) { + if ((oed = tinymce.activeEditor) != null) + oed.onDeactivate.dispatch(oed, t); + + t.onActivate.dispatch(t, oed); + } + + tinymce._setActive(t); + }, + + execCallback : function(n) { + var t = this, f = t.settings[n], s; + + if (!f) + return; + + // Look through lookup + if (t.callbackLookup && (s = t.callbackLookup[n])) { + f = s.func; + s = s.scope; + } + + if (is(f, 'string')) { + s = f.replace(/\.\w+$/, ''); + s = s ? tinymce.resolve(s) : 0; + f = tinymce.resolve(f); + t.callbackLookup = t.callbackLookup || {}; + t.callbackLookup[n] = {func : f, scope : s}; + } + + return f.apply(s || t, Array.prototype.slice.call(arguments, 1)); + }, + + translate : function(s) { + var c = this.settings.language || 'en', i18n = tinymce.i18n; + + if (!s) + return ''; + + return i18n[c + '.' + s] || s.replace(/{\#([^}]+)\}/g, function(a, b) { + return i18n[c + '.' + b] || '{#' + b + '}'; + }); + }, + + getLang : function(n, dv) { + return tinymce.i18n[(this.settings.language || 'en') + '.' + n] || (is(dv) ? dv : '{#' + n + '}'); + }, + + getParam : function(n, dv, ty) { + var tr = tinymce.trim, v = is(this.settings[n]) ? this.settings[n] : dv, o; + + if (ty === 'hash') { + o = {}; + + if (is(v, 'string')) { + each(v.indexOf('=') > 0 ? v.split(/[;,](?![^=;,]*(?:[;,]|$))/) : v.split(','), function(v) { + v = v.split('='); + + if (v.length > 1) + o[tr(v[0])] = tr(v[1]); + else + o[tr(v[0])] = tr(v); + }); + } else + o = v; + + return o; + } + + return v; + }, + + nodeChanged : function(o) { + var t = this, s = t.selection, n = (isIE ? s.getNode() : s.getStart()) || t.getBody(); + + // Fix for bug #1896577 it seems that this can not be fired while the editor is loading + if (t.initialized) { + o = o || {}; + n = isIE && n.ownerDocument != t.getDoc() ? t.getBody() : n; // Fix for IE initial state + + // Get parents and add them to object + o.parents = []; + t.dom.getParent(n, function(node) { + if (node.nodeName == 'BODY') + return true; + + o.parents.push(node); + }); + + t.onNodeChange.dispatch( + t, + o ? o.controlManager || t.controlManager : t.controlManager, + n, + s.isCollapsed(), + o + ); + } + }, + + addButton : function(n, s) { + var t = this; + + t.buttons = t.buttons || {}; + t.buttons[n] = s; + }, + + addCommand : function(n, f, s) { + this.execCommands[n] = {func : f, scope : s || this}; + }, + + addQueryStateHandler : function(n, f, s) { + this.queryStateCommands[n] = {func : f, scope : s || this}; + }, + + addQueryValueHandler : function(n, f, s) { + this.queryValueCommands[n] = {func : f, scope : s || this}; + }, + + addShortcut : function(pa, desc, cmd_func, sc) { + var t = this, c; + + if (!t.settings.custom_shortcuts) + return false; + + t.shortcuts = t.shortcuts || {}; + + if (is(cmd_func, 'string')) { + c = cmd_func; + + cmd_func = function() { + t.execCommand(c, false, null); + }; + } + + if (is(cmd_func, 'object')) { + c = cmd_func; + + cmd_func = function() { + t.execCommand(c[0], c[1], c[2]); + }; + } + + each(explode(pa), function(pa) { + var o = { + func : cmd_func, + scope : sc || this, + desc : desc, + alt : false, + ctrl : false, + shift : false + }; + + each(explode(pa, '+'), function(v) { + switch (v) { + case 'alt': + case 'ctrl': + case 'shift': + o[v] = true; + break; + + default: + o.charCode = v.charCodeAt(0); + o.keyCode = v.toUpperCase().charCodeAt(0); + } + }); + + t.shortcuts[(o.ctrl ? 'ctrl' : '') + ',' + (o.alt ? 'alt' : '') + ',' + (o.shift ? 'shift' : '') + ',' + o.keyCode] = o; + }); + + return true; + }, + + execCommand : function(cmd, ui, val, a) { + var t = this, s = 0, o, st; + + if (!/^(mceAddUndoLevel|mceEndUndoLevel|mceBeginUndoLevel|mceRepaint|SelectAll)$/.test(cmd) && (!a || !a.skip_focus)) + t.focus(); + + o = {}; + t.onBeforeExecCommand.dispatch(t, cmd, ui, val, o); + if (o.terminate) + return false; + + // Command callback + if (t.execCallback('execcommand_callback', t.id, t.selection.getNode(), cmd, ui, val)) { + t.onExecCommand.dispatch(t, cmd, ui, val, a); + return true; + } + + // Registred commands + if (o = t.execCommands[cmd]) { + st = o.func.call(o.scope, ui, val); + + // Fall through on true + if (st !== true) { + t.onExecCommand.dispatch(t, cmd, ui, val, a); + return st; + } + } + + // Plugin commands + each(t.plugins, function(p) { + if (p.execCommand && p.execCommand(cmd, ui, val)) { + t.onExecCommand.dispatch(t, cmd, ui, val, a); + s = 1; + return false; + } + }); + + if (s) + return true; + + // Theme commands + if (t.theme && t.theme.execCommand && t.theme.execCommand(cmd, ui, val)) { + t.onExecCommand.dispatch(t, cmd, ui, val, a); + return true; + } + + // Execute global commands + if (tinymce.GlobalCommands.execCommand(t, cmd, ui, val)) { + t.onExecCommand.dispatch(t, cmd, ui, val, a); + return true; + } + + // Editor commands + if (t.editorCommands.execCommand(cmd, ui, val)) { + t.onExecCommand.dispatch(t, cmd, ui, val, a); + return true; + } + + // Browser commands + t.getDoc().execCommand(cmd, ui, val); + t.onExecCommand.dispatch(t, cmd, ui, val, a); + }, + + queryCommandState : function(cmd) { + var t = this, o, s; + + // Is hidden then return undefined + if (t._isHidden()) + return; + + // Registred commands + if (o = t.queryStateCommands[cmd]) { + s = o.func.call(o.scope); + + // Fall though on true + if (s !== true) + return s; + } + + // Registred commands + o = t.editorCommands.queryCommandState(cmd); + if (o !== -1) + return o; + + // Browser commands + try { + return this.getDoc().queryCommandState(cmd); + } catch (ex) { + // Fails sometimes see bug: 1896577 + } + }, + + queryCommandValue : function(c) { + var t = this, o, s; + + // Is hidden then return undefined + if (t._isHidden()) + return; + + // Registred commands + if (o = t.queryValueCommands[c]) { + s = o.func.call(o.scope); + + // Fall though on true + if (s !== true) + return s; + } + + // Registred commands + o = t.editorCommands.queryCommandValue(c); + if (is(o)) + return o; + + // Browser commands + try { + return this.getDoc().queryCommandValue(c); + } catch (ex) { + // Fails sometimes see bug: 1896577 + } + }, + + show : function() { + var t = this; + + DOM.show(t.getContainer()); + DOM.hide(t.id); + t.load(); + }, + + hide : function() { + var t = this, d = t.getDoc(); + + // Fixed bug where IE has a blinking cursor left from the editor + if (isIE && d) + d.execCommand('SelectAll'); + + // We must save before we hide so Safari doesn't crash + t.save(); + DOM.hide(t.getContainer()); + DOM.setStyle(t.id, 'display', t.orgDisplay); + }, + + isHidden : function() { + return !DOM.isHidden(this.id); + }, + + setProgressState : function(b, ti, o) { + this.onSetProgressState.dispatch(this, b, ti, o); + + return b; + }, + + load : function(o) { + var t = this, e = t.getElement(), h; + + if (e) { + o = o || {}; + o.load = true; + + // Double encode existing entities in the value + h = t.setContent(is(e.value) ? e.value : e.innerHTML, o); + o.element = e; + + if (!o.no_events) + t.onLoadContent.dispatch(t, o); + + o.element = e = null; + + return h; + } + }, + + save : function(o) { + var t = this, e = t.getElement(), h, f; + + if (!e || !t.initialized) + return; + + o = o || {}; + o.save = true; + + // Add undo level will trigger onchange event + if (!o.no_events) { + t.undoManager.typing = 0; + t.undoManager.add(); + } + + o.element = e; + h = o.content = t.getContent(o); + + if (!o.no_events) + t.onSaveContent.dispatch(t, o); + + h = o.content; + + if (!/TEXTAREA|INPUT/i.test(e.nodeName)) { + e.innerHTML = h; + + // Update hidden form element + if (f = DOM.getParent(t.id, 'form')) { + each(f.elements, function(e) { + if (e.name == t.id) { + e.value = h; + return false; + } + }); + } + } else + e.value = h; + + o.element = e = null; + + return h; + }, + + setContent : function(h, o) { + var t = this; + + o = o || {}; + o.format = o.format || 'html'; + o.set = true; + o.content = h; + + if (!o.no_events) + t.onBeforeSetContent.dispatch(t, o); + + // Padd empty content in Gecko and Safari. Commands will otherwise fail on the content + // It will also be impossible to place the caret in the editor unless there is a BR element present + if (!tinymce.isIE && (h.length === 0 || /^\s+$/.test(h))) { + o.content = t.dom.setHTML(t.getBody(), '
'); + o.format = 'raw'; + } + + o.content = t.dom.setHTML(t.getBody(), tinymce.trim(o.content)); + + if (o.format != 'raw' && t.settings.cleanup) { + o.getInner = true; + o.content = t.dom.setHTML(t.getBody(), t.serializer.serialize(t.getBody(), o)); + } + + if (!o.no_events) + t.onSetContent.dispatch(t, o); + + return o.content; + }, + + getContent : function(o) { + var t = this, h; + + o = o || {}; + o.format = o.format || 'html'; + o.get = true; + + if (!o.no_events) + t.onBeforeGetContent.dispatch(t, o); + + if (o.format != 'raw' && t.settings.cleanup) { + o.getInner = true; + h = t.serializer.serialize(t.getBody(), o); + } else + h = t.getBody().innerHTML; + + h = h.replace(/^\s*|\s*$/g, ''); + o.content = h; + + if (!o.no_events) + t.onGetContent.dispatch(t, o); + + return o.content; + }, + + isDirty : function() { + var t = this; + + return tinymce.trim(t.startContent) != tinymce.trim(t.getContent({format : 'raw', no_events : 1})) && !t.isNotDirty; + }, + + getContainer : function() { + var t = this; + + if (!t.container) + t.container = DOM.get(t.editorContainer || t.id + '_parent'); + + return t.container; + }, + + getContentAreaContainer : function() { + return this.contentAreaContainer; + }, + + getElement : function() { + return DOM.get(this.settings.content_element || this.id); + }, + + getWin : function() { + var t = this, e; + + if (!t.contentWindow) { + e = DOM.get(t.id + "_ifr"); + + if (e) + t.contentWindow = e.contentWindow; + } + + return t.contentWindow; + }, + + getDoc : function() { + var t = this, w; + + if (!t.contentDocument) { + w = t.getWin(); + + if (w) + t.contentDocument = w.document; + } + + return t.contentDocument; + }, + + getBody : function() { + return this.bodyElement || this.getDoc().body; + }, + + convertURL : function(u, n, e) { + var t = this, s = t.settings; + + // Use callback instead + if (s.urlconverter_callback) + return t.execCallback('urlconverter_callback', u, e, true, n); + + // Don't convert link href since thats the CSS files that gets loaded into the editor also skip local file URLs + if (!s.convert_urls || (e && e.nodeName == 'LINK') || u.indexOf('file:') === 0) + return u; + + // Convert to relative + if (s.relative_urls) + return t.documentBaseURI.toRelative(u); + + // Convert to absolute + u = t.documentBaseURI.toAbsolute(u, s.remove_script_host); + + return u; + }, + + addVisual : function(e) { + var t = this, s = t.settings; + + e = e || t.getBody(); + + if (!is(t.hasVisual)) + t.hasVisual = s.visual; + + each(t.dom.select('table,a', e), function(e) { + var v; + + switch (e.nodeName) { + case 'TABLE': + v = t.dom.getAttrib(e, 'border'); + + if (!v || v == '0') { + if (t.hasVisual) + t.dom.addClass(e, s.visual_table_class); + else + t.dom.removeClass(e, s.visual_table_class); + } + + return; + + case 'A': + v = t.dom.getAttrib(e, 'name'); + + if (v) { + if (t.hasVisual) + t.dom.addClass(e, 'mceItemAnchor'); + else + t.dom.removeClass(e, 'mceItemAnchor'); + } + + return; + } + }); + + t.onVisualAid.dispatch(t, e, t.hasVisual); + }, + + remove : function() { + var t = this, e = t.getContainer(); + + t.removed = 1; // Cancels post remove event execution + t.hide(); + + t.execCallback('remove_instance_callback', t); + t.onRemove.dispatch(t); + + // Clear all execCommand listeners this is required to avoid errors if the editor was removed inside another command + t.onExecCommand.listeners = []; + + tinymce.remove(t); + DOM.remove(e); + }, + + destroy : function(s) { + var t = this; + + // One time is enough + if (t.destroyed) + return; + + if (!s) { + tinymce.removeUnload(t.destroy); + tinyMCE.onBeforeUnload.remove(t._beforeUnload); + + // Manual destroy + if (t.theme && t.theme.destroy) + t.theme.destroy(); + + // Destroy controls, selection and dom + t.controlManager.destroy(); + t.selection.destroy(); + t.dom.destroy(); + + // Remove all events + + // Don't clear the window or document if content editable + // is enabled since other instances might still be present + if (!t.settings.content_editable) { + Event.clear(t.getWin()); + Event.clear(t.getDoc()); + } + + Event.clear(t.getBody()); + Event.clear(t.formElement); + } + + if (t.formElement) { + t.formElement.submit = t.formElement._mceOldSubmit; + t.formElement._mceOldSubmit = null; + } + + t.contentAreaContainer = t.formElement = t.container = t.settings.content_element = t.bodyElement = t.contentDocument = t.contentWindow = null; + + if (t.selection) + t.selection = t.selection.win = t.selection.dom = t.selection.dom.doc = null; + + t.destroyed = 1; + }, + + // Internal functions + + _addEvents : function() { + // 'focus', 'blur', 'dblclick', 'beforedeactivate', submit, reset + var t = this, i, s = t.settings, lo = { + mouseup : 'onMouseUp', + mousedown : 'onMouseDown', + click : 'onClick', + keyup : 'onKeyUp', + keydown : 'onKeyDown', + keypress : 'onKeyPress', + submit : 'onSubmit', + reset : 'onReset', + contextmenu : 'onContextMenu', + dblclick : 'onDblClick', + paste : 'onPaste' // Doesn't work in all browsers yet + }; + + function eventHandler(e, o) { + var ty = e.type; + + // Don't fire events when it's removed + if (t.removed) + return; + + // Generic event handler + if (t.onEvent.dispatch(t, e, o) !== false) { + // Specific event handler + t[lo[e.fakeType || e.type]].dispatch(t, e, o); + } + }; + + // Add DOM events + each(lo, function(v, k) { + switch (k) { + case 'contextmenu': + if (tinymce.isOpera) { + // Fake contextmenu on Opera + t.dom.bind(t.getBody(), 'mousedown', function(e) { + if (e.ctrlKey) { + e.fakeType = 'contextmenu'; + eventHandler(e); + } + }); + } else + t.dom.bind(t.getBody(), k, eventHandler); + break; + + case 'paste': + t.dom.bind(t.getBody(), k, function(e) { + eventHandler(e); + }); + break; + + case 'submit': + case 'reset': + t.dom.bind(t.getElement().form || DOM.getParent(t.id, 'form'), k, eventHandler); + break; + + default: + t.dom.bind(s.content_editable ? t.getBody() : t.getDoc(), k, eventHandler); + } + }); + + t.dom.bind(s.content_editable ? t.getBody() : (isGecko ? t.getDoc() : t.getWin()), 'focus', function(e) { + t.focus(true); + }); + + + // Fixes bug where a specified document_base_uri could result in broken images + // This will also fix drag drop of images in Gecko + if (tinymce.isGecko) { + // Convert all images to absolute URLs +/* t.onSetContent.add(function(ed, o) { + each(ed.dom.select('img'), function(e) { + var v; + + if (v = e.getAttribute('_mce_src')) + e.src = t.documentBaseURI.toAbsolute(v); + }) + });*/ + + t.dom.bind(t.getDoc(), 'DOMNodeInserted', function(e) { + var v; + + e = e.target; + + if (e.nodeType === 1 && e.nodeName === 'IMG' && (v = e.getAttribute('_mce_src'))) + e.src = t.documentBaseURI.toAbsolute(v); + }); + } + + // Set various midas options in Gecko + if (isGecko) { + function setOpts() { + var t = this, d = t.getDoc(), s = t.settings; + + if (isGecko && !s.readonly) { + if (t._isHidden()) { + try { + if (!s.content_editable) + d.designMode = 'On'; + } catch (ex) { + // Fails if it's hidden + } + } + + try { + // Try new Gecko method + d.execCommand("styleWithCSS", 0, false); + } catch (ex) { + // Use old method + if (!t._isHidden()) + try {d.execCommand("useCSS", 0, true);} catch (ex) {} + } + + if (!s.table_inline_editing) + try {d.execCommand('enableInlineTableEditing', false, false);} catch (ex) {} + + if (!s.object_resizing) + try {d.execCommand('enableObjectResizing', false, false);} catch (ex) {} + } + }; + + t.onBeforeExecCommand.add(setOpts); + t.onMouseDown.add(setOpts); + } + + // Workaround for bug, http://bugs.webkit.org/show_bug.cgi?id=12250 + // WebKit can't even do simple things like selecting an image + // This also fixes so it's possible to select mceItemAnchors + if (tinymce.isWebKit) { + t.onClick.add(function(ed, e) { + e = e.target; + + // Needs tobe the setBaseAndExtend or it will fail to select floated images + if (e.nodeName == 'IMG' || (e.nodeName == 'A' && t.dom.hasClass(e, 'mceItemAnchor'))) + t.selection.getSel().setBaseAndExtent(e, 0, e, 1); + }); + } + + // Add node change handlers + t.onMouseUp.add(t.nodeChanged); + //t.onClick.add(t.nodeChanged); + t.onKeyUp.add(function(ed, e) { + var c = e.keyCode; + + if ((c >= 33 && c <= 36) || (c >= 37 && c <= 40) || c == 13 || c == 45 || c == 46 || c == 8 || (tinymce.isMac && (c == 91 || c == 93)) || e.ctrlKey) + t.nodeChanged(); + }); + + // Add reset handler + t.onReset.add(function() { + t.setContent(t.startContent, {format : 'raw'}); + }); + + // Add shortcuts + if (s.custom_shortcuts) { + if (s.custom_undo_redo_keyboard_shortcuts) { + t.addShortcut('ctrl+z', t.getLang('undo_desc'), 'Undo'); + t.addShortcut('ctrl+y', t.getLang('redo_desc'), 'Redo'); + } + + // Add default shortcuts for gecko + t.addShortcut('ctrl+b', t.getLang('bold_desc'), 'Bold'); + t.addShortcut('ctrl+i', t.getLang('italic_desc'), 'Italic'); + t.addShortcut('ctrl+u', t.getLang('underline_desc'), 'Underline'); + + // BlockFormat shortcuts keys + for (i=1; i<=6; i++) + t.addShortcut('ctrl+' + i, '', ['FormatBlock', false, 'h' + i]); + + t.addShortcut('ctrl+7', '', ['FormatBlock', false, '

']); + t.addShortcut('ctrl+8', '', ['FormatBlock', false, '

']); + t.addShortcut('ctrl+9', '', ['FormatBlock', false, '
']); + + function find(e) { + var v = null; + + if (!e.altKey && !e.ctrlKey && !e.metaKey) + return v; + + each(t.shortcuts, function(o) { + if (tinymce.isMac && o.ctrl != e.metaKey) + return; + else if (!tinymce.isMac && o.ctrl != e.ctrlKey) + return; + + if (o.alt != e.altKey) + return; + + if (o.shift != e.shiftKey) + return; + + if (e.keyCode == o.keyCode || (e.charCode && e.charCode == o.charCode)) { + v = o; + return false; + } + }); + + return v; + }; + + t.onKeyUp.add(function(ed, e) { + var o = find(e); + + if (o) + return Event.cancel(e); + }); + + t.onKeyPress.add(function(ed, e) { + var o = find(e); + + if (o) + return Event.cancel(e); + }); + + t.onKeyDown.add(function(ed, e) { + var o = find(e); + + if (o) { + o.func.call(o.scope); + return Event.cancel(e); + } + }); + } + + if (tinymce.isIE) { + // Fix so resize will only update the width and height attributes not the styles of an image + // It will also block mceItemNoResize items + t.dom.bind(t.getDoc(), 'controlselect', function(e) { + var re = t.resizeInfo, cb; + + e = e.target; + + // Don't do this action for non image elements + if (e.nodeName !== 'IMG') + return; + + if (re) + t.dom.unbind(re.node, re.ev, re.cb); + + if (!t.dom.hasClass(e, 'mceItemNoResize')) { + ev = 'resizeend'; + cb = t.dom.bind(e, ev, function(e) { + var v; + + e = e.target; + + if (v = t.dom.getStyle(e, 'width')) { + t.dom.setAttrib(e, 'width', v.replace(/[^0-9%]+/g, '')); + t.dom.setStyle(e, 'width', ''); + } + + if (v = t.dom.getStyle(e, 'height')) { + t.dom.setAttrib(e, 'height', v.replace(/[^0-9%]+/g, '')); + t.dom.setStyle(e, 'height', ''); + } + }); + } else { + ev = 'resizestart'; + cb = t.dom.bind(e, 'resizestart', Event.cancel, Event); + } + + re = t.resizeInfo = { + node : e, + ev : ev, + cb : cb + }; + }); + + t.onKeyDown.add(function(ed, e) { + switch (e.keyCode) { + case 8: + // Fix IE control + backspace browser bug + if (t.selection.getRng().item) { + ed.dom.remove(t.selection.getRng().item(0)); + return Event.cancel(e); + } + } + }); + + /*if (t.dom.boxModel) { + t.getBody().style.height = '100%'; + + Event.add(t.getWin(), 'resize', function(e) { + var docElm = t.getDoc().documentElement; + + docElm.style.height = (docElm.offsetHeight - 10) + 'px'; + }); + }*/ + } + + if (tinymce.isOpera) { + t.onClick.add(function(ed, e) { + Event.prevent(e); + }); + } + + // Add custom undo/redo handlers + if (s.custom_undo_redo) { + function addUndo() { + t.undoManager.typing = 0; + t.undoManager.add(); + }; + + t.dom.bind(t.getDoc(), 'focusout', function(e) { + if (!t.removed && t.undoManager.typing) + addUndo(); + }); + + t.onKeyUp.add(function(ed, e) { + if ((e.keyCode >= 33 && e.keyCode <= 36) || (e.keyCode >= 37 && e.keyCode <= 40) || e.keyCode == 13 || e.keyCode == 45 || e.ctrlKey) + addUndo(); + }); + + t.onKeyDown.add(function(ed, e) { + var rng, parent, bookmark; + + // IE has a really odd bug where the DOM might include an node that doesn't have + // a proper structure. If you try to access nodeValue it would throw an illegal value exception. + // This seems to only happen when you delete contents and it seems to be avoidable if you refresh the element + // after you delete contents from it. See: #3008923 + if (isIE && e.keyCode == 46) { + rng = t.selection.getRng(); + + if (rng.parentElement) { + parent = rng.parentElement(); + + // Select next word when ctrl key is used in combo with delete + if (e.ctrlKey) { + rng.moveEnd('word', 1); + rng.select(); + } + + // Delete contents + t.selection.getSel().clear(); + + // Check if we are within the same parent + if (rng.parentElement() == parent) { + bookmark = t.selection.getBookmark(); + + try { + // Update the HTML and hopefully it will remove the artifacts + parent.innerHTML = parent.innerHTML; + } catch (ex) { + // And since it's IE it can sometimes produce an unknown runtime error + } + + // Restore the caret position + t.selection.moveToBookmark(bookmark); + } + + // Block the default delete behavior since it might be broken + e.preventDefault(); + return; + } + } + + // Is caracter positon keys + if ((e.keyCode >= 33 && e.keyCode <= 36) || (e.keyCode >= 37 && e.keyCode <= 40) || e.keyCode == 13 || e.keyCode == 45) { + if (t.undoManager.typing) + addUndo(); + + return; + } + + if (!t.undoManager.typing) { + t.undoManager.add(); + t.undoManager.typing = 1; + } + }); + + t.onMouseDown.add(function() { + if (t.undoManager.typing) + addUndo(); + }); + } + }, + + _isHidden : function() { + var s; + + if (!isGecko) + return 0; + + // Weird, wheres that cursor selection? + s = this.selection.getSel(); + return (!s || !s.rangeCount || s.rangeCount == 0); + }, + + // Fix for bug #1867292 + _fixNesting : function(s) { + var d = [], i; + + s = s.replace(/<(\/)?([^\s>]+)[^>]*?>/g, function(a, b, c) { + var e; + + // Handle end element + if (b === '/') { + if (!d.length) + return ''; + + if (c !== d[d.length - 1].tag) { + for (i=d.length - 1; i>=0; i--) { + if (d[i].tag === c) { + d[i].close = 1; + break; + } + } + + return ''; + } else { + d.pop(); + + if (d.length && d[d.length - 1].close) { + a = a + ''; + d.pop(); + } + } + } else { + // Ignore these + if (/^(br|hr|input|meta|img|link|param)$/i.test(c)) + return a; + + // Ignore closed ones + if (/\/>$/.test(a)) + return a; + + d.push({tag : c}); // Push start element + } + + return a; + }); + + // End all open tags + for (i=d.length - 1; i>=0; i--) + s += ''; + + return s; + } + }); +})(tinymce); + +(function(tinymce) { + // Added for compression purposes + var each = tinymce.each, undefined, TRUE = true, FALSE = false; + + tinymce.EditorCommands = function(editor) { + var dom = editor.dom, + selection = editor.selection, + commands = {state: {}, exec : {}, value : {}}, + settings = editor.settings, + bookmark; + + function execCommand(command, ui, value) { + var func; + + command = command.toLowerCase(); + if (func = commands.exec[command]) { + func(command, ui, value); + return TRUE; + } + + return FALSE; + }; + + function queryCommandState(command) { + var func; + + command = command.toLowerCase(); + if (func = commands.state[command]) + return func(command); + + return -1; + }; + + function queryCommandValue(command) { + var func; + + command = command.toLowerCase(); + if (func = commands.value[command]) + return func(command); + + return FALSE; + }; + + function addCommands(command_list, type) { + type = type || 'exec'; + + each(command_list, function(callback, command) { + each(command.toLowerCase().split(','), function(command) { + commands[type][command] = callback; + }); + }); + }; + + // Expose public methods + tinymce.extend(this, { + execCommand : execCommand, + queryCommandState : queryCommandState, + queryCommandValue : queryCommandValue, + addCommands : addCommands + }); + + // Private methods + + function execNativeCommand(command, ui, value) { + if (ui === undefined) + ui = FALSE; + + if (value === undefined) + value = null; + + return editor.getDoc().execCommand(command, ui, value); + }; + + function isFormatMatch(name) { + return editor.formatter.match(name); + }; + + function toggleFormat(name, value) { + editor.formatter.toggle(name, value ? {value : value} : undefined); + }; + + function storeSelection(type) { + bookmark = selection.getBookmark(type); + }; + + function restoreSelection() { + selection.moveToBookmark(bookmark); + }; + + // Add execCommand overrides + addCommands({ + // Ignore these, added for compatibility + 'mceResetDesignMode,mceBeginUndoLevel' : function() {}, + + // Add undo manager logic + 'mceEndUndoLevel,mceAddUndoLevel' : function() { + editor.undoManager.add(); + }, + + 'Cut,Copy,Paste' : function(command) { + var doc = editor.getDoc(), failed; + + // Try executing the native command + try { + execNativeCommand(command); + } catch (ex) { + // Command failed + failed = TRUE; + } + + // Present alert message about clipboard access not being available + if (failed || !doc.queryCommandSupported(command)) { + if (tinymce.isGecko) { + editor.windowManager.confirm(editor.getLang('clipboard_msg'), function(state) { + if (state) + open('http://www.mozilla.org/editor/midasdemo/securityprefs.html', '_blank'); + }); + } else + editor.windowManager.alert(editor.getLang('clipboard_no_support')); + } + }, + + // Override unlink command + unlink : function(command) { + if (selection.isCollapsed()) + selection.select(selection.getNode()); + + execNativeCommand(command); + selection.collapse(FALSE); + }, + + // Override justify commands to use the text formatter engine + 'JustifyLeft,JustifyCenter,JustifyRight,JustifyFull' : function(command) { + var align = command.substring(7); + + // Remove all other alignments first + each('left,center,right,full'.split(','), function(name) { + if (align != name) + editor.formatter.remove('align' + name); + }); + + toggleFormat('align' + align); + }, + + // Override list commands to fix WebKit bug + 'InsertUnorderedList,InsertOrderedList' : function(command) { + var listElm, listParent; + + execNativeCommand(command); + + // WebKit produces lists within block elements so we need to split them + // we will replace the native list creation logic to custom logic later on + // TODO: Remove this when the list creation logic is removed + listElm = dom.getParent(selection.getNode(), 'ol,ul'); + if (listElm) { + listParent = listElm.parentNode; + + // If list is within a text block then split that block + if (/^(H[1-6]|P|ADDRESS|PRE)$/.test(listParent.nodeName)) { + storeSelection(); + dom.split(listParent, listElm); + restoreSelection(); + } + } + }, + + // Override commands to use the text formatter engine + 'Bold,Italic,Underline,Strikethrough' : function(command) { + toggleFormat(command); + }, + + // Override commands to use the text formatter engine + 'ForeColor,HiliteColor,FontName' : function(command, ui, value) { + toggleFormat(command, value); + }, + + FontSize : function(command, ui, value) { + var fontClasses, fontSizes; + + // Convert font size 1-7 to styles + if (value >= 1 && value <= 7) { + fontSizes = tinymce.explode(settings.font_size_style_values); + fontClasses = tinymce.explode(settings.font_size_classes); + + if (fontClasses) + value = fontClasses[value - 1] || value; + else + value = fontSizes[value - 1] || value; + } + + toggleFormat(command, value); + }, + + RemoveFormat : function(command) { + editor.formatter.remove(command); + }, + + mceBlockQuote : function(command) { + toggleFormat('blockquote'); + }, + + FormatBlock : function(command, ui, value) { + return toggleFormat(value || 'p'); + }, + + mceCleanup : function() { + var bookmark = selection.getBookmark(); + + editor.setContent(editor.getContent({cleanup : TRUE}), {cleanup : TRUE}); + + selection.moveToBookmark(bookmark); + }, + + mceRemoveNode : function(command, ui, value) { + var node = value || selection.getNode(); + + // Make sure that the body node isn't removed + if (node != editor.getBody()) { + storeSelection(); + editor.dom.remove(node, TRUE); + restoreSelection(); + } + }, + + mceSelectNodeDepth : function(command, ui, value) { + var counter = 0; + + dom.getParent(selection.getNode(), function(node) { + if (node.nodeType == 1 && counter++ == value) { + selection.select(node); + return FALSE; + } + }, editor.getBody()); + }, + + mceSelectNode : function(command, ui, value) { + selection.select(value); + }, + + mceInsertContent : function(command, ui, value) { + selection.setContent(value); + }, + + mceInsertRawHTML : function(command, ui, value) { + selection.setContent('tiny_mce_marker'); + editor.setContent(editor.getContent().replace(/tiny_mce_marker/g, value)); + }, + + mceSetContent : function(command, ui, value) { + editor.setContent(value); + }, + + 'Indent,Outdent' : function(command) { + var intentValue, indentUnit, value; + + // Setup indent level + intentValue = settings.indentation; + indentUnit = /[a-z%]+$/i.exec(intentValue); + intentValue = parseInt(intentValue); + + if (!queryCommandState('InsertUnorderedList') && !queryCommandState('InsertOrderedList')) { + each(selection.getSelectedBlocks(), function(element) { + if (command == 'outdent') { + value = Math.max(0, parseInt(element.style.paddingLeft || 0) - intentValue); + dom.setStyle(element, 'paddingLeft', value ? value + indentUnit : ''); + } else + dom.setStyle(element, 'paddingLeft', (parseInt(element.style.paddingLeft || 0) + intentValue) + indentUnit); + }); + } else + execNativeCommand(command); + }, + + mceRepaint : function() { + var bookmark; + + if (tinymce.isGecko) { + try { + storeSelection(TRUE); + + if (selection.getSel()) + selection.getSel().selectAllChildren(editor.getBody()); + + selection.collapse(TRUE); + restoreSelection(); + } catch (ex) { + // Ignore + } + } + }, + + mceToggleFormat : function(command, ui, value) { + editor.formatter.toggle(value); + }, + + InsertHorizontalRule : function() { + selection.setContent('
'); + }, + + mceToggleVisualAid : function() { + editor.hasVisual = !editor.hasVisual; + editor.addVisual(); + }, + + mceReplaceContent : function(command, ui, value) { + selection.setContent(value.replace(/\{\$selection\}/g, selection.getContent({format : 'text'}))); + }, + + mceInsertLink : function(command, ui, value) { + var link = dom.getParent(selection.getNode(), 'a'); + + if (tinymce.is(value, 'string')) + value = {href : value}; + + if (!link) { + execNativeCommand('CreateLink', FALSE, 'javascript:mctmp(0);'); + each(dom.select('a[href=javascript:mctmp(0);]'), function(link) { + dom.setAttribs(link, value); + }); + } else { + if (value.href) + dom.setAttribs(link, value); + else + editor.dom.remove(link, TRUE); + } + }, + + selectAll : function() { + var root = dom.getRoot(), rng = dom.createRng(); + + rng.setStart(root, 0); + rng.setEnd(root, root.childNodes.length); + + editor.selection.setRng(rng); + } + }); + + // Add queryCommandState overrides + addCommands({ + // Override justify commands + 'JustifyLeft,JustifyCenter,JustifyRight,JustifyFull' : function(command) { + return isFormatMatch('align' + command.substring(7)); + }, + + 'Bold,Italic,Underline,Strikethrough' : function(command) { + return isFormatMatch(command); + }, + + mceBlockQuote : function() { + return isFormatMatch('blockquote'); + }, + + Outdent : function() { + var node; + + if (settings.inline_styles) { + if ((node = dom.getParent(selection.getStart(), dom.isBlock)) && parseInt(node.style.paddingLeft) > 0) + return TRUE; + + if ((node = dom.getParent(selection.getEnd(), dom.isBlock)) && parseInt(node.style.paddingLeft) > 0) + return TRUE; + } + + return queryCommandState('InsertUnorderedList') || queryCommandState('InsertOrderedList') || (!settings.inline_styles && !!dom.getParent(selection.getNode(), 'BLOCKQUOTE')); + }, + + 'InsertUnorderedList,InsertOrderedList' : function(command) { + return dom.getParent(selection.getNode(), command == 'insertunorderedlist' ? 'UL' : 'OL'); + } + }, 'state'); + + // Add queryCommandValue overrides + addCommands({ + 'FontSize,FontName' : function(command) { + var value = 0, parent; + + if (parent = dom.getParent(selection.getNode(), 'span')) { + if (command == 'fontsize') + value = parent.style.fontSize; + else + value = parent.style.fontFamily.replace(/, /g, ',').replace(/[\'\"]/g, '').toLowerCase(); + } + + return value; + } + }, 'value'); + + // Add undo manager logic + if (settings.custom_undo_redo) { + addCommands({ + Undo : function() { + editor.undoManager.undo(); + }, + + Redo : function() { + editor.undoManager.redo(); + } + }); + } + }; +})(tinymce); +(function(tinymce) { + var Dispatcher = tinymce.util.Dispatcher; + + tinymce.UndoManager = function(editor) { + var self, index = 0, data = []; + + function getContent() { + return tinymce.trim(editor.getContent({format : 'raw', no_events : 1})); + }; + + return self = { + typing : 0, + + onAdd : new Dispatcher(self), + onUndo : new Dispatcher(self), + onRedo : new Dispatcher(self), + + add : function(level) { + var i, settings = editor.settings, lastLevel; + + level = level || {}; + level.content = getContent(); + + // Add undo level if needed + lastLevel = data[index]; + if (lastLevel && lastLevel.content == level.content) { + if (index > 0 || data.length == 1) + return null; + } + + // Time to compress + if (settings.custom_undo_redo_levels) { + if (data.length > settings.custom_undo_redo_levels) { + for (i = 0; i < data.length - 1; i++) + data[i] = data[i + 1]; + + data.length--; + index = data.length; + } + } + + // Get a non intrusive normalized bookmark + level.bookmark = editor.selection.getBookmark(2, true); + + // Crop array if needed + if (index < data.length - 1) { + // Treat first level as initial + if (index == 0) + data = []; + else + data.length = index + 1; + } + + data.push(level); + index = data.length - 1; + + self.onAdd.dispatch(self, level); + editor.isNotDirty = 0; + + return level; + }, + + undo : function() { + var level, i; + + if (self.typing) { + self.add(); + self.typing = 0; + } + + if (index > 0) { + level = data[--index]; + + editor.setContent(level.content, {format : 'raw'}); + editor.selection.moveToBookmark(level.bookmark); + + self.onUndo.dispatch(self, level); + } + + return level; + }, + + redo : function() { + var level; + + if (index < data.length - 1) { + level = data[++index]; + + editor.setContent(level.content, {format : 'raw'}); + editor.selection.moveToBookmark(level.bookmark); + + self.onRedo.dispatch(self, level); + } + + return level; + }, + + clear : function() { + data = []; + index = self.typing = 0; + }, + + hasUndo : function() { + return index > 0 || self.typing; + }, + + hasRedo : function() { + return index < data.length - 1; + } + }; + }; +})(tinymce); + +(function(tinymce) { + // Shorten names + var Event = tinymce.dom.Event, + isIE = tinymce.isIE, + isGecko = tinymce.isGecko, + isOpera = tinymce.isOpera, + each = tinymce.each, + extend = tinymce.extend, + TRUE = true, + FALSE = false; + + function cloneFormats(node) { + var clone, temp, inner; + + do { + if (/^(SPAN|STRONG|B|EM|I|FONT|STRIKE|U)$/.test(node.nodeName)) { + if (clone) { + temp = node.cloneNode(false); + temp.appendChild(clone); + clone = temp; + } else { + clone = inner = node.cloneNode(false); + } + + clone.removeAttribute('id'); + } + } while (node = node.parentNode); + + if (clone) + return {wrapper : clone, inner : inner}; + }; + + // Checks if the selection/caret is at the end of the specified block element + function isAtEnd(rng, par) { + var rng2 = par.ownerDocument.createRange(); + + rng2.setStart(rng.endContainer, rng.endOffset); + rng2.setEndAfter(par); + + // Get number of characters to the right of the cursor if it's zero then we are at the end and need to merge the next block element + return rng2.cloneContents().textContent.length == 0; + }; + + function isEmpty(n) { + n = n.innerHTML; + + n = n.replace(/<(img|hr|table|input|select|textarea)[ \>]/gi, '-'); // Keep these convert them to - chars + n = n.replace(/<[^>]+>/g, ''); // Remove all tags + + return n.replace(/[ \u00a0\t\r\n]+/g, '') == ''; + }; + + function splitList(selection, dom, li) { + var listBlock, block; + + if (isEmpty(li)) { + listBlock = dom.getParent(li, 'ul,ol'); + + if (!dom.getParent(listBlock.parentNode, 'ul,ol')) { + dom.split(listBlock, li); + block = dom.create('p', 0, '
'); + dom.replace(block, li); + selection.select(block, 1); + } + + return FALSE; + } + + return TRUE; + }; + + tinymce.create('tinymce.ForceBlocks', { + ForceBlocks : function(ed) { + var t = this, s = ed.settings, elm; + + t.editor = ed; + t.dom = ed.dom; + elm = (s.forced_root_block || 'p').toLowerCase(); + s.element = elm.toUpperCase(); + + ed.onPreInit.add(t.setup, t); + + t.reOpera = new RegExp('(\\u00a0| | )<\/' + elm + '>', 'gi'); + t.rePadd = new RegExp(']+)><\\\/p>|]+)\\\/>|]+)>\\s+<\\\/p>|

<\\\/p>||

\\s+<\\\/p>'.replace(/p/g, elm), 'gi'); + t.reNbsp2BR1 = new RegExp(']+)>[\\s\\u00a0]+<\\\/p>|

[\\s\\u00a0]+<\\\/p>'.replace(/p/g, elm), 'gi'); + t.reNbsp2BR2 = new RegExp('<%p()([^>]+)>( | )<\\\/%p>|<%p>( | )<\\\/%p>'.replace(/%p/g, elm), 'gi'); + t.reBR2Nbsp = new RegExp(']+)>\\s*
\\s*<\\\/p>|

\\s*
\\s*<\\\/p>'.replace(/p/g, elm), 'gi'); + + function padd(ed, o) { + if (isOpera) + o.content = o.content.replace(t.reOpera, ''); + + o.content = o.content.replace(t.rePadd, '<' + elm + '$1$2$3$4$5$6>\u00a0'); + + if (!isIE && !isOpera && o.set) { + // Use   instead of BR in padded paragraphs + o.content = o.content.replace(t.reNbsp2BR1, '<' + elm + '$1$2>
'); + o.content = o.content.replace(t.reNbsp2BR2, '<' + elm + '$1$2>
'); + } else + o.content = o.content.replace(t.reBR2Nbsp, '<' + elm + '$1$2>\u00a0'); + }; + + ed.onBeforeSetContent.add(padd); + ed.onPostProcess.add(padd); + + if (s.forced_root_block) { + ed.onInit.add(t.forceRoots, t); + ed.onSetContent.add(t.forceRoots, t); + ed.onBeforeGetContent.add(t.forceRoots, t); + } + }, + + setup : function() { + var t = this, ed = t.editor, s = ed.settings, dom = ed.dom, selection = ed.selection; + + // Force root blocks when typing and when getting output + if (s.forced_root_block) { + ed.onBeforeExecCommand.add(t.forceRoots, t); + ed.onKeyUp.add(t.forceRoots, t); + ed.onPreProcess.add(t.forceRoots, t); + } + + if (s.force_br_newlines) { + // Force IE to produce BRs on enter + if (isIE) { + ed.onKeyPress.add(function(ed, e) { + var n; + + if (e.keyCode == 13 && selection.getNode().nodeName != 'LI') { + selection.setContent('
', {format : 'raw'}); + n = dom.get('__'); + n.removeAttribute('id'); + selection.select(n); + selection.collapse(); + return Event.cancel(e); + } + }); + } + } + + if (s.force_p_newlines) { + if (!isIE) { + ed.onKeyPress.add(function(ed, e) { + if (e.keyCode == 13 && !e.shiftKey && !t.insertPara(e)) + Event.cancel(e); + }); + } else { + // Ungly hack to for IE to preserve the formatting when you press + // enter at the end of a block element with formatted contents + // This logic overrides the browsers default logic with + // custom logic that enables us to control the output + tinymce.addUnload(function() { + t._previousFormats = 0; // Fix IE leak + }); + + ed.onKeyPress.add(function(ed, e) { + t._previousFormats = 0; + + // Clone the current formats, this will later be applied to the new block contents + if (e.keyCode == 13 && !e.shiftKey && ed.selection.isCollapsed() && s.keep_styles) + t._previousFormats = cloneFormats(ed.selection.getStart()); + }); + + ed.onKeyUp.add(function(ed, e) { + // Let IE break the element and the wrap the new caret location in the previous formats + if (e.keyCode == 13 && !e.shiftKey) { + var parent = ed.selection.getStart(), fmt = t._previousFormats; + + // Parent is an empty block + if (!parent.hasChildNodes()) { + parent = dom.getParent(parent, dom.isBlock); + + if (parent) { + parent.innerHTML = ''; + + if (t._previousFormats) { + parent.appendChild(fmt.wrapper); + fmt.inner.innerHTML = '\uFEFF'; + } else + parent.innerHTML = '\uFEFF'; + + selection.select(parent, 1); + ed.getDoc().execCommand('Delete', false, null); + } + } + } + }); + } + + if (isGecko) { + ed.onKeyDown.add(function(ed, e) { + if ((e.keyCode == 8 || e.keyCode == 46) && !e.shiftKey) + t.backspaceDelete(e, e.keyCode == 8); + }); + } + } + + // Workaround for missing shift+enter support, http://bugs.webkit.org/show_bug.cgi?id=16973 + if (tinymce.isWebKit) { + function insertBr(ed) { + var rng = selection.getRng(), br, div = dom.create('div', null, ' '), divYPos, vpHeight = dom.getViewPort(ed.getWin()).h; + + // Insert BR element + rng.insertNode(br = dom.create('br')); + + // Place caret after BR + rng.setStartAfter(br); + rng.setEndAfter(br); + selection.setRng(rng); + + // Could not place caret after BR then insert an nbsp entity and move the caret + if (selection.getSel().focusNode == br.previousSibling) { + selection.select(dom.insertAfter(dom.doc.createTextNode('\u00a0'), br)); + selection.collapse(TRUE); + } + + // Create a temporary DIV after the BR and get the position as it + // seems like getPos() returns 0 for text nodes and BR elements. + dom.insertAfter(div, br); + divYPos = dom.getPos(div).y; + dom.remove(div); + + // Scroll to new position, scrollIntoView can't be used due to bug: http://bugs.webkit.org/show_bug.cgi?id=16117 + if (divYPos > vpHeight) // It is not necessary to scroll if the DIV is inside the view port. + ed.getWin().scrollTo(0, divYPos); + }; + + ed.onKeyPress.add(function(ed, e) { + if (e.keyCode == 13 && (e.shiftKey || (s.force_br_newlines && !dom.getParent(selection.getNode(), 'h1,h2,h3,h4,h5,h6,ol,ul')))) { + insertBr(ed); + Event.cancel(e); + } + }); + } + + // Padd empty inline elements within block elements + // For example:

becomes

 

+ ed.onPreProcess.add(function(ed, o) { + each(dom.select('p,h1,h2,h3,h4,h5,h6,div', o.node), function(p) { + if (isEmpty(p)) { + each(dom.select('span,em,strong,b,i', o.node), function(n) { + if (!n.hasChildNodes()) { + n.appendChild(ed.getDoc().createTextNode('\u00a0')); + return FALSE; // Break the loop one padding is enough + } + }); + } + }); + }); + + // IE specific fixes + if (isIE) { + // Replaces IE:s auto generated paragraphs with the specified element name + if (s.element != 'P') { + ed.onKeyPress.add(function(ed, e) { + t.lastElm = selection.getNode().nodeName; + }); + + ed.onKeyUp.add(function(ed, e) { + var bl, n = selection.getNode(), b = ed.getBody(); + + if (b.childNodes.length === 1 && n.nodeName == 'P') { + n = dom.rename(n, s.element); + selection.select(n); + selection.collapse(); + ed.nodeChanged(); + } else if (e.keyCode == 13 && !e.shiftKey && t.lastElm != 'P') { + bl = dom.getParent(n, 'p'); + + if (bl) { + dom.rename(bl, s.element); + ed.nodeChanged(); + } + } + }); + } + } + }, + + find : function(n, t, s) { + var ed = this.editor, w = ed.getDoc().createTreeWalker(n, 4, null, FALSE), c = -1; + + while (n = w.nextNode()) { + c++; + + // Index by node + if (t == 0 && n == s) + return c; + + // Node by index + if (t == 1 && c == s) + return n; + } + + return -1; + }, + + forceRoots : function(ed, e) { + var t = this, ed = t.editor, b = ed.getBody(), d = ed.getDoc(), se = ed.selection, s = se.getSel(), r = se.getRng(), si = -2, ei, so, eo, tr, c = -0xFFFFFF; + var nx, bl, bp, sp, le, nl = b.childNodes, i, n, eid; + + // Fix for bug #1863847 + //if (e && e.keyCode == 13) + // return TRUE; + + // Wrap non blocks into blocks + for (i = nl.length - 1; i >= 0; i--) { + nx = nl[i]; + + // Ignore internal elements + if (nx.nodeType === 1 && nx.getAttribute('_mce_type')) { + bl = null; + continue; + } + + // Is text or non block element + if (nx.nodeType === 3 || (!t.dom.isBlock(nx) && nx.nodeType !== 8 && !/^(script|mce:script|style|mce:style)$/i.test(nx.nodeName))) { + if (!bl) { + // Create new block but ignore whitespace + if (nx.nodeType != 3 || /[^\s]/g.test(nx.nodeValue)) { + // Store selection + if (si == -2 && r) { + if (!isIE) { + // If selection is element then mark it + if (r.startContainer.nodeType == 1 && (n = r.startContainer.childNodes[r.startOffset]) && n.nodeType == 1) { + // Save the id of the selected element + eid = n.getAttribute("id"); + n.setAttribute("id", "__mce"); + } else { + // If element is inside body, might not be the case in contentEdiable mode + if (ed.dom.getParent(r.startContainer, function(e) {return e === b;})) { + so = r.startOffset; + eo = r.endOffset; + si = t.find(b, 0, r.startContainer); + ei = t.find(b, 0, r.endContainer); + } + } + } else { + // Force control range into text range + if (r.item) { + tr = d.body.createTextRange(); + tr.moveToElementText(r.item(0)); + r = tr; + } + + tr = d.body.createTextRange(); + tr.moveToElementText(b); + tr.collapse(1); + bp = tr.move('character', c) * -1; + + tr = r.duplicate(); + tr.collapse(1); + sp = tr.move('character', c) * -1; + + tr = r.duplicate(); + tr.collapse(0); + le = (tr.move('character', c) * -1) - sp; + + si = sp - bp; + ei = le; + } + } + + // Uses replaceChild instead of cloneNode since it removes selected attribute from option elements on IE + // See: http://support.microsoft.com/kb/829907 + bl = ed.dom.create(ed.settings.forced_root_block); + nx.parentNode.replaceChild(bl, nx); + bl.appendChild(nx); + } + } else { + if (bl.hasChildNodes()) + bl.insertBefore(nx, bl.firstChild); + else + bl.appendChild(nx); + } + } else + bl = null; // Time to create new block + } + + // Restore selection + if (si != -2) { + if (!isIE) { + bl = b.getElementsByTagName(ed.settings.element)[0]; + r = d.createRange(); + + // Select last location or generated block + if (si != -1) + r.setStart(t.find(b, 1, si), so); + else + r.setStart(bl, 0); + + // Select last location or generated block + if (ei != -1) + r.setEnd(t.find(b, 1, ei), eo); + else + r.setEnd(bl, 0); + + if (s) { + s.removeAllRanges(); + s.addRange(r); + } + } else { + try { + r = s.createRange(); + r.moveToElementText(b); + r.collapse(1); + r.moveStart('character', si); + r.moveEnd('character', ei); + r.select(); + } catch (ex) { + // Ignore + } + } + } else if (!isIE && (n = ed.dom.get('__mce'))) { + // Restore the id of the selected element + if (eid) + n.setAttribute('id', eid); + else + n.removeAttribute('id'); + + // Move caret before selected element + r = d.createRange(); + r.setStartBefore(n); + r.setEndBefore(n); + se.setRng(r); + } + }, + + getParentBlock : function(n) { + var d = this.dom; + + return d.getParent(n, d.isBlock); + }, + + insertPara : function(e) { + var t = this, ed = t.editor, dom = ed.dom, d = ed.getDoc(), se = ed.settings, s = ed.selection.getSel(), r = s.getRangeAt(0), b = d.body; + var rb, ra, dir, sn, so, en, eo, sb, eb, bn, bef, aft, sc, ec, n, vp = dom.getViewPort(ed.getWin()), y, ch, car; + + // If root blocks are forced then use Operas default behavior since it's really good +// Removed due to bug: #1853816 +// if (se.forced_root_block && isOpera) +// return TRUE; + + // Setup before range + rb = d.createRange(); + + // If is before the first block element and in body, then move it into first block element + rb.setStart(s.anchorNode, s.anchorOffset); + rb.collapse(TRUE); + + // Setup after range + ra = d.createRange(); + + // If is before the first block element and in body, then move it into first block element + ra.setStart(s.focusNode, s.focusOffset); + ra.collapse(TRUE); + + // Setup start/end points + dir = rb.compareBoundaryPoints(rb.START_TO_END, ra) < 0; + sn = dir ? s.anchorNode : s.focusNode; + so = dir ? s.anchorOffset : s.focusOffset; + en = dir ? s.focusNode : s.anchorNode; + eo = dir ? s.focusOffset : s.anchorOffset; + + // If selection is in empty table cell + if (sn === en && /^(TD|TH)$/.test(sn.nodeName)) { + if (sn.firstChild.nodeName == 'BR') + dom.remove(sn.firstChild); // Remove BR + + // Create two new block elements + if (sn.childNodes.length == 0) { + ed.dom.add(sn, se.element, null, '
'); + aft = ed.dom.add(sn, se.element, null, '
'); + } else { + n = sn.innerHTML; + sn.innerHTML = ''; + ed.dom.add(sn, se.element, null, n); + aft = ed.dom.add(sn, se.element, null, '
'); + } + + // Move caret into the last one + r = d.createRange(); + r.selectNodeContents(aft); + r.collapse(1); + ed.selection.setRng(r); + + return FALSE; + } + + // If the caret is in an invalid location in FF we need to move it into the first block + if (sn == b && en == b && b.firstChild && ed.dom.isBlock(b.firstChild)) { + sn = en = sn.firstChild; + so = eo = 0; + rb = d.createRange(); + rb.setStart(sn, 0); + ra = d.createRange(); + ra.setStart(en, 0); + } + + // Never use body as start or end node + sn = sn.nodeName == "HTML" ? d.body : sn; // Fix for Opera bug: https://bugs.opera.com/show_bug.cgi?id=273224&comments=yes + sn = sn.nodeName == "BODY" ? sn.firstChild : sn; + en = en.nodeName == "HTML" ? d.body : en; // Fix for Opera bug: https://bugs.opera.com/show_bug.cgi?id=273224&comments=yes + en = en.nodeName == "BODY" ? en.firstChild : en; + + // Get start and end blocks + sb = t.getParentBlock(sn); + eb = t.getParentBlock(en); + bn = sb ? sb.nodeName : se.element; // Get block name to create + + // Return inside list use default browser behavior + if (n = t.dom.getParent(sb, 'li,pre')) { + if (n.nodeName == 'LI') + return splitList(ed.selection, t.dom, n); + + return TRUE; + } + + // If caption or absolute layers then always generate new blocks within + if (sb && (sb.nodeName == 'CAPTION' || /absolute|relative|fixed/gi.test(dom.getStyle(sb, 'position', 1)))) { + bn = se.element; + sb = null; + } + + // If caption or absolute layers then always generate new blocks within + if (eb && (eb.nodeName == 'CAPTION' || /absolute|relative|fixed/gi.test(dom.getStyle(sb, 'position', 1)))) { + bn = se.element; + eb = null; + } + + // Use P instead + if (/(TD|TABLE|TH|CAPTION)/.test(bn) || (sb && bn == "DIV" && /left|right/gi.test(dom.getStyle(sb, 'float', 1)))) { + bn = se.element; + sb = eb = null; + } + + // Setup new before and after blocks + bef = (sb && sb.nodeName == bn) ? sb.cloneNode(0) : ed.dom.create(bn); + aft = (eb && eb.nodeName == bn) ? eb.cloneNode(0) : ed.dom.create(bn); + + // Remove id from after clone + aft.removeAttribute('id'); + + // Is header and cursor is at the end, then force paragraph under + if (/^(H[1-6])$/.test(bn) && isAtEnd(r, sb)) + aft = ed.dom.create(se.element); + + // Find start chop node + n = sc = sn; + do { + if (n == b || n.nodeType == 9 || t.dom.isBlock(n) || /(TD|TABLE|TH|CAPTION)/.test(n.nodeName)) + break; + + sc = n; + } while ((n = n.previousSibling ? n.previousSibling : n.parentNode)); + + // Find end chop node + n = ec = en; + do { + if (n == b || n.nodeType == 9 || t.dom.isBlock(n) || /(TD|TABLE|TH|CAPTION)/.test(n.nodeName)) + break; + + ec = n; + } while ((n = n.nextSibling ? n.nextSibling : n.parentNode)); + + // Place first chop part into before block element + if (sc.nodeName == bn) + rb.setStart(sc, 0); + else + rb.setStartBefore(sc); + + rb.setEnd(sn, so); + bef.appendChild(rb.cloneContents() || d.createTextNode('')); // Empty text node needed for Safari + + // Place secnd chop part within new block element + try { + ra.setEndAfter(ec); + } catch(ex) { + //console.debug(s.focusNode, s.focusOffset); + } + + ra.setStart(en, eo); + aft.appendChild(ra.cloneContents() || d.createTextNode('')); // Empty text node needed for Safari + + // Create range around everything + r = d.createRange(); + if (!sc.previousSibling && sc.parentNode.nodeName == bn) { + r.setStartBefore(sc.parentNode); + } else { + if (rb.startContainer.nodeName == bn && rb.startOffset == 0) + r.setStartBefore(rb.startContainer); + else + r.setStart(rb.startContainer, rb.startOffset); + } + + if (!ec.nextSibling && ec.parentNode.nodeName == bn) + r.setEndAfter(ec.parentNode); + else + r.setEnd(ra.endContainer, ra.endOffset); + + // Delete and replace it with new block elements + r.deleteContents(); + + if (isOpera) + ed.getWin().scrollTo(0, vp.y); + + // Never wrap blocks in blocks + if (bef.firstChild && bef.firstChild.nodeName == bn) + bef.innerHTML = bef.firstChild.innerHTML; + + if (aft.firstChild && aft.firstChild.nodeName == bn) + aft.innerHTML = aft.firstChild.innerHTML; + + // Padd empty blocks + if (isEmpty(bef)) + bef.innerHTML = '
'; + + function appendStyles(e, en) { + var nl = [], nn, n, i; + + e.innerHTML = ''; + + // Make clones of style elements + if (se.keep_styles) { + n = en; + do { + // We only want style specific elements + if (/^(SPAN|STRONG|B|EM|I|FONT|STRIKE|U)$/.test(n.nodeName)) { + nn = n.cloneNode(FALSE); + dom.setAttrib(nn, 'id', ''); // Remove ID since it needs to be unique + nl.push(nn); + } + } while (n = n.parentNode); + } + + // Append style elements to aft + if (nl.length > 0) { + for (i = nl.length - 1, nn = e; i >= 0; i--) + nn = nn.appendChild(nl[i]); + + // Padd most inner style element + nl[0].innerHTML = isOpera ? ' ' : '
'; // Extra space for Opera so that the caret can move there + return nl[0]; // Move caret to most inner element + } else + e.innerHTML = isOpera ? ' ' : '
'; // Extra space for Opera so that the caret can move there + }; + + // Fill empty afterblook with current style + if (isEmpty(aft)) + car = appendStyles(aft, en); + + // Opera needs this one backwards for older versions + if (isOpera && parseFloat(opera.version()) < 9.5) { + r.insertNode(bef); + r.insertNode(aft); + } else { + r.insertNode(aft); + r.insertNode(bef); + } + + // Normalize + aft.normalize(); + bef.normalize(); + + function first(n) { + return d.createTreeWalker(n, NodeFilter.SHOW_TEXT, null, FALSE).nextNode() || n; + }; + + // Move cursor and scroll into view + r = d.createRange(); + r.selectNodeContents(isGecko ? first(car || aft) : car || aft); + r.collapse(1); + s.removeAllRanges(); + s.addRange(r); + + // scrollIntoView seems to scroll the parent window in most browsers now including FF 3.0b4 so it's time to stop using it and do it our selfs + y = ed.dom.getPos(aft).y; + ch = aft.clientHeight; + + // Is element within viewport + if (y < vp.y || y + ch > vp.y + vp.h) { + ed.getWin().scrollTo(0, y < vp.y ? y : y - vp.h + 25); // Needs to be hardcoded to roughly one line of text if a huge text block is broken into two blocks + //console.debug('SCROLL!', 'vp.y: ' + vp.y, 'y' + y, 'vp.h' + vp.h, 'clientHeight' + aft.clientHeight, 'yyy: ' + (y < vp.y ? y : y - vp.h + aft.clientHeight)); + } + + return FALSE; + }, + + backspaceDelete : function(e, bs) { + var t = this, ed = t.editor, b = ed.getBody(), dom = ed.dom, n, se = ed.selection, r = se.getRng(), sc = r.startContainer, n, w, tn, walker; + + // Delete when caret is behind a element doesn't work correctly on Gecko see #3011651 + if (!bs && r.collapsed && sc.nodeType == 1 && r.startOffset == sc.childNodes.length) { + walker = new tinymce.dom.TreeWalker(sc.lastChild, sc); + + // Walk the dom backwards until we find a text node + for (n = sc.lastChild; n; n = walker.prev()) { + if (n.nodeType == 3) { + r.setStart(n, n.nodeValue.length); + r.collapse(true); + se.setRng(r); + return; + } + } + } + + // The caret sometimes gets stuck in Gecko if you delete empty paragraphs + // This workaround removes the element by hand and moves the caret to the previous element + if (sc && ed.dom.isBlock(sc) && !/^(TD|TH)$/.test(sc.nodeName) && bs) { + if (sc.childNodes.length == 0 || (sc.childNodes.length == 1 && sc.firstChild.nodeName == 'BR')) { + // Find previous block element + n = sc; + while ((n = n.previousSibling) && !ed.dom.isBlock(n)) ; + + if (n) { + if (sc != b.firstChild) { + // Find last text node + w = ed.dom.doc.createTreeWalker(n, NodeFilter.SHOW_TEXT, null, FALSE); + while (tn = w.nextNode()) + n = tn; + + // Place caret at the end of last text node + r = ed.getDoc().createRange(); + r.setStart(n, n.nodeValue ? n.nodeValue.length : 0); + r.setEnd(n, n.nodeValue ? n.nodeValue.length : 0); + se.setRng(r); + + // Remove the target container + ed.dom.remove(sc); + } + + return Event.cancel(e); + } + } + } + } + }); +})(tinymce); + +(function(tinymce) { + // Shorten names + var DOM = tinymce.DOM, Event = tinymce.dom.Event, each = tinymce.each, extend = tinymce.extend; + + tinymce.create('tinymce.ControlManager', { + ControlManager : function(ed, s) { + var t = this, i; + + s = s || {}; + t.editor = ed; + t.controls = {}; + t.onAdd = new tinymce.util.Dispatcher(t); + t.onPostRender = new tinymce.util.Dispatcher(t); + t.prefix = s.prefix || ed.id + '_'; + t._cls = {}; + + t.onPostRender.add(function() { + each(t.controls, function(c) { + c.postRender(); + }); + }); + }, + + get : function(id) { + return this.controls[this.prefix + id] || this.controls[id]; + }, + + setActive : function(id, s) { + var c = null; + + if (c = this.get(id)) + c.setActive(s); + + return c; + }, + + setDisabled : function(id, s) { + var c = null; + + if (c = this.get(id)) + c.setDisabled(s); + + return c; + }, + + add : function(c) { + var t = this; + + if (c) { + t.controls[c.id] = c; + t.onAdd.dispatch(c, t); + } + + return c; + }, + + createControl : function(n) { + var c, t = this, ed = t.editor; + + each(ed.plugins, function(p) { + if (p.createControl) { + c = p.createControl(n, t); + + if (c) + return false; + } + }); + + switch (n) { + case "|": + case "separator": + return t.createSeparator(); + } + + if (!c && ed.buttons && (c = ed.buttons[n])) + return t.createButton(n, c); + + return t.add(c); + }, + + createDropMenu : function(id, s, cc) { + var t = this, ed = t.editor, c, bm, v, cls; + + s = extend({ + 'class' : 'mceDropDown', + constrain : ed.settings.constrain_menus + }, s); + + s['class'] = s['class'] + ' ' + ed.getParam('skin') + 'Skin'; + if (v = ed.getParam('skin_variant')) + s['class'] += ' ' + ed.getParam('skin') + 'Skin' + v.substring(0, 1).toUpperCase() + v.substring(1); + + id = t.prefix + id; + cls = cc || t._cls.dropmenu || tinymce.ui.DropMenu; + c = t.controls[id] = new cls(id, s); + c.onAddItem.add(function(c, o) { + var s = o.settings; + + s.title = ed.getLang(s.title, s.title); + + if (!s.onclick) { + s.onclick = function(v) { + if (s.cmd) + ed.execCommand(s.cmd, s.ui || false, s.value); + }; + } + }); + + ed.onRemove.add(function() { + c.destroy(); + }); + + // Fix for bug #1897785, #1898007 + if (tinymce.isIE) { + c.onShowMenu.add(function() { + // IE 8 needs focus in order to store away a range with the current collapsed caret location + ed.focus(); + + bm = ed.selection.getBookmark(1); + }); + + c.onHideMenu.add(function() { + if (bm) { + ed.selection.moveToBookmark(bm); + bm = 0; + } + }); + } + + return t.add(c); + }, + + createListBox : function(id, s, cc) { + var t = this, ed = t.editor, cmd, c, cls; + + if (t.get(id)) + return null; + + s.title = ed.translate(s.title); + s.scope = s.scope || ed; + + if (!s.onselect) { + s.onselect = function(v) { + ed.execCommand(s.cmd, s.ui || false, v || s.value); + }; + } + + s = extend({ + title : s.title, + 'class' : 'mce_' + id, + scope : s.scope, + control_manager : t + }, s); + + id = t.prefix + id; + + if (ed.settings.use_native_selects) + c = new tinymce.ui.NativeListBox(id, s); + else { + cls = cc || t._cls.listbox || tinymce.ui.ListBox; + c = new cls(id, s); + } + + t.controls[id] = c; + + // Fix focus problem in Safari + if (tinymce.isWebKit) { + c.onPostRender.add(function(c, n) { + // Store bookmark on mousedown + Event.add(n, 'mousedown', function() { + ed.bookmark = ed.selection.getBookmark(1); + }); + + // Restore on focus, since it might be lost + Event.add(n, 'focus', function() { + ed.selection.moveToBookmark(ed.bookmark); + ed.bookmark = null; + }); + }); + } + + if (c.hideMenu) + ed.onMouseDown.add(c.hideMenu, c); + + return t.add(c); + }, + + createButton : function(id, s, cc) { + var t = this, ed = t.editor, o, c, cls; + + if (t.get(id)) + return null; + + s.title = ed.translate(s.title); + s.label = ed.translate(s.label); + s.scope = s.scope || ed; + + if (!s.onclick && !s.menu_button) { + s.onclick = function() { + ed.execCommand(s.cmd, s.ui || false, s.value); + }; + } + + s = extend({ + title : s.title, + 'class' : 'mce_' + id, + unavailable_prefix : ed.getLang('unavailable', ''), + scope : s.scope, + control_manager : t + }, s); + + id = t.prefix + id; + + if (s.menu_button) { + cls = cc || t._cls.menubutton || tinymce.ui.MenuButton; + c = new cls(id, s); + ed.onMouseDown.add(c.hideMenu, c); + } else { + cls = t._cls.button || tinymce.ui.Button; + c = new cls(id, s); + } + + return t.add(c); + }, + + createMenuButton : function(id, s, cc) { + s = s || {}; + s.menu_button = 1; + + return this.createButton(id, s, cc); + }, + + createSplitButton : function(id, s, cc) { + var t = this, ed = t.editor, cmd, c, cls; + + if (t.get(id)) + return null; + + s.title = ed.translate(s.title); + s.scope = s.scope || ed; + + if (!s.onclick) { + s.onclick = function(v) { + ed.execCommand(s.cmd, s.ui || false, v || s.value); + }; + } + + if (!s.onselect) { + s.onselect = function(v) { + ed.execCommand(s.cmd, s.ui || false, v || s.value); + }; + } + + s = extend({ + title : s.title, + 'class' : 'mce_' + id, + scope : s.scope, + control_manager : t + }, s); + + id = t.prefix + id; + cls = cc || t._cls.splitbutton || tinymce.ui.SplitButton; + c = t.add(new cls(id, s)); + ed.onMouseDown.add(c.hideMenu, c); + + return c; + }, + + createColorSplitButton : function(id, s, cc) { + var t = this, ed = t.editor, cmd, c, cls, bm; + + if (t.get(id)) + return null; + + s.title = ed.translate(s.title); + s.scope = s.scope || ed; + + if (!s.onclick) { + s.onclick = function(v) { + if (tinymce.isIE) + bm = ed.selection.getBookmark(1); + + ed.execCommand(s.cmd, s.ui || false, v || s.value); + }; + } + + if (!s.onselect) { + s.onselect = function(v) { + ed.execCommand(s.cmd, s.ui || false, v || s.value); + }; + } + + s = extend({ + title : s.title, + 'class' : 'mce_' + id, + 'menu_class' : ed.getParam('skin') + 'Skin', + scope : s.scope, + more_colors_title : ed.getLang('more_colors') + }, s); + + id = t.prefix + id; + cls = cc || t._cls.colorsplitbutton || tinymce.ui.ColorSplitButton; + c = new cls(id, s); + ed.onMouseDown.add(c.hideMenu, c); + + // Remove the menu element when the editor is removed + ed.onRemove.add(function() { + c.destroy(); + }); + + // Fix for bug #1897785, #1898007 + if (tinymce.isIE) { + c.onShowMenu.add(function() { + // IE 8 needs focus in order to store away a range with the current collapsed caret location + ed.focus(); + bm = ed.selection.getBookmark(1); + }); + + c.onHideMenu.add(function() { + if (bm) { + ed.selection.moveToBookmark(bm); + bm = 0; + } + }); + } + + return t.add(c); + }, + + createToolbar : function(id, s, cc) { + var c, t = this, cls; + + id = t.prefix + id; + cls = cc || t._cls.toolbar || tinymce.ui.Toolbar; + c = new cls(id, s); + + if (t.get(id)) + return null; + + return t.add(c); + }, + + createSeparator : function(cc) { + var cls = cc || this._cls.separator || tinymce.ui.Separator; + + return new cls(); + }, + + setControlType : function(n, c) { + return this._cls[n.toLowerCase()] = c; + }, + + destroy : function() { + each(this.controls, function(c) { + c.destroy(); + }); + + this.controls = null; + } + }); +})(tinymce); + +(function(tinymce) { + var Dispatcher = tinymce.util.Dispatcher, each = tinymce.each, isIE = tinymce.isIE, isOpera = tinymce.isOpera; + + tinymce.create('tinymce.WindowManager', { + WindowManager : function(ed) { + var t = this; + + t.editor = ed; + t.onOpen = new Dispatcher(t); + t.onClose = new Dispatcher(t); + t.params = {}; + t.features = {}; + }, + + open : function(s, p) { + var t = this, f = '', x, y, mo = t.editor.settings.dialog_type == 'modal', w, sw, sh, vp = tinymce.DOM.getViewPort(), u; + + // Default some options + s = s || {}; + p = p || {}; + sw = isOpera ? vp.w : screen.width; // Opera uses windows inside the Opera window + sh = isOpera ? vp.h : screen.height; + s.name = s.name || 'mc_' + new Date().getTime(); + s.width = parseInt(s.width || 320); + s.height = parseInt(s.height || 240); + s.resizable = true; + s.left = s.left || parseInt(sw / 2.0) - (s.width / 2.0); + s.top = s.top || parseInt(sh / 2.0) - (s.height / 2.0); + p.inline = false; + p.mce_width = s.width; + p.mce_height = s.height; + p.mce_auto_focus = s.auto_focus; + + if (mo) { + if (isIE) { + s.center = true; + s.help = false; + s.dialogWidth = s.width + 'px'; + s.dialogHeight = s.height + 'px'; + s.scroll = s.scrollbars || false; + } + } + + // Build features string + each(s, function(v, k) { + if (tinymce.is(v, 'boolean')) + v = v ? 'yes' : 'no'; + + if (!/^(name|url)$/.test(k)) { + if (isIE && mo) + f += (f ? ';' : '') + k + ':' + v; + else + f += (f ? ',' : '') + k + '=' + v; + } + }); + + t.features = s; + t.params = p; + t.onOpen.dispatch(t, s, p); + + u = s.url || s.file; + u = tinymce._addVer(u); + + try { + if (isIE && mo) { + w = 1; + window.showModalDialog(u, window, f); + } else + w = window.open(u, s.name, f); + } catch (ex) { + // Ignore + } + + if (!w) + alert(t.editor.getLang('popup_blocked')); + }, + + close : function(w) { + w.close(); + this.onClose.dispatch(this); + }, + + createInstance : function(cl, a, b, c, d, e) { + var f = tinymce.resolve(cl); + + return new f(a, b, c, d, e); + }, + + confirm : function(t, cb, s, w) { + w = w || window; + + cb.call(s || this, w.confirm(this._decode(this.editor.getLang(t, t)))); + }, + + alert : function(tx, cb, s, w) { + var t = this; + + w = w || window; + w.alert(t._decode(t.editor.getLang(tx, tx))); + + if (cb) + cb.call(s || t); + }, + + resizeBy : function(dw, dh, win) { + win.resizeBy(dw, dh); + }, + + // Internal functions + + _decode : function(s) { + return tinymce.DOM.decode(s).replace(/\\n/g, '\n'); + } + }); +}(tinymce)); +(function(tinymce) { + function CommandManager() { + var execCommands = {}, queryStateCommands = {}, queryValueCommands = {}; + + function add(collection, cmd, func, scope) { + if (typeof(cmd) == 'string') + cmd = [cmd]; + + tinymce.each(cmd, function(cmd) { + collection[cmd.toLowerCase()] = {func : func, scope : scope}; + }); + }; + + tinymce.extend(this, { + add : function(cmd, func, scope) { + add(execCommands, cmd, func, scope); + }, + + addQueryStateHandler : function(cmd, func, scope) { + add(queryStateCommands, cmd, func, scope); + }, + + addQueryValueHandler : function(cmd, func, scope) { + add(queryValueCommands, cmd, func, scope); + }, + + execCommand : function(scope, cmd, ui, value, args) { + if (cmd = execCommands[cmd.toLowerCase()]) { + if (cmd.func.call(scope || cmd.scope, ui, value, args) !== false) + return true; + } + }, + + queryCommandValue : function() { + if (cmd = queryValueCommands[cmd.toLowerCase()]) + return cmd.func.call(scope || cmd.scope, ui, value, args); + }, + + queryCommandState : function() { + if (cmd = queryStateCommands[cmd.toLowerCase()]) + return cmd.func.call(scope || cmd.scope, ui, value, args); + } + }); + }; + + tinymce.GlobalCommands = new CommandManager(); +})(tinymce); +(function(tinymce) { + tinymce.Formatter = function(ed) { + var formats = {}, + each = tinymce.each, + dom = ed.dom, + selection = ed.selection, + TreeWalker = tinymce.dom.TreeWalker, + rangeUtils = new tinymce.dom.RangeUtils(dom), + isValid = ed.schema.isValid, + isBlock = dom.isBlock, + forcedRootBlock = ed.settings.forced_root_block, + nodeIndex = dom.nodeIndex, + INVISIBLE_CHAR = '\uFEFF', + MCE_ATTR_RE = /^(src|href|style)$/, + FALSE = false, + TRUE = true, + undefined, + pendingFormats = {apply : [], remove : []}; + + function isArray(obj) { + return obj instanceof Array; + }; + + function getParents(node, selector) { + return dom.getParents(node, selector, dom.getRoot()); + }; + + function isCaretNode(node) { + return node.nodeType === 1 && (node.face === 'mceinline' || node.style.fontFamily === 'mceinline'); + }; + + // Public functions + + function get(name) { + return name ? formats[name] : formats; + }; + + function register(name, format) { + if (name) { + if (typeof(name) !== 'string') { + each(name, function(format, name) { + register(name, format); + }); + } else { + // Force format into array and add it to internal collection + format = format.length ? format : [format]; + + each(format, function(format) { + // Set deep to false by default on selector formats this to avoid removing + // alignment on images inside paragraphs when alignment is changed on paragraphs + if (format.deep === undefined) + format.deep = !format.selector; + + // Default to true + if (format.split === undefined) + format.split = !format.selector || format.inline; + + // Default to true + if (format.remove === undefined && format.selector && !format.inline) + format.remove = 'none'; + + // Mark format as a mixed format inline + block level + if (format.selector && format.inline) { + format.mixed = true; + format.block_expand = true; + } + + // Split classes if needed + if (typeof(format.classes) === 'string') + format.classes = format.classes.split(/\s+/); + }); + + formats[name] = format; + } + } + }; + + function apply(name, vars, node) { + var formatList = get(name), format = formatList[0], bookmark, rng, i; + + function moveStart(rng) { + var container = rng.startContainer, + offset = rng.startOffset, + walker, node; + + // Move startContainer/startOffset in to a suitable node + if (container.nodeType == 1 || container.nodeValue === "") { + container = container.nodeType == 1 ? container.childNodes[offset] : container; + + // Might fail if the offset is behind the last element in it's container + if (container) { + walker = new TreeWalker(container, container.parentNode); + for (node = walker.current(); node; node = walker.next()) { + if (node.nodeType == 3 && !isWhiteSpaceNode(node)) { + rng.setStart(node, 0); + break; + } + } + } + } + + return rng; + }; + + function setElementFormat(elm, fmt) { + fmt = fmt || format; + + if (elm) { + each(fmt.styles, function(value, name) { + dom.setStyle(elm, name, replaceVars(value, vars)); + }); + + each(fmt.attributes, function(value, name) { + dom.setAttrib(elm, name, replaceVars(value, vars)); + }); + + each(fmt.classes, function(value) { + value = replaceVars(value, vars); + + if (!dom.hasClass(elm, value)) + dom.addClass(elm, value); + }); + } + }; + + function applyRngStyle(rng) { + var newWrappers = [], wrapName, wrapElm; + + // Setup wrapper element + wrapName = format.inline || format.block; + wrapElm = dom.create(wrapName); + setElementFormat(wrapElm); + + rangeUtils.walk(rng, function(nodes) { + var currentWrapElm; + + function process(node) { + var nodeName = node.nodeName.toLowerCase(), parentName = node.parentNode.nodeName.toLowerCase(), found; + + // Stop wrapping on br elements + if (isEq(nodeName, 'br')) { + currentWrapElm = 0; + + // Remove any br elements when we wrap things + if (format.block) + dom.remove(node); + + return; + } + + // If node is wrapper type + if (format.wrapper && matchNode(node, name, vars)) { + currentWrapElm = 0; + return; + } + + // Can we rename the block + if (format.block && !format.wrapper && isTextBlock(nodeName)) { + node = dom.rename(node, wrapName); + setElementFormat(node); + newWrappers.push(node); + currentWrapElm = 0; + return; + } + + // Handle selector patterns + if (format.selector) { + // Look for matching formats + each(formatList, function(format) { + if (dom.is(node, format.selector) && !isCaretNode(node)) { + setElementFormat(node, format); + found = true; + } + }); + + // Continue processing if a selector match wasn't found and a inline element is defined + if (!format.inline || found) { + currentWrapElm = 0; + return; + } + } + + // Is it valid to wrap this item + if (isValid(wrapName, nodeName) && isValid(parentName, wrapName)) { + // Start wrapping + if (!currentWrapElm) { + // Wrap the node + currentWrapElm = wrapElm.cloneNode(FALSE); + node.parentNode.insertBefore(currentWrapElm, node); + newWrappers.push(currentWrapElm); + } + + currentWrapElm.appendChild(node); + } else { + // Start a new wrapper for possible children + currentWrapElm = 0; + + each(tinymce.grep(node.childNodes), process); + + // End the last wrapper + currentWrapElm = 0; + } + }; + + // Process siblings from range + each(nodes, process); + }); + + // Cleanup + each(newWrappers, function(node) { + var childCount; + + function getChildCount(node) { + var count = 0; + + each(node.childNodes, function(node) { + if (!isWhiteSpaceNode(node) && !isBookmarkNode(node)) + count++; + }); + + return count; + }; + + function mergeStyles(node) { + var child, clone; + + each(node.childNodes, function(node) { + if (node.nodeType == 1 && !isBookmarkNode(node) && !isCaretNode(node)) { + child = node; + return FALSE; // break loop + } + }); + + // If child was found and of the same type as the current node + if (child && matchName(child, format)) { + clone = child.cloneNode(FALSE); + setElementFormat(clone); + + dom.replace(clone, node, TRUE); + dom.remove(child, 1); + } + + return clone || node; + }; + + childCount = getChildCount(node); + + // Remove empty nodes + if (childCount === 0) { + dom.remove(node, 1); + return; + } + + if (format.inline || format.wrapper) { + // Merges the current node with it's children of similar type to reduce the number of elements + if (!format.exact && childCount === 1) + node = mergeStyles(node); + + // Remove/merge children + each(formatList, function(format) { + // Merge all children of similar type will move styles from child to parent + // this: text + // will become: text + each(dom.select(format.inline, node), function(child) { + removeFormat(format, vars, child, format.exact ? child : null); + }); + }); + + // Remove child if direct parent is of same type + if (matchNode(node.parentNode, name, vars)) { + dom.remove(node, 1); + node = 0; + return TRUE; + } + + // Look for parent with similar style format + if (format.merge_with_parents) { + dom.getParent(node.parentNode, function(parent) { + if (matchNode(parent, name, vars)) { + dom.remove(node, 1); + node = 0; + return TRUE; + } + }); + } + + // Merge next and previous siblings if they are similar texttext becomes texttext + if (node) { + node = mergeSiblings(getNonWhiteSpaceSibling(node), node); + node = mergeSiblings(node, getNonWhiteSpaceSibling(node, TRUE)); + } + } + }); + }; + + if (format) { + if (node) { + rng = dom.createRng(); + + rng.setStartBefore(node); + rng.setEndAfter(node); + + applyRngStyle(expandRng(rng, formatList)); + } else { + if (!selection.isCollapsed() || !format.inline) { + // Apply formatting to selection + bookmark = selection.getBookmark(); + applyRngStyle(expandRng(selection.getRng(TRUE), formatList)); + + selection.moveToBookmark(bookmark); + selection.setRng(moveStart(selection.getRng(TRUE))); + ed.nodeChanged(); + } else + performCaretAction('apply', name, vars); + } + } + }; + + function remove(name, vars, node) { + var formatList = get(name), format = formatList[0], bookmark, i, rng; + + function moveStart(rng) { + var container = rng.startContainer, + offset = rng.startOffset, + walker, node, nodes, tmpNode; + + // Convert text node into index if possible + if (container.nodeType == 3 && offset >= container.nodeValue.length - 1) { + container = container.parentNode; + offset = nodeIndex(container) + 1; + } + + // Move startContainer/startOffset in to a suitable node + if (container.nodeType == 1) { + nodes = container.childNodes; + container = nodes[Math.min(offset, nodes.length - 1)]; + walker = new TreeWalker(container); + + // If offset is at end of the parent node walk to the next one + if (offset > nodes.length - 1) + walker.next(); + + for (node = walker.current(); node; node = walker.next()) { + if (node.nodeType == 3 && !isWhiteSpaceNode(node)) { + // IE has a "neat" feature where it moves the start node into the closest element + // we can avoid this by inserting an element before it and then remove it after we set the selection + tmpNode = dom.create('a', null, INVISIBLE_CHAR); + node.parentNode.insertBefore(tmpNode, node); + + // Set selection and remove tmpNode + rng.setStart(node, 0); + selection.setRng(rng); + dom.remove(tmpNode); + + return; + } + } + } + }; + + // Merges the styles for each node + function process(node) { + var children, i, l; + + // Grab the children first since the nodelist might be changed + children = tinymce.grep(node.childNodes); + + // Process current node + for (i = 0, l = formatList.length; i < l; i++) { + if (removeFormat(formatList[i], vars, node, node)) + break; + } + + // Process the children + if (format.deep) { + for (i = 0, l = children.length; i < l; i++) + process(children[i]); + } + }; + + function findFormatRoot(container) { + var formatRoot; + + // Find format root + each(getParents(container.parentNode).reverse(), function(parent) { + var format; + + // Find format root element + if (!formatRoot && parent.id != '_start' && parent.id != '_end') { + // Is the node matching the format we are looking for + format = matchNode(parent, name, vars); + if (format && format.split !== false) + formatRoot = parent; + } + }); + + return formatRoot; + }; + + function wrapAndSplit(format_root, container, target, split) { + var parent, clone, lastClone, firstClone, i, formatRootParent; + + // Format root found then clone formats and split it + if (format_root) { + formatRootParent = format_root.parentNode; + + for (parent = container.parentNode; parent && parent != formatRootParent; parent = parent.parentNode) { + clone = parent.cloneNode(FALSE); + + for (i = 0; i < formatList.length; i++) { + if (removeFormat(formatList[i], vars, clone, clone)) { + clone = 0; + break; + } + } + + // Build wrapper node + if (clone) { + if (lastClone) + clone.appendChild(lastClone); + + if (!firstClone) + firstClone = clone; + + lastClone = clone; + } + } + + // Never split block elements if the format is mixed + if (split && (!format.mixed || !isBlock(format_root))) + container = dom.split(format_root, container); + + // Wrap container in cloned formats + if (lastClone) { + target.parentNode.insertBefore(lastClone, target); + firstClone.appendChild(target); + } + } + + return container; + }; + + function splitToFormatRoot(container) { + return wrapAndSplit(findFormatRoot(container), container, container, true); + }; + + function unwrap(start) { + var node = dom.get(start ? '_start' : '_end'), + out = node[start ? 'firstChild' : 'lastChild']; + + // If the end is placed within the start the result will be removed + // So this checks if the out node is a bookmark node if it is it + // checks for another more suitable node + if (isBookmarkNode(out)) + out = out[start ? 'firstChild' : 'lastChild']; + + dom.remove(node, true); + + return out; + }; + + function removeRngStyle(rng) { + var startContainer, endContainer; + + rng = expandRng(rng, formatList, TRUE); + + if (format.split) { + startContainer = getContainer(rng, TRUE); + endContainer = getContainer(rng); + + if (startContainer != endContainer) { + // Wrap start/end nodes in span element since these might be cloned/moved + startContainer = wrap(startContainer, 'span', {id : '_start', _mce_type : 'bookmark'}); + endContainer = wrap(endContainer, 'span', {id : '_end', _mce_type : 'bookmark'}); + + // Split start/end + splitToFormatRoot(startContainer); + splitToFormatRoot(endContainer); + + // Unwrap start/end to get real elements again + startContainer = unwrap(TRUE); + endContainer = unwrap(); + } else + startContainer = endContainer = splitToFormatRoot(startContainer); + + // Update range positions since they might have changed after the split operations + rng.startContainer = startContainer.parentNode; + rng.startOffset = nodeIndex(startContainer); + rng.endContainer = endContainer.parentNode; + rng.endOffset = nodeIndex(endContainer) + 1; + } + + // Remove items between start/end + rangeUtils.walk(rng, function(nodes) { + each(nodes, function(node) { + process(node); + }); + }); + }; + + // Handle node + if (node) { + rng = dom.createRng(); + rng.setStartBefore(node); + rng.setEndAfter(node); + removeRngStyle(rng); + return; + } + + if (!selection.isCollapsed() || !format.inline) { + bookmark = selection.getBookmark(); + removeRngStyle(selection.getRng(TRUE)); + selection.moveToBookmark(bookmark); + + // Check if start element still has formatting then we are at: "text|text" and need to move the start into the next text node + if (match(name, vars, selection.getStart())) { + moveStart(selection.getRng(true)); + } + + ed.nodeChanged(); + } else + performCaretAction('remove', name, vars); + }; + + function toggle(name, vars, node) { + if (match(name, vars, node)) + remove(name, vars, node); + else + apply(name, vars, node); + }; + + function matchNode(node, name, vars, similar) { + var formatList = get(name), format, i, classes; + + function matchItems(node, format, item_name) { + var key, value, items = format[item_name], i; + + // Check all items + if (items) { + // Non indexed object + if (items.length === undefined) { + for (key in items) { + if (items.hasOwnProperty(key)) { + if (item_name === 'attributes') + value = dom.getAttrib(node, key); + else + value = getStyle(node, key); + + if (similar && !value && !format.exact) + return; + + if ((!similar || format.exact) && !isEq(value, replaceVars(items[key], vars))) + return; + } + } + } else { + // Only one match needed for indexed arrays + for (i = 0; i < items.length; i++) { + if (item_name === 'attributes' ? dom.getAttrib(node, items[i]) : getStyle(node, items[i])) + return format; + } + } + } + + return format; + }; + + if (formatList && node) { + // Check each format in list + for (i = 0; i < formatList.length; i++) { + format = formatList[i]; + + // Name name, attributes, styles and classes + if (matchName(node, format) && matchItems(node, format, 'attributes') && matchItems(node, format, 'styles')) { + // Match classes + if (classes = format.classes) { + for (i = 0; i < classes.length; i++) { + if (!dom.hasClass(node, classes[i])) + return; + } + } + + return format; + } + } + } + }; + + function match(name, vars, node) { + var startNode, i; + + function matchParents(node) { + // Find first node with similar format settings + node = dom.getParent(node, function(node) { + return !!matchNode(node, name, vars, true); + }); + + // Do an exact check on the similar format element + return matchNode(node, name, vars); + }; + + // Check specified node + if (node) + return matchParents(node); + + // Check pending formats + if (selection.isCollapsed()) { + for (i = pendingFormats.apply.length - 1; i >= 0; i--) { + if (pendingFormats.apply[i].name == name) + return true; + } + + for (i = pendingFormats.remove.length - 1; i >= 0; i--) { + if (pendingFormats.remove[i].name == name) + return false; + } + + return matchParents(selection.getNode()); + } + + // Check selected node + node = selection.getNode(); + if (matchParents(node)) + return TRUE; + + // Check start node if it's different + startNode = selection.getStart(); + if (startNode != node) { + if (matchParents(startNode)) + return TRUE; + } + + return FALSE; + }; + + function matchAll(names, vars) { + var startElement, matchedFormatNames = [], checkedMap = {}, i, ni, name; + + // If the selection is collapsed then check pending formats + if (selection.isCollapsed()) { + for (ni = 0; ni < names.length; ni++) { + // If the name is to be removed, then stop it from being added + for (i = pendingFormats.remove.length - 1; i >= 0; i--) { + name = names[ni]; + + if (pendingFormats.remove[i].name == name) { + checkedMap[name] = true; + break; + } + } + } + + // If the format is to be applied + for (i = pendingFormats.apply.length - 1; i >= 0; i--) { + for (ni = 0; ni < names.length; ni++) { + name = names[ni]; + + if (!checkedMap[name] && pendingFormats.apply[i].name == name) { + checkedMap[name] = true; + matchedFormatNames.push(name); + } + } + } + } + + // Check start of selection for formats + startElement = selection.getStart(); + dom.getParent(startElement, function(node) { + var i, name; + + for (i = 0; i < names.length; i++) { + name = names[i]; + + if (!checkedMap[name] && matchNode(node, name, vars)) { + checkedMap[name] = true; + matchedFormatNames.push(name); + } + } + }); + + return matchedFormatNames; + }; + + function canApply(name) { + var formatList = get(name), startNode, parents, i, x, selector; + + if (formatList) { + startNode = selection.getStart(); + parents = getParents(startNode); + + for (x = formatList.length - 1; x >= 0; x--) { + selector = formatList[x].selector; + + // Format is not selector based, then always return TRUE + if (!selector) + return TRUE; + + for (i = parents.length - 1; i >= 0; i--) { + if (dom.is(parents[i], selector)) + return TRUE; + } + } + } + + return FALSE; + }; + + // Expose to public + tinymce.extend(this, { + get : get, + register : register, + apply : apply, + remove : remove, + toggle : toggle, + match : match, + matchAll : matchAll, + matchNode : matchNode, + canApply : canApply + }); + + // Private functions + + function matchName(node, format) { + // Check for inline match + if (isEq(node, format.inline)) + return TRUE; + + // Check for block match + if (isEq(node, format.block)) + return TRUE; + + // Check for selector match + if (format.selector) + return dom.is(node, format.selector); + }; + + function isEq(str1, str2) { + str1 = str1 || ''; + str2 = str2 || ''; + + str1 = '' + (str1.nodeName || str1); + str2 = '' + (str2.nodeName || str2); + + return str1.toLowerCase() == str2.toLowerCase(); + }; + + function getStyle(node, name) { + var styleVal = dom.getStyle(node, name); + + // Force the format to hex + if (name == 'color' || name == 'backgroundColor') + styleVal = dom.toHex(styleVal); + + // Opera will return bold as 700 + if (name == 'fontWeight' && styleVal == 700) + styleVal = 'bold'; + + return '' + styleVal; + }; + + function replaceVars(value, vars) { + if (typeof(value) != "string") + value = value(vars); + else if (vars) { + value = value.replace(/%(\w+)/g, function(str, name) { + return vars[name] || str; + }); + } + + return value; + }; + + function isWhiteSpaceNode(node) { + return node && node.nodeType === 3 && /^([\s\r\n]+|)$/.test(node.nodeValue); + }; + + function wrap(node, name, attrs) { + var wrapper = dom.create(name, attrs); + + node.parentNode.insertBefore(wrapper, node); + wrapper.appendChild(node); + + return wrapper; + }; + + function expandRng(rng, format, remove) { + var startContainer = rng.startContainer, + startOffset = rng.startOffset, + endContainer = rng.endContainer, + endOffset = rng.endOffset, sibling, lastIdx; + + // This function walks up the tree if there is no siblings before/after the node + function findParentContainer(container, child_name, sibling_name, root) { + var parent, child; + + root = root || dom.getRoot(); + + for (;;) { + // Check if we can move up are we at root level or body level + parent = container.parentNode; + + // Stop expanding on block elements or root depending on format + if (parent == root || (!format[0].block_expand && isBlock(parent))) + return container; + + for (sibling = parent[child_name]; sibling && sibling != container; sibling = sibling[sibling_name]) { + if (sibling.nodeType == 1 && !isBookmarkNode(sibling)) + return container; + + if (sibling.nodeType == 3 && !isWhiteSpaceNode(sibling)) + return container; + } + + container = container.parentNode; + } + + return container; + }; + + // If index based start position then resolve it + if (startContainer.nodeType == 1 && startContainer.hasChildNodes()) { + lastIdx = startContainer.childNodes.length - 1; + startContainer = startContainer.childNodes[startOffset > lastIdx ? lastIdx : startOffset]; + + if (startContainer.nodeType == 3) + startOffset = 0; + } + + // If index based end position then resolve it + if (endContainer.nodeType == 1 && endContainer.hasChildNodes()) { + lastIdx = endContainer.childNodes.length - 1; + endContainer = endContainer.childNodes[endOffset > lastIdx ? lastIdx : endOffset - 1]; + + if (endContainer.nodeType == 3) + endOffset = endContainer.nodeValue.length; + } + + // Exclude bookmark nodes if possible + if (isBookmarkNode(startContainer.parentNode)) + startContainer = startContainer.parentNode; + + if (isBookmarkNode(startContainer)) + startContainer = startContainer.nextSibling || startContainer; + + if (isBookmarkNode(endContainer.parentNode)) + endContainer = endContainer.parentNode; + + if (isBookmarkNode(endContainer)) + endContainer = endContainer.previousSibling || endContainer; + + // Move start/end point up the tree if the leaves are sharp and if we are in different containers + // Example * becomes !: !

*texttext*

! + // This will reduce the number of wrapper elements that needs to be created + // Move start point up the tree + if (format[0].inline || format[0].block_expand) { + startContainer = findParentContainer(startContainer, 'firstChild', 'nextSibling'); + endContainer = findParentContainer(endContainer, 'lastChild', 'previousSibling'); + } + + // Expand start/end container to matching selector + if (format[0].selector && format[0].expand !== FALSE && !format[0].inline) { + function findSelectorEndPoint(container, sibling_name) { + var parents, i, y; + + if (container.nodeType == 3 && container.nodeValue.length == 0 && container[sibling_name]) + container = container[sibling_name]; + + parents = getParents(container); + for (i = 0; i < parents.length; i++) { + for (y = 0; y < format.length; y++) { + if (dom.is(parents[i], format[y].selector)) + return parents[i]; + } + } + + return container; + }; + + // Find new startContainer/endContainer if there is better one + startContainer = findSelectorEndPoint(startContainer, 'previousSibling'); + endContainer = findSelectorEndPoint(endContainer, 'nextSibling'); + } + + // Expand start/end container to matching block element or text node + if (format[0].block || format[0].selector) { + function findBlockEndPoint(container, sibling_name, sibling_name2) { + var node; + + // Expand to block of similar type + if (!format[0].wrapper) + node = dom.getParent(container, format[0].block); + + // Expand to first wrappable block element or any block element + if (!node) + node = dom.getParent(container.nodeType == 3 ? container.parentNode : container, isBlock); + + // Exclude inner lists from wrapping + if (node && format[0].wrapper) + node = getParents(node, 'ul,ol').reverse()[0] || node; + + // Didn't find a block element look for first/last wrappable element + if (!node) { + node = container; + + while (node[sibling_name] && !isBlock(node[sibling_name])) { + node = node[sibling_name]; + + // Break on BR but include it will be removed later on + // we can't remove it now since we need to check if it can be wrapped + if (isEq(node, 'br')) + break; + } + } + + return node || container; + }; + + // Find new startContainer/endContainer if there is better one + startContainer = findBlockEndPoint(startContainer, 'previousSibling'); + endContainer = findBlockEndPoint(endContainer, 'nextSibling'); + + // Non block element then try to expand up the leaf + if (format[0].block) { + if (!isBlock(startContainer)) + startContainer = findParentContainer(startContainer, 'firstChild', 'nextSibling'); + + if (!isBlock(endContainer)) + endContainer = findParentContainer(endContainer, 'lastChild', 'previousSibling'); + } + } + + // Setup index for startContainer + if (startContainer.nodeType == 1) { + startOffset = nodeIndex(startContainer); + startContainer = startContainer.parentNode; + } + + // Setup index for endContainer + if (endContainer.nodeType == 1) { + endOffset = nodeIndex(endContainer) + 1; + endContainer = endContainer.parentNode; + } + + // Return new range like object + return { + startContainer : startContainer, + startOffset : startOffset, + endContainer : endContainer, + endOffset : endOffset + }; + } + + function removeFormat(format, vars, node, compare_node) { + var i, attrs, stylesModified; + + // Check if node matches format + if (!matchName(node, format)) + return FALSE; + + // Should we compare with format attribs and styles + if (format.remove != 'all') { + // Remove styles + each(format.styles, function(value, name) { + value = replaceVars(value, vars); + + // Indexed array + if (typeof(name) === 'number') { + name = value; + compare_node = 0; + } + + if (!compare_node || isEq(getStyle(compare_node, name), value)) + dom.setStyle(node, name, ''); + + stylesModified = 1; + }); + + // Remove style attribute if it's empty + if (stylesModified && dom.getAttrib(node, 'style') == '') { + node.removeAttribute('style'); + node.removeAttribute('_mce_style'); + } + + // Remove attributes + each(format.attributes, function(value, name) { + var valueOut; + + value = replaceVars(value, vars); + + // Indexed array + if (typeof(name) === 'number') { + name = value; + compare_node = 0; + } + + if (!compare_node || isEq(dom.getAttrib(compare_node, name), value)) { + // Keep internal classes + if (name == 'class') { + value = dom.getAttrib(node, name); + if (value) { + // Build new class value where everything is removed except the internal prefixed classes + valueOut = ''; + each(value.split(/\s+/), function(cls) { + if (/mce\w+/.test(cls)) + valueOut += (valueOut ? ' ' : '') + cls; + }); + + // We got some internal classes left + if (valueOut) { + dom.setAttrib(node, name, valueOut); + return; + } + } + } + + // IE6 has a bug where the attribute doesn't get removed correctly + if (name == "class") + node.removeAttribute('className'); + + // Remove mce prefixed attributes + if (MCE_ATTR_RE.test(name)) + node.removeAttribute('_mce_' + name); + + node.removeAttribute(name); + } + }); + + // Remove classes + each(format.classes, function(value) { + value = replaceVars(value, vars); + + if (!compare_node || dom.hasClass(compare_node, value)) + dom.removeClass(node, value); + }); + + // Check for non internal attributes + attrs = dom.getAttribs(node); + for (i = 0; i < attrs.length; i++) { + if (attrs[i].nodeName.indexOf('_') !== 0) + return FALSE; + } + } + + // Remove the inline child if it's empty for example or + if (format.remove != 'none') { + removeNode(node, format); + return TRUE; + } + }; + + function removeNode(node, format) { + var parentNode = node.parentNode, rootBlockElm; + + if (format.block) { + if (!forcedRootBlock) { + function find(node, next, inc) { + node = getNonWhiteSpaceSibling(node, next, inc); + + return !node || (node.nodeName == 'BR' || isBlock(node)); + }; + + // Append BR elements if needed before we remove the block + if (isBlock(node) && !isBlock(parentNode)) { + if (!find(node, FALSE) && !find(node.firstChild, TRUE, 1)) + node.insertBefore(dom.create('br'), node.firstChild); + + if (!find(node, TRUE) && !find(node.lastChild, FALSE, 1)) + node.appendChild(dom.create('br')); + } + } else { + // Wrap the block in a forcedRootBlock if we are at the root of document + if (parentNode == dom.getRoot()) { + if (!format.list_block || !isEq(node, format.list_block)) { + each(tinymce.grep(node.childNodes), function(node) { + if (isValid(forcedRootBlock, node.nodeName.toLowerCase())) { + if (!rootBlockElm) + rootBlockElm = wrap(node, forcedRootBlock); + else + rootBlockElm.appendChild(node); + } else + rootBlockElm = 0; + }); + } + } + } + } + + // Never remove nodes that isn't the specified inline element if a selector is specified too + if (format.selector && format.inline && !isEq(format.inline, node)) + return; + + dom.remove(node, 1); + }; + + function getNonWhiteSpaceSibling(node, next, inc) { + if (node) { + next = next ? 'nextSibling' : 'previousSibling'; + + for (node = inc ? node : node[next]; node; node = node[next]) { + if (node.nodeType == 1 || !isWhiteSpaceNode(node)) + return node; + } + } + }; + + function isBookmarkNode(node) { + return node && node.nodeType == 1 && node.getAttribute('_mce_type') == 'bookmark'; + }; + + function mergeSiblings(prev, next) { + var marker, sibling, tmpSibling; + + function compareElements(node1, node2) { + // Not the same name + if (node1.nodeName != node2.nodeName) + return FALSE; + + function getAttribs(node) { + var attribs = {}; + + each(dom.getAttribs(node), function(attr) { + var name = attr.nodeName.toLowerCase(); + + // Don't compare internal attributes or style + if (name.indexOf('_') !== 0 && name !== 'style') + attribs[name] = dom.getAttrib(node, name); + }); + + return attribs; + }; + + function compareObjects(obj1, obj2) { + var value, name; + + for (name in obj1) { + // Obj1 has item obj2 doesn't have + if (obj1.hasOwnProperty(name)) { + value = obj2[name]; + + // Obj2 doesn't have obj1 item + if (value === undefined) + return FALSE; + + // Obj2 item has a different value + if (obj1[name] != value) + return FALSE; + + // Delete similar value + delete obj2[name]; + } + } + + // Check if obj 2 has something obj 1 doesn't have + for (name in obj2) { + // Obj2 has item obj1 doesn't have + if (obj2.hasOwnProperty(name)) + return FALSE; + } + + return TRUE; + }; + + // Attribs are not the same + if (!compareObjects(getAttribs(node1), getAttribs(node2))) + return FALSE; + + // Styles are not the same + if (!compareObjects(dom.parseStyle(dom.getAttrib(node1, 'style')), dom.parseStyle(dom.getAttrib(node2, 'style')))) + return FALSE; + + return TRUE; + }; + + // Check if next/prev exists and that they are elements + if (prev && next) { + function findElementSibling(node, sibling_name) { + for (sibling = node; sibling; sibling = sibling[sibling_name]) { + if (sibling.nodeType == 3 && !isWhiteSpaceNode(sibling)) + return node; + + if (sibling.nodeType == 1 && !isBookmarkNode(sibling)) + return sibling; + } + + return node; + }; + + // If previous sibling is empty then jump over it + prev = findElementSibling(prev, 'previousSibling'); + next = findElementSibling(next, 'nextSibling'); + + // Compare next and previous nodes + if (compareElements(prev, next)) { + // Append nodes between + for (sibling = prev.nextSibling; sibling && sibling != next;) { + tmpSibling = sibling; + sibling = sibling.nextSibling; + prev.appendChild(tmpSibling); + } + + // Remove next node + dom.remove(next); + + // Move children into prev node + each(tinymce.grep(next.childNodes), function(node) { + prev.appendChild(node); + }); + + return prev; + } + } + + return next; + }; + + function isTextBlock(name) { + return /^(h[1-6]|p|div|pre|address|dl|dt|dd)$/.test(name); + }; + + function getContainer(rng, start) { + var container, offset, lastIdx; + + container = rng[start ? 'startContainer' : 'endContainer']; + offset = rng[start ? 'startOffset' : 'endOffset']; + + if (container.nodeType == 1) { + lastIdx = container.childNodes.length - 1; + + if (!start && offset) + offset--; + + container = container.childNodes[offset > lastIdx ? lastIdx : offset]; + } + + return container; + }; + + function performCaretAction(type, name, vars) { + var i, currentPendingFormats = pendingFormats[type], + otherPendingFormats = pendingFormats[type == 'apply' ? 'remove' : 'apply']; + + function hasPending() { + return pendingFormats.apply.length || pendingFormats.remove.length; + }; + + function resetPending() { + pendingFormats.apply = []; + pendingFormats.remove = []; + }; + + function perform(caret_node) { + // Apply pending formats + each(pendingFormats.apply.reverse(), function(item) { + apply(item.name, item.vars, caret_node); + }); + + // Remove pending formats + each(pendingFormats.remove.reverse(), function(item) { + remove(item.name, item.vars, caret_node); + }); + + dom.remove(caret_node, 1); + resetPending(); + }; + + // Check if it already exists then ignore it + for (i = currentPendingFormats.length - 1; i >= 0; i--) { + if (currentPendingFormats[i].name == name) + return; + } + + currentPendingFormats.push({name : name, vars : vars}); + + // Check if it's in the other type, then remove it + for (i = otherPendingFormats.length - 1; i >= 0; i--) { + if (otherPendingFormats[i].name == name) + otherPendingFormats.splice(i, 1); + } + + // Pending apply or remove formats + if (hasPending()) { + ed.getDoc().execCommand('FontName', false, 'mceinline'); + pendingFormats.lastRng = selection.getRng(); + + // IE will convert the current word + each(dom.select('font,span'), function(node) { + var bookmark; + + if (isCaretNode(node)) { + bookmark = selection.getBookmark(); + perform(node); + selection.moveToBookmark(bookmark); + ed.nodeChanged(); + } + }); + + // Only register listeners once if we need to + if (!pendingFormats.isListening && hasPending()) { + pendingFormats.isListening = true; + + each('onKeyDown,onKeyUp,onKeyPress,onMouseUp'.split(','), function(event) { + ed[event].addToTop(function(ed, e) { + // Do we have pending formats and is the selection moved has moved + if (hasPending() && !tinymce.dom.RangeUtils.compareRanges(pendingFormats.lastRng, selection.getRng())) { + each(dom.select('font,span'), function(node) { + var textNode, rng; + + // Look for marker + if (isCaretNode(node)) { + textNode = node.firstChild; + + if (textNode) { + perform(node); + + rng = dom.createRng(); + rng.setStart(textNode, textNode.nodeValue.length); + rng.setEnd(textNode, textNode.nodeValue.length); + selection.setRng(rng); + ed.nodeChanged(); + } else + dom.remove(node); + } + }); + + // Always unbind and clear pending styles on keyup + if (e.type == 'keyup' || e.type == 'mouseup') + resetPending(); + } + }); + }); + } + } + }; + }; +})(tinymce); + +tinymce.onAddEditor.add(function(tinymce, ed) { + var filters, fontSizes, dom, settings = ed.settings; + + if (settings.inline_styles) { + fontSizes = tinymce.explode(settings.font_size_style_values); + + function replaceWithSpan(node, styles) { + dom.replace(dom.create('span', { + style : styles + }), node, 1); + }; + + filters = { + font : function(dom, node) { + replaceWithSpan(node, { + backgroundColor : node.style.backgroundColor, + color : node.color, + fontFamily : node.face, + fontSize : fontSizes[parseInt(node.size) - 1] + }); + }, + + u : function(dom, node) { + replaceWithSpan(node, { + textDecoration : 'underline' + }); + }, + + strike : function(dom, node) { + replaceWithSpan(node, { + textDecoration : 'line-through' + }); + } + }; + + function convert(editor, params) { + dom = editor.dom; + + if (settings.convert_fonts_to_spans) { + tinymce.each(dom.select('font,u,strike', params.node), function(node) { + filters[node.nodeName.toLowerCase()](ed.dom, node); + }); + } + }; + + ed.onPreProcess.add(convert); + + ed.onInit.add(function() { + ed.selection.onSetContent.add(convert); + }); + } +}); + diff --git a/web/libs/tiny_mce/utils/editable_selects.js b/web/libs/tiny_mce/utils/editable_selects.js new file mode 100644 index 0000000..fd943c0 --- /dev/null +++ b/web/libs/tiny_mce/utils/editable_selects.js @@ -0,0 +1,70 @@ +/** + * editable_selects.js + * + * Copyright 2009, Moxiecode Systems AB + * Released under LGPL License. + * + * License: http://tinymce.moxiecode.com/license + * Contributing: http://tinymce.moxiecode.com/contributing + */ + +var TinyMCE_EditableSelects = { + editSelectElm : null, + + init : function() { + var nl = document.getElementsByTagName("select"), i, d = document, o; + + for (i=0; i'; + h += ' '; + + return h; +} + +function updateColor(img_id, form_element_id) { + document.getElementById(img_id).style.backgroundColor = document.forms[0].elements[form_element_id].value; +} + +function setBrowserDisabled(id, state) { + var img = document.getElementById(id); + var lnk = document.getElementById(id + "_link"); + + if (lnk) { + if (state) { + lnk.setAttribute("realhref", lnk.getAttribute("href")); + lnk.removeAttribute("href"); + tinyMCEPopup.dom.addClass(img, 'disabled'); + } else { + if (lnk.getAttribute("realhref")) + lnk.setAttribute("href", lnk.getAttribute("realhref")); + + tinyMCEPopup.dom.removeClass(img, 'disabled'); + } + } +} + +function getBrowserHTML(id, target_form_element, type, prefix) { + var option = prefix + "_" + type + "_browser_callback", cb, html; + + cb = tinyMCEPopup.getParam(option, tinyMCEPopup.getParam("file_browser_callback")); + + if (!cb) + return ""; + + html = ""; + html += ''; + html += ' '; + + return html; +} + +function openBrowser(img_id, target_form_element, type, option) { + var img = document.getElementById(img_id); + + if (img.className != "mceButtonDisabled") + tinyMCEPopup.openBrowser(target_form_element, type, option); +} + +function selectByValue(form_obj, field_name, value, add_custom, ignore_case) { + if (!form_obj || !form_obj.elements[field_name]) + return; + + var sel = form_obj.elements[field_name]; + + var found = false; + for (var i=0; i parseInt(v)) + st = this.mark(f, n); + } + } + + return st; + }, + + hasClass : function(n, c, d) { + return new RegExp('\\b' + c + (d ? '[0-9]+' : '') + '\\b', 'g').test(n.className); + }, + + getNum : function(n, c) { + c = n.className.match(new RegExp('\\b' + c + '([0-9]+)\\b', 'g'))[0]; + c = c.replace(/[^0-9]/g, ''); + + return c; + }, + + addClass : function(n, c, b) { + var o = this.removeClass(n, c); + n.className = b ? c + (o != '' ? (' ' + o) : '') : (o != '' ? (o + ' ') : '') + c; + }, + + removeClass : function(n, c) { + c = n.className.replace(new RegExp("(^|\\s+)" + c + "(\\s+|$)"), ' '); + return n.className = c != ' ' ? c : ''; + }, + + tags : function(f, s) { + return f.getElementsByTagName(s); + }, + + mark : function(f, n) { + var s = this.settings; + + this.addClass(n, s.invalid_cls); + this.markLabels(f, n, s.invalid_cls); + + return false; + }, + + markLabels : function(f, n, ic) { + var nl, i; + + nl = this.tags(f, "label"); + for (i=0; i + + + out_file("views/head.php"); ?> + + + + + + + +
+
+ +
+out_file("views/admin/colonne.php"); ?> +
+ +
+out_file("views/messages.php"); ?> +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> +
+ +
+ +
+
+ + + + + diff --git a/web/out/dist/compte.php b/web/out/dist/compte.php new file mode 100644 index 0000000..604a9ca --- /dev/null +++ b/web/out/dist/compte.php @@ -0,0 +1,44 @@ + + + + out_file("views/head.php"); ?> + + + + + + + +
+
+ +
+out_file("views/users/colonne.php"); ?> +
+ +
+out_file("views/messages.php"); ?> +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> +
+ +
+ +
+
+ + + + + diff --git a/web/out/dist/config.xml b/web/out/dist/config.xml new file mode 100644 index 0000000..a50ddb4 --- /dev/null +++ b/web/out/dist/config.xml @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/out/dist/content.php b/web/out/dist/content.php new file mode 100644 index 0000000..99f10d3 --- /dev/null +++ b/web/out/dist/content.php @@ -0,0 +1,5 @@ +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> \ No newline at end of file diff --git a/web/out/dist/css/actions/admin.css b/web/out/dist/css/actions/admin.css new file mode 100644 index 0000000..ea51ffe --- /dev/null +++ b/web/out/dist/css/actions/admin.css @@ -0,0 +1,199 @@ +table.admin +{ width: 100%; +} + +table.admin tr.hl td +{ padding: 3px; +} + +table.admin td.action +{ text-align: center; + width: 50px; +} + +ul.admin +{ list-style-type: none; + margin: 10px 10px 20px 10px; + text-align: right; + padding-bottom: 10px; +} + +ul.admin li +{ display: inline; +} + +ul.admin li a +{ padding: 3px 7px 3px 7px; +} + +ul li a.add +{ padding: 3px 7px 3px 18px; +} + +ul.admin li.admin_form_title +{ display: block; + float: left; + padding: 0px 7px 3px 7px; +} + +ul.form +{ clear: both; + list-style-type: none; +} + +ul.form li +{ clear: both; + padding: 5px; +} + +ul.form li label +{ float: left; + display: block; + width: 100px; + text-align: right; + padding: 0 15px 0 15px; +} + +ul.form li div p +{ float: left; + display: block; + width: 350px; + text-align: left; + padding: 0 0px 15px 0px; +} + +ul.form li p span +{ display: block; + padding: 5px; + font-size: 0.9em; +} + +ul.admin_form_head +{ clear: both; + list-style-type: none; + margin: 10px 0px 0px 0px; +} + +ul.admin_form_head li +{ clear: both; + padding: 5px; + text-align: right; + line-height: 20px; +} + +ul.admin_form_head li input +{ margin: 0px 10px 0px 10px; +} + +ul.admin_form_content +{ list-style-type: none; + margin: 0px 0px 0px 0px; + padding: 10px 0px 10px 0px; +} + +ul.admin_form_content ul.admin +{ list-style-type: none; + margin: 10px 10px 20px 10px; + text-align: right; + padding-bottom: 10px; +} + +ul.admin_form_content ul.admin li +{ display: inline; +} + +ul.admin_form_content ul.admin li a +{ padding: 3px 7px 3px 7px; +} + +ul.admin_form_content ul li a.add +{ padding: 3px 7px 3px 18px; +} + +ul.admin_form_content ul.admin li.admin_form_title +{ display: block; + float: left; + padding: 0px 7px 3px 7px; +} + +.admin_source_infos +{ margin: 0px 10px 10px 20px; +} + +.admin_source_infos ul.admin_source_head +{ list-style-type: none; + margin: 0px 0px 0px 0px; + text-align: right; + padding-bottom: 10px; + padding-top: 5px; +} + +ul.admin_source_head li +{ display: inline; +} + +ul.admin_source_head li a +{ padding: 3px 7px 3px 7px; +} + +ul.admin_source_head li.admin_form_title +{ display: block; + float: left; + padding: 0px 7px 3px 7px; + font-size: 1.2em; +} + +.admin_source_url +{ margin: 10px 0px 0px 20px; +} + +input[type=text], input[type=file], input[type=password], textarea, select +{ padding: 3px; +} + +input[type=submit], a.button +{ padding: 3px 7px 3px 7px; + cursor: pointer; +} + +ul.form li.buttons +{ text-align: center; +} + +.tinymce +{ width: 500px; + height: 400px; +} + +.document +{ margin: 5px; + padding: 5px; +} + +.document .delete +{ float: right; +} + +.document .clear +{ height: 5px; +} + +.xml_edit_content +{ display: block; + margin: 5px 10px 30px 0px; + text-align: right; +} + +.xml_edit_content textarea +{ width: 97%; +} + +ul.xml_infos +{ margin: 10px 10px 0px 20px; +} + +ul.xml_infos li +{ padding: 5px; + margin: 0px 0px 0px 20px; +} + diff --git a/web/out/dist/css/actions/admin_plugins.css b/web/out/dist/css/actions/admin_plugins.css new file mode 100644 index 0000000..e899c45 --- /dev/null +++ b/web/out/dist/css/actions/admin_plugins.css @@ -0,0 +1,32 @@ +ul.plugins +{ list-style-type: none; + margin: 20px 10px; +} + +ul.plugins li +{ padding: 5px 10px; + margin: 10px; +} + +ul.plugins p.folder +{ float: right; + font-size: 0.9em; +} + +ul.plugins li ul.plugin_links +{ text-align: right; +} + +ul.plugins li ul.plugin_links li +{ display: inline; + padding: 1px 7px; + margin: 0; +} + +ul.plugins li ul.plugin_links li input +{ width: 2em; +} + +ul.plugins li.buttons +{ text-align: right; +} \ No newline at end of file diff --git a/web/out/dist/css/actions/forms_contact.css b/web/out/dist/css/actions/forms_contact.css new file mode 100644 index 0000000..b59c801 --- /dev/null +++ b/web/out/dist/css/actions/forms_contact.css @@ -0,0 +1,32 @@ +@import url("admin.css"); + +#contact form +{ margin: 20px 0px 10px 0px; +} + +#contact form .ptitcaptcha img +{ float: left; + margin: 0px 10px 0px 0px; +} + +#contact ul.form li label +{ float: left; + display: block; + width: 50px; + text-align: right; + padding: 0 15px 0 15px; +} + +#contact ul.form li p +{ float: left; + display: block; + width: 380px; + text-align: left; + padding: 0 15px 5px 15px; +} + +#contact ul.form li p span +{ display: block; + padding: 5px; + font-size: 0.9em; +} \ No newline at end of file diff --git a/web/out/dist/css/actions/users.css b/web/out/dist/css/actions/users.css new file mode 100644 index 0000000..c7f8d13 --- /dev/null +++ b/web/out/dist/css/actions/users.css @@ -0,0 +1 @@ +@import url("admin.css"); diff --git a/web/out/dist/css/colorbox.css b/web/out/dist/css/colorbox.css new file mode 100644 index 0000000..c31b237 --- /dev/null +++ b/web/out/dist/css/colorbox.css @@ -0,0 +1,92 @@ +/* + ColorBox Core Style: + The following CSS is consistent between example themes and should not be altered. +*/ +#colorbox, #cboxOverlay, #cboxWrapper{position:absolute; top:0; left:0; z-index:9999; overflow:hidden;} +#cboxOverlay{position:fixed; width:100%; height:100%;} +#cboxMiddleLeft, #cboxBottomLeft{clear:left;} +#cboxContent{position:relative;} +#cboxLoadedContent{overflow:auto;} +#cboxTitle{margin:0;} +#cboxLoadingOverlay, #cboxLoadingGraphic{position:absolute; top:0; left:0; width:100%;} +#cboxPrevious, #cboxNext, #cboxClose, #cboxSlideshow{cursor:pointer;} +.cboxPhoto{float:left; margin:auto; border:0; display:block;} +.cboxIframe{width:100%; height:100%; display:block; border:0;} + +/* + User Style: + Change the following styles to modify the appearance of ColorBox. They are + ordered & tabbed in a way that represents the nesting of the generated HTML. +*/ +#cboxOverlay{background:url(../images/colorbox/overlay.png) repeat 0 0;} +#colorbox{} +/* + #cboxTopLeft{width:21px; height:21px; background:url(../images/colorbox/controls.png) no-repeat -100px 0;} + #cboxTopRight{width:21px; height:21px; background:url(../images/colorbox/controls.png) no-repeat -129px 0;} + #cboxBottomLeft{width:21px; height:21px; background:url(../images/colorbox/controls.png) no-repeat -100px -29px;} + #cboxBottomRight{width:21px; height:21px; background:url(../images/colorbox/controls.png) no-repeat -129px -29px;} + #cboxMiddleLeft{width:21px; background:url(../images/colorbox/controls.png) left top repeat-y;} + #cboxMiddleRight{width:21px; background:url(../images/colorbox/controls.png) right top repeat-y;} + #cboxTopCenter{height:21px; background:url(../images/colorbox/border.png) 0 0 repeat-x;} + #cboxBottomCenter{height:21px; background:url(../images/colorbox/border.png) 0 -29px repeat-x;} +*/ + #cboxTopLeft{width:21px; height:21px;} + #cboxTopRight{width:21px; height:21px;} + #cboxBottomLeft{width:21px; height:21px;} + #cboxBottomRight{width:21px; height:21px;} + #cboxMiddleLeft{width:21px;} + #cboxMiddleRight{width:21px;} + #cboxTopCenter{height:21px;} + #cboxBottomCenter{height:21px;} + #cboxContent{background:#ffffff; overflow:hidden; color: #555555; padding: 10px 10px 0px 10px; border-radius: 3px 3px 3px 3px; -moz-border-radius: 3px 3px 3px 3px;} + #cboxError{padding:50px; border:1px solid #ccc;} + #cboxLoadedContent{margin-bottom:28px;} + #cboxTitle{position:absolute; bottom:4px; left:0; text-align:center; width:100%; color:#949494;} + #cboxCurrent{position:absolute; bottom:4px; left:58px; color:#949494;} + #cboxSlideshow{position:absolute; bottom:4px; right:30px; color:#0092ef;} + #cboxPrevious{position:absolute; bottom:0; left:0; background:url(../images/colorbox/controls.png) no-repeat -75px 0; width:25px; height:25px; text-indent:-9999px;} + #cboxPrevious.hover{background-position:-75px -25px;} + #cboxNext{position:absolute; bottom:0; left:27px; background:url(../images/colorbox/controls.png) no-repeat -50px 0; width:25px; height:25px; text-indent:-9999px;} + #cboxNext.hover{background-position:-50px -25px;} + #cboxLoadingOverlay{} + #cboxLoadingGraphic{background:url(../images/colorbox/loading.gif) no-repeat center center;} + #cboxClose{position:absolute; bottom:0; right:0; background:url(../images/colorbox/controls.png) no-repeat -25px 0; width:25px; height:25px; text-indent:-9999px;} + #cboxClose.hover{background-position:-25px -25px;} + +/* + The following fixes a problem where IE7+ replaces a PNG's alpha transparency with a black fill + when an alpha filter (opacity change) is set on the element or ancestor element. +*/ +.cboxIE #cboxTopLeft, +.cboxIE #cboxTopCenter, +.cboxIE #cboxTopRight, +.cboxIE #cboxBottomLeft, +.cboxIE #cboxBottomCenter, +.cboxIE #cboxBottomRight, +.cboxIE #cboxMiddleLeft, +.cboxIE #cboxMiddleRight { + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr=#00FFFFFF,endColorstr=#00FFFFFF); +} + +/* + The following provides PNG transparency support for IE6 +*/ +.cboxIE6 #cboxTopLeft{background:url(../images/colorbox/ie6/borderTopLeft.png);} +.cboxIE6 #cboxTopCenter{background:url(../images/colorbox/ie6/borderTopCenter.png);} +.cboxIE6 #cboxTopRight{background:url(../images/colorbox/ie6/borderTopRight.png);} +.cboxIE6 #cboxBottomLeft{background:url(../images/colorbox/ie6/borderBottomLeft.png);} +.cboxIE6 #cboxBottomCenter{background:url(../images/colorbox/ie6/borderBottomCenter.png);} +.cboxIE6 #cboxBottomRight{background:url(../images/colorbox/ie6/borderBottomRight.png);} +.cboxIE6 #cboxMiddleLeft{background:url(../images/colorbox/ie6/borderMiddleLeft.png);} +.cboxIE6 #cboxMiddleRight{background:url(../images/colorbox/ie6/borderMiddleRight.png);} + +.cboxIE6 #cboxTopLeft, +.cboxIE6 #cboxTopCenter, +.cboxIE6 #cboxTopRight, +.cboxIE6 #cboxBottomLeft, +.cboxIE6 #cboxBottomCenter, +.cboxIE6 #cboxBottomRight, +.cboxIE6 #cboxMiddleLeft, +.cboxIE6 #cboxMiddleRight { + _behavior: expression(this.src = this.src ? this.src : this.currentStyle.backgroundImage.split('"')[1], this.style.background = "none", this.style.filter = "progid:DXImageTransform.Microsoft.AlphaImageLoader(src=" + this.src + ", sizingMethod='scale')"); +} diff --git a/web/out/dist/css/colors.css b/web/out/dist/css/colors.css new file mode 100644 index 0000000..9b50de8 --- /dev/null +++ b/web/out/dist/css/colors.css @@ -0,0 +1,324 @@ +body +{ background-color: #ffffff; + color: #333333; +} + +a +{ text-decoration: none; + color: #000066; +} + +a img +{ border: none; +} + +a:hover +{ color: #c0c0c0; +} + +.navig +{ color: #333333; + border: solid 1px #c0c0c0; + background-color: #ffffff; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +.loading +{ background-image: url("../icons/ajax-loader.gif"); + background-repeat: no-repeat; + background-position: 5px 5px; +} + +/* ------------------------- messages --------------- */ + +.messages +{ border: solid 1px #c0c0c0; +} + +.erreur +{ border: solid 1px #c0c0c0; +} + +.redirect_message div +{ border: solid 1px #c0c0c0; +} + +/* ------------------------- blocs generaux --------- */ + +#header +{ padding-top: 10px; +} + +#header .content +{ border-bottom: solid 1px #d9d9d9; +} + +#colonne +{ /*border-right: dashed 1px #555555; */ +} + +#footer .content +{ border-top: solid 1px #e9e9e9; +} + +#footer .content p +{ color: #777777; +} + +/* ----------------------------------- menu top ----- */ + +#menu_top ul.menu li a +{ border: solid 1px #e9e9e9; + background-color: #ffffff; +} + +#menu_top ul.menu li ul li a +{ border-top: none; + border-right: solid 1px #333333; + border-bottom: none; + border-left: solid 1px #333333; + background-color: #050505; +} + +#menu_top ul.menu li ul li.last a +{ border-top: none; + border-right: solid 1px #333333; + border-bottom: solid 1px #333333; + border-left: solid 1px #333333; + background-color: #050505; +} + +/* ----------------------------------- admin --------- */ + +table.admin tr.hl td +{ border: solid 1px #d1d1d1; +} + +table.admin tr.hl:hover +{ background-color: #f9f9f9; +} + +input[type=text], input[type=file], input[type=password], textarea, select +{ border: solid 1px #999999; + color: #333333; +} + +input[type=submit], a.button +{ border: solid 1px #d1d1d1; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +input[type=submit]:hover, a.button:hover +{ border: solid 1px #d1d1d1; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +ul.admin +{ border-bottom: dashed 1px #c0c0c0; +} + +ul.admin_form_head +{ border: solid 1px #c0c0c0; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +ul.admin_form_content ul.admin +{ border-bottom: none; +} + +ul.admin li a +{ border: solid 1px #d1d1d1; +} + +.admin_source_infos ul.admin li a +{ border: none; + background-color: #101010; + color: #c0c0c0; +} + +ul.admin li a.add +{ background-image: url("../icons/add.gif"); + background-repeat: no-repeat; + background-position: 3px 6px; + border: solid 1px #d1d1d1; +} + +ul.admin li a:hover +{ +} + +.admin_source_infos +{ border: solid 1px #c0c0c0; +/* background-color: #0a0a0a;*/ + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +.admin_source_infos ul.admin li a:hover +{ border: none; + background-color: #333333; + color: #c0c0c0; +} + +#documents .document +{ border: solid 1px #c0c0c0; +} + +/* ------------------------------- plugins ----------- */ + +ul.plugins li +{ border: solid 1px #c0c0c0; +} + +ul.plugins li.enabled +{ background-color: #ffffff; +} + +ul.plugins li.disabled +{ background-color: #f7f7f7; +} + +ul.plugins li.uninstalled +{ background-color: #e5e5e5; +} + +ul.plugins li ul.plugin_links li +{ border-top: none; + border-right: none; + border-bottom: none; + border-left: solid 1px #c0c0c0; +} + +ul.plugins li ul.plugin_links li input +{ border: solid 1px #c0c0c0; +} + +/* ------------------------------- liste groupes ----------- */ + +ul.groupes li h4 a +{ border: solid 1px #d9d9d9; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +/* ------------------------------- page album ----------- */ + +p#play_all a +{ border: solid 1px #c0c0c0; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; + background-image: url("../icons/ecouter.png"); + background-repeat: no-repeat; + background-position: 6px 6px; + background-color: #ffffff; +} + +/* ----------------------------------- sources --------- */ + +ul.albums li a +{ border: solid 1px #555555; +} + +.logo_groupe +{ /*border: solid 1px #e9e9e9;*/ + background-color: #ffffff; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +ul#lien_contact li a +{ border-bottom: solid 1px #d9d9d9; +} + +#colonne ul#album_links +{ /*border-bottom: solid 1px #333333;*/ +} + +#colonne ul#album_links li +{ +} + +#colonne ul.menu_albums li +{ border: solid 1px #d9d9d9; + background-color: #ffffff; +} + +#center ul.menu_albums li +{ border: solid 1px #d9d9d9; + float: left; +} + +.track +{ border: solid 1px #ffffff; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +.track h5 +{ background-color: #ffffff; + border-radius: 3px 3px 0px 0px; + -moz-border-radius: 3px 3px 0px 0px; +} + +.playing_track +{ border: solid 1px #dedede; + background-color: #ffffff; + border-radius: 3px 3px 3px 3px; + -moz-border-radius: 3px 3px 3px 3px; +} + +.player_progress +{ background-color: #ececec; +} + +.player_progress .loaded +{ background-color: #dedede; +} + +.player_progress .position +{ background-color: #999999; +} + +.player_controls a img +{ border: none; +} + +.source_arbo ul.menu_source +{ float: right; + margin: 0px 10px 1px 0px; +} + +.source_arbo ul.menu_source li +{ float: right; + padding: 1px; +} + +.source_arbo ul.menu_source li a +{ display: block; + text-align: center; + background-color: #151515; + border-radius: 3px 3px 0px 0px; + -moz-border-radius: 3px 3px 0px 0px; + padding: 2px 5px 2px 5px; +} + +.source_arbo ul.menu_source li a:hover +{ +} + +.source_arbo ul.menu_source li.icon a +{ border: none; + padding: 2px 2px 2px 2px; +} + +.pistes +{ border-left: none; +} + +.derivation +{ border-left: none; +} diff --git a/web/out/dist/css/footer.css b/web/out/dist/css/footer.css new file mode 100644 index 0000000..d9393d4 --- /dev/null +++ b/web/out/dist/css/footer.css @@ -0,0 +1,12 @@ +#footer .content +{ height: 100px; +} + +#footer .content p +{ text-align: right; +} + +#footer .content p#a_propos_links +{ text-align: left; + float: left; +} diff --git a/web/out/dist/css/general.css b/web/out/dist/css/general.css new file mode 100644 index 0000000..dd3602e --- /dev/null +++ b/web/out/dist/css/general.css @@ -0,0 +1,70 @@ +body +{ font: normal 12px Verdana, Helvetica, Arial, sans-serif; +} + +ul +{ margin: 5px 5px 5px 15px; +} + +h1 +{ margin: 5px +} + +h2 +{ margin: 5px +} + +h2 span +{ font-weight: normal; + font-size: 0.8em; +} + +h3 +{ margin: 5px +} + +p +{ margin: 5px + text-align: justify; +} + +.messages +{ margin: 10px; + padding: 10px; +} + +.erreur +{ margin: 50px 100px 50px 100px; + padding: 20px; +} + +.redirect_message div +{ margin: 50px 100px 50px 100px; + padding: 20px; +} + +ul.list +{ margin: 5px 10px 10px 15px; +} + +ul.list li +{ margin: 5px 5px 5px 15px; + padding: 5px; +} + +.navig +{ text-align: right; + padding: 3px; + margin: 10px; +} + +.loading +{ margin: 5px 0px 10px 15px; + padding: 0px; + height: 40px; + width: 40px; +} + +.loading span +{ display: none; +} diff --git a/web/out/dist/css/header.css b/web/out/dist/css/header.css new file mode 100644 index 0000000..04b1324 --- /dev/null +++ b/web/out/dist/css/header.css @@ -0,0 +1,11 @@ +#header h1 +{ padding-top: 5px; + padding: 5px 0px 0px 0px; + margin: 0px; +} + +#header h1 a +{ text-decoration: none; + display: block; + padding: 10px; +} diff --git a/web/out/dist/css/main.css b/web/out/dist/css/main.css new file mode 100644 index 0000000..32abddb --- /dev/null +++ b/web/out/dist/css/main.css @@ -0,0 +1,32 @@ +#main .content +{ padding: 10px 0px 10px 0px; + width: 800px; +} + +#colonne +{ float: left; + width: 240px; + padding: 0px 0px 50px 0px; +} + +#center +{ float: left; + width: 540px; + padding: 10px; +} + +#center.no_colonne +{ width: 800px; +} + +#colonne ul.menu +{ margin-left: 15px; +} + +#colonne ul.menu li +{ margin-left: 15px; +} + +#colonne ul.navig_menu +{ margin-top: 20px; +} diff --git a/web/out/dist/css/menu_top.css b/web/out/dist/css/menu_top.css new file mode 100644 index 0000000..f751fef --- /dev/null +++ b/web/out/dist/css/menu_top.css @@ -0,0 +1,31 @@ +#menu_top ul.menu +{ margin: 5px 0px 0px 0px; + float: right; + position: relative; +} + +#menu_top ul.menu li +{ list-style-type: none; + margin-left: 15px; + float: left; +} + +#menu_top ul.menu li a +{ display: block; + padding: 5px 10px 5px 10px; +} + +#menu_top ul.menu li ul +{ position: absolute; + margin: 0px 0px 0px -15px; + z-index: 1; + display: none; +} + +#menu_top ul.menu li ul li +{ float: none; +} + +#menu_top ul.menu li ul li a +{ padding: 5px 10px 5px 10px; +} diff --git a/web/out/dist/css/style.css b/web/out/dist/css/style.css new file mode 100644 index 0000000..0eed589 --- /dev/null +++ b/web/out/dist/css/style.css @@ -0,0 +1,34 @@ +@import url("general.css"); +@import url("header.css"); +@import url("menu_top.css"); +@import url("main.css"); +@import url("footer.css"); + +* +{ margin: 0; + padding: 0; +} + +html +{ height: 100%; +} + +body +{ text-align: center; + height: 100%; +} + +pre, div { text-align: left; } + +.content +{ margin-left: auto; + margin-right: auto; + width: 800px; +} + +.clear +{ clear: both; + font-size: 0px; + line-height: 0px; + height: 0px; +} diff --git a/web/out/dist/css/tinymce.css b/web/out/dist/css/tinymce.css new file mode 100644 index 0000000..e892ebe --- /dev/null +++ b/web/out/dist/css/tinymce.css @@ -0,0 +1,3 @@ +body, td, pre +{ +} \ No newline at end of file diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png b/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png new file mode 100644 index 0000000..29460f0 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png b/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png new file mode 100644 index 0000000..64ece57 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png b/web/out/dist/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png new file mode 100644 index 0000000..abdc010 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png b/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png new file mode 100644 index 0000000..9b383f4 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png b/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png new file mode 100644 index 0000000..a23baad Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png b/web/out/dist/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png new file mode 100644 index 0000000..42ccba2 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png b/web/out/dist/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png new file mode 100644 index 0000000..39d5824 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png b/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png new file mode 100644 index 0000000..f127367 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png b/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png new file mode 100644 index 0000000..359397a Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-icons_222222_256x240.png b/web/out/dist/css/ui-lightness/images/ui-icons_222222_256x240.png new file mode 100644 index 0000000..b273ff1 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-icons_222222_256x240.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-icons_228ef1_256x240.png b/web/out/dist/css/ui-lightness/images/ui-icons_228ef1_256x240.png new file mode 100644 index 0000000..a641a37 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-icons_228ef1_256x240.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-icons_ef8c08_256x240.png b/web/out/dist/css/ui-lightness/images/ui-icons_ef8c08_256x240.png new file mode 100644 index 0000000..85e63e9 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-icons_ef8c08_256x240.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-icons_ffd27a_256x240.png b/web/out/dist/css/ui-lightness/images/ui-icons_ffd27a_256x240.png new file mode 100644 index 0000000..e117eff Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-icons_ffd27a_256x240.png differ diff --git a/web/out/dist/css/ui-lightness/images/ui-icons_ffffff_256x240.png b/web/out/dist/css/ui-lightness/images/ui-icons_ffffff_256x240.png new file mode 100644 index 0000000..42f8f99 Binary files /dev/null and b/web/out/dist/css/ui-lightness/images/ui-icons_ffffff_256x240.png differ diff --git a/web/out/dist/css/ui-lightness/jquery-ui-1.8.12.custom.css b/web/out/dist/css/ui-lightness/jquery-ui-1.8.12.custom.css new file mode 100644 index 0000000..3f7bf90 --- /dev/null +++ b/web/out/dist/css/ui-lightness/jquery-ui-1.8.12.custom.css @@ -0,0 +1,578 @@ +/* + * jQuery UI CSS Framework 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; } +.ui-widget-content a { color: #333333; } +.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; } +.ui-widget-header a { color: #ffffff; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; } +.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); } +.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/* + * jQuery UI Resizable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; + /* http://bugs.jqueryui.com/ticket/7233 + - Resizable: resizable handles fail to work in IE if transparent and content overlaps + */ + background-image:url(data:); +} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.12 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Dialog 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Slider 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI Datepicker 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Progressbar 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/web/out/dist/functions.php b/web/out/dist/functions.php new file mode 100644 index 0000000..21ab7e9 --- /dev/null +++ b/web/out/dist/functions.php @@ -0,0 +1,80 @@ + $max) + { if(isset($legende)) + { $navig .= + $legende." ".($current + 1)." à " + .(($current + $max) > $total ? $total : $current + $max) + ." sur ".$total." - aller à la "; + } + $get_params = array(); + if(($q = strpos($base_url, "?")) !== false) + { $v_query = explode("&", substr($base_url, $q + 1)); + $base_url = substr($base_url, 0, $q); + foreach($v_query as $query) + { if($query) + { $v = explode("=", $query); + $get_params[$v[0]] = $v[1]; + } + } + } + if(isset($get_params[$start_param])) unset($get_params[$start_param]); + $base_url .= "?"; + foreach($get_params as $key => $value) $base_url .= $key."=".$value."&"; + $nb_pages = ceil($total / $max); + $navig .= + "page : " + ."\n"; + if($current >= $max) + { $navig .= + "«\n"; + } + if($current < $total - $max) + { $navig .= + "»\n"; + } + } + return $navig; + } + + function aff_date($date) + { if(preg_match("/([0-9]{2,4})-([0-9]{1,2})-([0-9]{1,2})/", $date, $regs)) + { $date = $regs[3]." ".mois($regs[2])." ".$regs[1]; + } + return $date; + } + + function mois($n) + { switch($n) + { case 1: $mois = "jan"; break; + case 2: $mois = "fev"; break; + case 3: $mois = "mars"; break; + case 4: $mois = "avr"; break; + case 5: $mois = "mai"; break; + case 6: $mois = "juin"; break; + case 7: $mois = "juil"; break; + case 8: $mois = "aout"; break; + case 9: $mois = "sept"; break; + case 10: $mois = "oct"; break; + case 11: $mois = "nov"; break; + case 12: $mois = "dec"; break; + default: $mois = $n; + } + return $mois; + } + +?> \ No newline at end of file diff --git a/web/out/dist/html_reponse.php b/web/out/dist/html_reponse.php new file mode 100644 index 0000000..80aa95a --- /dev/null +++ b/web/out/dist/html_reponse.php @@ -0,0 +1,32 @@ + + + + out_file("views/head.php"); ?> + + + + + +
+
+out_file("views/messages.php"); ?> +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> +
+
+ + + + + diff --git a/web/out/dist/html_simple_reponse.php b/web/out/dist/html_simple_reponse.php new file mode 100644 index 0000000..4a63648 --- /dev/null +++ b/web/out/dist/html_simple_reponse.php @@ -0,0 +1,13 @@ + + + + + + +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> + + \ No newline at end of file diff --git a/web/out/dist/icons/add.gif b/web/out/dist/icons/add.gif new file mode 100644 index 0000000..a853e08 Binary files /dev/null and b/web/out/dist/icons/add.gif differ diff --git a/web/out/dist/icons/ajax-loader.gif b/web/out/dist/icons/ajax-loader.gif new file mode 100644 index 0000000..09d621e Binary files /dev/null and b/web/out/dist/icons/ajax-loader.gif differ diff --git a/web/out/dist/icons/asc.gif b/web/out/dist/icons/asc.gif new file mode 100644 index 0000000..8ea0713 Binary files /dev/null and b/web/out/dist/icons/asc.gif differ diff --git a/web/out/dist/icons/del.gif b/web/out/dist/icons/del.gif new file mode 100644 index 0000000..6ec6096 Binary files /dev/null and b/web/out/dist/icons/del.gif differ diff --git a/web/out/dist/icons/desc.gif b/web/out/dist/icons/desc.gif new file mode 100644 index 0000000..bf7c2d4 Binary files /dev/null and b/web/out/dist/icons/desc.gif differ diff --git a/web/out/dist/icons/edit.gif b/web/out/dist/icons/edit.gif new file mode 100644 index 0000000..773e8b3 Binary files /dev/null and b/web/out/dist/icons/edit.gif differ diff --git a/web/out/dist/icons/list.gif b/web/out/dist/icons/list.gif new file mode 100644 index 0000000..82375ff Binary files /dev/null and b/web/out/dist/icons/list.gif differ diff --git a/web/out/dist/images/colorbox/border.png b/web/out/dist/images/colorbox/border.png new file mode 100644 index 0000000..f463a10 Binary files /dev/null and b/web/out/dist/images/colorbox/border.png differ diff --git a/web/out/dist/images/colorbox/controls.png b/web/out/dist/images/colorbox/controls.png new file mode 100644 index 0000000..051b4a6 Binary files /dev/null and b/web/out/dist/images/colorbox/controls.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderBottomCenter.png b/web/out/dist/images/colorbox/ie6/borderBottomCenter.png new file mode 100644 index 0000000..0d4475e Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderBottomCenter.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderBottomLeft.png b/web/out/dist/images/colorbox/ie6/borderBottomLeft.png new file mode 100644 index 0000000..2775eba Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderBottomLeft.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderBottomRight.png b/web/out/dist/images/colorbox/ie6/borderBottomRight.png new file mode 100644 index 0000000..f7f5137 Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderBottomRight.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderMiddleLeft.png b/web/out/dist/images/colorbox/ie6/borderMiddleLeft.png new file mode 100644 index 0000000..a2d63d1 Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderMiddleLeft.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderMiddleRight.png b/web/out/dist/images/colorbox/ie6/borderMiddleRight.png new file mode 100644 index 0000000..fd7c3e8 Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderMiddleRight.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderTopCenter.png b/web/out/dist/images/colorbox/ie6/borderTopCenter.png new file mode 100644 index 0000000..2937a9c Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderTopCenter.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderTopLeft.png b/web/out/dist/images/colorbox/ie6/borderTopLeft.png new file mode 100644 index 0000000..f9d458b Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderTopLeft.png differ diff --git a/web/out/dist/images/colorbox/ie6/borderTopRight.png b/web/out/dist/images/colorbox/ie6/borderTopRight.png new file mode 100644 index 0000000..74b8583 Binary files /dev/null and b/web/out/dist/images/colorbox/ie6/borderTopRight.png differ diff --git a/web/out/dist/images/colorbox/loading.gif b/web/out/dist/images/colorbox/loading.gif new file mode 100644 index 0000000..09d621e Binary files /dev/null and b/web/out/dist/images/colorbox/loading.gif differ diff --git a/web/out/dist/images/colorbox/loading_background.png b/web/out/dist/images/colorbox/loading_background.png new file mode 100644 index 0000000..6ae83e6 Binary files /dev/null and b/web/out/dist/images/colorbox/loading_background.png differ diff --git a/web/out/dist/images/colorbox/overlay.png b/web/out/dist/images/colorbox/overlay.png new file mode 100644 index 0000000..ddf9e09 Binary files /dev/null and b/web/out/dist/images/colorbox/overlay.png differ diff --git a/web/out/dist/index.php b/web/out/dist/index.php new file mode 100644 index 0000000..2ddd92e --- /dev/null +++ b/web/out/dist/index.php @@ -0,0 +1,53 @@ + + + + out_file("views/head.php"); ?> + + + + + + + +
+ +
+
+ +out_config("colonne")) : ?> +
+out_file("views/index/colonne.php"); ?> +
+ + +
out_config("colonne") ? "" : " class=\"no_colonne\"" ?>> +out_file("views/messages.php"); ?> +out_file_exists($layout["content"])) require $this->out_file($layout["content"]); + +?> + +
+ +
+ +
+
+ + + + + diff --git a/web/out/dist/js/actions/admin.js b/web/out/dist/js/actions/admin.js new file mode 100644 index 0000000..a0287e1 --- /dev/null +++ b/web/out/dist/js/actions/admin.js @@ -0,0 +1,14 @@ +$(document).ready +( function() + { init_contact_form_ckeckbox(); + } +); + +function init_contact_form_ckeckbox() +{ $("#contact_form").click + ( function() + { if($(this).get(0).checked) $("#email_li").slideDown(200); + else $("#email_li").slideUp(200); + } + ); +} diff --git a/web/out/dist/js/actions/users.js b/web/out/dist/js/actions/users.js new file mode 100644 index 0000000..0039302 --- /dev/null +++ b/web/out/dist/js/actions/users.js @@ -0,0 +1,14 @@ +$(document).ready +( function() + { init_tinymce(); + } +); + +function init_tinymce() +{ $(".tinymce").each + ( function() + { tinyMCE.execCommand("mceAddControl", true, $(this).attr("id")); + } + ); +} + diff --git a/web/out/dist/js/jquery-1.5.2.min.js b/web/out/dist/js/jquery-1.5.2.min.js new file mode 100644 index 0000000..f78f96a --- /dev/null +++ b/web/out/dist/js/jquery-1.5.2.min.js @@ -0,0 +1,16 @@ +/*! + * jQuery JavaScript Library v1.5.2 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Mar 31 15:28:23 2011 -0400 + */ +(function(a,b){function ci(a){return d.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cf(a){if(!b_[a]){var b=d("<"+a+">").appendTo("body"),c=b.css("display");b.remove();if(c==="none"||c==="")c="block";b_[a]=c}return b_[a]}function ce(a,b){var c={};d.each(cd.concat.apply([],cd.slice(0,b)),function(){c[this]=a});return c}function b$(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function bZ(){try{return new a.XMLHttpRequest}catch(b){}}function bY(){d(a).unload(function(){for(var a in bW)bW[a](0,1)})}function bS(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var e=a.dataTypes,f={},g,h,i=e.length,j,k=e[0],l,m,n,o,p;for(g=1;g=0===c})}function P(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function H(a,b){return(a&&a!=="*"?a+".":"")+b.replace(t,"`").replace(u,"&")}function G(a){var b,c,e,f,g,h,i,j,k,l,m,n,o,p=[],q=[],s=d._data(this,"events");if(a.liveFired!==this&&s&&s.live&&!a.target.disabled&&(!a.button||a.type!=="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var t=s.live.slice(0);for(i=0;ic)break;a.currentTarget=f.elem,a.data=f.handleObj.data,a.handleObj=f.handleObj,o=f.handleObj.origHandler.apply(f.elem,arguments);if(o===!1||a.isPropagationStopped()){c=f.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function E(a,c,e){var f=d.extend({},e[0]);f.type=a,f.originalEvent={},f.liveFired=b,d.event.handle.call(c,f),f.isDefaultPrevented()&&e[0].preventDefault()}function y(){return!0}function x(){return!1}function i(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function h(a,c,e){if(e===b&&a.nodeType===1){e=a.getAttribute("data-"+c);if(typeof e==="string"){try{e=e==="true"?!0:e==="false"?!1:e==="null"?null:d.isNaN(e)?g.test(e)?d.parseJSON(e):e:parseFloat(e)}catch(f){}d.data(a,c,e)}else e=b}return e}var c=a.document,d=function(){function G(){if(!d.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(G,1);return}d.ready()}}var d=function(a,b){return new d.fn.init(a,b,g)},e=a.jQuery,f=a.$,g,h=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/,i=/\S/,j=/^\s+/,k=/\s+$/,l=/\d/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=navigator.userAgent,w,x,y,z=Object.prototype.toString,A=Object.prototype.hasOwnProperty,B=Array.prototype.push,C=Array.prototype.slice,D=String.prototype.trim,E=Array.prototype.indexOf,F={};d.fn=d.prototype={constructor:d,init:function(a,e,f){var g,i,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!e&&c.body){this.context=c,this[0]=c.body,this.selector="body",this.length=1;return this}if(typeof a==="string"){g=h.exec(a);if(!g||!g[1]&&e)return!e||e.jquery?(e||f).find(a):this.constructor(e).find(a);if(g[1]){e=e instanceof d?e[0]:e,k=e?e.ownerDocument||e:c,j=m.exec(a),j?d.isPlainObject(e)?(a=[c.createElement(j[1])],d.fn.attr.call(a,e,!0)):a=[k.createElement(j[1])]:(j=d.buildFragment([g[1]],[k]),a=(j.cacheable?d.clone(j.fragment):j.fragment).childNodes);return d.merge(this,a)}i=c.getElementById(g[2]);if(i&&i.parentNode){if(i.id!==g[2])return f.find(a);this.length=1,this[0]=i}this.context=c,this.selector=a;return this}if(d.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return d.makeArray(a,this)},selector:"",jquery:"1.5.2",length:0,size:function(){return this.length},toArray:function(){return C.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var e=this.constructor();d.isArray(a)?B.apply(e,a):d.merge(e,a),e.prevObject=this,e.context=this.context,b==="find"?e.selector=this.selector+(this.selector?" ":"")+c:b&&(e.selector=this.selector+"."+b+"("+c+")");return e},each:function(a,b){return d.each(this,a,b)},ready:function(a){d.bindReady(),x.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(C.apply(this,arguments),"slice",C.call(arguments).join(","))},map:function(a){return this.pushStack(d.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:B,sort:[].sort,splice:[].splice},d.fn.init.prototype=d.fn,d.extend=d.fn.extend=function(){var a,c,e,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i==="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!=="object"&&!d.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j0)return;x.resolveWith(c,[d]),d.fn.trigger&&d(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!x){x=d._Deferred();if(c.readyState==="complete")return setTimeout(d.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",y,!1),a.addEventListener("load",d.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",y),a.attachEvent("onload",d.ready);var b=!1;try{b=a.frameElement==null}catch(e){}c.documentElement.doScroll&&b&&G()}}},isFunction:function(a){return d.type(a)==="function"},isArray:Array.isArray||function(a){return d.type(a)==="array"},isWindow:function(a){return a&&typeof a==="object"&&"setInterval"in a},isNaN:function(a){return a==null||!l.test(a)||isNaN(a)},type:function(a){return a==null?String(a):F[z.call(a)]||"object"},isPlainObject:function(a){if(!a||d.type(a)!=="object"||a.nodeType||d.isWindow(a))return!1;if(a.constructor&&!A.call(a,"constructor")&&!A.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a){}return c===b||A.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!=="string"||!b)return null;b=d.trim(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return a.JSON&&a.JSON.parse?a.JSON.parse(b):(new Function("return "+b))();d.error("Invalid JSON: "+b)},parseXML:function(b,c,e){a.DOMParser?(e=new DOMParser,c=e.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),e=c.documentElement,(!e||!e.nodeName||e.nodeName==="parsererror")&&d.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(a){if(a&&i.test(a)){var b=c.head||c.getElementsByTagName("head")[0]||c.documentElement,e=c.createElement("script");d.support.scriptEval()?e.appendChild(c.createTextNode(a)):e.text=a,b.insertBefore(e,b.firstChild),b.removeChild(e)}},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,e){var f,g=0,h=a.length,i=h===b||d.isFunction(a);if(e){if(i){for(f in a)if(c.apply(a[f],e)===!1)break}else for(;g1?f.call(arguments,0):c,--g||h.resolveWith(h,f.call(b,0))}}var b=arguments,c=0,e=b.length,g=e,h=e<=1&&a&&d.isFunction(a.promise)?a:d.Deferred();if(e>1){for(;c
a";var e=b.getElementsByTagName("*"),f=b.getElementsByTagName("a")[0],g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=b.getElementsByTagName("input")[0];if(e&&e.length&&f){d.support={leadingWhitespace:b.firstChild.nodeType===3,tbody:!b.getElementsByTagName("tbody").length,htmlSerialize:!!b.getElementsByTagName("link").length,style:/red/.test(f.getAttribute("style")),hrefNormalized:f.getAttribute("href")==="/a",opacity:/^0.55$/.test(f.style.opacity),cssFloat:!!f.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,deleteExpando:!0,optDisabled:!1,checkClone:!1,noCloneEvent:!0,noCloneChecked:!0,boxModel:null,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableHiddenOffsets:!0,reliableMarginRight:!0},i.checked=!0,d.support.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,d.support.optDisabled=!h.disabled;var j=null;d.support.scriptEval=function(){if(j===null){var b=c.documentElement,e=c.createElement("script"),f="script"+d.now();try{e.appendChild(c.createTextNode("window."+f+"=1;"))}catch(g){}b.insertBefore(e,b.firstChild),a[f]?(j=!0,delete a[f]):j=!1,b.removeChild(e)}return j};try{delete b.test}catch(k){d.support.deleteExpando=!1}!b.addEventListener&&b.attachEvent&&b.fireEvent&&(b.attachEvent("onclick",function l(){d.support.noCloneEvent=!1,b.detachEvent("onclick",l)}),b.cloneNode(!0).fireEvent("onclick")),b=c.createElement("div"),b.innerHTML="";var m=c.createDocumentFragment();m.appendChild(b.firstChild),d.support.checkClone=m.cloneNode(!0).cloneNode(!0).lastChild.checked,d(function(){var a=c.createElement("div"),b=c.getElementsByTagName("body")[0];if(b){a.style.width=a.style.paddingLeft="1px",b.appendChild(a),d.boxModel=d.support.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,d.support.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="
",d.support.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="
t
";var e=a.getElementsByTagName("td");d.support.reliableHiddenOffsets=e[0].offsetHeight===0,e[0].style.display="",e[1].style.display="none",d.support.reliableHiddenOffsets=d.support.reliableHiddenOffsets&&e[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(a.style.width="1px",a.style.marginRight="0",d.support.reliableMarginRight=(parseInt(c.defaultView.getComputedStyle(a,null).marginRight,10)||0)===0),b.removeChild(a).style.display="none",a=e=null}});var n=function(a){var b=c.createElement("div");a="on"+a;if(!b.attachEvent)return!0;var d=a in b;d||(b.setAttribute(a,"return;"),d=typeof b[a]==="function");return d};d.support.submitBubbles=n("submit"),d.support.changeBubbles=n("change"),b=e=f=null}}();var g=/^(?:\{.*\}|\[.*\])$/;d.extend({cache:{},uuid:0,expando:"jQuery"+(d.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?d.cache[a[d.expando]]:a[d.expando];return!!a&&!i(a)},data:function(a,c,e,f){if(d.acceptData(a)){var g=d.expando,h=typeof c==="string",i,j=a.nodeType,k=j?d.cache:a,l=j?a[d.expando]:a[d.expando]&&d.expando;if((!l||f&&l&&!k[l][g])&&h&&e===b)return;l||(j?a[d.expando]=l=++d.uuid:l=d.expando),k[l]||(k[l]={},j||(k[l].toJSON=d.noop));if(typeof c==="object"||typeof c==="function")f?k[l][g]=d.extend(k[l][g],c):k[l]=d.extend(k[l],c);i=k[l],f&&(i[g]||(i[g]={}),i=i[g]),e!==b&&(i[c]=e);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[c]:i}},removeData:function(b,c,e){if(d.acceptData(b)){var f=d.expando,g=b.nodeType,h=g?d.cache:b,j=g?b[d.expando]:d.expando;if(!h[j])return;if(c){var k=e?h[j][f]:h[j];if(k){delete k[c];if(!i(k))return}}if(e){delete h[j][f];if(!i(h[j]))return}var l=h[j][f];d.support.deleteExpando||h!=a?delete h[j]:h[j]=null,l?(h[j]={},g||(h[j].toJSON=d.noop),h[j][f]=l):g&&(d.support.deleteExpando?delete b[d.expando]:b.removeAttribute?b.removeAttribute(d.expando):b[d.expando]=null)}},_data:function(a,b,c){return d.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=d.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),d.fn.extend({data:function(a,c){var e=null;if(typeof a==="undefined"){if(this.length){e=d.data(this[0]);if(this[0].nodeType===1){var f=this[0].attributes,g;for(var i=0,j=f.length;i-1)return!0;return!1},val:function(a){if(!arguments.length){var c=this[0];if(c){if(d.nodeName(c,"option")){var e=c.attributes.value;return!e||e.specified?c.value:c.text}if(d.nodeName(c,"select")){var f=c.selectedIndex,g=[],h=c.options,i=c.type==="select-one";if(f<0)return null;for(var j=i?f:0,k=i?f+1:h.length;j=0;else if(d.nodeName(this,"select")){var f=d.makeArray(e);d("option",this).each(function(){this.selected=d.inArray(d(this).val(),f)>=0}),f.length||(this.selectedIndex=-1)}else this.value=e}})}}),d.extend({attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,e,f){if(!a||a.nodeType===3||a.nodeType===8||a.nodeType===2)return b;if(f&&c in d.attrFn)return d(a)[c](e);var g=a.nodeType!==1||!d.isXMLDoc(a),h=e!==b;c=g&&d.props[c]||c;if(a.nodeType===1){var i=m.test(c);if(c==="selected"&&!d.support.optSelected){var j=a.parentNode;j&&(j.selectedIndex,j.parentNode&&j.parentNode.selectedIndex)}if((c in a||a[c]!==b)&&g&&!i){h&&(c==="type"&&n.test(a.nodeName)&&a.parentNode&&d.error("type property can't be changed"),e===null?a.nodeType===1&&a.removeAttribute(c):a[c]=e);if(d.nodeName(a,"form")&&a.getAttributeNode(c))return a.getAttributeNode(c).nodeValue;if(c==="tabIndex"){var k=a.getAttributeNode("tabIndex");return k&&k.specified?k.value:o.test(a.nodeName)||p.test(a.nodeName)&&a.href?0:b}return a[c]}if(!d.support.style&&g&&c==="style"){h&&(a.style.cssText=""+e);return a.style.cssText}h&&a.setAttribute(c,""+e);if(!a.attributes[c]&&(a.hasAttribute&&!a.hasAttribute(c)))return b;var l=!d.support.hrefNormalized&&g&&i?a.getAttribute(c,2):a.getAttribute(c);return l===null?b:l}h&&(a[c]=e);return a[c]}});var r=/\.(.*)$/,s=/^(?:textarea|input|select)$/i,t=/\./g,u=/ /g,v=/[^\w\s.|`]/g,w=function(a){return a.replace(v,"\\$&")};d.event={add:function(c,e,f,g){if(c.nodeType!==3&&c.nodeType!==8){try{d.isWindow(c)&&(c!==a&&!c.frameElement)&&(c=a)}catch(h){}if(f===!1)f=x;else if(!f)return;var i,j;f.handler&&(i=f,f=i.handler),f.guid||(f.guid=d.guid++);var k=d._data(c);if(!k)return;var l=k.events,m=k.handle;l||(k.events=l={}),m||(k.handle=m=function(a){return typeof d!=="undefined"&&d.event.triggered!==a.type?d.event.handle.apply(m.elem,arguments):b}),m.elem=c,e=e.split(" ");var n,o=0,p;while(n=e[o++]){j=i?d.extend({},i):{handler:f,data:g},n.indexOf(".")>-1?(p=n.split("."),n=p.shift(),j.namespace=p.slice(0).sort().join(".")):(p=[],j.namespace=""),j.type=n,j.guid||(j.guid=f.guid);var q=l[n],r=d.event.special[n]||{};if(!q){q=l[n]=[];if(!r.setup||r.setup.call(c,g,p,m)===!1)c.addEventListener?c.addEventListener(n,m,!1):c.attachEvent&&c.attachEvent("on"+n,m)}r.add&&(r.add.call(c,j),j.handler.guid||(j.handler.guid=f.guid)),q.push(j),d.event.global[n]=!0}c=null}},global:{},remove:function(a,c,e,f){if(a.nodeType!==3&&a.nodeType!==8){e===!1&&(e=x);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=d.hasData(a)&&d._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(e=c.handler,c=c.type);if(!c||typeof c==="string"&&c.charAt(0)==="."){c=c||"";for(h in t)d.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+d.map(m.slice(0).sort(),w).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!e){for(j=0;j=0&&(a.type=f=f.slice(0,-1),a.exclusive=!0),e||(a.stopPropagation(),d.event.global[f]&&d.each(d.cache,function(){var b=d.expando,e=this[b];e&&e.events&&e.events[f]&&d.event.trigger(a,c,e.handle.elem)}));if(!e||e.nodeType===3||e.nodeType===8)return b;a.result=b,a.target=e,c=d.makeArray(c),c.unshift(a)}a.currentTarget=e;var h=d._data(e,"handle");h&&h.apply(e,c);var i=e.parentNode||e.ownerDocument;try{e&&e.nodeName&&d.noData[e.nodeName.toLowerCase()]||e["on"+f]&&e["on"+f].apply(e,c)===!1&&(a.result=!1,a.preventDefault())}catch(j){}if(!a.isPropagationStopped()&&i)d.event.trigger(a,c,i,!0);else if(!a.isDefaultPrevented()){var k,l=a.target,m=f.replace(r,""),n=d.nodeName(l,"a")&&m==="click",o=d.event.special[m]||{};if((!o._default||o._default.call(e,a)===!1)&&!n&&!(l&&l.nodeName&&d.noData[l.nodeName.toLowerCase()])){try{l[m]&&(k=l["on"+m],k&&(l["on"+m]=null),d.event.triggered=a.type,l[m]())}catch(p){}k&&(l["on"+m]=k),d.event.triggered=b}}},handle:function(c){var e,f,g,h,i,j=[],k=d.makeArray(arguments);c=k[0]=d.event.fix(c||a.event),c.currentTarget=this,e=c.type.indexOf(".")<0&&!c.exclusive,e||(g=c.type.split("."),c.type=g.shift(),j=g.slice(0).sort(),h=new RegExp("(^|\\.)"+j.join("\\.(?:.*\\.)?")+"(\\.|$)")),c.namespace=c.namespace||j.join("."),i=d._data(this,"events"),f=(i||{})[c.type];if(i&&f){f=f.slice(0);for(var l=0,m=f.length;l-1?d.map(a.options,function(a){return a.selected}).join("-"):"":a.nodeName.toLowerCase()==="select"&&(c=a.selectedIndex);return c},D=function D(a){var c=a.target,e,f;if(s.test(c.nodeName)&&!c.readOnly){e=d._data(c,"_change_data"),f=C(c),(a.type!=="focusout"||c.type!=="radio")&&d._data(c,"_change_data",f);if(e===b||f===e)return;if(e!=null||f)a.type="change",a.liveFired=b,d.event.trigger(a,arguments[1],c)}};d.event.special.change={filters:{focusout:D,beforedeactivate:D,click:function(a){var b=a.target,c=b.type;(c==="radio"||c==="checkbox"||b.nodeName.toLowerCase()==="select")&&D.call(this,a)},keydown:function(a){var b=a.target,c=b.type;(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&D.call(this,a)},beforeactivate:function(a){var b=a.target;d._data(b,"_change_data",C(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in B)d.event.add(this,c+".specialChange",B[c]);return s.test(this.nodeName)},teardown:function(a){d.event.remove(this,".specialChange");return s.test(this.nodeName)}},B=d.event.special.change.filters,B.focus=B.beforeactivate}c.addEventListener&&d.each({focus:"focusin",blur:"focusout"},function(a,b){function f(a){var c=d.event.fix(a);c.type=b,c.originalEvent={},d.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var e=0;d.event.special[b]={setup:function(){e++===0&&c.addEventListener(a,f,!0)},teardown:function(){--e===0&&c.removeEventListener(a,f,!0)}}}),d.each(["bind","one"],function(a,c){d.fn[c]=function(a,e,f){if(typeof a==="object"){for(var g in a)this[c](g,e,a[g],f);return this}if(d.isFunction(e)||e===!1)f=e,e=b;var h=c==="one"?d.proxy(f,function(a){d(this).unbind(a,h);return f.apply(this,arguments)}):f;if(a==="unload"&&c!=="one")this.one(a,e,f);else for(var i=0,j=this.length;i0?this.bind(b,a,c):this.trigger(b)},d.attrFn&&(d.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,e=0,f=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,e,g){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!=="string")return e;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(f.call(n)==="[object Array]")if(u)if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&e.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&e.push(j[t]);else e.push.apply(e,n);else p(n,e);o&&(k(o,h,e,g),k.uniqueSort(e));return e};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e":function(a,b){var c,d=typeof b==="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return"text"===c&&(b===c||b===null)},radio:function(a){return"radio"===a.type},checkbox:function(a){return"checkbox"===a.type},file:function(a){return"file"===a.type},password:function(a){return"password"===a.type},submit:function(a){return"submit"===a.type},image:function(a){return"image"===a.type},reset:function(a){return"reset"===a.type},button:function(a){return"button"===a.type||a.nodeName.toLowerCase()==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return bc[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(f.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length==="number")for(var e=a.length;c",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!=="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!=="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!=="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!=="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="

";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="
";if(a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!=="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g0)for(var g=c;g0},closest:function(a,b){var c=[],e,f,g=this[0];if(d.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(e=0,f=a.length;e-1:d(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=N.test(a)?d(a,b||this.context):null;for(e=0,f=this.length;e-1:d.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b)break}}c=c.length>1?d.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a==="string")return d.inArray(this[0],a?d(a):this.parent().children());return d.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a==="string"?d(a,b):d.makeArray(a),e=d.merge(this.get(),c);return this.pushStack(P(c[0])||P(e[0])?e:d.unique(e))},andSelf:function(){return this.add(this.prevObject)}}),d.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return d.dir(a,"parentNode")},parentsUntil:function(a,b,c){return d.dir(a,"parentNode",c)},next:function(a){return d.nth(a,2,"nextSibling")},prev:function(a){return d.nth(a,2,"previousSibling")},nextAll:function(a){return d.dir(a,"nextSibling")},prevAll:function(a){return d.dir(a,"previousSibling")},nextUntil:function(a,b,c){return d.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return d.dir(a,"previousSibling",c)},siblings:function(a){return d.sibling(a.parentNode.firstChild,a)},children:function(a){return d.sibling(a.firstChild)},contents:function(a){return d.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:d.makeArray(a.childNodes)}},function(a,b){d.fn[a]=function(c,e){var f=d.map(this,b,c),g=M.call(arguments);I.test(a)||(e=c),e&&typeof e==="string"&&(f=d.filter(e,f)),f=this.length>1&&!O[a]?d.unique(f):f,(this.length>1||K.test(e))&&J.test(a)&&(f=f.reverse());return this.pushStack(f,a,g.join(","))}}),d.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?d.find.matchesSelector(b[0],a)?[b[0]]:[]:d.find.matches(a,b)},dir:function(a,c,e){var f=[],g=a[c];while(g&&g.nodeType!==9&&(e===b||g.nodeType!==1||!d(g).is(e)))g.nodeType===1&&f.push(g),g=g[c];return f},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var R=/ jQuery\d+="(?:\d+|null)"/g,S=/^\s+/,T=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,U=/<([\w:]+)/,V=/",""],legend:[1,"
","
"],thead:[1,"","
"],tr:[2,"","
"],td:[3,"","
"],col:[2,"","
"],area:[1,"",""],_default:[0,"",""]};Z.optgroup=Z.option,Z.tbody=Z.tfoot=Z.colgroup=Z.caption=Z.thead,Z.th=Z.td,d.support.htmlSerialize||(Z._default=[1,"div
","
"]),d.fn.extend({text:function(a){if(d.isFunction(a))return this.each(function(b){var c=d(this);c.text(a.call(this,b,c.text()))});if(typeof a!=="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return d.text(this)},wrapAll:function(a){if(d.isFunction(a))return this.each(function(b){d(this).wrapAll(a.call(this,b))});if(this[0]){var b=d(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(d.isFunction(a))return this.each(function(b){d(this).wrapInner(a.call(this,b))});return this.each(function(){var b=d(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){d(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){d.nodeName(this,"body")||d(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=d(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,d(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,e;(e=this[c])!=null;c++)if(!a||d.filter(a,[e]).length)!b&&e.nodeType===1&&(d.cleanData(e.getElementsByTagName("*")),d.cleanData([e])),e.parentNode&&e.parentNode.removeChild(e);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&d.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return d.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(R,""):null;if(typeof a!=="string"||X.test(a)||!d.support.leadingWhitespace&&S.test(a)||Z[(U.exec(a)||["",""])[1].toLowerCase()])d.isFunction(a)?this.each(function(b){var c=d(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);else{a=a.replace(T,"<$1>");try{for(var c=0,e=this.length;c1&&l0?this.clone(!0):this).get();d(f[h])[b](j),e=e.concat(j)}return this.pushStack(e,a,f.selector)}}),d.extend({clone:function(a,b,c){var e=a.cloneNode(!0),f,g,h;if((!d.support.noCloneEvent||!d.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!d.isXMLDoc(a)){ba(a,e),f=bb(a),g=bb(e);for(h=0;f[h];++h)ba(f[h],g[h])}if(b){_(a,e);if(c){f=bb(a),g=bb(e);for(h=0;f[h];++h)_(f[h],g[h])}}return e},clean:function(a,b,e,f){b=b||c,typeof b.createElement==="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var g=[];for(var h=0,i;(i=a[h])!=null;h++){typeof i==="number"&&(i+="");if(!i)continue;if(typeof i!=="string"||W.test(i)){if(typeof i==="string"){i=i.replace(T,"<$1>");var j=(U.exec(i)||["",""])[1].toLowerCase(),k=Z[j]||Z._default,l=k[0],m=b.createElement("div");m.innerHTML=k[1]+i+k[2];while(l--)m=m.lastChild;if(!d.support.tbody){var n=V.test(i),o=j==="table"&&!n?m.firstChild&&m.firstChild.childNodes:k[1]===""&&!n?m.childNodes:[];for(var p=o.length-1;p>=0;--p)d.nodeName(o[p],"tbody")&&!o[p].childNodes.length&&o[p].parentNode.removeChild(o[p])}!d.support.leadingWhitespace&&S.test(i)&&m.insertBefore(b.createTextNode(S.exec(i)[0]),m.firstChild),i=m.childNodes}}else i=b.createTextNode(i);i.nodeType?g.push(i):g=d.merge(g,i)}if(e)for(h=0;g[h];h++)!f||!d.nodeName(g[h],"script")||g[h].type&&g[h].type.toLowerCase()!=="text/javascript"?(g[h].nodeType===1&&g.splice.apply(g,[h+1,0].concat(d.makeArray(g[h].getElementsByTagName("script")))),e.appendChild(g[h])):f.push(g[h].parentNode?g[h].parentNode.removeChild(g[h]):g[h]);return g},cleanData:function(a){var b,c,e=d.cache,f=d.expando,g=d.event.special,h=d.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&d.noData[j.nodeName.toLowerCase()])continue;c=j[d.expando];if(c){b=e[c]&&e[c][f];if(b&&b.events){for(var k in b.events)g[k]?d.event.remove(j,k):d.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[d.expando]:j.removeAttribute&&j.removeAttribute(d.expando),delete e[c]}}}});var bd=/alpha\([^)]*\)/i,be=/opacity=([^)]*)/,bf=/-([a-z])/ig,bg=/([A-Z]|^ms)/g,bh=/^-?\d+(?:px)?$/i,bi=/^-?\d/,bj={position:"absolute",visibility:"hidden",display:"block"},bk=["Left","Right"],bl=["Top","Bottom"],bm,bn,bo,bp=function(a,b){return b.toUpperCase()};d.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return d.access(this,a,c,!0,function(a,c,e){return e!==b?d.style(a,c,e):d.css(a,c)})},d.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bm(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{zIndex:!0,fontWeight:!0,opacity:!0,zoom:!0,lineHeight:!0},cssProps:{"float":d.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,e,f){if(a&&a.nodeType!==3&&a.nodeType!==8&&a.style){var g,h=d.camelCase(c),i=a.style,j=d.cssHooks[h];c=d.cssProps[h]||h;if(e===b){if(j&&"get"in j&&(g=j.get(a,!1,f))!==b)return g;return i[c]}if(typeof e==="number"&&isNaN(e)||e==null)return;typeof e==="number"&&!d.cssNumber[h]&&(e+="px");if(!j||!("set"in j)||(e=j.set(a,e))!==b)try{i[c]=e}catch(k){}}},css:function(a,c,e){var f,g=d.camelCase(c),h=d.cssHooks[g];c=d.cssProps[g]||g;if(h&&"get"in h&&(f=h.get(a,!0,e))!==b)return f;if(bm)return bm(a,c,g)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]},camelCase:function(a){return a.replace(bf,bp)}}),d.curCSS=d.css,d.each(["height","width"],function(a,b){d.cssHooks[b]={get:function(a,c,e){var f;if(c){a.offsetWidth!==0?f=bq(a,b,e):d.swap(a,bj,function(){f=bq(a,b,e)});if(f<=0){f=bm(a,b,b),f==="0px"&&bo&&(f=bo(a,b,b));if(f!=null)return f===""||f==="auto"?"0px":f}if(f<0||f==null){f=a.style[b];return f===""||f==="auto"?"0px":f}return typeof f==="string"?f:f+"px"}},set:function(a,b){if(!bh.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),d.support.opacity||(d.cssHooks.opacity={get:function(a,b){return be.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style;c.zoom=1;var e=d.isNaN(b)?"":"alpha(opacity="+b*100+")",f=c.filter||"";c.filter=bd.test(f)?f.replace(bd,e):c.filter+" "+e}}),d(function(){d.support.reliableMarginRight||(d.cssHooks.marginRight={get:function(a,b){var c;d.swap(a,{display:"inline-block"},function(){b?c=bm(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bn=function(a,c,e){var f,g,h;e=e.replace(bg,"-$1").toLowerCase();if(!(g=a.ownerDocument.defaultView))return b;if(h=g.getComputedStyle(a,null))f=h.getPropertyValue(e),f===""&&!d.contains(a.ownerDocument.documentElement,a)&&(f=d.style(a,e));return f}),c.documentElement.currentStyle&&(bo=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bh.test(d)&&bi.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bm=bn||bo,d.expr&&d.expr.filters&&(d.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!d.support.reliableHiddenOffsets&&(a.style.display||d.css(a,"display"))==="none"},d.expr.filters.visible=function(a){return!d.expr.filters.hidden(a)});var br=/%20/g,bs=/\[\]$/,bt=/\r?\n/g,bu=/#.*$/,bv=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bw=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bx=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,by=/^(?:GET|HEAD)$/,bz=/^\/\//,bA=/\?/,bB=/)<[^<]*)*<\/script>/gi,bC=/^(?:select|textarea)/i,bD=/\s+/,bE=/([?&])_=[^&]*/,bF=/(^|\-)([a-z])/g,bG=function(a,b,c){return b+c.toUpperCase()},bH=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bI=d.fn.load,bJ={},bK={},bL,bM;try{bL=c.location.href}catch(bN){bL=c.createElement("a"),bL.href="",bL=bL.href}bM=bH.exec(bL.toLowerCase())||[],d.fn.extend({load:function(a,c,e){if(typeof a!=="string"&&bI)return bI.apply(this,arguments);if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var g=a.slice(f,a.length);a=a.slice(0,f)}var h="GET";c&&(d.isFunction(c)?(e=c,c=b):typeof c==="object"&&(c=d.param(c,d.ajaxSettings.traditional),h="POST"));var i=this;d.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?d("
").append(c.replace(bB,"")).find(g):c)),e&&i.each(e,[c,b,a])}});return this},serialize:function(){return d.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?d.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bC.test(this.nodeName)||bw.test(this.type))}).map(function(a,b){var c=d(this).val();return c==null?null:d.isArray(c)?d.map(c,function(a,c){return{name:b.name,value:a.replace(bt,"\r\n")}}):{name:b.name,value:c.replace(bt,"\r\n")}}).get()}}),d.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){d.fn[b]=function(a){return this.bind(b,a)}}),d.each(["get","post"],function(a,c){d[c]=function(a,e,f,g){d.isFunction(e)&&(g=g||f,f=e,e=b);return d.ajax({type:c,url:a,data:e,success:f,dataType:g})}}),d.extend({getScript:function(a,c){return d.get(a,b,c,"script")},getJSON:function(a,b,c){return d.get(a,b,c,"json")},ajaxSetup:function(a,b){b?d.extend(!0,a,d.ajaxSettings,b):(b=a,a=d.extend(!0,d.ajaxSettings,b));for(var c in {context:1,url:1})c in b?a[c]=b[c]:c in d.ajaxSettings&&(a[c]=d.ajaxSettings[c]);return a},ajaxSettings:{url:bL,isLocal:bx.test(bM[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":d.parseJSON,"text xml":d.parseXML}},ajaxPrefilter:bO(bJ),ajaxTransport:bO(bK),ajax:function(a,c){function v(a,c,l,n){if(r!==2){r=2,p&&clearTimeout(p),o=b,m=n||"",u.readyState=a?4:0;var q,t,v,w=l?bR(e,u,l):b,x,y;if(a>=200&&a<300||a===304){if(e.ifModified){if(x=u.getResponseHeader("Last-Modified"))d.lastModified[k]=x;if(y=u.getResponseHeader("Etag"))d.etag[k]=y}if(a===304)c="notmodified",q=!0;else try{t=bS(e,w),c="success",q=!0}catch(z){c="parsererror",v=z}}else{v=c;if(!c||a)c="error",a<0&&(a=0)}u.status=a,u.statusText=c,q?h.resolveWith(f,[t,c,u]):h.rejectWith(f,[u,c,v]),u.statusCode(j),j=b,s&&g.trigger("ajax"+(q?"Success":"Error"),[u,e,q?t:v]),i.resolveWith(f,[u,c]),s&&(g.trigger("ajaxComplete",[u,e]),--d.active||d.event.trigger("ajaxStop"))}}typeof a==="object"&&(c=a,a=b),c=c||{};var e=d.ajaxSetup({},c),f=e.context||e,g=f!==e&&(f.nodeType||f instanceof d)?d(f):d.event,h=d.Deferred(),i=d._Deferred(),j=e.statusCode||{},k,l={},m,n,o,p,q,r=0,s,t,u={readyState:0,setRequestHeader:function(a,b){r||(l[a.toLowerCase().replace(bF,bG)]=b);return this},getAllResponseHeaders:function(){return r===2?m:null},getResponseHeader:function(a){var c;if(r===2){if(!n){n={};while(c=bv.exec(m))n[c[1].toLowerCase()]=c[2]}c=n[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){r||(e.mimeType=a);return this},abort:function(a){a=a||"abort",o&&o.abort(a),v(0,a);return this}};h.promise(u),u.success=u.done,u.error=u.fail,u.complete=i.done,u.statusCode=function(a){if(a){var b;if(r<2)for(b in a)j[b]=[j[b],a[b]];else b=a[u.status],u.then(b,b)}return this},e.url=((a||e.url)+"").replace(bu,"").replace(bz,bM[1]+"//"),e.dataTypes=d.trim(e.dataType||"*").toLowerCase().split(bD),e.crossDomain==null&&(q=bH.exec(e.url.toLowerCase()),e.crossDomain=q&&(q[1]!=bM[1]||q[2]!=bM[2]||(q[3]||(q[1]==="http:"?80:443))!=(bM[3]||(bM[1]==="http:"?80:443)))),e.data&&e.processData&&typeof e.data!=="string"&&(e.data=d.param(e.data,e.traditional)),bP(bJ,e,c,u);if(r===2)return!1;s=e.global,e.type=e.type.toUpperCase(),e.hasContent=!by.test(e.type),s&&d.active++===0&&d.event.trigger("ajaxStart");if(!e.hasContent){e.data&&(e.url+=(bA.test(e.url)?"&":"?")+e.data),k=e.url;if(e.cache===!1){var w=d.now(),x=e.url.replace(bE,"$1_="+w);e.url=x+(x===e.url?(bA.test(e.url)?"&":"?")+"_="+w:"")}}if(e.data&&e.hasContent&&e.contentType!==!1||c.contentType)l["Content-Type"]=e.contentType;e.ifModified&&(k=k||e.url,d.lastModified[k]&&(l["If-Modified-Since"]=d.lastModified[k]),d.etag[k]&&(l["If-None-Match"]=d.etag[k])),l.Accept=e.dataTypes[0]&&e.accepts[e.dataTypes[0]]?e.accepts[e.dataTypes[0]]+(e.dataTypes[0]!=="*"?", */*; q=0.01":""):e.accepts["*"];for(t in e.headers)u.setRequestHeader(t,e.headers[t]);if(e.beforeSend&&(e.beforeSend.call(f,u,e)===!1||r===2)){u.abort();return!1}for(t in {success:1,error:1,complete:1})u[t](e[t]);o=bP(bK,e,c,u);if(o){u.readyState=1,s&&g.trigger("ajaxSend",[u,e]),e.async&&e.timeout>0&&(p=setTimeout(function(){u.abort("timeout")},e.timeout));try{r=1,o.send(l,v)}catch(y){status<2?v(-1,y):d.error(y)}}else v(-1,"No Transport");return u},param:function(a,c){var e=[],f=function(a,b){b=d.isFunction(b)?b():b,e[e.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=d.ajaxSettings.traditional);if(d.isArray(a)||a.jquery&&!d.isPlainObject(a))d.each(a,function(){f(this.name,this.value)});else for(var g in a)bQ(g,a[g],c,f);return e.join("&").replace(br,"+")}}),d.extend({active:0,lastModified:{},etag:{}});var bT=d.now(),bU=/(\=)\?(&|$)|\?\?/i;d.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return d.expando+"_"+bT++}}),d.ajaxPrefilter("json jsonp",function(b,c,e){var f=typeof b.data==="string";if(b.dataTypes[0]==="jsonp"||c.jsonpCallback||c.jsonp!=null||b.jsonp!==!1&&(bU.test(b.url)||f&&bU.test(b.data))){var g,h=b.jsonpCallback=d.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2",m=function(){a[h]=i,g&&d.isFunction(i)&&a[h](g[0])};b.jsonp!==!1&&(j=j.replace(bU,l),b.url===j&&(f&&(k=k.replace(bU,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},e.then(m,m),b.converters["script json"]=function(){g||d.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),d.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){d.globalEval(a);return a}}}),d.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),d.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var bV=d.now(),bW,bX;d.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&bZ()||b$()}:bZ,bX=d.ajaxSettings.xhr(),d.support.ajax=!!bX,d.support.cors=bX&&"withCredentials"in bX,bX=b,d.support.ajax&&d.ajaxTransport(function(a){if(!a.crossDomain||d.support.cors){var c;return{send:function(e,f){var g=a.xhr(),h,i;a.username?g.open(a.type,a.url,a.async,a.username,a.password):g.open(a.type,a.url,a.async);if(a.xhrFields)for(i in a.xhrFields)g[i]=a.xhrFields[i];a.mimeType&&g.overrideMimeType&&g.overrideMimeType(a.mimeType),!a.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(i in e)g.setRequestHeader(i,e[i])}catch(j){}g.send(a.hasContent&&a.data||null),c=function(e,i){var j,k,l,m,n;try{if(c&&(i||g.readyState===4)){c=b,h&&(g.onreadystatechange=d.noop,delete bW[h]);if(i)g.readyState!==4&&g.abort();else{j=g.status,l=g.getAllResponseHeaders(),m={},n=g.responseXML,n&&n.documentElement&&(m.xml=n),m.text=g.responseText;try{k=g.statusText}catch(o){k=""}j||!a.isLocal||a.crossDomain?j===1223&&(j=204):j=m.text?200:404}}}catch(p){i||f(-1,p)}m&&f(j,k,m,l)},a.async&&g.readyState!==4?(bW||(bW={},bY()),h=bV++,g.onreadystatechange=bW[h]=c):c()},abort:function(){c&&c(0,1)}}}});var b_={},ca=/^(?:toggle|show|hide)$/,cb=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cc,cd=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];d.fn.extend({show:function(a,b,c){var e,f;if(a||a===0)return this.animate(ce("show",3),a,b,c);for(var g=0,h=this.length;g=0;a--)c[a].elem===this&&(b&&c[a](!0),c.splice(a,1))}),b||this.dequeue();return this}}),d.each({slideDown:ce("show",1),slideUp:ce("hide",1),slideToggle:ce("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){d.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),d.extend({speed:function(a,b,c){var e=a&&typeof a==="object"?d.extend({},a):{complete:c||!c&&b||d.isFunction(a)&&a,duration:a,easing:c&&b||b&&!d.isFunction(b)&&b};e.duration=d.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in d.fx.speeds?d.fx.speeds[e.duration]:d.fx.speeds._default,e.old=e.complete,e.complete=function(){e.queue!==!1&&d(this).dequeue(),d.isFunction(e.old)&&e.old.call(this)};return e},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig||(b.orig={})}}),d.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(d.fx.step[this.prop]||d.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=d.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function g(a){return e.step(a)}var e=this,f=d.fx;this.startTime=d.now(),this.start=a,this.end=b,this.unit=c||this.unit||(d.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,g.elem=this.elem,g()&&d.timers.push(g)&&!cc&&(cc=setInterval(f.tick,f.interval))},show:function(){this.options.orig[this.prop]=d.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),d(this.elem).show()},hide:function(){this.options.orig[this.prop]=d.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=d.now(),c=!0;if(a||b>=this.options.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),this.options.curAnim[this.prop]=!0;for(var e in this.options.curAnim)this.options.curAnim[e]!==!0&&(c=!1);if(c){if(this.options.overflow!=null&&!d.support.shrinkWrapBlocks){var f=this.elem,g=this.options;d.each(["","X","Y"],function(a,b){f.style["overflow"+b]=g.overflow[a]})}this.options.hide&&d(this.elem).hide();if(this.options.hide||this.options.show)for(var h in this.options.curAnim)d.style(this.elem,h,this.options.orig[h]);this.options.complete.call(this.elem)}return!1}var i=b-this.startTime;this.state=i/this.options.duration;var j=this.options.specialEasing&&this.options.specialEasing[this.prop],k=this.options.easing||(d.easing.swing?"swing":"linear");this.pos=d.easing[j||k](this.state,i,0,1,this.options.duration),this.now=this.start+(this.end-this.start)*this.pos,this.update();return!0}},d.extend(d.fx,{tick:function(){var a=d.timers;for(var b=0;b
";d.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),e=b.firstChild,f=e.firstChild,h=e.nextSibling.firstChild.firstChild,this.doesNotAddBorder=f.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,f.style.position="fixed",f.style.top="20px",this.supportsFixedPosition=f.offsetTop===20||f.offsetTop===15,f.style.position=f.style.top="",e.style.overflow="hidden",e.style.position="relative",this.subtractsBorderForOverflowNotVisible=f.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),d.offset.initialize=d.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;d.offset.initialize(),d.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(d.css(a,"marginTop"))||0,c+=parseFloat(d.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var e=d.css(a,"position");e==="static"&&(a.style.position="relative");var f=d(a),g=f.offset(),h=d.css(a,"top"),i=d.css(a,"left"),j=(e==="absolute"||e==="fixed")&&d.inArray("auto",[h,i])>-1,k={},l={},m,n;j&&(l=f.position()),m=j?l.top:parseInt(h,10)||0,n=j?l.left:parseInt(i,10)||0,d.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):f.css(k)}},d.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),e=ch.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(d.css(a,"marginTop"))||0,c.left-=parseFloat(d.css(a,"marginLeft"))||0,e.top+=parseFloat(d.css(b[0],"borderTopWidth"))||0,e.left+=parseFloat(d.css(b[0],"borderLeftWidth"))||0;return{top:c.top-e.top,left:c.left-e.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&(!ch.test(a.nodeName)&&d.css(a,"position")==="static"))a=a.offsetParent;return a})}}),d.each(["Left","Top"],function(a,c){var e="scroll"+c;d.fn[e]=function(c){var f=this[0],g;if(!f)return null;if(c!==b)return this.each(function(){g=ci(this),g?g.scrollTo(a?d(g).scrollLeft():c,a?c:d(g).scrollTop()):this[e]=c});g=ci(f);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:d.support.boxModel&&g.document.documentElement[e]||g.document.body[e]:f[e]}}),d.each(["Height","Width"],function(a,c){var e=c.toLowerCase();d.fn["inner"+c]=function(){return this[0]?parseFloat(d.css(this[0],e,"padding")):null},d.fn["outer"+c]=function(a){return this[0]?parseFloat(d.css(this[0],e,a?"margin":"border")):null},d.fn[e]=function(a){var f=this[0];if(!f)return a==null?null:this;if(d.isFunction(a))return this.each(function(b){var c=d(this);c[e](a.call(this,b,c[e]()))});if(d.isWindow(f)){var g=f.document.documentElement["client"+c];return f.document.compatMode==="CSS1Compat"&&g||f.document.body["client"+c]||g}if(f.nodeType===9)return Math.max(f.documentElement["client"+c],f.body["scroll"+c],f.documentElement["scroll"+c],f.body["offset"+c],f.documentElement["offset"+c]);if(a===b){var h=d.css(f,e),i=parseFloat(h);return d.isNaN(i)?h:i}return this.css(e,typeof a==="string"?a:a+"px")}}),a.jQuery=a.$=d})(window); \ No newline at end of file diff --git a/web/out/dist/js/jquery-ui-1.8.12.custom.min.js b/web/out/dist/js/jquery-ui-1.8.12.custom.min.js new file mode 100644 index 0000000..1b1c88f --- /dev/null +++ b/web/out/dist/js/jquery-ui-1.8.12.custom.min.js @@ -0,0 +1,783 @@ +/*! + * jQuery UI 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.12",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, +NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this, +"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position"); +if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f, +"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h, +d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}}); +c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate); +if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top- +this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions(); +d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis|| +this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&& +this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== +a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]|| +0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], +this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top- +(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(), +height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"? +document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"), +10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"), +10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&& +d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], +this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.leftthis.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g= +this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])? +e:!(e-this.offset.click.left
').css({width:this.offsetWidth+ +"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity", +a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>= +i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()}; +if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(), +d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset= +this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio: +this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize", +b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height; +f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing"); +this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top= +null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidthb.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+ +this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b, +a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a, +c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize, +originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.12"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize= +b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width", +"height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})}; +if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height- +g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width, +height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d= +e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options, +d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper? +d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height= +a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&& +/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable"); +b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/ +(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]= +b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false; +d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left- +this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= +this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= +d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| +0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", +a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- +f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- +this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, +this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", +a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= +this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.12", +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g= +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; +this.menu=d("
    ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})}, +deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0); +e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e, +g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first")); +this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){if(this.options.text)e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("");d.secondary&&b.append("");if(!this.options.text){e.push(f?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()}, +destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
    ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), +h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id", +e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== +b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+= +1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== +f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
    ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, +function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, +originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", +f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): +[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); +if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): +e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= +this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- +b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.12",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("
    ");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("").appendTo(this.element).addClass("ui-slider-handle"); +if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur(); +else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e= +false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");h=b._start(c,f);if(h===false)return}break}i=b.options.step;h=b.options.values&&b.options.values.length?(g=b.values(f)):(g=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=b._valueMin();break;case d.ui.keyCode.END:g=b._valueMax();break;case d.ui.keyCode.PAGE_UP:g=b._trimAlignValue(h+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=b._trimAlignValue(h-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h=== +b._valueMax())return;g=b._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===b._valueMin())return;g=b._trimAlignValue(h-i);break}b._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"); +this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,h,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(a.range===true&&this.values(1)===a.min){g+=1;f=d(this.handles[g])}if(this._start(b, +g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();a=f.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-f.width()/2,top:b.pageY-a.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true}, +_mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a; +if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value= +this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var b=this.options.range,a=this.options,c=this,e=!this._animateOff?a.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate); +if(k===1)c.range[e?"animate":"css"]({width:f-g+"%"},{queue:false,duration:a.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:a.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.12"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
  • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.12"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k')}function F(a,b){d.extend(a,b);for(var c in b)if(b[c]== +null||b[c]==A)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.12"}});var y=(new Date).getTime();d.extend(K.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){F(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase(); +f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('
    ')}}, +_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&& +b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f== +""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a, +c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b), +true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}F(a.settings,e||{}); +b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass); +this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup", +this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs, +function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null: +f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target); +if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a); +d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");F(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-= +document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim"); +var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst= +b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var e=a.dpDiv.find("iframe.ui-datepicker-cover");e.length&&e.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover"); +this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+ +this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&& +a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var f=a.yearshtml;setTimeout(function(){f===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);f=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth(): +0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a), +"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"? +"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a= +d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a= +d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c== +"M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth= +b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker(); +this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0); +a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c? +c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=z+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}w=this._daylightSavingAdjust(new Date(c,j-1,l));if(w.getFullYear()!=c||w.getMonth()+1!=j||w.getDate()!=l)throw"Invalid date";return w},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y", +RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+112?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= +a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), +b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= +this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+r+"":f?"":''+r+"";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
    '+(c?h:"")+(this._isInRange(a,r)?'":"")+(c?"":h)+"
    ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z= +this._get(a,"monthNames"),w=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),v=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var L=this._getDefaultDate(a),I="",D=0;D1)switch(E){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]- +1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='
    '+(/all|left/.test(t)&&D==0?c?f:n:"")+(/all|right/.test(t)&&D==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,D>0||E>0,z,w)+'
    ';var B=j?'":"";for(t=0;t<7;t++){var q= +(t+h)%7;B+="=5?' class="ui-datepicker-week-end"':"")+'>'+s[q]+""}x+=B+"";B=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,B);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;B=l?6:Math.ceil((t+B)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O";var P=!j?"":'";for(t=0;t<7;t++){var G= +p?p.apply(a.input?a.input[0]:null,[q]):[true,""],C=q.getMonth()!=g,J=C&&!H||!G[0]||k&&qo;P+='";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+= +P+""}g++;if(g>11){g=0;m++}x+="
    '+this._get(a,"weekHeader")+"
    '+this._get(a,"calculateWeek")(q)+""+(C&&!v?" ":J?''+q.getDate()+"":''+q.getDate()+"")+"
    "+(l?""+(i[0]>0&&E==i[1]-1?'
    ':""):"");M+=x}I+=M}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'':"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
    ', +o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&& +l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";if(d.browser.mozilla)k+='";else{k+=a.yearshtml;a.yearshtml=null}}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
    ";return k},_adjustInstDate:function(a,b,c){var e= +a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a, +"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); +c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= +function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker, +[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new K;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.12";window["DP_jQuery_"+y]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
    ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.12"})})(jQuery); +;/* + * jQuery UI Effects 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function n(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return o.transparent;return o[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return n(b)}function p(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function q(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function m(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=n(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var o={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},r=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue("fx",function(){var e=f(this),g=e.attr("style")||" ",h=q(p.call(this)),l,v=e.attr("className");f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});l=q(p.call(this));e.attr("className",v);e.animate(u(h,l),a,b,function(){f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)});h=f.queue(this);l=h.splice(h.length-1,1)[0]; +h.splice(1,0,l);f.dequeue(this)})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c, +a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.12",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent", +border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c); +return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments); +else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c), +b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c, +a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c, +a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a== +e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.12 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); +; \ No newline at end of file diff --git a/web/out/dist/js/jquery.colorbox-min.js b/web/out/dist/js/jquery.colorbox-min.js new file mode 100644 index 0000000..b795ee8 --- /dev/null +++ b/web/out/dist/js/jquery.colorbox-min.js @@ -0,0 +1,4 @@ +// ColorBox v1.3.16 - a full featured, light-weight, customizable lightbox based on jQuery 1.3+ +// Copyright (c) 2011 Jack Moore - jack@colorpowered.com +// Licensed under the MIT license: http://www.opensource.org/licenses/mit-license.php +(function(a,b,c){function ba(b){if(!T){O=b,Z(a.extend(J,a.data(O,e))),x=a(O),P=0,J.rel!=="nofollow"&&(x=a("."+V).filter(function(){var b=a.data(this,e).rel||this.rel;return b===J.rel}),P=x.index(O),P===-1&&(x=x.add(O),P=x.length-1));if(!R){R=S=!0,q.show();if(J.returnFocus)try{O.blur(),a(O).one(k,function(){try{this.focus()}catch(a){}})}catch(c){}p.css({opacity:+J.opacity,cursor:J.overlayClose?"pointer":"auto"}).show(),J.w=X(J.initialWidth,"x"),J.h=X(J.initialHeight,"y"),U.position(0),n&&y.bind("resize."+o+" scroll."+o,function(){p.css({width:y.width(),height:y.height(),top:y.scrollTop(),left:y.scrollLeft()})}).trigger("resize."+o),$(g,J.onOpen),I.add(C).hide(),H.html(J.close).show()}U.load(!0)}}function _(){var a,b=f+"Slideshow_",c="click."+f,d,e,g;J.slideshow&&x[1]&&(d=function(){E.text(J.slideshowStop).unbind(c).bind(i,function(){if(P"),b.open=!0;f.each(function(){a.data(this,e,a.extend({},a.data(this,e)||d,b)),a(this).addClass(V)}),g=b.open,a.isFunction(g)&&(g=g.call(f)),g&&ba(f[0]);return f},U.init=function(){y=a(c),q=W().attr({id:e,"class":m?f+(n?"IE6":"IE"):""}),p=W("Overlay",n?"position:absolute":"").hide(),r=W("Wrapper"),s=W("Content").append(z=W("LoadedContent","width:0; height:0; overflow:hidden"),B=W("LoadingOverlay").add(W("LoadingGraphic")),C=W("Title"),D=W("Current"),F=W("Next"),G=W("Previous"),E=W("Slideshow").bind(g,_),H=W("Close")),r.append(W().append(W("TopLeft"),t=W("TopCenter"),W("TopRight")),W(!1,"clear:left").append(u=W("MiddleLeft"),s,v=W("MiddleRight")),W(!1,"clear:left").append(W("BottomLeft"),w=W("BottomCenter"),W("BottomRight"))).children().children().css({"float":"left"}),A=W(!1,"position:absolute; width:9999px; visibility:hidden; display:none"),a("body").prepend(p,q.append(r,A)),s.children().hover(function(){a(this).addClass("hover")},function(){a(this).removeClass("hover")}).addClass("hover"),K=t.height()+w.height()+s.outerHeight(!0)-s.height(),L=u.width()+v.width()+s.outerWidth(!0)-s.width(),M=z.outerHeight(!0),N=z.outerWidth(!0),q.css({"padding-bottom":K,"padding-right":L}).hide(),F.click(function(){U.next()}),G.click(function(){U.prev()}),H.click(function(){U.close()}),I=F.add(G).add(D).add(E),s.children().removeClass("hover"),a("."+V).live("click",function(a){a.button!==0&&typeof a.button!="undefined"||a.ctrlKey||a.shiftKey||a.altKey||(a.preventDefault(),ba(this))}),p.click(function(){J.overlayClose&&U.close()}),a(b).bind("keydown."+f,function(a){var b=a.keyCode;R&&J.escKey&&b===27&&(a.preventDefault(),U.close()),R&&J.arrowKey&&x[1]&&(b===37?(a.preventDefault(),G.click()):b===39&&(a.preventDefault(),F.click()))})},U.remove=function(){q.add(p).remove(),a("."+V).die("click").removeData(e).removeClass(V)},U.position=function(a,c){function g(a){t[0].style.width=w[0].style.width=s[0].style.width=a.style.width,B[0].style.height=B[1].style.height=s[0].style.height=u[0].style.height=v[0].style.height=a.style.height}var d,e=Math.max(b.documentElement.clientHeight-J.h-M-K,0)/2+y.scrollTop(),f=Math.max(y.width()-J.w-N-L,0)/2+y.scrollLeft();d=q.width()===J.w+N&&q.height()===J.h+M?0:a,r[0].style.width=r[0].style.height="9999px",q.dequeue().animate({width:J.w+N,height:J.h+M,top:e,left:f},{duration:d,complete:function(){g(this),S=!1,r[0].style.width=J.w+N+L+"px",r[0].style.height=J.h+M+K+"px",c&&c()},step:function(){g(this)}})},U.resize=function(a){if(R){a=a||{},a.width&&(J.w=X(a.width,"x")-N-L),a.innerWidth&&(J.w=X(a.innerWidth,"x")),z.css({width:J.w}),a.height&&(J.h=X(a.height,"y")-M-K),a.innerHeight&&(J.h=X(a.innerHeight,"y"));if(!a.innerHeight&&!a.height){var b=z.wrapInner("
    ").children();J.h=b.height(),b.replaceWith(b.children())}z.css({height:J.h}),U.position(J.transition==="none"?0:J.speed)}},U.prep=function(b){function h(b){U.position(b,function(){var b,d,g,h,j=x.length,k,n;!R||(n=function(){B.hide(),$(i,J.onComplete)},m&&Q&&z.fadeIn(100),C.html(J.title).add(z).show(),j>1?(typeof J.current=="string"&&D.html(J.current.replace(/\{current\}/,P+1).replace(/\{total\}/,j)).show(),F[J.loop||P")[0].src=h),Y(d)&&(a("")[0].src=d))):I.hide(),J.iframe?(k=a("